| // Copyright 2016 The Fuchsia Authors. All rights reserved. |
| // Use of this source code is governed by a BSD-style license that can be |
| // found in the LICENSE file. |
| |
| #include <assert.h> |
| #include <inttypes.h> |
| #include <lib/test-exceptions/exception-catcher.h> |
| #include <lib/zx/channel.h> |
| #include <lib/zx/clock.h> |
| #include <lib/zx/exception.h> |
| #include <lib/zx/job.h> |
| #include <lib/zx/process.h> |
| #include <lib/zx/task.h> |
| #include <lib/zx/thread.h> |
| #include <lib/zx/time.h> |
| #include <stdio.h> |
| #include <stdlib.h> |
| #include <string.h> |
| #include <unistd.h> |
| #include <zircon/compiler.h> |
| #include <zircon/process.h> |
| #include <zircon/processargs.h> |
| #include <zircon/syscalls.h> |
| #include <zircon/syscalls/debug.h> |
| #include <zircon/syscalls/exception.h> |
| #include <zircon/syscalls/port.h> |
| #include <zircon/threads.h> |
| |
| #include <iterator> |
| #include <optional> |
| #include <string> |
| #include <type_traits> |
| |
| #include <fbl/algorithm.h> |
| #include <test-utils/test-utils.h> |
| #include <zxtest/zxtest.h> |
| |
| namespace { |
| |
| static int thread_func(void* arg); |
| |
| // argv[0] |
| static char* program_path; |
| |
| static const char test_child_name[] = "test-child"; |
| static const char exit_closing_excp_handle_child_name[] = "exit-closing-excp-handle"; |
| |
| enum message { |
| // Make the type of this enum signed so that we don't get a compile failure |
| // later with things like EXPECT_EQ(msg, MSG_PONG) [unsigned vs signed |
| // comparison mismatch] |
| MSG_ENSURE_SIGNED = -1, |
| MSG_DONE, |
| MSG_CRASH, |
| MSG_PING, |
| MSG_PONG, |
| MSG_CREATE_AUX_THREAD, |
| MSG_AUX_THREAD_HANDLE, |
| MSG_CRASH_AUX_THREAD, |
| MSG_SHUTDOWN_AUX_THREAD |
| }; |
| |
| static void crash_me() { |
| volatile int* p = 0; |
| *p = 42; |
| } |
| |
| static void send_msg_new_thread_handle(zx_handle_t handle, zx_handle_t thread) { |
| // Note: The handle is transferred to the receiver. |
| uint64_t data = MSG_AUX_THREAD_HANDLE; |
| zx_status_t status = zx_channel_write(handle, 0, &data, sizeof(data), &thread, 1); |
| ZX_DEBUG_ASSERT(status == ZX_OK); |
| } |
| |
| static void send_msg(zx_handle_t handle, message msg) { |
| uint64_t data = msg; |
| zx_status_t status = zx_channel_write(handle, 0, &data, sizeof(data), NULL, 0); |
| ZX_DEBUG_ASSERT(status == ZX_OK); |
| } |
| |
| static bool recv_msg(zx_handle_t handle, message* msg) { |
| uint64_t data; |
| uint32_t num_bytes = sizeof(data); |
| |
| if (!tu_channel_wait_readable(handle)) { |
| return false; |
| } |
| |
| zx_status_t status = |
| zx_channel_read(handle, 0, &data, nullptr, num_bytes, 0, &num_bytes, nullptr); |
| if (status != ZX_OK || num_bytes != sizeof(data)) { |
| return false; |
| } |
| |
| *msg = static_cast<message>(data); |
| return true; |
| } |
| |
| static void recv_msg_new_thread_handle(zx_handle_t handle, zx_handle_t* thread) { |
| uint64_t data; |
| uint32_t num_bytes = sizeof(data); |
| |
| ASSERT_TRUE(tu_channel_wait_readable(handle), "peer closed while trying to read message"); |
| |
| uint32_t num_handles = 1; |
| zx_status_t status = |
| zx_channel_read(handle, 0, &data, thread, num_bytes, num_handles, &num_bytes, &num_handles); |
| ASSERT_EQ(status, ZX_OK); |
| ASSERT_EQ(num_bytes, sizeof(data)); |
| ASSERT_EQ(num_handles, 1u); |
| |
| ASSERT_EQ(static_cast<message>(data), MSG_AUX_THREAD_HANDLE); |
| } |
| |
| static bool ensure_child_running(zx_handle_t channel) { |
| // Note: This function is called from external threads and thus does |
| // not use EXPECT_*/ASSERT_*. |
| message msg; |
| send_msg(channel, MSG_PING); |
| if (!recv_msg(channel, &msg)) { |
| return false; |
| } |
| if (msg != MSG_PONG) { |
| return false; |
| } |
| return true; |
| } |
| |
| static void msg_loop(zx_handle_t channel) { |
| bool my_done_tests = false; |
| zx_handle_t channel_to_thread = ZX_HANDLE_INVALID; |
| |
| while (!my_done_tests) { |
| message msg; |
| if (!recv_msg(channel, &msg)) { |
| return; |
| } |
| switch (msg) { |
| case MSG_DONE: |
| my_done_tests = true; |
| break; |
| case MSG_CRASH: |
| crash_me(); |
| break; |
| case MSG_PING: |
| send_msg(channel, MSG_PONG); |
| break; |
| case MSG_CREATE_AUX_THREAD: |
| // Spin up a thread that we can talk to. |
| { |
| if (channel_to_thread != ZX_HANDLE_INVALID) { |
| printf("previous thread connection not shutdown\n"); |
| return; |
| } |
| zx_handle_t channel_from_thread; |
| zx_status_t status = zx_channel_create(0, &channel_to_thread, &channel_from_thread); |
| ZX_DEBUG_ASSERT(status == ZX_OK); |
| thrd_t thread; |
| int ret = thrd_create_with_name( |
| &thread, thread_func, (void*)(uintptr_t)channel_from_thread, "msg-loop-subthread"); |
| ZX_DEBUG_ASSERT(ret == thrd_success); |
| // Make sure the new thread is up and running before sending |
| // its handle back: this removes potential problems like |
| // needing to handle ZX_EXCP_THREAD_STARTING exceptions if the |
| // debugger exception channel is bound later. |
| if (ensure_child_running(channel_to_thread)) { |
| zx_handle_t thread_handle = thrd_get_zx_handle(thread); |
| zx_handle_t copy = ZX_HANDLE_INVALID; |
| zx_status_t status = zx_handle_duplicate(thread_handle, ZX_RIGHT_SAME_RIGHTS, ©); |
| ZX_DEBUG_ASSERT(status == ZX_OK); |
| send_msg_new_thread_handle(channel, copy); |
| } else { |
| // We could terminate the thread or some such, but the |
| // process will be killed by our "caller". |
| send_msg_new_thread_handle(channel, ZX_HANDLE_INVALID); |
| zx_handle_close(channel_to_thread); |
| channel_to_thread = ZX_HANDLE_INVALID; |
| } |
| } |
| break; |
| case MSG_CRASH_AUX_THREAD: |
| send_msg(channel_to_thread, MSG_CRASH); |
| break; |
| case MSG_SHUTDOWN_AUX_THREAD: |
| send_msg(channel_to_thread, MSG_DONE); |
| zx_handle_close(channel_to_thread); |
| channel_to_thread = ZX_HANDLE_INVALID; |
| break; |
| default: |
| printf("unknown message received: %d\n", msg); |
| break; |
| } |
| } |
| } |
| |
| static int thread_func(void* arg) { |
| zx_handle_t msg_channel = (zx_handle_t)(uintptr_t)arg; |
| msg_loop(msg_channel); |
| zx_handle_close(msg_channel); |
| return 0; |
| } |
| |
| static void __NO_RETURN test_child() { |
| zx_handle_t channel = zx_take_startup_handle(PA_USER0); |
| if (channel == ZX_HANDLE_INVALID) |
| tu_fatal("zx_take_startup_handle", ZX_ERR_BAD_HANDLE - 1000); |
| msg_loop(channel); |
| exit(0); |
| } |
| |
| static springboard_t* setup_test_child(zx_handle_t job, const char* arg, zx_handle_t* out_channel) { |
| zx_handle_t our_channel, their_channel; |
| zx_status_t status = zx_channel_create(0, &our_channel, &their_channel); |
| ZX_DEBUG_ASSERT(status == ZX_OK); |
| const char* test_child_path = program_path; |
| const char* const argv[] = { |
| test_child_path, |
| arg, |
| }; |
| int argc = std::size(argv); |
| zx_handle_t handles[1] = {their_channel}; |
| uint32_t handle_ids[1] = {PA_USER0}; |
| *out_channel = our_channel; |
| springboard_t* sb = |
| tu_launch_init(job, test_child_name, argc, argv, 0, NULL, 1, handles, handle_ids); |
| return sb; |
| } |
| |
| static void start_test_child_with_exception_channel(const zx::job& job, const std::string& arg, |
| zx::process* out_child, |
| zx::channel* out_exception_channel, |
| zx::channel* out_channel) { |
| springboard_t* sb = |
| setup_test_child(job.get(), arg.c_str(), out_channel->reset_and_get_address()); |
| ASSERT_OK(zx_task_create_exception_channel(springboard_get_process_handle(sb), |
| ZX_EXCEPTION_CHANNEL_DEBUGGER, |
| out_exception_channel->reset_and_get_address())); |
| out_child->reset(tu_launch_fini(sb)); |
| } |
| |
| struct proc_handles { |
| zx_handle_t proc; |
| zx_handle_t vmar; |
| }; |
| |
| // Waits for and reads an exception. |
| // |
| // If |type| is valid, checks that the received exception matches. |
| // If |info| is non-null, fills it in with the received struct. |
| // |
| // Returns an invalid exception and marks test failure on error or if |type| |
| // doesn't match. |
| zx::exception ReadException(const zx::channel& channel, |
| std::optional<zx_excp_type_t> type = std::nullopt, |
| zx_exception_info_t* info_out = nullptr) { |
| zx::exception exception; |
| zx_exception_info_t info; |
| uint32_t num_handles = 1; |
| uint32_t num_bytes = sizeof(info); |
| |
| zx_status_t status = channel.wait_one(ZX_CHANNEL_READABLE, zx::time::infinite(), nullptr); |
| if (status != ZX_OK) { |
| EXPECT_OK(status); |
| return zx::exception(); |
| } |
| |
| status = zx_channel_read(channel.get(), 0, &info, exception.reset_and_get_address(), num_bytes, |
| num_handles, &num_bytes, &num_handles); |
| EXPECT_EQ(status, ZX_OK); |
| if (!exception.is_valid()) { |
| EXPECT_TRUE(exception.is_valid()); |
| return zx::exception(); |
| } |
| |
| if (info_out != nullptr) { |
| *info_out = info; |
| } |
| |
| if (type && type != info.type) { |
| EXPECT_EQ(type, info.type); |
| return zx::exception(); |
| } |
| return exception; |
| } |
| |
| static void __NO_RETURN trigger_unsupported() { |
| // An unsupported exception is not a failure. |
| // Generally it just means that support for the exception doesn't |
| // exist yet on this particular architecture. |
| exit(0); |
| } |
| |
| static void __NO_RETURN trigger_general() { |
| #if defined(__x86_64__) |
| #elif defined(__aarch64__) |
| #endif |
| trigger_unsupported(); |
| } |
| |
| static void __NO_RETURN trigger_fatal_page_fault() { |
| *(volatile int*)0 = 42; |
| trigger_unsupported(); |
| } |
| |
| static void __NO_RETURN trigger_undefined_insn() { |
| #if defined(__x86_64__) |
| __asm__("ud2"); |
| #elif defined(__aarch64__) |
| // An instruction not supported at this privilege level will do. |
| // ARM calls these "unallocated instructions". Geez, "unallocated"? |
| __asm__("mrs x0, elr_el1"); |
| #endif |
| trigger_unsupported(); |
| } |
| |
| static void __NO_RETURN trigger_sw_bkpt() { |
| #if defined(__x86_64__) |
| __asm__("int3"); |
| #elif defined(__aarch64__) |
| __asm__("brk 0"); |
| #endif |
| trigger_unsupported(); |
| } |
| |
| static void __NO_RETURN trigger_hw_bkpt() { |
| #if defined(__x86_64__) |
| // We can't set the debug regs from user space, support for setting the |
| // debug regs via the debugger interface is work-in-progress, and we can't |
| // use "int $1" here. So testing this will have to wait. |
| #elif defined(__aarch64__) |
| #endif |
| trigger_unsupported(); |
| } |
| |
| static void __NO_RETURN trigger_port_overflow() { |
| zx_handle_t port; |
| zx_status_t status = zx_port_create(0u, &port); |
| if (status != ZX_OK) |
| ZX_PANIC("zx_port_create"); |
| |
| zx_port_packet_t packet = {1ull, ZX_PKT_TYPE_USER, 0, {{}}}; |
| |
| int count = 0; |
| for (;;) { |
| status = zx_port_queue(port, &packet); |
| if (status != ZX_OK) { |
| printf("packet queue failed. error: %d after %d writes\n", status, count); |
| break; |
| } |
| ++count; |
| if ((count % 100) == 0) { |
| write(1, ".", 1); |
| } |
| } |
| |
| zx_handle_close(port); |
| zx_nanosleep(ZX_TIME_INFINITE); |
| trigger_unsupported(); |
| } |
| |
| #if defined(__aarch64__) |
| static void __NO_RETURN trigger_arm64_wfi() { |
| // WFI is illegal in user space |
| __asm__("wfi"); |
| __asm__("wfi"); |
| trigger_unsupported(); |
| } |
| |
| static void __NO_RETURN trigger_arm64_wfe() { |
| // WFE is legal in user space |
| // Run it twice in a row in case the event is already set and it is naturally |
| // 'falling through'. |
| __asm__("wfe"); |
| __asm__("wfe"); |
| trigger_unsupported(); |
| } |
| |
| #endif |
| |
| // ARM does not trap on integer divide-by-zero. |
| #if defined(__x86_64__) |
| static void __NO_RETURN trigger_integer_divide_by_zero() { |
| // Use an x86 division instruction (rather than doing division from C) |
| // to ensure that the compiler does not convert the division into |
| // something else. |
| uint32_t result; |
| __asm__ volatile("idivb %1" : "=a"(result) : "r"((uint8_t)0), "a"((uint16_t)1)); |
| trigger_unsupported(); |
| } |
| |
| static void __NO_RETURN trigger_sse_divide_by_zero() { |
| // Unmask all exceptions for SSE operations. |
| uint32_t mxcsr = 0; |
| __asm__ volatile("ldmxcsr %0" : : "m"(mxcsr)); |
| |
| double a = 1; |
| double b = 0; |
| __asm__ volatile("divsd %1, %0" : "+x"(a) : "x"(b)); |
| |
| // QEMU's software emulation of x86 appears to have a bug where it does |
| // not correctly emulate generating division-by-zero exceptions from |
| // SSE instructions. See https://bugs.launchpad.net/qemu/+bug/1668041. |
| // So we will reach this point on non-KVM QEMU. In this case, make the |
| // test pass by generating a fault by other means. |
| // |
| // That means this test isn't requiring that "divsd" generates a fault. |
| // It is only requiring that the fault is handled properly |
| // (e.g. doesn't cause a kernel panic) if the instruction does fault |
| // (as on real hardware). |
| printf( |
| "trigger_sse_divide_by_zero: divsd did not fault; " |
| "assume we are running under a buggy non-KVM QEMU\n"); |
| trigger_integer_divide_by_zero(); |
| } |
| |
| static void __NO_RETURN trigger_x87_divide_by_zero() { |
| // Unmask all exceptions for x87 operations. |
| uint16_t control_word = 0; |
| __asm__ volatile("fldcw %0" : : "m"(control_word)); |
| |
| double a = 1; |
| double b = 0; |
| __asm__ volatile( |
| "fldl %0\n" |
| "fdivl %1\n" |
| // Check for the pending exception. |
| "fwait\n" |
| : |
| : "m"(a), "m"(b)); |
| trigger_unsupported(); |
| } |
| #endif |
| |
| static const struct { |
| zx_excp_type_t type; |
| const char* name; |
| bool crashes; |
| void __NO_RETURN (*trigger_function)(); |
| } exceptions[] = { |
| {ZX_EXCP_GENERAL, "general", false, trigger_general}, |
| {ZX_EXCP_FATAL_PAGE_FAULT, "page-fault", true, trigger_fatal_page_fault}, |
| {ZX_EXCP_UNDEFINED_INSTRUCTION, "undefined-insn", true, trigger_undefined_insn}, |
| {ZX_EXCP_SW_BREAKPOINT, "sw-bkpt", true, trigger_sw_bkpt}, |
| {ZX_EXCP_HW_BREAKPOINT, "hw-bkpt", false, trigger_hw_bkpt}, |
| {ZX_EXCP_POLICY_ERROR, "port-overflow", true, trigger_port_overflow}, |
| #if defined(__x86_64__) |
| {ZX_EXCP_GENERAL, "integer-divide-by-zero", true, trigger_integer_divide_by_zero}, |
| {ZX_EXCP_GENERAL, "sse-divide-by-zero", true, trigger_sse_divide_by_zero}, |
| {ZX_EXCP_GENERAL, "x87-divide-by-zero", true, trigger_x87_divide_by_zero}, |
| #endif |
| #if defined(__aarch64__) |
| {ZX_EXCP_GENERAL, "arm64-wfi", true, trigger_arm64_wfi}, |
| {ZX_EXCP_GENERAL, "arm64-wfe", false, trigger_arm64_wfe}, |
| #endif |
| }; |
| |
| static void __NO_RETURN trigger_exception(const char* excp_name) { |
| for (size_t i = 0; i < std::size(exceptions); ++i) { |
| if (strcmp(excp_name, exceptions[i].name) == 0) { |
| exceptions[i].trigger_function(); |
| } |
| } |
| fprintf(stderr, "unknown exception: %s\n", excp_name); |
| exit(1); |
| } |
| |
| static void __NO_RETURN test_child_trigger(const char* excp_name) { |
| trigger_exception(excp_name); |
| /* NOTREACHED */ |
| } |
| |
| TEST(ExceptionTest, Trigger) { |
| for (size_t i = 0; i < std::size(exceptions); ++i) { |
| zx_excp_type_t excp_type = exceptions[i].type; |
| const char* excp_name = exceptions[i].name; |
| zx::process child; |
| zx::channel exception_channel, our_channel; |
| std::string arg = std::string("trigger=") + excp_name; |
| start_test_child_with_exception_channel(*zx::job::default_job(), arg, &child, |
| &exception_channel, &our_channel); |
| |
| test_exceptions::ExceptionCatcher catcher(*zx::job::default_job()); |
| |
| // First read the THREAD_STARTING exception. We can just discard it |
| // immediately since THREAD_STARTING doesn't care whether it's resumed or |
| // not. |
| zx_exception_info_t info; |
| ReadException(exception_channel, ZX_EXCP_THREAD_STARTING, &info); |
| const zx_koid_t tid = info.tid; |
| |
| // This can be |excp_type| or THREAD_EXITING if |excp_type| is unsupported. |
| zx::exception exception = ReadException(exception_channel, std::nullopt, &info); |
| ASSERT_EQ(tid, info.tid); |
| |
| if (info.type != ZX_EXCP_THREAD_EXITING) { |
| ASSERT_EQ(excp_type, info.type); |
| exception.reset(); |
| |
| if (exceptions[i].crashes) { |
| zx::result<zx::exception> result = catcher.ExpectException(child); |
| ASSERT_TRUE(result.is_ok()); |
| ASSERT_OK(child.kill()); |
| } |
| |
| exception = ReadException(exception_channel, ZX_EXCP_THREAD_EXITING, &info); |
| ASSERT_EQ(tid, info.tid); |
| } |
| |
| // We've already seen tid's thread-exit report, so just skip that |
| // test here. |
| exception.reset(); |
| EXPECT_OK(child.wait_one(ZX_TASK_TERMINATED, zx::time::infinite(), nullptr)); |
| } |
| } |
| |
| static void test_child_exit_closing_excp_handle() { |
| // Test https://fxbug.dev/42106406. Process termination closing the last handle of the exception |
| // channel should not cause a panic. |
| zx::channel exception_channel; |
| ZX_ASSERT(zx::process::self()->create_exception_channel(0, &exception_channel) == ZX_OK); |
| exit(0); |
| |
| /* NOTREACHED */ |
| } |
| |
| TEST(ExceptionTest, ExitClosingExcpHandle) { |
| const char* test_child_path = program_path; |
| const char* const argv[] = { |
| test_child_path, |
| exit_closing_excp_handle_child_name, |
| }; |
| int argc = std::size(argv); |
| |
| springboard_t* sb = tu_launch_init(zx_job_default(), exit_closing_excp_handle_child_name, argc, |
| argv, 0, NULL, 0, NULL, NULL); |
| zx_handle_t child = tu_launch_fini(sb); |
| |
| zx_signals_t signals = ZX_PROCESS_TERMINATED; |
| zx_signals_t pending; |
| EXPECT_OK(zx_object_wait_one(child, signals, ZX_TIME_INFINITE, &pending)); |
| EXPECT_TRUE(pending & ZX_PROCESS_TERMINATED); |
| |
| EXPECT_EQ(tu_process_get_return_code(child), 0); |
| } |
| |
| // Same as send_msg() but also allows ZX_ERR_PEER_CLOSED. |
| // Useful for generic test cleanup to handle both live and killed tasks. |
| static void SendMessageOrPeerClosed(const zx::channel& channel, message msg) { |
| uint64_t data = msg; |
| zx_status_t status = channel.write(0, &data, sizeof(data), nullptr, 0); |
| if (status != ZX_OK && status != ZX_ERR_PEER_CLOSED) { |
| tu_fatal(__func__, status); |
| } |
| } |
| |
| // C++ wrapper for our testing message loop to remove common boilerplate. |
| // |
| // Creates this test loop task structure under the current job: |
| // - parent job |
| // - job |
| // - process |
| // - thread |
| // - aux thread |
| class TestLoop { |
| public: |
| enum class Control { kAutomatic, kManual }; |
| |
| // TestLoop can operate in two different modes: |
| // |
| // Automatic control will take care of all the setup/teardown so that when |
| // this constructor returns the test threads will be running, and when |
| // the destructor is called they will be stopped and closed down. |
| // |
| // Manual control requires the caller to make the following calls in order: |
| // - Step1CreateProcess() |
| // - Step2StartThreads() |
| // - Step3FinishSetup() |
| // - Step4ShutdownAuxThread() |
| // - Step5ShutdownMainThread() |
| // This is necessary to give the caller a chance to install exception |
| // handlers in between each step, e.g. in order to catch THREAD_STARTING |
| // synthetic exceptions. |
| TestLoop(Control control = Control::kAutomatic) { |
| EXPECT_OK(zx::job::create(*zx::job::default_job(), 0, &parent_job_)); |
| EXPECT_OK(zx::job::create(parent_job_, 0, &job_)); |
| |
| if (control == Control::kAutomatic) { |
| Step1CreateProcess(); |
| Step2StartThreads(); |
| Step3ReadAuxThreadHandle(); |
| } |
| } |
| |
| void Step1CreateProcess() { |
| springboard_ = |
| setup_test_child(job_.get(), test_child_name, process_channel_.reset_and_get_address()); |
| ASSERT_NOT_NULL(springboard_); |
| process_.reset(springboard_get_process_handle(springboard_)); |
| } |
| |
| void Step2StartThreads() { |
| // The initial process handle we got is invalidated by this call |
| // and we're given the new one to use instead. |
| zx_handle_t process = tu_launch_fini(springboard_); |
| if (process != process_.get()) { |
| process_.reset(process); |
| } |
| ASSERT_TRUE(process_.is_valid()); |
| send_msg(process_channel_.get(), MSG_CREATE_AUX_THREAD); |
| } |
| |
| // If there are any debugger handlers attached, the task start exceptions |
| // must be handled before calling this or it will block forever. |
| void Step3ReadAuxThreadHandle() { |
| recv_msg_new_thread_handle(process_channel_.get(), aux_thread_.reset_and_get_address()); |
| } |
| |
| void Step4ShutdownAuxThread() { |
| // Don't use use zx_task_kill() here, it stops exception processing |
| // immediately so we may miss expected exceptions. |
| SendMessageOrPeerClosed(process_channel_, MSG_SHUTDOWN_AUX_THREAD); |
| } |
| |
| void Step5ShutdownMainThread() { SendMessageOrPeerClosed(process_channel_, MSG_DONE); } |
| |
| // Closes the test tasks and blocks until everything has cleaned up. |
| // |
| // If there is an active debug handler, the process must be closed first |
| // via zx_task_kill() or Shutdown(), or else this can block forever waiting |
| // for the thread exit exceptions to be handled. |
| ~TestLoop() { |
| // It's OK to call these multiple times so we can just unconditionally |
| // call them in both automatic or manual control mode. |
| Step4ShutdownAuxThread(); |
| Step5ShutdownMainThread(); |
| |
| EXPECT_OK(process_.wait_one(ZX_TASK_TERMINATED, zx::time::infinite(), nullptr)); |
| } |
| |
| const zx::job& parent_job() const { return parent_job_; } |
| const zx::job& job() const { return job_; } |
| const zx::process& process() const { return process_; } |
| const zx::thread& aux_thread() const { return aux_thread_; } |
| |
| // Sends a message to the aux thread to crash itself. |
| // |
| // If this is used, before exiting the test either kill the aux thread or |
| // pass the exception to the unittest crash handler and block until it |
| // kills the thread. |
| // |
| // The blocking is important because otherwise there's a race where the loop |
| // process main thread can exit and kill the aux thread before the crash |
| // handler gets a chance to see the exception. If this happens, the crash |
| // handler will notice there was a registered exception that never occurred |
| // and will fail the test. |
| void CrashAuxThread() { send_msg(process_channel_.get(), MSG_CRASH_AUX_THREAD); } |
| |
| private: |
| springboard* springboard_ = nullptr; |
| zx::job parent_job_; |
| zx::job job_; |
| zx::process process_; |
| zx::channel process_channel_; |
| zx::thread aux_thread_; |
| }; |
| |
| // Returns true if the exception has a thread handle. If |koid| is given, |
| // also checks that the thread's koid matches it. |
| bool ExceptionHasThread(const zx::exception& exception, zx_koid_t koid = ZX_KOID_INVALID) { |
| zx::thread thread; |
| if (exception.get_thread(&thread) != ZX_OK) { |
| return false; |
| } |
| if (koid == ZX_KOID_INVALID) { |
| return true; |
| } |
| zx_info_handle_basic_t info; |
| zx_status_t status = thread.get_info(ZX_INFO_HANDLE_BASIC, &info, sizeof(info), nullptr, nullptr); |
| ZX_ASSERT(status == ZX_OK); |
| return koid == info.koid; |
| } |
| |
| // Returns true if the exception has a process handle. If |koid| is given, |
| // also checks that the process' koid matches it. |
| bool ExceptionHasProcess(const zx::exception& exception, zx_koid_t koid = ZX_KOID_INVALID) { |
| zx::process process; |
| if (exception.get_process(&process) != ZX_OK) { |
| return false; |
| } |
| if (koid == ZX_KOID_INVALID) { |
| return true; |
| } |
| zx_info_handle_basic_t info; |
| zx_status_t status = |
| process.get_info(ZX_INFO_HANDLE_BASIC, &info, sizeof(info), nullptr, nullptr); |
| ZX_ASSERT(status == ZX_OK); |
| return koid == info.koid; |
| } |
| |
| uint32_t GetExceptionStateProperty(const zx::exception& exception) { |
| uint32_t state = ~0; |
| EXPECT_OK(exception.get_property(ZX_PROP_EXCEPTION_STATE, &state, sizeof(state))); |
| return state; |
| } |
| |
| void SetExceptionStateProperty(const zx::exception& exception, uint32_t state) { |
| ASSERT_OK(exception.set_property(ZX_PROP_EXCEPTION_STATE, &state, sizeof(state))); |
| } |
| |
| uint32_t GetExceptionStrategyProperty(const zx::exception& exception) { |
| uint32_t state = ~0; |
| EXPECT_OK(exception.get_property(ZX_PROP_EXCEPTION_STRATEGY, &state, sizeof(state))); |
| return state; |
| } |
| |
| void SetExceptionStrategyProperty(const zx::exception& exception, uint32_t state) { |
| ASSERT_OK(exception.set_property(ZX_PROP_EXCEPTION_STRATEGY, &state, sizeof(state))); |
| } |
| |
| // A finite timeout to use when you want to make sure something isn't happening |
| // e.g. a certain signal isn't going to be asserted. |
| auto constexpr kTestTimeout = zx::msec(50); |
| |
| TEST(ExceptionTest, CreateExceptionChannel) { |
| TestLoop loop; |
| |
| zx::channel exception_channel; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channel)); |
| EXPECT_TRUE(exception_channel.is_valid()); |
| } |
| |
| TEST(ExceptionTest, CreateExceptionChannelRights) { |
| TestLoop loop; |
| |
| zx::channel exception_channel; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0, &exception_channel)); |
| |
| zx_info_handle_basic_t info; |
| ASSERT_OK( |
| exception_channel.get_info(ZX_INFO_HANDLE_BASIC, &info, sizeof(info), nullptr, nullptr)); |
| |
| // If this set of rights ever changes make sure to adjust the |
| // task_create_exception_channel() documentation as well. |
| EXPECT_EQ(info.rights, ZX_RIGHT_TRANSFER | ZX_RIGHT_WAIT | ZX_RIGHT_READ); |
| } |
| |
| TEST(ExceptionTest, CreateExceptionChannelInvalidArgs) { |
| TestLoop loop; |
| |
| zx::channel exception_channel; |
| EXPECT_EQ( |
| loop.aux_thread().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &exception_channel), |
| ZX_ERR_INVALID_ARGS); |
| } |
| |
| TEST(ExceptionTest, ProcessDebuggerAttached) { |
| TestLoop loop; |
| |
| zx_info_process_t info; |
| ASSERT_OK(loop.process().get_info(ZX_INFO_PROCESS, &info, sizeof(info), nullptr, nullptr)); |
| EXPECT_FALSE(info.flags & ZX_INFO_PROCESS_FLAG_DEBUGGER_ATTACHED); |
| |
| { |
| zx::channel exception_channel; |
| ASSERT_OK( |
| loop.process().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &exception_channel)); |
| |
| ASSERT_OK(loop.process().get_info(ZX_INFO_PROCESS, &info, sizeof(info), nullptr, nullptr)); |
| EXPECT_TRUE(info.flags & ZX_INFO_PROCESS_FLAG_DEBUGGER_ATTACHED); |
| } |
| |
| ASSERT_OK(loop.process().get_info(ZX_INFO_PROCESS, &info, sizeof(info), nullptr, nullptr)); |
| EXPECT_FALSE(info.flags & ZX_INFO_PROCESS_FLAG_DEBUGGER_ATTACHED); |
| } |
| |
| // Removes a right from a task and ensures that channel creation now fails. |
| // |
| // |task_func|: TestLoop member function to get the task. |
| // |right|: ZX_RIGHT_* value to remove. |
| template <auto task_func> |
| void TaskRequiresRight(zx_rights_t right) { |
| TestLoop loop; |
| const auto& task = (loop.*task_func)(); |
| |
| zx_info_handle_basic_t info; |
| zx_status_t status = task.get_info(ZX_INFO_HANDLE_BASIC, &info, sizeof(info), nullptr, nullptr); |
| ASSERT_EQ(status, ZX_OK); |
| |
| auto reduced_task = typename std::remove_reference<decltype(task)>::type(); |
| ASSERT_OK(task.duplicate(info.rights & ~right, &reduced_task)); |
| |
| zx::channel exception_channel; |
| EXPECT_EQ(reduced_task.create_exception_channel(0, &exception_channel), ZX_ERR_ACCESS_DENIED); |
| } |
| |
| TEST(ExceptionTest, ThreadRequiresRights) { |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::aux_thread>(ZX_RIGHT_INSPECT)); |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::aux_thread>(ZX_RIGHT_DUPLICATE)); |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::aux_thread>(ZX_RIGHT_TRANSFER)); |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::aux_thread>(ZX_RIGHT_MANAGE_THREAD)); |
| } |
| |
| TEST(ExceptionTest, ProcessRequiresRights) { |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::process>(ZX_RIGHT_INSPECT)); |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::process>(ZX_RIGHT_DUPLICATE)); |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::process>(ZX_RIGHT_TRANSFER)); |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::process>(ZX_RIGHT_MANAGE_THREAD)); |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::process>(ZX_RIGHT_ENUMERATE)); |
| } |
| |
| TEST(ExceptionTest, JobRequiresRights) { |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::job>(ZX_RIGHT_INSPECT)); |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::job>(ZX_RIGHT_DUPLICATE)); |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::job>(ZX_RIGHT_TRANSFER)); |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::job>(ZX_RIGHT_MANAGE_THREAD)); |
| ASSERT_NO_FAILURES(TaskRequiresRight<&TestLoop::job>(ZX_RIGHT_ENUMERATE)); |
| } |
| |
| TEST(ExceptionTest, CreateSecondExceptionChannel) { |
| TestLoop loop; |
| zx::channel exception_channel; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channel)); |
| |
| // Trying to register a second channel should fail. |
| zx::channel exception_channel2; |
| EXPECT_EQ(loop.aux_thread().create_exception_channel(0u, &exception_channel2), |
| ZX_ERR_ALREADY_BOUND); |
| EXPECT_FALSE(exception_channel2.is_valid()); |
| } |
| |
| TEST(ExceptionTest, OverwriteClosedExceptionChannel) { |
| TestLoop loop; |
| zx::channel exception_channel; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channel)); |
| |
| // If we close the existing channel, registering a new one should succeed. |
| exception_channel.reset(); |
| zx::channel exception_channel2; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channel2)); |
| EXPECT_TRUE(exception_channel2.is_valid()); |
| } |
| |
| // This is the basic test to receive an exception, parameterized so we can |
| // easily run it against all the different exception handler types. |
| // |
| // |task_func|: TestLoop member function to get the task. |
| // |create_flags|: flags to pass to zx_task_create_exception_channel(). |
| // |expected_type|: expected exception type reported in zx_info_thread_t. |
| // |has_process|: true if the exception should have a process handle. |
| template <auto task_func> |
| void receive_test(uint32_t create_flags, uint32_t expected_type, bool has_process) { |
| TestLoop loop; |
| zx::channel exception_channel; |
| ASSERT_OK((loop.*task_func)().create_exception_channel(create_flags, &exception_channel)); |
| |
| loop.CrashAuxThread(); |
| zx_exception_info_t exception_info; |
| zx::exception exception = |
| ReadException(exception_channel, ZX_EXCP_FATAL_PAGE_FAULT, &exception_info); |
| |
| // Make sure exception info is correct. |
| zx_info_handle_basic_t basic_info; |
| zx_status_t status = loop.aux_thread().get_info(ZX_INFO_HANDLE_BASIC, &basic_info, |
| sizeof(basic_info), nullptr, nullptr); |
| ASSERT_EQ(status, ZX_OK); |
| zx_koid_t aux_thread_koid = basic_info.koid; |
| EXPECT_EQ(exception_info.tid, aux_thread_koid); |
| EXPECT_TRUE(ExceptionHasThread(exception, exception_info.tid)); |
| |
| status = loop.process().get_info(ZX_INFO_HANDLE_BASIC, &basic_info, sizeof(basic_info), nullptr, |
| nullptr); |
| ASSERT_EQ(status, ZX_OK); |
| zx_koid_t process_koid = basic_info.koid; |
| EXPECT_EQ(exception_info.pid, process_koid); |
| if (has_process) { |
| EXPECT_TRUE(ExceptionHasProcess(exception, exception_info.pid)); |
| } else { |
| EXPECT_FALSE(ExceptionHasProcess(exception)); |
| } |
| |
| // Make sure the thread state is correct. |
| zx_info_thread_t thread_info; |
| status = loop.aux_thread().get_info(ZX_INFO_THREAD, &thread_info, sizeof(thread_info), nullptr, |
| nullptr); |
| ASSERT_EQ(status, ZX_OK); |
| EXPECT_EQ(thread_info.state, ZX_THREAD_STATE_BLOCKED_EXCEPTION); |
| EXPECT_EQ(thread_info.wait_exception_channel_type, expected_type); |
| |
| test_exceptions::ExceptionCatcher catcher(*zx::job::default_job()); |
| exception.reset(); |
| zx::result<zx::exception> result = catcher.ExpectException(loop.aux_thread()); |
| ASSERT_TRUE(result.is_ok()); |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| TEST(ExceptionTest, ThreadReceive) { |
| receive_test<&TestLoop::aux_thread>(0, ZX_EXCEPTION_CHANNEL_TYPE_THREAD, false); |
| } |
| |
| TEST(ExceptionTest, ProcessReceive) { |
| receive_test<&TestLoop::process>(0, ZX_EXCEPTION_CHANNEL_TYPE_PROCESS, true); |
| } |
| |
| TEST(ExceptionTest, ProcessDebuggerReceive) { |
| receive_test<&TestLoop::process>(ZX_EXCEPTION_CHANNEL_DEBUGGER, |
| ZX_EXCEPTION_CHANNEL_TYPE_DEBUGGER, true); |
| } |
| |
| TEST(ExceptionTest, JobReceive) { |
| receive_test<&TestLoop::job>(0, ZX_EXCEPTION_CHANNEL_TYPE_JOB, true); |
| } |
| |
| TEST(ExceptionTest, JobDebuggerReceive) { |
| receive_test<&TestLoop::parent_job>(0, ZX_EXCEPTION_CHANNEL_TYPE_JOB, true); |
| } |
| |
| TEST(ExceptionTest, ExceptionResume) { |
| TestLoop loop; |
| zx::channel exception_channel; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channel)); |
| |
| loop.CrashAuxThread(); |
| zx::exception exception = ReadException(exception_channel, ZX_EXCP_FATAL_PAGE_FAULT); |
| |
| // If we tell this exception to resume the thread, it should fault |
| // again and return another exception back to us rather than |
| // bubbling up the chain. |
| SetExceptionStateProperty(exception, ZX_EXCEPTION_STATE_HANDLED); |
| exception.reset(); |
| exception = ReadException(exception_channel, ZX_EXCP_FATAL_PAGE_FAULT); |
| |
| // Close the new exception without marking it handled so it bubbles up. |
| test_exceptions::ExceptionCatcher catcher(loop.process()); |
| exception.reset(); |
| zx::result<zx::exception> result = catcher.ExpectException(loop.aux_thread()); |
| ASSERT_TRUE(result.is_ok()); |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| TEST(ExceptionTest, ExceptionStateProperty) { |
| TestLoop loop; |
| zx::channel exception_channel; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channel)); |
| |
| loop.CrashAuxThread(); |
| zx::exception exception = ReadException(exception_channel, ZX_EXCP_FATAL_PAGE_FAULT); |
| |
| // By default exceptions should be unhandled. |
| EXPECT_EQ(GetExceptionStateProperty(exception), ZX_EXCEPTION_STATE_TRY_NEXT); |
| |
| SetExceptionStateProperty(exception, ZX_EXCEPTION_STATE_HANDLED); |
| EXPECT_EQ(GetExceptionStateProperty(exception), ZX_EXCEPTION_STATE_HANDLED); |
| |
| SetExceptionStateProperty(exception, ZX_EXCEPTION_STATE_TRY_NEXT); |
| EXPECT_EQ(GetExceptionStateProperty(exception), ZX_EXCEPTION_STATE_TRY_NEXT); |
| |
| test_exceptions::ExceptionCatcher catcher(loop.process()); |
| exception.reset(); |
| zx::result<zx::exception> result = catcher.ExpectException(loop.aux_thread()); |
| ASSERT_TRUE(result.is_ok()); |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| TEST(ExceptionTest, ExceptionStatePropertyBadArgs) { |
| TestLoop loop; |
| zx::channel exception_channel; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channel)); |
| |
| loop.CrashAuxThread(); |
| zx::exception exception = ReadException(exception_channel, ZX_EXCP_FATAL_PAGE_FAULT); |
| |
| // Wrong handle type. |
| uint32_t state = ZX_EXCEPTION_STATE_HANDLED; |
| EXPECT_EQ(loop.aux_thread().set_property(ZX_PROP_EXCEPTION_STATE, &state, sizeof(state)), |
| ZX_ERR_WRONG_TYPE); |
| EXPECT_EQ(loop.aux_thread().get_property(ZX_PROP_EXCEPTION_STATE, &state, sizeof(state)), |
| ZX_ERR_WRONG_TYPE); |
| |
| // Illegal state value. |
| state = ~0; |
| EXPECT_EQ(exception.set_property(ZX_PROP_EXCEPTION_STATE, &state, sizeof(state)), |
| ZX_ERR_INVALID_ARGS); |
| |
| // Buffer too short. |
| state = ZX_EXCEPTION_STATE_HANDLED; |
| EXPECT_EQ(exception.set_property(ZX_PROP_EXCEPTION_STATE, &state, sizeof(state) - 1), |
| ZX_ERR_BUFFER_TOO_SMALL); |
| EXPECT_EQ(exception.get_property(ZX_PROP_EXCEPTION_STATE, &state, sizeof(state) - 1), |
| ZX_ERR_BUFFER_TOO_SMALL); |
| |
| test_exceptions::ExceptionCatcher catcher(loop.process()); |
| exception.reset(); |
| zx::result<zx::exception> result = catcher.ExpectException(loop.aux_thread()); |
| ASSERT_TRUE(result.is_ok()); |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| TEST(ExceptionTest, ExceptionStrategy) { |
| TestLoop loop; |
| zx::channel exception_channel; |
| ASSERT_OK( |
| loop.process().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &exception_channel)); |
| |
| loop.CrashAuxThread(); |
| zx::exception exception = ReadException(exception_channel, ZX_EXCP_FATAL_PAGE_FAULT); |
| |
| // By default exceptions should be first-chance. |
| EXPECT_EQ(GetExceptionStrategyProperty(exception), ZX_EXCEPTION_STRATEGY_FIRST_CHANCE); |
| |
| SetExceptionStrategyProperty(exception, ZX_EXCEPTION_STRATEGY_SECOND_CHANCE); |
| EXPECT_EQ(GetExceptionStrategyProperty(exception), ZX_EXCEPTION_STRATEGY_SECOND_CHANCE); |
| |
| // Exception strategy values are independent of state values. |
| SetExceptionStateProperty(exception, ZX_EXCEPTION_STATE_HANDLED); |
| EXPECT_EQ(GetExceptionStrategyProperty(exception), ZX_EXCEPTION_STRATEGY_SECOND_CHANCE); |
| SetExceptionStateProperty(exception, ZX_EXCEPTION_STATE_TRY_NEXT); |
| EXPECT_EQ(GetExceptionStrategyProperty(exception), ZX_EXCEPTION_STRATEGY_SECOND_CHANCE); |
| |
| test_exceptions::ExceptionCatcher catcher(loop.process()); |
| exception.reset(); |
| zx::result<zx::exception> result = catcher.ExpectException(loop.aux_thread()); |
| ASSERT_TRUE(result.is_ok()); |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| TEST(ExceptionTest, ExceptionStrategyBadArgs) { |
| TestLoop loop; |
| zx::channel exception_channel; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channel)); |
| loop.CrashAuxThread(); |
| |
| zx::exception exception = ReadException(exception_channel, ZX_EXCP_FATAL_PAGE_FAULT); |
| |
| // Second chance property can only be set on a channel associated with a |
| // process debugger. |
| uint32_t state = ZX_EXCEPTION_STRATEGY_SECOND_CHANCE; |
| EXPECT_EQ(exception.set_property(ZX_PROP_EXCEPTION_STRATEGY, &state, sizeof(state)), |
| ZX_ERR_BAD_STATE); |
| |
| test_exceptions::ExceptionCatcher catcher(loop.process()); |
| exception.reset(); |
| zx::result<zx::exception> result = catcher.ExpectException(loop.aux_thread()); |
| ASSERT_TRUE(result.is_ok()); |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| TEST(ExceptionTest, CloseChannelWithException) { |
| TestLoop loop; |
| zx::channel exception_channel; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channel)); |
| |
| loop.CrashAuxThread(); |
| ASSERT_OK(exception_channel.wait_one(ZX_CHANNEL_READABLE, zx::time::infinite(), nullptr)); |
| |
| // Closing the channel while it still contains the exception should pass |
| // control to the next handler. |
| test_exceptions::ExceptionCatcher catcher(loop.process()); |
| exception_channel.reset(); |
| zx::result<zx::exception> result = catcher.ExpectException(loop.aux_thread()); |
| ASSERT_TRUE(result.is_ok()); |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| TEST(ExceptionTest, CloseChannelWithoutException) { |
| TestLoop loop; |
| zx::channel exception_channel; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channel)); |
| |
| loop.CrashAuxThread(); |
| zx::exception exception = ReadException(exception_channel, ZX_EXCP_FATAL_PAGE_FAULT); |
| |
| // Closing the channel after the exception object has been read out has no |
| // effect since the exception object now controls the exception lifecycle. |
| exception_channel.reset(); |
| |
| // Wait a little bit to make sure the thread really is still blocked on our |
| // exception object. If it wasn't, the exception would filter up now and |
| // ExpectException() will deadlock when it fails to find the exception. |
| zx::nanosleep(zx::deadline_after(kTestTimeout)); |
| |
| test_exceptions::ExceptionCatcher catcher(loop.process()); |
| exception.reset(); |
| zx::result<zx::exception> result = catcher.ExpectException(loop.aux_thread()); |
| ASSERT_TRUE(result.is_ok()); |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| // Make sure a closed exception channel has no effect on other handlers. |
| TEST(ExceptionTest, SkipClosedExceptionChannel) { |
| TestLoop loop; |
| zx::channel job_channel, process_channel; |
| ASSERT_OK(loop.job().create_exception_channel(0, &job_channel)); |
| ASSERT_OK(loop.process().create_exception_channel(0, &process_channel)); |
| |
| { |
| zx::channel thread_channel; |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0, &thread_channel)); |
| } |
| |
| loop.CrashAuxThread(); |
| |
| // We should receive the exception on the process handler and it should |
| // wait for our response as normal. |
| { |
| zx::exception exception = ReadException(process_channel, ZX_EXCP_FATAL_PAGE_FAULT); |
| ASSERT_EQ(job_channel.wait_one(ZX_CHANNEL_READABLE, zx::deadline_after(kTestTimeout), nullptr), |
| ZX_ERR_TIMED_OUT); |
| } |
| |
| // The exception should continue up to the job handler as normal. |
| zx::exception exception = ReadException(job_channel, ZX_EXCP_FATAL_PAGE_FAULT); |
| |
| ASSERT_OK(loop.process().kill()); |
| } |
| |
| // Killing the task should mark its exception channels with PEER_CLOSED. |
| // Parameterized to more easily run it against the different handler types. |
| template <auto task_func> |
| void TaskDeathClosesExceptionChannel(uint32_t create_flags) { |
| TestLoop loop; |
| const auto& task = (loop.*task_func)(); |
| zx::channel exception_channel; |
| ASSERT_OK(task.create_exception_channel(create_flags, &exception_channel)); |
| |
| ASSERT_OK(task.kill()); |
| EXPECT_OK(exception_channel.wait_one(ZX_CHANNEL_PEER_CLOSED, zx::time::infinite(), nullptr)); |
| } |
| |
| TEST(ExceptionTest, TaskDeathClosesProcessExceptionChannel) { |
| TaskDeathClosesExceptionChannel<&TestLoop::process>(0); |
| } |
| |
| TEST(ExceptionTest, TaskDeathClosesProcessDebugExceptionChannel) { |
| TaskDeathClosesExceptionChannel<&TestLoop::process>(ZX_EXCEPTION_CHANNEL_DEBUGGER); |
| } |
| |
| TEST(ExceptionTest, TaskDeathClosesJobExceptionChannel) { |
| TaskDeathClosesExceptionChannel<&TestLoop::job>(0); |
| } |
| |
| TEST(ExceptionTest, TaskDeathClosesJobDebugExceptionChannel) { |
| TaskDeathClosesExceptionChannel<&TestLoop::job>(ZX_EXCEPTION_CHANNEL_DEBUGGER); |
| } |
| |
| TEST(ExceptionTest, ExceptionChannelOrder) { |
| TestLoop loop; |
| |
| // Set the exception channels up in the expected order. |
| zx::channel exception_channels[5]; |
| ASSERT_OK(loop.process().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, |
| &exception_channels[0])); |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channels[1])); |
| ASSERT_OK(loop.process().create_exception_channel(0u, &exception_channels[2])); |
| ASSERT_OK(loop.job().create_exception_channel(0u, &exception_channels[3])); |
| ASSERT_OK(loop.parent_job().create_exception_channel(0u, &exception_channels[4])); |
| |
| loop.CrashAuxThread(); |
| test_exceptions::ExceptionCatcher catcher(*zx::job::default_job()); |
| |
| for (const zx::channel& channel : exception_channels) { |
| ReadException(channel, ZX_EXCP_FATAL_PAGE_FAULT); |
| } |
| |
| zx::result<zx::exception> result = catcher.ExpectException(loop.aux_thread()); |
| ASSERT_TRUE(result.is_ok()); |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| TEST(ExceptionTest, ExceptionChannelOrderWithSecondChanceDebugging) { |
| TestLoop loop; |
| |
| // Set the exception channels up in their expected order, modulo that we |
| // expect debugger to handle the exception again after the process exception |
| // channel. |
| zx::channel exception_channels[5]; |
| ASSERT_OK(loop.process().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, |
| &exception_channels[0])); |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channels[1])); |
| ASSERT_OK(loop.process().create_exception_channel(0u, &exception_channels[2])); |
| ASSERT_OK(loop.job().create_exception_channel(0u, &exception_channels[3])); |
| ASSERT_OK(loop.parent_job().create_exception_channel(0u, &exception_channels[4])); |
| |
| loop.CrashAuxThread(); |
| test_exceptions::ExceptionCatcher catcher(*zx::job::default_job()); |
| |
| // First set the excpetion as 'second chance' and close its handle so it can |
| // be tried by the next handler. |
| { |
| zx::exception exception = ReadException(exception_channels[0], ZX_EXCP_FATAL_PAGE_FAULT); |
| SetExceptionStrategyProperty(exception, ZX_EXCEPTION_STRATEGY_SECOND_CHANCE); |
| } |
| int remaining_order[5] = {1, 2, 0, 3, 4}; |
| for (const int i : remaining_order) { |
| ReadException(exception_channels[i], ZX_EXCP_FATAL_PAGE_FAULT); |
| } |
| |
| zx::result<zx::exception> result = catcher.ExpectException(loop.aux_thread()); |
| ASSERT_TRUE(result.is_ok()); |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| TEST(ExceptionTest, DebugChannelClosedBeforeSecondChance) { |
| // This case validates that a second chance exception with a closed debug |
| // exception channel reverts to behaving like a first chance exception. |
| |
| TestLoop loop; |
| |
| // Set the exception channels up in their expected order, modulo that we |
| // expect debugger to handle the exception again after the process exception |
| // channel. |
| zx::channel exception_channels[5]; |
| ASSERT_OK(loop.process().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, |
| &exception_channels[0])); |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0u, &exception_channels[1])); |
| ASSERT_OK(loop.process().create_exception_channel(0u, &exception_channels[2])); |
| ASSERT_OK(loop.job().create_exception_channel(0u, &exception_channels[3])); |
| ASSERT_OK(loop.parent_job().create_exception_channel(0u, &exception_channels[4])); |
| |
| loop.CrashAuxThread(); |
| test_exceptions::ExceptionCatcher catcher(*zx::job::default_job()); |
| |
| // We mark the exception as second chance, but then promptly close the |
| // debugger exception channel. |
| { |
| zx::exception exception = ReadException(exception_channels[0], ZX_EXCP_FATAL_PAGE_FAULT); |
| SetExceptionStrategyProperty(exception, ZX_EXCEPTION_STRATEGY_SECOND_CHANCE); |
| } |
| exception_channels[0].reset(); |
| |
| int remaining_order[4] = {1, 2, 3, 4}; |
| for (const int i : remaining_order) { |
| ReadException(exception_channels[i], ZX_EXCP_FATAL_PAGE_FAULT); |
| } |
| |
| zx::result<zx::exception> result = catcher.ExpectException(loop.aux_thread()); |
| ASSERT_TRUE(result.is_ok()); |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| TEST(ExceptionTest, ThreadLifecycleChannelExceptions) { |
| TestLoop loop(TestLoop::Control::kManual); |
| |
| loop.Step1CreateProcess(); |
| zx::channel exception_channel; |
| ASSERT_OK( |
| loop.process().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &exception_channel)); |
| |
| // We should get both primary and aux thread exceptions. |
| loop.Step2StartThreads(); |
| |
| zx_exception_info_t primary_start_info; |
| { |
| zx::exception exception = |
| ReadException(exception_channel, ZX_EXCP_THREAD_STARTING, &primary_start_info); |
| zx_info_handle_basic_t basic_info; |
| zx_status_t status = loop.process().get_info(ZX_INFO_HANDLE_BASIC, &basic_info, |
| sizeof(basic_info), nullptr, nullptr); |
| ASSERT_EQ(status, ZX_OK); |
| zx_koid_t process_koid = basic_info.koid; |
| EXPECT_EQ(primary_start_info.pid, process_koid); |
| EXPECT_TRUE(ExceptionHasThread(exception, primary_start_info.tid)); |
| EXPECT_TRUE(ExceptionHasProcess(exception, primary_start_info.pid)); |
| } |
| |
| zx_exception_info_t aux_start_info; |
| { |
| zx::exception exception = |
| ReadException(exception_channel, ZX_EXCP_THREAD_STARTING, &aux_start_info); |
| zx_info_handle_basic_t basic_info; |
| zx_status_t status = loop.process().get_info(ZX_INFO_HANDLE_BASIC, &basic_info, |
| sizeof(basic_info), nullptr, nullptr); |
| ASSERT_EQ(status, ZX_OK); |
| zx_koid_t process_koid = basic_info.koid; |
| EXPECT_EQ(aux_start_info.pid, process_koid); |
| EXPECT_TRUE(ExceptionHasThread(exception, aux_start_info.tid)); |
| EXPECT_TRUE(ExceptionHasProcess(exception, aux_start_info.pid)); |
| } |
| |
| // We don't have access to the primary thread handle so just check the aux |
| // thread TID to make sure it's correct. |
| loop.Step3ReadAuxThreadHandle(); |
| zx_info_handle_basic_t basic_info; |
| zx_status_t status = loop.aux_thread().get_info(ZX_INFO_HANDLE_BASIC, &basic_info, |
| sizeof(basic_info), nullptr, nullptr); |
| ASSERT_EQ(status, ZX_OK); |
| zx_koid_t aux_thread_koid = basic_info.koid; |
| EXPECT_EQ(aux_start_info.tid, aux_thread_koid); |
| |
| loop.Step4ShutdownAuxThread(); |
| zx_exception_info_t aux_exit_info; |
| { |
| zx::exception exception = |
| ReadException(exception_channel, ZX_EXCP_THREAD_EXITING, &aux_exit_info); |
| EXPECT_TRUE(ExceptionHasThread(exception, aux_exit_info.tid)); |
| EXPECT_TRUE(ExceptionHasProcess(exception, aux_exit_info.pid)); |
| EXPECT_EQ(aux_exit_info.tid, aux_start_info.tid); |
| EXPECT_EQ(aux_exit_info.pid, aux_start_info.pid); |
| } |
| |
| loop.Step5ShutdownMainThread(); |
| zx_exception_info_t primary_exit_info; |
| { |
| zx::exception exception = |
| ReadException(exception_channel, ZX_EXCP_THREAD_EXITING, &primary_exit_info); |
| EXPECT_TRUE(ExceptionHasThread(exception, primary_exit_info.tid)); |
| EXPECT_TRUE(ExceptionHasProcess(exception, primary_exit_info.pid)); |
| EXPECT_EQ(primary_exit_info.tid, primary_start_info.tid); |
| EXPECT_EQ(primary_exit_info.pid, primary_start_info.pid); |
| } |
| } |
| |
| // Parameterized to run against either the TestLoop job or parent job. |
| template <auto task_func> |
| void VerifyProcessLifecycle() { |
| zx::channel exception_channel; |
| { |
| TestLoop loop(TestLoop::Control::kManual); |
| |
| ASSERT_OK((loop.*task_func)().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, |
| &exception_channel)); |
| |
| // ZX_EXCP_PROCESS_STARTING shouldn't be sent until step 2 when we |
| // actually start the first thread on the process. |
| loop.Step1CreateProcess(); |
| EXPECT_EQ( |
| exception_channel.wait_one(ZX_CHANNEL_READABLE, zx::deadline_after(kTestTimeout), nullptr), |
| ZX_ERR_TIMED_OUT); |
| |
| loop.Step2StartThreads(); |
| zx_exception_info_t info; |
| { |
| zx::exception exception = ReadException(exception_channel, ZX_EXCP_PROCESS_STARTING, &info); |
| zx_info_handle_basic_t basic_info; |
| zx_status_t status = loop.process().get_info(ZX_INFO_HANDLE_BASIC, &basic_info, |
| sizeof(basic_info), nullptr, nullptr); |
| ASSERT_EQ(status, ZX_OK); |
| EXPECT_EQ(info.pid, basic_info.koid); |
| EXPECT_TRUE(ExceptionHasThread(exception, info.tid)); |
| EXPECT_TRUE(ExceptionHasProcess(exception, info.pid)); |
| } |
| |
| loop.Step3ReadAuxThreadHandle(); |
| loop.Step4ShutdownAuxThread(); |
| loop.Step5ShutdownMainThread(); |
| } |
| |
| // There is no PROCESS_EXITING exception, make sure the kernel finishes |
| // closing the channel without putting anything else in it. |
| // |
| // Unlike processes, jobs don't automatically die with their last child, |
| // so the TestLoop handles must be fully closed at this point to get the |
| // PEER_CLOSED signal. |
| zx_signals_t signals; |
| EXPECT_OK(exception_channel.wait_one(ZX_CHANNEL_PEER_CLOSED, zx::time::infinite(), &signals)); |
| EXPECT_FALSE(signals & ZX_CHANNEL_READABLE); |
| } |
| |
| TEST(ExceptionTest, ProcessLifecycleJobChannel) { VerifyProcessLifecycle<&TestLoop::job>(); } |
| |
| TEST(ExceptionTest, ProcessLifecycleParentJobChannel) { |
| VerifyProcessLifecycle<&TestLoop::parent_job>(); |
| } |
| |
| TEST(ExceptionTest, OrderOfProcessStartExceptions) { |
| TestLoop loop(TestLoop::Control::kManual); |
| zx::channel channel_root; |
| zx::channel channels[3]; |
| |
| ASSERT_OK( |
| loop.parent_job().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &channel_root)); |
| ASSERT_OK(loop.job().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &channels[0])); |
| ASSERT_OK(loop.job().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &channels[1])); |
| // Intentionally close and recreate channels[1]. |
| ASSERT_OK(loop.job().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &channels[1])); |
| ASSERT_OK(loop.job().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &channels[2])); |
| channels[1].reset(); |
| |
| loop.Step1CreateProcess(); |
| loop.Step2StartThreads(); |
| ReadException(channels[0], ZX_EXCP_PROCESS_STARTING); |
| ReadException(channels[2], ZX_EXCP_PROCESS_STARTING); |
| ReadException(channel_root, ZX_EXCP_PROCESS_STARTING); |
| } |
| |
| TEST(ExceptionTest, MaximumNumberOfJobDebugChannels) { |
| zx::job job; |
| zx::job::create(*zx::job::default_job(), 0, &job); |
| |
| for (size_t i = 0; i < ZX_EXCEPTION_CHANNEL_JOB_DEBUGGER_MAX_COUNT * 2; i++) { |
| zx::channel channel; |
| ASSERT_OK(job.create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &channel)); |
| } |
| |
| zx::channel channels[ZX_EXCEPTION_CHANNEL_JOB_DEBUGGER_MAX_COUNT]; |
| for (zx::channel& channel : channels) { |
| ASSERT_OK(job.create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &channel)); |
| } |
| zx::channel channel; |
| ASSERT_EQ(job.create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &channel), |
| ZX_ERR_ALREADY_BOUND); |
| } |
| |
| // Lifecycle exceptions should not be seen by normal (non-debug) handlers. |
| TEST(ExceptionTest, LifecycleExceptionsToDebugHandlersOnly) { |
| zx::channel exception_channels[4]; |
| { |
| TestLoop loop(TestLoop::Control::kManual); |
| ASSERT_OK(loop.parent_job().create_exception_channel(0, &exception_channels[0])); |
| ASSERT_OK(loop.job().create_exception_channel(0, &exception_channels[1])); |
| |
| loop.Step1CreateProcess(); |
| ASSERT_OK(loop.process().create_exception_channel(0, &exception_channels[2])); |
| |
| loop.Step2StartThreads(); |
| loop.Step3ReadAuxThreadHandle(); |
| ASSERT_OK(loop.aux_thread().create_exception_channel(0, &exception_channels[3])); |
| |
| loop.Step4ShutdownAuxThread(); |
| loop.Step5ShutdownMainThread(); |
| } |
| |
| // None of the normal handlers should have seen any exceptions. |
| for (const zx::channel& channel : exception_channels) { |
| zx_signals_t signals; |
| EXPECT_OK(channel.wait_one(ZX_CHANNEL_PEER_CLOSED, zx::time::infinite(), &signals)); |
| EXPECT_FALSE(signals & ZX_CHANNEL_READABLE); |
| } |
| } |
| |
| // Returns the state of the thread underlying the given exception or |
| // an invalid state on failure. |
| zx_thread_state_t GetExceptionThreadState(const zx::exception& exception) { |
| zx::thread thread; |
| if (exception.get_thread(&thread) != ZX_OK) { |
| return ~0; |
| } |
| zx_info_thread_t info; |
| zx_status_t status = thread.get_info(ZX_INFO_THREAD, &info, sizeof(info), nullptr, nullptr); |
| ZX_ASSERT(status == ZX_OK); |
| return info.state; |
| } |
| |
| // A lifecycle exception blocks due to: |
| // * process/thread start |
| // * thread killing itself via zx_thread_exit() |
| // |
| // It does not block due to: |
| // * zx_task_kill() on the thread or any of its parents |
| // |
| // In the non-blocking case, the exception is still sent, but the thread |
| // doesn't wait for a response. |
| TEST(ExceptionTest, LifecycleBlocking) { |
| TestLoop loop(TestLoop::Control::kManual); |
| loop.Step1CreateProcess(); |
| |
| zx::channel job_channel; |
| ASSERT_OK(loop.job().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &job_channel)); |
| zx::channel process_channel; |
| ASSERT_OK( |
| loop.process().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &process_channel)); |
| |
| // Process/thread start: exception handler should block the task. |
| loop.Step2StartThreads(); |
| { |
| zx::exception exception = ReadException(job_channel, ZX_EXCP_PROCESS_STARTING); |
| zx::nanosleep(zx::deadline_after(kTestTimeout)); |
| EXPECT_EQ(GetExceptionThreadState(exception), ZX_THREAD_STATE_BLOCKED_EXCEPTION); |
| } |
| for (int i = 0; i < 2; ++i) { |
| zx::exception exception = ReadException(process_channel, ZX_EXCP_THREAD_STARTING); |
| zx::nanosleep(zx::deadline_after(kTestTimeout)); |
| EXPECT_EQ(GetExceptionThreadState(exception), ZX_THREAD_STATE_BLOCKED_EXCEPTION); |
| } |
| |
| // The aux thread exits gracefully via zx_thread_exit() so should block. |
| loop.Step3ReadAuxThreadHandle(); |
| loop.Step4ShutdownAuxThread(); |
| { |
| zx::exception exception = ReadException(process_channel, ZX_EXCP_THREAD_EXITING); |
| zx::nanosleep(zx::deadline_after(kTestTimeout)); |
| // The thread reports DYING because it takes precedence over BLOCKED, |
| // but if it wasn't actually blocking it would report DEAD by now. |
| EXPECT_EQ(GetExceptionThreadState(exception), ZX_THREAD_STATE_DYING); |
| } |
| |
| // The main thread shuts down the whole process via zx_task_kill() so |
| // should not block. |
| loop.Step5ShutdownMainThread(); |
| { |
| zx::exception exception = ReadException(process_channel, ZX_EXCP_THREAD_EXITING); |
| zx::thread thread; |
| EXPECT_OK(zx_exception_get_thread(exception.get(), thread.reset_and_get_address())); |
| EXPECT_OK(thread.wait_one(ZX_THREAD_TERMINATED, zx::time::infinite(), nullptr)); |
| EXPECT_EQ(GetExceptionThreadState(exception), ZX_THREAD_STATE_DEAD); |
| } |
| } |
| |
| // Test read/write register state during (non-synthetic) exceptions. |
| // |
| // |task_func|: TestLoop member function to get the task. |
| // |create_flags|: flags to pass to zx_task_create_exception_channel(). |
| template <auto task_func> |
| void ReadWriteThreadState(uint32_t create_flags) { |
| TestLoop loop; |
| zx::channel exception_channel; |
| ASSERT_OK((loop.*task_func)().create_exception_channel(create_flags, &exception_channel)); |
| |
| loop.CrashAuxThread(); |
| zx::exception exception = ReadException(exception_channel, ZX_EXCP_FATAL_PAGE_FAULT); |
| |
| zx_thread_state_general_regs_t regs; |
| EXPECT_OK(loop.aux_thread().read_state(ZX_THREAD_STATE_GENERAL_REGS, ®s, sizeof(regs))); |
| EXPECT_OK(loop.aux_thread().write_state(ZX_THREAD_STATE_GENERAL_REGS, ®s, sizeof(regs))); |
| |
| EXPECT_OK(loop.process().kill()); |
| } |
| |
| TEST(ExceptionTest, ReadWriteThreadStateFromThreadChannel) { |
| ReadWriteThreadState<&TestLoop::aux_thread>(0); |
| } |
| |
| TEST(ExceptionTest, ReadWriteThreadStateFromProcessChannel) { |
| ReadWriteThreadState<&TestLoop::process>(0); |
| } |
| |
| TEST(ExceptionTest, ReadWriteThreadStateFromProcessDebugChannel) { |
| ReadWriteThreadState<&TestLoop::process>(ZX_EXCEPTION_CHANNEL_DEBUGGER); |
| } |
| |
| TEST(ExceptionTest, ReadWriteThreadStateFromJobChannel) { ReadWriteThreadState<&TestLoop::job>(0); } |
| |
| TEST(ExceptionTest, ReadWriteThreadStateFromParentJobChannel) { |
| ReadWriteThreadState<&TestLoop::parent_job>(0); |
| } |
| |
| // Processes an exception and returns the result of trying to read/write |
| // the thread general registers. |
| // |
| // If read/write return different status, marks a test failure and returns |
| // ZX_ERR_INTERNAL. |
| zx_status_t ExceptionRegAccess(const zx::channel& channel, zx_excp_type_t type) { |
| zx_exception_info_t info; |
| zx::exception exception = ReadException(channel, type, &info); |
| |
| zx::thread thread; |
| EXPECT_OK(exception.get_thread(&thread)); |
| if (!thread.is_valid()) { |
| return ZX_ERR_INTERNAL; |
| } |
| |
| zx_thread_state_general_regs_t regs; |
| zx_status_t read_status = thread.read_state(ZX_THREAD_STATE_GENERAL_REGS, ®s, sizeof(regs)); |
| zx_status_t write_status = thread.write_state(ZX_THREAD_STATE_GENERAL_REGS, ®s, sizeof(regs)); |
| |
| EXPECT_EQ(read_status, write_status); |
| if (read_status != write_status) { |
| return ZX_ERR_INTERNAL; |
| } |
| return read_status; |
| } |
| |
| // Read/write register state is supported during STARTING exceptions, but not |
| // during EXITING. |
| TEST(ExceptionTest, SyntheticExceptionReadWriteRegs) { |
| zx::channel job_channel; |
| zx::channel process_channel; |
| |
| TestLoop loop(TestLoop::Control::kManual); |
| ASSERT_OK(loop.job().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &job_channel)); |
| |
| loop.Step1CreateProcess(); |
| ASSERT_OK( |
| loop.process().create_exception_channel(ZX_EXCEPTION_CHANNEL_DEBUGGER, &process_channel)); |
| |
| loop.Step2StartThreads(); |
| EXPECT_OK(ExceptionRegAccess(job_channel, ZX_EXCP_PROCESS_STARTING)); |
| EXPECT_OK(ExceptionRegAccess(process_channel, ZX_EXCP_THREAD_STARTING)); |
| EXPECT_OK(ExceptionRegAccess(process_channel, ZX_EXCP_THREAD_STARTING)); |
| |
| loop.Step3ReadAuxThreadHandle(); |
| loop.Step4ShutdownAuxThread(); |
| EXPECT_EQ(ExceptionRegAccess(process_channel, ZX_EXCP_THREAD_EXITING), ZX_ERR_NOT_SUPPORTED); |
| |
| // When the main thread is shut down it kills the whole process, which |
| // causes it to stop waiting for responses from exception handlers. We'll |
| // still receive the exception, but by the time we process it here it's |
| // likely that the thread is already dead so we can't check reg access. |
| loop.Step5ShutdownMainThread(); |
| ReadException(process_channel, ZX_EXCP_THREAD_EXITING); |
| } |
| |
| static const char* check_trigger(int argc, char** argv) { |
| static const char trigger[] = "trigger="; |
| for (int i = 1; i < argc; ++i) { |
| if (strncmp(argv[i], trigger, sizeof(trigger) - 1) == 0) { |
| return argv[i] + sizeof(trigger) - 1; |
| } |
| } |
| return NULL; |
| } |
| |
| } // namespace |
| |
| int main(int argc, char** argv) { |
| program_path = argv[0]; |
| |
| // We use this same binary for both the main test runner and a test process |
| // running msg_loop(), but this can interfere with any common zxtest |
| // arguments that get passed. If this becomes a problem, consider using |
| // mini-process as the test process instead. |
| if (argc >= 2) { |
| const char* excp_name = check_trigger(argc, argv); |
| if (excp_name) { |
| test_child_trigger(excp_name); |
| return 0; |
| } |
| if (strcmp(argv[1], test_child_name) == 0) { |
| test_child(); |
| return 0; |
| } |
| if (strcmp(argv[1], exit_closing_excp_handle_child_name) == 0) { |
| test_child_exit_closing_excp_handle(); |
| /* NOTREACHED */ |
| } |
| } |
| |
| return RUN_ALL_TESTS(argc, argv); |
| } |