| /* |
| * Copyright (c) 2018 Intel Corporation. All Rights Reserved. |
| * |
| * Permission is hereby granted, free of charge, to any person obtaining a |
| * copy of this software and associated documentation files (the |
| * "Software"), to deal in the Software without restriction, including |
| * without limitation the rights to use, copy, modify, merge, publish, |
| * distribute, sub license, and/or sell copies of the Software, and to |
| * permit persons to whom the Software is furnished to do so, subject to |
| * the following conditions: |
| * |
| * The above copyright notice and this permission notice (including the |
| * next paragraph) shall be included in all copies or substantial portions |
| * of the Software. |
| * |
| * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS |
| * OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF |
| * MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT. |
| * IN NO EVENT SHALL PRECISION INSIGHT AND/OR ITS SUPPLIERS BE LIABLE FOR |
| * ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, |
| * TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE |
| * SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. |
| */ |
| #define LIBVA_UTILS_UPLOAD_DOWNLOAD_YUV_SURFACE 1 |
| |
| #include <stdio.h> |
| #include <string.h> |
| #include <stdlib.h> |
| #include <getopt.h> |
| #include <unistd.h> |
| #include <sys/types.h> |
| #include <sys/stat.h> |
| #include <sys/time.h> |
| #include <sys/mman.h> |
| #include <fcntl.h> |
| #include <assert.h> |
| #include <pthread.h> |
| #include <errno.h> |
| #include <math.h> |
| #include <va/va.h> |
| #include <va/va_enc_hevc.h> |
| #include "va_display.h" |
| #define ALIGN16(x) ((x+15)&~15) |
| #define CHECK_VASTATUS(va_status,func) \ |
| if (va_status != VA_STATUS_SUCCESS) { \ |
| fprintf(stderr,"%s:%s (%d) failed,exit\n", __func__, func, __LINE__); \ |
| exit(1); \ |
| } |
| |
| #include "loadsurface.h" |
| |
| #define NAL_REF_IDC_NONE 0 |
| #define NAL_REF_IDC_LOW 1 |
| #define NAL_REF_IDC_MEDIUM 2 |
| #define NAL_REF_IDC_HIGH 3 |
| |
| #define FRAME_I 1 |
| #define FRAME_P 2 |
| #define FRAME_B 3 |
| #define FRAME_IDR 7 |
| |
| // SLICE TYPE HEVC ENUM |
| enum { |
| SLICE_B = 0, |
| SLICE_P = 1, |
| SLICE_I = 2, |
| }; |
| #define IS_I_SLICE(type) (SLICE_I == (type)) |
| #define IS_P_SLICE(type) (SLICE_P == (type)) |
| #define IS_B_SLICE(type) (SLICE_B == (type)) |
| |
| |
| |
| #define ENTROPY_MODE_CAVLC 0 |
| #define ENTROPY_MODE_CABAC 1 |
| |
| #define PROFILE_IDC_MAIN 1 |
| #define PROFILE_IDC_MAIN10 2 |
| |
| #define BITSTREAM_ALLOCATE_STEPPING 4096 |
| #define LCU_SIZE 32 |
| |
| #define SURFACE_NUM 16 /* 16 surfaces for source YUV */ |
| #define SURFACE_NUM 16 /* 16 surfaces for reference */ |
| enum NALUType { |
| NALU_TRAIL_N = 0x00, // Coded slice segment of a non-TSA, non-STSA trailing picture - slice_segment_layer_rbsp, VLC |
| NALU_TRAIL_R = 0x01, // Coded slice segment of a non-TSA, non-STSA trailing picture - slice_segment_layer_rbsp, VLC |
| NALU_TSA_N = 0x02, // Coded slice segment of a TSA picture - slice_segment_layer_rbsp, VLC |
| NALU_TSA_R = 0x03, // Coded slice segment of a TSA picture - slice_segment_layer_rbsp, VLC |
| NALU_STSA_N = 0x04, // Coded slice of an STSA picture - slice_layer_rbsp, VLC |
| NALU_STSA_R = 0x05, // Coded slice of an STSA picture - slice_layer_rbsp, VLC |
| NALU_RADL_N = 0x06, // Coded slice of an RADL picture - slice_layer_rbsp, VLC |
| NALU_RADL_R = 0x07, // Coded slice of an RADL picture - slice_layer_rbsp, VLC |
| NALU_RASL_N = 0x08, // Coded slice of an RASL picture - slice_layer_rbsp, VLC |
| NALU_RASL_R = 0x09, // Coded slice of an RASL picture - slice_layer_rbsp, VLC |
| /* 0x0a..0x0f - Reserved */ |
| NALU_BLA_W_LP = 0x10, // Coded slice segment of an BLA picture - slice_segment_layer_rbsp, VLC |
| NALU_BLA_W_DLP = 0x11, // Coded slice segment of an BLA picture - slice_segment_layer_rbsp, VLC |
| NALU_BLA_N_LP = 0x12, // Coded slice segment of an BLA picture - slice_segment_layer_rbsp, VLC |
| NALU_IDR_W_DLP = 0x13, // Coded slice segment of an IDR picture - slice_segment_layer_rbsp, VLC |
| NALU_IDR_N_LP = 0x14, // Coded slice segment of an IDR picture - slice_segment_layer_rbsp, VLC |
| NALU_CRA = 0x15, // Coded slice segment of an CRA picture - slice_segment_layer_rbsp, VLC |
| /* 0x16..0x1f - Reserved */ |
| NALU_VPS = 0x20, // Video parameter set - video_parameter_set_rbsp, non-VLC |
| NALU_SPS = 0x21, // Sequence parameter set - seq_parameter_set_rbsp, non-VLC |
| NALU_PPS = 0x22, // Picture parameter set - pic_parameter_set_rbsp, non-VLC |
| NALU_AUD = 0x23, // Access unit delimiter - access_unit_delimiter_rbsp, non-VLC |
| NALU_EOS = 0x24, // End of sequence - end_of_seq_rbsp, non-VLC |
| NALU_EOB = 0x25, // End of bitsteam - end_of_bitsteam_rbsp, non-VLC |
| NALU_FD = 0x26, // Filler data - filler_data_rbsp, non-VLC |
| NALU_PREFIX_SEI = 0x27, // Supplemental enhancement information (SEI) - sei_rbsp, non_VLC |
| NALU_SUFFIX_SEI = 0x28, // Supplemental enhancement information (SEI) - sei_rbsp, non_VLC |
| /* 0x29..0x2f - Reserved */ |
| /* 0x30..0x3f - Unspecified */ |
| //this should be the last element of this enum |
| //chagne this value if NAL unit type increased |
| MAX_HEVC_NAL_TYPE = 0x3f, |
| |
| }; |
| |
| // Config const values |
| #define MAX_TEMPORAL_SUBLAYERS 8 |
| #define MAX_LAYER_ID 64 |
| #define MAX_LONGTERM_REF_PIC 32 |
| #define NUM_OF_EXTRA_SLICEHEADER_BITS 3 |
| struct ProfileTierParamSet { |
| uint8_t general_profile_space; //u(2) |
| int general_tier_flag; //u(1) |
| uint8_t general_profile_idc; //u(5) |
| int general_profile_compatibility_flag[32]; //u(1) |
| int general_progressive_source_flag; //u(1) |
| int general_interlaced_source_flag; //u(1) |
| int general_non_packed_constraint_flag; //u(1) |
| int general_frame_only_constraint_flag; //u(1) |
| int general_reserved_zero_43bits[43]; //u(1) |
| int general_reserved_zero_bit; //u(1) |
| uint8_t general_level_idc; //u(8) |
| }; |
| // Video parameter set structure |
| struct VideoParamSet { |
| uint8_t vps_video_parameter_set_id; //u(4) |
| int vps_base_layer_internal_flag; //u(1) |
| int vps_base_layer_available_flag; //u(1) |
| uint8_t vps_max_layers_minus1; //u(6) |
| uint8_t vps_max_sub_layers_minus1; //u(3) |
| int vps_temporal_id_nesting_flag; //u(1) |
| uint16_t vps_reserved_0xffff_16bits; //u(16) |
| |
| struct ProfileTierParamSet ptps; |
| uint8_t vps_max_nuh_reserved_zero_layer_id; |
| uint32_t vps_max_op_sets; |
| uint32_t vps_num_op_sets_minus1; |
| |
| int vps_sub_layer_ordering_info_present_flag; //u(1) |
| uint32_t vps_max_dec_pic_buffering_minus1[MAX_TEMPORAL_SUBLAYERS]; //ue(v) |
| uint32_t vps_max_num_reorder_pics[MAX_TEMPORAL_SUBLAYERS]; //ue(v) |
| uint32_t vps_max_latency_increase_plus1[MAX_TEMPORAL_SUBLAYERS]; //ue(v) |
| uint8_t vps_max_layer_id; //u(6) |
| uint32_t vps_num_layer_sets_minus1; //ue(v) |
| int layer_id_included_flag[MAX_TEMPORAL_SUBLAYERS][MAX_LAYER_ID]; //u(1) |
| int vps_timing_info_present_flag; //u(1) |
| uint32_t vps_num_units_in_tick; //u(32) |
| uint32_t vps_time_scale; //u(32 |
| int vps_poc_proportional_to_timing_flag; //u(1) |
| uint32_t vps_num_ticks_poc_diff_one_minus1; //ue(v) |
| uint32_t vps_num_hrd_parameters; //ue(v) |
| uint32_t hrd_layer_set_idx[MAX_TEMPORAL_SUBLAYERS]; //ue(v) |
| int cprms_present_flag[MAX_TEMPORAL_SUBLAYERS]; //u(1) |
| int vps_extension_flag; //u(1) |
| int vps_extension_data_flag; //u(1) |
| }; |
| |
| struct ShortTermRefPicParamSet { |
| int inter_ref_pic_set_prediction_flag; //u(1) |
| uint32_t delta_idx_minus1; //ue(v) |
| uint8_t delta_rps_sign; //u(1) |
| uint32_t abs_delta_rps_minus1; //ue(v) |
| uint8_t used_by_curr_pic_flag[32]; //u(1) |
| uint8_t use_delta_flag[32]; //u(1) |
| uint32_t num_negative_pics; //ue(v) |
| uint32_t num_positive_pics; //ue(v) |
| uint32_t delta_poc_s0_minus1[32]; //ue(v) |
| uint8_t used_by_curr_pic_s0_flag[32]; //u(1) |
| uint32_t delta_poc_s1_minus1[32]; //ue(v) |
| uint8_t used_by_curr_pic_s1_flag[32]; //u(1) |
| }; |
| struct SeqParamSet { |
| uint8_t sps_video_parameter_set_id; //u(4) |
| uint8_t sps_max_sub_layers_minus1; //u(3) |
| int sps_temporal_id_nesting_flag; //u(1) |
| |
| struct ProfileTierParamSet ptps; |
| uint32_t sps_seq_parameter_set_id; //ue(v) |
| uint32_t chroma_format_idc; //ue(v) |
| int separate_colour_plane_flag; //u(1) |
| uint32_t pic_width_in_luma_samples; //ue(v) |
| uint32_t pic_height_in_luma_samples; //ue(v) |
| int conformance_window_flag; //u(1) |
| uint32_t conf_win_left_offset; //ue(v) |
| uint32_t conf_win_right_offset; //ue(v) |
| uint32_t conf_win_top_offset; //ue(v) |
| uint32_t conf_win_bottom_offset; //ue(v) |
| uint32_t bit_depth_luma_minus8; //ue(v) |
| uint32_t bit_depth_chroma_minus8; //ue(v) |
| uint32_t log2_max_pic_order_cnt_lsb_minus4; //ue(v) |
| int sps_sub_layer_ordering_info_present_flag; //u(1) |
| uint32_t sps_max_dec_pic_buffering_minus1[MAX_TEMPORAL_SUBLAYERS]; //ue(v) |
| uint32_t sps_max_num_reorder_pics[MAX_TEMPORAL_SUBLAYERS]; //ue(v) |
| uint32_t sps_max_latency_increase_plus1[MAX_TEMPORAL_SUBLAYERS]; //ue(v) |
| uint32_t log2_min_luma_coding_block_size_minus3; //ue(v) |
| uint32_t log2_diff_max_min_luma_coding_block_size; |
| uint32_t log2_max_coding_block_size_minus3; //ue(v) |
| uint32_t log2_min_luma_transform_block_size_minus2; //ue(v) |
| uint32_t log2_diff_max_min_luma_transform_block_size; //ue(v) |
| uint32_t max_transform_hierarchy_depth_inter; //ue(v) |
| uint32_t max_transform_hierarchy_depth_intra; //ue(v) |
| uint8_t scaling_list_enabled_flag; //u(1) |
| uint8_t sps_scaling_list_data_present_flag; //u(1) |
| uint8_t amp_enabled_flag; //u(1) |
| uint8_t sample_adaptive_offset_enabled_flag; //u(1) |
| uint8_t pcm_enabled_flag; //u(1) |
| uint8_t pcm_sample_bit_depth_luma_minus1; //u(4) |
| uint8_t pcm_sample_bit_depth_chroma_minus1; //u(4) |
| uint32_t log2_min_pcm_luma_coding_block_size_minus3; |
| uint32_t log2_max_pcm_luma_coding_block_size_minus3; //ue(v) |
| uint32_t log2_diff_max_min_pcm_luma_coding_block_size; //ue(v) |
| uint8_t pcm_loop_filter_disabled_flag; //u(1) |
| uint32_t num_short_term_ref_pic_sets; //ue(v) |
| |
| struct ShortTermRefPicParamSet strp[66]; |
| uint8_t long_term_ref_pics_present_flag; //u(1) |
| uint32_t num_long_term_ref_pics_sps; //ue(v) |
| uint32_t lt_ref_pic_poc_lsb_sps[MAX_LONGTERM_REF_PIC]; //u(v) |
| uint8_t used_by_curr_pic_lt_sps_flag[MAX_LONGTERM_REF_PIC]; //u(1) |
| uint8_t sps_temporal_mvp_enabled_flag; //u(1) |
| uint8_t strong_intra_smoothing_enabled_flag; //u(1) |
| uint8_t vui_parameters_present_flag; //u(1) |
| //VuiParameters vui_parameters; |
| int sps_extension_present_flag; //u(1) |
| int sps_range_extension_flag; //u(1) |
| int sps_multilayer_extension_flag; //u(1) |
| int sps_3d_extension_flag; //u(1) |
| uint8_t sps_extension_5bits; //u(5) |
| int sps_extension_data_flag; //u(1) |
| }; |
| struct PicParamSet { |
| uint32_t pps_pic_parameter_set_id; //ue(v) |
| uint32_t pps_seq_parameter_set_id; //ue(v) |
| int dependent_slice_segments_enabled_flag; //u(1) |
| int output_flag_present_flag; //u(1) |
| uint8_t num_extra_slice_header_bits; //u(3) |
| int sign_data_hiding_enabled_flag; //u(1) |
| int cabac_init_present_flag; //u(1) |
| uint32_t num_ref_idx_l0_default_active_minus1; //ue(v) |
| uint32_t num_ref_idx_l1_default_active_minus1; //ue(v) |
| int32_t init_qp_minus26; //se(v) |
| int constrained_intra_pred_flag; //u(1) |
| int transform_skip_enabled_flag; //u(1) |
| int cu_qp_delta_enabled_flag; //u(1) |
| uint32_t diff_cu_qp_delta_depth; //ue(v) |
| uint32_t pps_cb_qp_offset; //se(v) |
| uint32_t pps_cr_qp_offset; //se(v) |
| int pps_slice_chroma_qp_offsets_present_flag; //u(1) |
| int weighted_pred_flag; //u(1) |
| int weighted_bipred_flag; //u(1) |
| int transquant_bypass_enabled_flag; //u(1) |
| int tiles_enabled_flag; //u(1) |
| int entropy_coding_sync_enabled_flag; //u(1) |
| uint32_t num_tile_columns_minus1; //ue(v) |
| uint32_t num_tile_rows_minus1; //ue(v) |
| int uniform_spacing_flag; //u(1) |
| uint32_t *column_width_minus1; //ue(v) |
| uint32_t *row_height_minus1; //ue(v) |
| int loop_filter_across_tiles_enabled_flag; //u(1) |
| int pps_loop_filter_across_slices_enabled_flag; //u(1) |
| int deblocking_filter_control_present_flag; //u(1) |
| int deblocking_filter_override_enabled_flag; //u(1) |
| int pps_deblocking_filter_disabled_flag; //u(1) |
| int32_t pps_beta_offset_div2; //se(v) |
| int32_t pps_tc_offset_div2; //se(v) |
| int pps_scaling_list_data_present_flag; //u(1) |
| int lists_modification_present_flag; //u(1) |
| uint32_t log2_parallel_merge_level_minus2; //ue(v) |
| int slice_segment_header_extension_present_flag; //u(1) |
| int pps_extension_present_flag; //u(1) |
| int pps_range_extension_flag; //u(1) |
| int pps_multilayer_extension_flag; //u(1) |
| int pps_3d_extension_flag; //u(1) |
| uint8_t pps_extension_5bits; //u(5) |
| uint8_t pps_extension_data_flag; //u(1) |
| uint32_t log2_max_transform_skip_block_size_minus2; //ue(v) |
| uint8_t cross_component_prediction_enabled_flag; //ue(1) |
| uint8_t chroma_qp_offset_list_enabled_flag; //ue(1) |
| uint32_t diff_cu_chroma_qp_offset_depth; //ue(v) |
| uint32_t chroma_qp_offset_list_len_minus1; //ue(v) |
| uint32_t cb_qp_offset_list[6]; //se(v) |
| uint32_t cr_qp_offset_list[6]; //se(v) |
| uint32_t log2_sao_offset_scale_luma; //ue(v) |
| uint32_t log2_sao_offset_scale_chroma; //ue(v) |
| }; |
| struct SliceHeader { |
| int first_slice_segment_in_pic_flag; //u(1) |
| int no_output_of_prior_pics_flag; //u(1) |
| uint32_t slice_pic_parameter_set_id; //ue(v) |
| int dependent_slice_segment_flag; //u(1) |
| uint32_t picture_width_in_ctus; |
| uint32_t picture_height_in_ctus; |
| uint32_t slice_segment_address; //u(v) |
| int slice_reserved_undetermined_flag[NUM_OF_EXTRA_SLICEHEADER_BITS]; //u(1) |
| uint32_t slice_type; //ue(v) |
| int pic_output_flag; //u(1) |
| uint8_t colour_plane_id; //u(2) |
| uint32_t pic_order_cnt_lsb; |
| uint32_t num_negative_pics; |
| uint32_t num_positive_pics; |
| uint32_t delta_poc_s0_minus1; |
| |
| struct ShortTermRefPicParamSet strp; |
| int short_term_ref_pic_set_sps_flag; //u(1) |
| uint32_t short_term_ref_pic_set_idx; //u(v) |
| uint32_t num_long_term_sps; //ue(v) |
| uint32_t num_long_term_pics; //ue(v) |
| uint32_t *lt_idx_sps; //u(v) |
| uint32_t *poc_lsb_lt; //u(v) |
| int *used_by_curr_pic_lt_flag; //u(1) |
| int *delta_poc_msb_present_flag; //u(1) |
| uint32_t *delta_poc_msb_cycle_lt; //ue(v) |
| int slice_temporal_mvp_enabled_flag; //u(1) |
| int slice_sao_luma_flag; //u(1) |
| int slice_sao_chroma_flag; //u(1) |
| int num_ref_idx_active_override_flag; //u(1) |
| uint32_t num_ref_idx_l0_active_minus1; //ue(v) |
| uint32_t num_ref_idx_l1_active_minus1; |
| uint32_t num_poc_total_cur; |
| int ref_pic_list_modification_flag_l0; |
| int ref_pic_list_modification_flag_l1; |
| uint32_t* list_entry_l0; |
| uint32_t* list_entry_l1; |
| |
| int ref_pic_list_combination_flag; |
| |
| uint32_t num_ref_idx_lc_active_minus1; |
| uint32_t ref_pic_list_modification_flag_lc; |
| int pic_from_list_0_flag; |
| uint32_t ref_idx_list_curr; |
| int mvd_l1_zero_flag; //u(1) |
| int cabac_init_present_flag; |
| int pic_temporal_mvp_enable_flag; |
| |
| int collocated_from_l0_flag; //u(1) |
| uint32_t collocated_ref_idx; //ue(v) |
| uint32_t five_minus_max_num_merge_cand; //ue(v) |
| int32_t delta_pic_order_cnt_bottom; //se(v) |
| int32_t slice_qp_delta; //se(v) |
| int32_t slice_qp_delta_cb; //se(v) |
| int32_t slice_qp_delta_cr; //se(v) |
| int cu_chroma_qp_offset_enabled_flag; //u(1) |
| int deblocking_filter_override_flag; //u(1) |
| int disable_deblocking_filter_flag; //u(1) |
| int32_t beta_offset_div2; //se(v) |
| int32_t tc_offset_div2; //se(v) |
| int slice_loop_filter_across_slices_enabled_flag; //u(1) |
| uint32_t num_entry_point_offsets; //ue(v) |
| uint32_t offset_len_minus1; //ue(v) |
| uint32_t *entry_point_offset; //u(v) |
| uint32_t slice_segment_header_extension_length; //ue(v) |
| uint8_t *slice_segment_header_extension_data_byte; //u(8) |
| }; |
| |
| static struct VideoParamSet vps; |
| static struct SeqParamSet sps; |
| static struct PicParamSet pps; |
| static struct SliceHeader ssh; |
| static VADisplay va_dpy; |
| static VAProfile hevc_profile = ~0; |
| static int real_hevc_profile = 0; |
| static int p2b = 1; |
| static VAConfigAttrib attrib[VAConfigAttribTypeMax]; |
| static VAConfigAttrib config_attrib[VAConfigAttribTypeMax]; |
| static int config_attrib_num = 0, enc_packed_header_idx; |
| static VASurfaceID src_surface[SURFACE_NUM]; |
| static VABufferID coded_buf[SURFACE_NUM]; |
| static VASurfaceID ref_surface[SURFACE_NUM]; |
| static VAConfigID config_id; |
| static VAContextID context_id; |
| static struct ProfileTierParamSet protier_param; |
| |
| static VAEncSequenceParameterBufferHEVC seq_param; |
| static VAEncPictureParameterBufferHEVC pic_param; |
| static VAEncSliceParameterBufferHEVC slice_param; |
| static VAPictureHEVC CurrentCurrPic; |
| static VAPictureHEVC ReferenceFrames[16], RefPicList0_P[32], RefPicList0_B[32], RefPicList1_B[32]; |
| |
| static unsigned int MaxPicOrderCntLsb = (2 << 8); |
| |
| static unsigned int num_ref_frames = 2; |
| static unsigned int num_active_ref_p = 1; |
| static unsigned int numShortTerm = 0; |
| static int constraint_set_flag = 0; |
| static int hevc_packedheader = 0; |
| static int hevc_maxref = 16; |
| |
| static char *coded_fn = NULL, *srcyuv_fn = NULL, *recyuv_fn = NULL; |
| static FILE *coded_fp = NULL, *srcyuv_fp = NULL, *recyuv_fp = NULL; |
| static unsigned long long srcyuv_frames = 0; |
| static int srcyuv_fourcc = VA_FOURCC_NV12; |
| static int calc_psnr = 0; |
| |
| static int frame_width = 176; |
| static int frame_height = 144; |
| static int frame_width_aligned; |
| static int frame_height_aligned; |
| static int frame_rate = 30; |
| static unsigned int frame_count = 60; |
| static unsigned int frame_coded = 0; |
| static unsigned int frame_bitrate = 0; |
| static unsigned int frame_slices = 1; |
| static double frame_size = 0; |
| static int initial_qp = 26; |
| static int minimal_qp = 0; |
| static int intra_period = 30; |
| static int intra_idr_period = 60; |
| static int ip_period = 1; |
| static int rc_mode = -1; |
| static int rc_default_modes[] = { |
| VA_RC_VBR, |
| VA_RC_CQP, |
| VA_RC_VBR_CONSTRAINED, |
| VA_RC_CBR, |
| VA_RC_VCM, |
| VA_RC_NONE, |
| }; |
| static unsigned long long current_frame_encoding = 0; |
| static unsigned long long current_frame_display = 0; |
| static unsigned long long current_IDR_display = 0; |
| static unsigned int current_frame_num = 0; |
| static int current_frame_type; |
| #define current_slot (current_frame_display % SURFACE_NUM) |
| |
| static int misc_priv_type = 0; |
| static int misc_priv_value = 0; |
| |
| #define MIN(a, b) ((a)>(b)?(b):(a)) |
| #define MAX(a, b) ((a)>(b)?(a):(b)) |
| |
| /* thread to save coded data/upload source YUV */ |
| struct storage_task_t { |
| void *next; |
| unsigned long long display_order; |
| unsigned long long encode_order; |
| }; |
| static struct storage_task_t *storage_task_header = NULL, *storage_task_tail = NULL; |
| #define SRC_SURFACE_IN_ENCODING 0 |
| #define SRC_SURFACE_IN_STORAGE 1 |
| static int srcsurface_status[SURFACE_NUM]; |
| static int encode_syncmode = 0; |
| static pthread_mutex_t encode_mutex = PTHREAD_MUTEX_INITIALIZER; |
| static pthread_cond_t encode_cond = PTHREAD_COND_INITIALIZER; |
| static pthread_t encode_thread; |
| |
| /* for performance profiling */ |
| static unsigned int UploadPictureTicks = 0; |
| static unsigned int BeginPictureTicks = 0; |
| static unsigned int RenderPictureTicks = 0; |
| static unsigned int EndPictureTicks = 0; |
| static unsigned int SyncPictureTicks = 0; |
| static unsigned int SavePictureTicks = 0; |
| static unsigned int TotalTicks = 0; |
| |
| struct __bitstream { |
| unsigned int *buffer; |
| int bit_offset; |
| int max_size_in_dword; |
| }; |
| typedef struct __bitstream bitstream; |
| |
| static unsigned int |
| va_swap32(unsigned int val) |
| { |
| unsigned char *pval = (unsigned char *)&val; |
| |
| return ((pval[0] << 24) | |
| (pval[1] << 16) | |
| (pval[2] << 8) | |
| (pval[3] << 0)); |
| } |
| |
| static void |
| bitstream_start(bitstream *bs) |
| { |
| bs->max_size_in_dword = BITSTREAM_ALLOCATE_STEPPING; |
| bs->buffer = calloc(bs->max_size_in_dword * sizeof(int), 1); |
| assert(bs->buffer); |
| bs->bit_offset = 0; |
| } |
| |
| static void |
| bitstream_end(bitstream *bs) |
| { |
| int pos = (bs->bit_offset >> 5); |
| int bit_offset = (bs->bit_offset & 0x1f); |
| int bit_left = 32 - bit_offset; |
| |
| if (bit_offset) { |
| bs->buffer[pos] = va_swap32((bs->buffer[pos] << bit_left)); |
| } |
| } |
| |
| static void |
| put_ui(bitstream *bs, unsigned int val, int size_in_bits) |
| { |
| int pos = (bs->bit_offset >> 5); |
| int bit_offset = (bs->bit_offset & 0x1f); |
| int bit_left = 32 - bit_offset; |
| |
| if (!size_in_bits) |
| return; |
| |
| bs->bit_offset += size_in_bits; |
| |
| if (bit_left > size_in_bits) { |
| bs->buffer[pos] = (bs->buffer[pos] << size_in_bits | val); |
| } else { |
| size_in_bits -= bit_left; |
| bs->buffer[pos] = (bs->buffer[pos] << bit_left) | (val >> size_in_bits); |
| bs->buffer[pos] = va_swap32(bs->buffer[pos]); |
| |
| if (pos + 1 == bs->max_size_in_dword) { |
| bs->max_size_in_dword += BITSTREAM_ALLOCATE_STEPPING; |
| bs->buffer = realloc(bs->buffer, bs->max_size_in_dword * sizeof(unsigned int)); |
| assert(bs->buffer); |
| } |
| |
| bs->buffer[pos + 1] = val; |
| } |
| } |
| |
| static void |
| put_ue(bitstream *bs, unsigned int val) |
| { |
| int size_in_bits = 0; |
| int tmp_val = ++val; |
| |
| while (tmp_val) { |
| tmp_val >>= 1; |
| size_in_bits++; |
| } |
| |
| put_ui(bs, 0, size_in_bits - 1); // leading zero |
| put_ui(bs, val, size_in_bits); |
| } |
| |
| static void |
| put_se(bitstream *bs, int val) |
| { |
| unsigned int new_val; |
| |
| if (val <= 0) |
| new_val = -2 * val; |
| else |
| new_val = 2 * val - 1; |
| |
| put_ue(bs, new_val); |
| } |
| |
| static void |
| byte_aligning(bitstream *bs, int bit) |
| { |
| int bit_offset = (bs->bit_offset & 0x7); |
| int bit_left = 8 - bit_offset; |
| int new_val; |
| |
| if (!bit_offset) |
| return; |
| |
| assert(bit == 0 || bit == 1); |
| |
| if (bit) |
| new_val = (1 << bit_left) - 1; |
| else |
| new_val = 0; |
| |
| put_ui(bs, new_val, bit_left); |
| } |
| |
| static void |
| rbsp_trailing_bits(bitstream *bs) |
| { |
| put_ui(bs, 1, 1); |
| byte_aligning(bs, 0); |
| } |
| |
| static void nal_start_code_prefix(bitstream *bs, int nal_unit_type) |
| { |
| if (nal_unit_type == NALU_VPS || |
| nal_unit_type == NALU_SPS || |
| nal_unit_type == NALU_PPS || |
| nal_unit_type == NALU_AUD) |
| put_ui(bs, 0x00000001, 32); |
| else |
| put_ui(bs, 0x000001, 24); |
| } |
| |
| static void nal_header(bitstream *bs, int nal_unit_type) |
| { |
| put_ui(bs, 0, 1); /* forbidden_zero_bit: 0 */ |
| put_ui(bs, nal_unit_type, 6); |
| put_ui(bs, 0, 6); |
| put_ui(bs, 1, 3); |
| } |
| |
| static int calc_poc(int pic_order_cnt_lsb) |
| { |
| static int picOrderCntMsb_ref = 0, pic_order_cnt_lsb_ref = 0; |
| int prevPicOrderCntMsb, prevPicOrderCntLsb; |
| int picOrderCntMsb, picOrderCnt; |
| |
| if (current_frame_type == FRAME_IDR) |
| prevPicOrderCntMsb = prevPicOrderCntLsb = 0; |
| else { |
| prevPicOrderCntMsb = picOrderCntMsb_ref; |
| prevPicOrderCntLsb = pic_order_cnt_lsb_ref; |
| } |
| |
| if ((pic_order_cnt_lsb < prevPicOrderCntLsb) && |
| ((prevPicOrderCntLsb - pic_order_cnt_lsb) >= (int)(MaxPicOrderCntLsb / 2))) |
| picOrderCntMsb = prevPicOrderCntMsb + MaxPicOrderCntLsb; |
| else if ((pic_order_cnt_lsb > prevPicOrderCntLsb) && |
| ((pic_order_cnt_lsb - prevPicOrderCntLsb) > (int)(MaxPicOrderCntLsb / 2))) |
| picOrderCntMsb = prevPicOrderCntMsb - MaxPicOrderCntLsb; |
| else |
| picOrderCntMsb = prevPicOrderCntMsb; |
| |
| picOrderCnt = picOrderCntMsb + pic_order_cnt_lsb; |
| |
| if (current_frame_type != FRAME_B) { |
| picOrderCntMsb_ref = picOrderCntMsb; |
| pic_order_cnt_lsb_ref = pic_order_cnt_lsb; |
| } |
| |
| return picOrderCnt; |
| } |
| |
| static void fill_profile_tier_level( |
| uint8_t vps_max_layers_minus1, |
| struct ProfileTierParamSet *ptps, |
| uint8_t profilePresentFlag) |
| { |
| if (!profilePresentFlag) |
| return; |
| |
| memset(ptps, 0, sizeof(*ptps)); |
| |
| ptps->general_profile_space = 0; |
| ptps->general_tier_flag = 0; |
| ptps->general_profile_idc = real_hevc_profile; |
| memset(ptps->general_profile_compatibility_flag, 0, 32 * sizeof(int)); |
| ptps->general_profile_compatibility_flag[ptps->general_profile_idc] = 1; |
| ptps->general_progressive_source_flag = 1; |
| ptps->general_interlaced_source_flag = 0; |
| ptps->general_non_packed_constraint_flag = 0; |
| ptps->general_frame_only_constraint_flag = 1; |
| |
| ptps->general_level_idc = 30; |
| ptps->general_level_idc = ptps->general_level_idc * 3; |
| |
| } |
| static void fill_vps_header(struct VideoParamSet *vps) |
| { |
| int i = 0; |
| memset(vps, 0, sizeof(*vps)); |
| |
| vps->vps_video_parameter_set_id = 0; |
| vps->vps_base_layer_internal_flag = 1; |
| vps->vps_base_layer_available_flag = 1; |
| vps->vps_max_layers_minus1 = 0; |
| vps->vps_max_sub_layers_minus1 = 0; // max temporal layer minus 1 |
| vps->vps_temporal_id_nesting_flag = 1; |
| vps->vps_reserved_0xffff_16bits = 0xFFFF; |
| // hevc::ProfileTierParamSet ptps; |
| memset(&vps->ptps, 0, sizeof(vps->ptps)); |
| fill_profile_tier_level(vps->vps_max_layers_minus1, &protier_param, 1); |
| vps->vps_sub_layer_ordering_info_present_flag = 0; |
| for (i = 0; i < MAX_TEMPORAL_SUBLAYERS; i++) { |
| vps->vps_max_dec_pic_buffering_minus1[i] = intra_period == 1 ? 1 : 6; |
| vps->vps_max_num_reorder_pics[i] = ip_period != 0 ? ip_period - 1 : 0; |
| vps->vps_max_latency_increase_plus1[i] = 0; |
| } |
| vps->vps_max_layer_id = 0; |
| vps->vps_num_layer_sets_minus1 = 0; |
| vps->vps_sub_layer_ordering_info_present_flag = 0; |
| vps->vps_max_nuh_reserved_zero_layer_id = 0; |
| vps->vps_max_op_sets = 1; |
| vps->vps_timing_info_present_flag = 0; |
| vps->vps_extension_flag = 0; |
| } |
| |
| static void fill_short_term_ref_pic_header( |
| struct ShortTermRefPicParamSet *strp, |
| uint8_t strp_index) |
| { |
| uint32_t i = 0; |
| // inter_ref_pic_set_prediction_flag is always 0 now |
| strp->inter_ref_pic_set_prediction_flag = 0; |
| /* don't need to set below parameters since inter_ref_pic_set_prediction_flag equal to 0 |
| strp->delta_idx_minus1 should be set to 0 since strp_index != num_short_term_ref_pic_sets in sps |
| strp->delta_rps_sign; |
| strp->abs_delta_rps_minus1; |
| strp->used_by_curr_pic_flag[j]; |
| strp->use_delta_flag[j]; |
| */ |
| strp->num_negative_pics = num_active_ref_p; |
| int num_positive_pics = ip_period > 1 ? 1 : 0; |
| strp->num_positive_pics = strp_index == 0 ? 0 : num_positive_pics; |
| |
| if (strp_index == 0) { |
| for (i = 0; i < strp->num_negative_pics; i++) { |
| strp->delta_poc_s0_minus1[i] = ip_period - 1; |
| strp->used_by_curr_pic_s0_flag[i] = 1; |
| } |
| } else { |
| for (i = 0; i < strp->num_negative_pics; i++) { |
| strp->delta_poc_s0_minus1[i] = (i == 0) ? |
| (strp_index - 1) : (ip_period - 1); |
| strp->used_by_curr_pic_s0_flag[i] = 1; |
| } |
| for (i = 0; i < strp->num_positive_pics; i++) { |
| strp->delta_poc_s1_minus1[i] = ip_period - 1 - strp_index; |
| strp->used_by_curr_pic_s1_flag[i] = 1; |
| } |
| |
| } |
| } |
| |
| void fill_sps_header(struct SeqParamSet *sps, int id) |
| { |
| int i = 0; |
| memset(sps, 0, sizeof(struct SeqParamSet)); |
| |
| sps->sps_video_parameter_set_id = 0; |
| sps->sps_max_sub_layers_minus1 = 0; |
| sps->sps_temporal_id_nesting_flag = 1; |
| fill_profile_tier_level(sps->sps_max_sub_layers_minus1, &sps->ptps, 1); |
| sps->sps_seq_parameter_set_id = id; |
| sps->chroma_format_idc = 1; |
| if (sps->chroma_format_idc == 3) { |
| sps->separate_colour_plane_flag = 0; |
| } |
| frame_width_aligned = ALIGN16(frame_width); |
| frame_height_aligned = ALIGN16(frame_height); |
| sps->pic_width_in_luma_samples = frame_width_aligned; |
| sps->pic_height_in_luma_samples = frame_height_aligned; |
| if (frame_width_aligned != frame_width || |
| frame_height_aligned != frame_height) { |
| sps->conformance_window_flag = 1; |
| sps->conf_win_left_offset = 0; |
| sps->conf_win_top_offset = 0; |
| switch (sps->chroma_format_idc) { |
| case 0: |
| case 3: // 4:4:4 format |
| sps->conf_win_right_offset = (frame_width_aligned - frame_width); |
| sps->conf_win_bottom_offset = (frame_height_aligned - frame_height); |
| break; |
| |
| case 2: // 4:2:2 format |
| sps->conf_win_right_offset = (frame_width_aligned - frame_width) >> 1; |
| sps->conf_win_bottom_offset = (frame_height_aligned - frame_height); |
| break; |
| |
| case 1: |
| default: // 4:2:0 format |
| sps->conf_win_right_offset = (frame_width_aligned - frame_width) >> 1; |
| sps->conf_win_bottom_offset = (frame_height_aligned - frame_height) >> 1; |
| break; |
| } |
| } else { |
| sps->conformance_window_flag = 0; |
| } |
| |
| sps->bit_depth_luma_minus8 = 0; |
| sps->bit_depth_chroma_minus8 = 0; |
| sps->log2_max_pic_order_cnt_lsb_minus4 = MAX((ceil(log(ip_period - 1 + 4) / log(2.0)) + 3), 4) - 4; |
| sps->sps_sub_layer_ordering_info_present_flag = 0; |
| for (i = 0; i < MAX_TEMPORAL_SUBLAYERS; i++) { |
| sps->sps_max_dec_pic_buffering_minus1[i] = intra_period == 1 ? 1 : 6; |
| sps->sps_max_num_reorder_pics[i] = ip_period != 0 ? ip_period - 1 : 0; |
| sps->sps_max_latency_increase_plus1[i] = 0; |
| } |
| sps->log2_min_luma_coding_block_size_minus3 = 0; |
| int log2_max_luma_coding_block_size = log2(LCU_SIZE); |
| int log2_min_luma_coding_block_size = sps->log2_min_luma_coding_block_size_minus3 + 3; |
| sps->log2_diff_max_min_luma_coding_block_size = log2_max_luma_coding_block_size - |
| log2_min_luma_coding_block_size; |
| sps->log2_min_luma_transform_block_size_minus2 = 0; |
| sps->log2_diff_max_min_luma_transform_block_size = 3; |
| sps->max_transform_hierarchy_depth_inter = 2; |
| sps->max_transform_hierarchy_depth_intra = 2; |
| sps->scaling_list_enabled_flag = 0; |
| //sps->sps_scaling_list_data_present_flag; // ignore since scaling_list_enabled_flag equal to 0 |
| sps->amp_enabled_flag = 1; |
| sps->sample_adaptive_offset_enabled_flag = 0; |
| sps->pcm_enabled_flag = 0; |
| /* ignore below parameters seting since pcm_enabled_flag equal to 0 |
| pcm_sample_bit_depth_luma_minus1; |
| pcm_sample_bit_depth_chroma_minus1; |
| log2_min_pcm_luma_coding_block_size_minus3; |
| log2_diff_max_min_pcm_luma_coding_block_size; |
| pcm_loop_filter_disabled_flag; |
| */ |
| sps->num_short_term_ref_pic_sets = ip_period; |
| |
| memset(&sps->strp[0], 0, sizeof(sps->strp)); |
| for (i = 0; i < MIN(sps->num_short_term_ref_pic_sets, 64); i++) |
| fill_short_term_ref_pic_header(&sps->strp[i], i); |
| sps->long_term_ref_pics_present_flag = 0; |
| /* ignore below parameters seting since long_term_ref_pics_present_flag equal to 0 |
| num_long_term_ref_pics_sps; |
| lt_ref_pic_poc_lsb_sps[kMaxLongTermRefPic]; |
| used_by_curr_pic_lt_sps_flag[kMaxLongTermRefPic]; |
| */ |
| sps->sps_temporal_mvp_enabled_flag = 1; |
| sps->strong_intra_smoothing_enabled_flag = 0; |
| |
| sps->vui_parameters_present_flag = 0; |
| sps->sps_extension_present_flag = 0; |
| /* ignore below parameters seting since sps_extension_present_flag equal to 0 |
| sps->sps_range_extension_flag |
| sps->sps_multilayer_extension_flag |
| sps->sps_3d_extension_flag |
| sps->sps_extension_5bits |
| sps->sps_extension_data_flag |
| */ |
| } |
| |
| static void fill_pps_header( |
| struct PicParamSet *pps, |
| uint32_t pps_id, |
| uint32_t sps_id) |
| { |
| memset(pps, 0, sizeof(struct PicParamSet)); |
| |
| pps->pps_pic_parameter_set_id = pps_id; |
| pps->pps_seq_parameter_set_id = sps_id; |
| pps->dependent_slice_segments_enabled_flag = 0; |
| pps->output_flag_present_flag = 0; |
| pps->num_extra_slice_header_bits = 0; |
| pps->sign_data_hiding_enabled_flag = 0; |
| pps->cabac_init_present_flag = 1; |
| |
| pps->num_ref_idx_l0_default_active_minus1 = 0; |
| pps->num_ref_idx_l1_default_active_minus1 = 0; |
| |
| pps->init_qp_minus26 = initial_qp - 26; |
| pps->constrained_intra_pred_flag = 0; |
| pps->transform_skip_enabled_flag = 0; |
| pps->cu_qp_delta_enabled_flag = 0; |
| if (pps->cu_qp_delta_enabled_flag) |
| pps->diff_cu_qp_delta_depth = 0; |
| pps->pps_cb_qp_offset = 0; |
| pps->pps_cr_qp_offset = 0; |
| pps->pps_slice_chroma_qp_offsets_present_flag = 0; |
| pps->weighted_pred_flag = 0; |
| pps->weighted_bipred_flag = 0; |
| pps->transquant_bypass_enabled_flag = 0; |
| pps->entropy_coding_sync_enabled_flag = 0; |
| pps->tiles_enabled_flag = 0; |
| |
| pps->pps_loop_filter_across_slices_enabled_flag = 0; |
| pps->deblocking_filter_control_present_flag = 1; |
| pps->deblocking_filter_override_enabled_flag = 0, |
| pps->pps_deblocking_filter_disabled_flag = 0, |
| pps->pps_beta_offset_div2 = 2, |
| pps->pps_tc_offset_div2 = 0, |
| pps->pps_scaling_list_data_present_flag = 0; |
| pps->lists_modification_present_flag = 0; |
| pps->log2_parallel_merge_level_minus2 = 0; |
| pps->slice_segment_header_extension_present_flag = 0; |
| pps->pps_extension_present_flag = 0; |
| pps->pps_range_extension_flag = 0; |
| |
| } |
| static void fill_slice_header( |
| uint32_t count, |
| struct PicParamSet *pps, |
| struct SliceHeader *slice) |
| { |
| memset(slice, 0, sizeof(struct SliceHeader)); |
| slice->pic_output_flag = 1; |
| slice->colour_plane_id = 0; |
| slice->no_output_of_prior_pics_flag = 0; |
| slice->pic_order_cnt_lsb = calc_poc((current_frame_display - current_IDR_display) % MaxPicOrderCntLsb); |
| |
| //slice_segment_address (u(v)) |
| slice->picture_height_in_ctus = (frame_height + LCU_SIZE - 1) / LCU_SIZE; |
| slice->picture_width_in_ctus = (frame_width + LCU_SIZE - 1) / LCU_SIZE; |
| slice->slice_segment_address = 0; |
| slice->first_slice_segment_in_pic_flag = ((slice->slice_segment_address == 0) ? 1 : 0); |
| slice->slice_type = current_frame_type == FRAME_P ? (p2b ? SLICE_B : SLICE_P) : |
| current_frame_type == FRAME_B ? SLICE_B : SLICE_I; |
| |
| slice->dependent_slice_segment_flag = 0; |
| slice->short_term_ref_pic_set_sps_flag = 1; |
| slice->num_ref_idx_active_override_flag = 0; |
| slice->short_term_ref_pic_set_idx = slice->pic_order_cnt_lsb % ip_period; |
| slice->strp.num_negative_pics = numShortTerm; |
| slice->strp.num_positive_pics = 0; |
| slice->slice_sao_luma_flag = 0; |
| slice->slice_sao_chroma_flag = 0; |
| slice->slice_temporal_mvp_enabled_flag = 1; |
| |
| slice->num_ref_idx_l0_active_minus1 = pps->num_ref_idx_l0_default_active_minus1; |
| slice->num_ref_idx_l1_active_minus1 = pps->num_ref_idx_l1_default_active_minus1; |
| |
| slice->num_poc_total_cur = 0; |
| // for I slice |
| if (current_frame_type == FRAME_I || current_frame_type == FRAME_IDR) { |
| slice->ref_pic_list_modification_flag_l0 = 0; |
| slice->list_entry_l0 = 0; |
| slice->ref_pic_list_modification_flag_l1 = 0; |
| slice->list_entry_l1 = 0; |
| } else { |
| slice->ref_pic_list_modification_flag_l0 = 1; |
| slice->num_poc_total_cur = 2; |
| } |
| |
| slice->ref_pic_list_combination_flag = 0; |
| slice->num_ref_idx_lc_active_minus1 = 0; |
| slice->ref_pic_list_modification_flag_lc = 0; |
| slice->pic_from_list_0_flag = 0; |
| slice->ref_idx_list_curr = 0; |
| slice->mvd_l1_zero_flag = 0; |
| slice->cabac_init_present_flag = 0; |
| |
| slice->slice_qp_delta = 0; |
| slice->slice_qp_delta_cb = pps->pps_cb_qp_offset; |
| slice->slice_qp_delta_cr = pps->pps_cr_qp_offset; |
| |
| slice->deblocking_filter_override_flag = 0; |
| slice->disable_deblocking_filter_flag = 0; |
| slice->tc_offset_div2 = pps->pps_tc_offset_div2; |
| slice->beta_offset_div2 = pps->pps_beta_offset_div2; |
| |
| slice->collocated_from_l0_flag = 1; |
| slice->collocated_ref_idx = pps->num_ref_idx_l0_default_active_minus1; |
| |
| slice->five_minus_max_num_merge_cand = 0; |
| |
| slice->slice_loop_filter_across_slices_enabled_flag = 0; |
| slice->num_entry_point_offsets = 0; |
| slice->offset_len_minus1 = 0; |
| } |
| |
| static void protier_rbsp(bitstream *bs) |
| { |
| uint32_t i = 0; |
| put_ui(bs, protier_param.general_profile_space, 2); |
| put_ui(bs, protier_param.general_tier_flag, 1); |
| put_ui(bs, protier_param.general_profile_idc, 5); |
| |
| for (i = 0; i < 32; i++) |
| put_ui(bs, protier_param.general_profile_compatibility_flag[i], 1); |
| |
| put_ui(bs, protier_param.general_progressive_source_flag, 1); |
| put_ui(bs, protier_param.general_interlaced_source_flag, 1); |
| put_ui(bs, protier_param.general_non_packed_constraint_flag, 1); |
| put_ui(bs, protier_param.general_frame_only_constraint_flag, 1); |
| put_ui(bs, 0, 16); |
| put_ui(bs, 0, 16); |
| put_ui(bs, 0, 12); |
| put_ui(bs, protier_param.general_level_idc, 8); |
| } |
| void pack_short_term_ref_pic_setp( |
| bitstream *bs, |
| struct ShortTermRefPicParamSet* strp, |
| int first_strp) |
| { |
| uint32_t i = 0; |
| if (!first_strp) |
| put_ui(bs, strp->inter_ref_pic_set_prediction_flag, 1); |
| |
| // inter_ref_pic_set_prediction_flag is always 0 now |
| put_ue(bs, strp->num_negative_pics); |
| put_ue(bs, strp->num_positive_pics); |
| |
| for (i = 0; i < strp->num_negative_pics; i++) { |
| put_ue(bs, strp->delta_poc_s0_minus1[i]); |
| put_ui(bs, strp->used_by_curr_pic_s0_flag[i], 1); |
| } |
| for (i = 0; i < strp->num_positive_pics; i++) { |
| put_ue(bs, strp->delta_poc_s1_minus1[i]); |
| put_ui(bs, strp->used_by_curr_pic_s1_flag[i], 1); |
| } |
| } |
| static void vps_rbsp(bitstream *bs) |
| { |
| uint32_t i = 0; |
| put_ui(bs, vps.vps_video_parameter_set_id, 4); |
| put_ui(bs, 3, 2); //vps_reserved_three_2bits |
| put_ui(bs, 0, 6); //vps_reserved_zero_6bits |
| |
| put_ui(bs, vps.vps_max_sub_layers_minus1, 3); |
| put_ui(bs, vps.vps_temporal_id_nesting_flag, 1); |
| put_ui(bs, 0xFFFF, 16); //vps_reserved_0xffff_16bits |
| protier_rbsp(bs); |
| |
| put_ui(bs, vps.vps_sub_layer_ordering_info_present_flag, 1); |
| |
| for (i = (vps.vps_sub_layer_ordering_info_present_flag ? 0 : vps.vps_max_sub_layers_minus1); i <= vps.vps_max_sub_layers_minus1; i++) { |
| // NOTE: In teddi and mv_encoder, the setting is max_dec_pic_buffering. |
| // here just follow the spec 7.3.2.1 |
| put_ue(bs, vps.vps_max_dec_pic_buffering_minus1[i]); |
| put_ue(bs, vps.vps_max_num_reorder_pics[i]); |
| put_ue(bs, vps.vps_max_latency_increase_plus1[i]); |
| } |
| |
| put_ui(bs, vps.vps_max_nuh_reserved_zero_layer_id, 6); |
| put_ue(bs, vps.vps_num_op_sets_minus1); |
| |
| put_ui(bs, vps.vps_timing_info_present_flag, 1); |
| |
| if (vps.vps_timing_info_present_flag) { |
| put_ue(bs, vps.vps_num_units_in_tick); |
| put_ue(bs, vps.vps_time_scale); |
| put_ue(bs, vps.vps_poc_proportional_to_timing_flag); |
| if (vps.vps_poc_proportional_to_timing_flag) { |
| put_ue(bs, vps.vps_num_ticks_poc_diff_one_minus1); |
| } |
| put_ue(bs, vps.vps_num_hrd_parameters); |
| for (i = 0; i < vps.vps_num_hrd_parameters; i++) { |
| put_ue(bs, vps.hrd_layer_set_idx[i]); |
| if (i > 0) { |
| put_ui(bs, vps.cprms_present_flag[i], 1); |
| } |
| } |
| } |
| |
| // no extension flag |
| put_ui(bs, 0, 1); |
| } |
| |
| static void sps_rbsp(bitstream *bs) |
| { |
| uint32_t i = 0; |
| put_ui(bs, sps.sps_video_parameter_set_id, 4); |
| put_ui(bs, sps.sps_max_sub_layers_minus1, 3); |
| put_ui(bs, sps.sps_temporal_id_nesting_flag, 1); |
| |
| protier_rbsp(bs); |
| |
| put_ue(bs, sps.sps_seq_parameter_set_id); |
| put_ue(bs, sps.chroma_format_idc); |
| |
| if (sps.chroma_format_idc == 3) { |
| put_ui(bs, sps.separate_colour_plane_flag, 1); |
| |
| } |
| put_ue(bs, sps.pic_width_in_luma_samples); |
| put_ue(bs, sps.pic_height_in_luma_samples); |
| |
| put_ui(bs, sps.conformance_window_flag, 1); |
| |
| if (sps.conformance_window_flag) { |
| put_ue(bs, sps.conf_win_left_offset); |
| put_ue(bs, sps.conf_win_right_offset); |
| put_ue(bs, sps.conf_win_top_offset); |
| put_ue(bs, sps.conf_win_bottom_offset); |
| } |
| put_ue(bs, sps.bit_depth_luma_minus8); |
| put_ue(bs, sps.bit_depth_chroma_minus8); |
| put_ue(bs, sps.log2_max_pic_order_cnt_lsb_minus4); |
| put_ui(bs, sps.sps_sub_layer_ordering_info_present_flag, 1); |
| |
| for (i = (sps.sps_sub_layer_ordering_info_present_flag ? 0 : sps.sps_max_sub_layers_minus1); i <= sps.sps_max_sub_layers_minus1; i++) { |
| // NOTE: In teddi and mv_encoder, the setting is max_dec_pic_buffering. |
| // here just follow the spec 7.3.2.2 |
| put_ue(bs, sps.sps_max_dec_pic_buffering_minus1[i]); |
| put_ue(bs, sps.sps_max_num_reorder_pics[i]); |
| put_ue(bs, sps.sps_max_latency_increase_plus1[i]); |
| } |
| |
| put_ue(bs, sps.log2_min_luma_coding_block_size_minus3); |
| put_ue(bs, sps.log2_diff_max_min_luma_coding_block_size); |
| put_ue(bs, sps.log2_min_luma_transform_block_size_minus2); |
| put_ue(bs, sps.log2_diff_max_min_luma_transform_block_size); |
| put_ue(bs, sps.max_transform_hierarchy_depth_inter); |
| put_ue(bs, sps.max_transform_hierarchy_depth_intra); |
| |
| // scaling_list_enabled_flag is set as 0 in fill_sps_header() for now |
| put_ui(bs, sps.scaling_list_enabled_flag, 1); |
| if (sps.scaling_list_enabled_flag) { |
| put_ui(bs, sps.sps_scaling_list_data_present_flag, 1); |
| if (sps.sps_scaling_list_data_present_flag) { |
| //scaling_list_data(); |
| } |
| } |
| |
| put_ui(bs, sps.amp_enabled_flag, 1); |
| put_ui(bs, sps.sample_adaptive_offset_enabled_flag, 1); |
| |
| // pcm_enabled_flag is set as 0 in fill_sps_header() for now |
| put_ui(bs, sps.pcm_enabled_flag, 1); |
| if (sps.pcm_enabled_flag) { |
| put_ui(bs, sps.pcm_sample_bit_depth_luma_minus1, 4); |
| put_ui(bs, sps.pcm_sample_bit_depth_chroma_minus1, 4); |
| put_ue(bs, sps.log2_min_pcm_luma_coding_block_size_minus3); |
| put_ue(bs, sps.log2_diff_max_min_pcm_luma_coding_block_size); |
| put_ui(bs, sps.pcm_loop_filter_disabled_flag, 1); |
| } |
| |
| put_ue(bs, sps.num_short_term_ref_pic_sets); |
| for (i = 0; i < sps.num_short_term_ref_pic_sets; i++) { |
| pack_short_term_ref_pic_setp(bs, &sps.strp[i], i == 0); |
| } |
| |
| // long_term_ref_pics_present_flag is set as 0 in fill_sps_header() for now |
| put_ui(bs, sps.long_term_ref_pics_present_flag, 1); |
| if (sps.long_term_ref_pics_present_flag) { |
| put_ue(bs, sps.num_long_term_ref_pics_sps); |
| for (i = 0; i < sps.num_long_term_ref_pics_sps; i++) { |
| put_ue(bs, sps.lt_ref_pic_poc_lsb_sps[i]); |
| put_ui(bs, sps.used_by_curr_pic_lt_sps_flag[i], 1); |
| } |
| } |
| |
| put_ui(bs, sps.sps_temporal_mvp_enabled_flag, 1); |
| put_ui(bs, sps.strong_intra_smoothing_enabled_flag, 1); |
| |
| // vui_parameters_present_flag is set as 0 in fill_sps_header() for now |
| put_ui(bs, sps.vui_parameters_present_flag, 1); |
| |
| put_ui(bs, sps.sps_extension_present_flag, 1); |
| } |
| |
| static void pps_rbsp(bitstream *bs) |
| { |
| uint32_t i = 0; |
| put_ue(bs, pps.pps_pic_parameter_set_id); |
| put_ue(bs, pps.pps_seq_parameter_set_id); |
| put_ui(bs, pps.dependent_slice_segments_enabled_flag, 1); |
| put_ui(bs, pps.output_flag_present_flag, 1); |
| put_ui(bs, pps.num_extra_slice_header_bits, 3); |
| put_ui(bs, pps.sign_data_hiding_enabled_flag, 1); |
| put_ui(bs, pps.cabac_init_present_flag, 1); |
| |
| put_ue(bs, pps.num_ref_idx_l0_default_active_minus1); |
| put_ue(bs, pps.num_ref_idx_l1_default_active_minus1); |
| put_se(bs, pps.init_qp_minus26); |
| |
| put_ui(bs, pps.constrained_intra_pred_flag, 1); |
| put_ui(bs, pps.transform_skip_enabled_flag, 1); |
| |
| put_ui(bs, pps.cu_qp_delta_enabled_flag, 1); |
| if (pps.cu_qp_delta_enabled_flag) { |
| put_ue(bs, pps.diff_cu_qp_delta_depth); |
| } |
| |
| put_se(bs, pps.pps_cb_qp_offset); |
| put_se(bs, pps.pps_cr_qp_offset); |
| |
| put_ui(bs, pps.pps_slice_chroma_qp_offsets_present_flag, 1); |
| put_ui(bs, pps.weighted_pred_flag, 1); |
| put_ui(bs, pps.weighted_bipred_flag, 1); |
| put_ui(bs, pps.transquant_bypass_enabled_flag, 1); |
| put_ui(bs, pps.tiles_enabled_flag, 1); |
| put_ui(bs, pps.entropy_coding_sync_enabled_flag, 1); |
| |
| if (pps.tiles_enabled_flag) { |
| put_ue(bs, pps.num_tile_columns_minus1); |
| put_ue(bs, pps.num_tile_rows_minus1); |
| put_ui(bs, pps.uniform_spacing_flag, 1); |
| if (!pps.uniform_spacing_flag) { |
| for (i = 0; i < pps.num_tile_columns_minus1; i++) { |
| put_ue(bs, pps.column_width_minus1[i]); |
| } |
| |
| for (i = 0; i < pps.num_tile_rows_minus1; i++) { |
| put_ue(bs, pps.row_height_minus1[i]); |
| } |
| |
| } |
| put_ui(bs, pps.loop_filter_across_tiles_enabled_flag, 1); |
| } |
| |
| put_ui(bs, pps.pps_loop_filter_across_slices_enabled_flag, 1); |
| put_ui(bs, pps.deblocking_filter_control_present_flag, 1); |
| if (pps.deblocking_filter_control_present_flag) { |
| put_ui(bs, pps.deblocking_filter_override_enabled_flag, 1); |
| put_ui(bs, pps.pps_deblocking_filter_disabled_flag, 1); |
| if (!pps.pps_deblocking_filter_disabled_flag) { |
| put_se(bs, pps.pps_beta_offset_div2); |
| put_se(bs, pps.pps_tc_offset_div2); |
| } |
| } |
| |
| // pps_scaling_list_data_present_flag is set as 0 in fill_pps_header() for now |
| put_ui(bs, pps.pps_scaling_list_data_present_flag, 1); |
| if (pps.pps_scaling_list_data_present_flag) { |
| //scaling_list_data(); |
| } |
| |
| put_ui(bs, pps.lists_modification_present_flag, 1); |
| put_ue(bs, pps.log2_parallel_merge_level_minus2); |
| put_ui(bs, pps.slice_segment_header_extension_present_flag, 1); |
| |
| put_ui(bs, pps.pps_extension_present_flag, 1); |
| if (pps.pps_extension_present_flag) { |
| put_ui(bs, pps.pps_range_extension_flag, 1); |
| put_ui(bs, pps.pps_multilayer_extension_flag, 1); |
| put_ui(bs, pps.pps_3d_extension_flag, 1); |
| put_ui(bs, pps.pps_extension_5bits, 1); |
| |
| } |
| |
| if (pps.pps_range_extension_flag) { |
| if (pps.transform_skip_enabled_flag) |
| put_ue(bs, pps.log2_max_transform_skip_block_size_minus2); |
| put_ui(bs, pps.cross_component_prediction_enabled_flag, 1); |
| put_ui(bs, pps.chroma_qp_offset_list_enabled_flag, 1); |
| |
| if (pps.chroma_qp_offset_list_enabled_flag) { |
| put_ue(bs, pps.diff_cu_chroma_qp_offset_depth); |
| put_ue(bs, pps.chroma_qp_offset_list_len_minus1); |
| for (i = 0; i <= pps.chroma_qp_offset_list_len_minus1; i++) { |
| put_ue(bs, pps.cb_qp_offset_list[i]); |
| put_ue(bs, pps.cr_qp_offset_list[i]); |
| } |
| } |
| |
| put_ue(bs, pps.log2_sao_offset_scale_luma); |
| put_ue(bs, pps.log2_sao_offset_scale_chroma); |
| } |
| |
| } |
| static void sliceHeader_rbsp( |
| bitstream *bs, |
| struct SliceHeader *slice_header, |
| struct SeqParamSet *sps, |
| struct PicParamSet *pps, |
| int isidr) |
| { |
| uint8_t nal_unit_type = NALU_TRAIL_R; |
| int gop_ref_distance = ip_period; |
| int incomplete_mini_gop = 0; |
| int p_slice_flag = 1; |
| int i = 0; |
| |
| put_ui(bs, slice_header->first_slice_segment_in_pic_flag, 1); |
| if (slice_header->pic_order_cnt_lsb == 0) |
| nal_unit_type = NALU_IDR_W_DLP; |
| |
| if (nal_unit_type >= 16 && nal_unit_type <= 23) |
| put_ui(bs, slice_header->no_output_of_prior_pics_flag, 1); |
| |
| put_ue(bs, slice_header->slice_pic_parameter_set_id); |
| |
| if (!slice_header->first_slice_segment_in_pic_flag) { |
| if (slice_header->dependent_slice_segment_flag) { |
| put_ui(bs, slice_header->dependent_slice_segment_flag, 1); |
| } |
| |
| put_ui(bs, slice_header->slice_segment_address, |
| (uint8_t)(ceil(log(slice_header->picture_height_in_ctus * slice_header->picture_width_in_ctus) / log(2.0)))); |
| } |
| if (!slice_header->dependent_slice_segment_flag) { |
| for (i = 0; i < pps->num_extra_slice_header_bits; i++) { |
| put_ui(bs, slice_header->slice_reserved_undetermined_flag[i], 1); |
| } |
| put_ue(bs, slice_header->slice_type); |
| if (pps->output_flag_present_flag) { |
| put_ui(bs, slice_header->pic_output_flag, 1); |
| } |
| if (sps->separate_colour_plane_flag == 1) { |
| put_ui(bs, slice_header->colour_plane_id, 2); |
| } |
| |
| if (!(nal_unit_type == NALU_IDR_W_DLP || nal_unit_type == NALU_IDR_N_LP)) { |
| put_ui(bs, slice_header->pic_order_cnt_lsb, (sps->log2_max_pic_order_cnt_lsb_minus4 + 4)); |
| put_ui(bs, slice_header->short_term_ref_pic_set_sps_flag, 1); |
| |
| if (!slice_header->short_term_ref_pic_set_sps_flag) { |
| // refer to Teddi |
| if (sps->num_short_term_ref_pic_sets > 0) |
| put_ui(bs, 0, 1); // inter_ref_pic_set_prediction_flag, always 0 for now |
| |
| put_ue(bs, slice_header->strp.num_negative_pics); |
| put_ue(bs, slice_header->strp.num_positive_pics); |
| |
| // below chunks of codes (majorly two big 'for' blocks) are refering both |
| // Teddi and mv_encoder, they look kind of ugly, however, keep them as these |
| // since it will be pretty easy to update if change/update in Teddi side. |
| // According to Teddi, these are CModel Implementation. |
| int prev = 0; |
| int frame_cnt_in_gop = slice_header->pic_order_cnt_lsb / 2; |
| // this is the first big 'for' block |
| for (i = 0; i < slice_header->strp.num_negative_pics; i++) { |
| // Low Delay B case |
| if (1 == gop_ref_distance) { |
| put_ue(bs, 0 /*delta_poc_s0_minus1*/); |
| } else { |
| if (incomplete_mini_gop) { |
| if (frame_cnt_in_gop % gop_ref_distance > i) { |
| put_ue(bs, 0 /*delta_poc_s0_minus1*/); |
| } else { |
| int DeltaPoc = -(int)(gop_ref_distance); |
| put_ue(bs, prev - DeltaPoc - 1 /*delta_poc_s0_minus1*/); |
| } |
| } else { |
| // For Non-BPyramid GOP i.e B0 type |
| if (num_active_ref_p > 1) { |
| // MultiRef Case |
| if (p_slice_flag) { |
| // DeltaPOC Equals NumB |
| int DeltaPoc = -(int)(gop_ref_distance); |
| put_ue(bs, prev - DeltaPoc - 1 /*delta_poc_s0_minus1*/); |
| } else { |
| // for normal B |
| if (frame_cnt_in_gop < gop_ref_distance) { |
| if (0 == i) { |
| int DeltaPoc = -(int)(frame_cnt_in_gop); |
| put_ue(bs, prev - DeltaPoc - 1 /*delta_poc_s0_minus1*/); |
| } |
| } else if (frame_cnt_in_gop > gop_ref_distance) { |
| if (0 == i) { |
| //Need % to wraparound the delta poc, to avoid corruption caused on POC=5 with GOP (29,2) and 4 refs |
| int DeltaPoc = -(int)((frame_cnt_in_gop - gop_ref_distance) % gop_ref_distance); |
| put_ue(bs, prev - DeltaPoc - 1 /*delta_poc_s0_minus1*/); |
| } else if (1 <= i) { |
| int DeltaPoc = -(int)(gop_ref_distance); |
| put_ue(bs, prev - DeltaPoc - 1 /*delta_poc_s0_minus1*/); |
| } |
| } |
| } |
| } else { |
| // the big 'if' wraps here is - |
| // if (!slice_header->short_term_ref_pic_set_sps_flag) |
| // From the Teddi logic, the short_term_ref_pic_set_sps_flag only can be '0' |
| // either for B-Prymid or first several frames in a GOP in multi-ref cases |
| // when there are not enough backward refs. |
| // So though there are really some codes under this 'else'in Teddi, don't |
| // want to introduce them in MEA to avoid confusion, and put an assert |
| // here to guard that there is new case we need handle in the future. |
| assert(0); |
| |
| } |
| } |
| } |
| put_ui(bs, 1 /*used_by_curr_pic_s0_flag*/, 1); |
| } |
| |
| prev = 0; |
| // this is the second big 'for' block |
| for (i = 0; i < slice_header->strp.num_positive_pics; i++) { |
| // Non-BPyramid GOP |
| if (num_active_ref_p > 1) { |
| // MultiRef Case |
| if (frame_cnt_in_gop < gop_ref_distance) { |
| int DeltaPoc = (int)(gop_ref_distance - frame_cnt_in_gop); |
| put_ue(bs, DeltaPoc - prev - 1 /*delta_poc_s1_minus1*/); |
| } else if (frame_cnt_in_gop > gop_ref_distance) { |
| int DeltaPoc = (int)(gop_ref_distance * slice_header->strp.num_negative_pics - frame_cnt_in_gop); |
| put_ue(bs, DeltaPoc - prev - 1 /*delta_poc_s1_minus1*/); |
| } |
| } else { |
| // the big 'if' wraps here is - |
| // if (!slice_header->short_term_ref_pic_set_sps_flag) |
| // From the Teddi logic, the short_term_ref_pic_set_sps_flag only can be '0' |
| // either for B-Prymid or first several frames in a GOP in multi-ref cases |
| // when there are not enough backward refs. |
| // So though there are really some codes under this 'else'in Teddi, don't |
| // want to introduce them in MEA to avoid confusion, and put an assert |
| // here to guard that there is new case we need handle in the future. |
| assert(0); |
| } |
| put_ui(bs, 1 /*used_by_curr_pic_s1_flag*/, 1); |
| } |
| } else if (sps->num_short_term_ref_pic_sets > 1) |
| put_ui(bs, slice_header->short_term_ref_pic_set_idx, |
| (uint8_t)(ceil(log(sps->num_short_term_ref_pic_sets) / log(2.0)))); |
| |
| if (sps->long_term_ref_pics_present_flag) { |
| if (sps->num_long_term_ref_pics_sps > 0) |
| put_ue(bs, slice_header->num_long_term_sps); |
| |
| put_ue(bs, slice_header->num_long_term_pics); |
| } |
| |
| if (slice_header->slice_temporal_mvp_enabled_flag) |
| put_ui(bs, slice_header->slice_temporal_mvp_enabled_flag, 1); |
| |
| } |
| |
| if (sps->sample_adaptive_offset_enabled_flag) { |
| put_ui(bs, slice_header->slice_sao_luma_flag, 1); |
| put_ui(bs, slice_header->slice_sao_chroma_flag, 1); |
| } |
| |
| if (slice_header->slice_type != SLICE_I) { |
| put_ui(bs, slice_header->num_ref_idx_active_override_flag, 1); |
| |
| if (slice_header->num_ref_idx_active_override_flag) { |
| put_ue(bs, slice_header->num_ref_idx_l0_active_minus1); |
| if (slice_header->slice_type == SLICE_B) |
| put_ue(bs, slice_header->num_ref_idx_l1_active_minus1); |
| } |
| |
| if (pps->lists_modification_present_flag && slice_header->num_poc_total_cur > 1) { |
| /* ref_pic_list_modification */ |
| put_ui(bs, slice_header->ref_pic_list_modification_flag_l0, 1); |
| |
| if (slice_header->ref_pic_list_modification_flag_l0) { |
| for (i = 0; i <= slice_header->num_ref_idx_l0_active_minus1; i++) { |
| put_ui(bs, slice_header->list_entry_l0[i], |
| (uint8_t)(ceil(log(slice_header->num_poc_total_cur) / log(2.0)))); |
| } |
| } |
| |
| put_ui(bs, slice_header->ref_pic_list_modification_flag_l1, 1); |
| |
| if (slice_header->ref_pic_list_modification_flag_l1) { |
| for (i = 0; i <= slice_header->num_ref_idx_l1_active_minus1; i++) { |
| put_ui(bs, slice_header->list_entry_l1[i], |
| (uint8_t)(ceil(log(slice_header->num_poc_total_cur) / log(2.0)))); |
| } |
| } |
| } |
| |
| if (slice_header->slice_type == SLICE_B) { |
| put_ui(bs, slice_header->mvd_l1_zero_flag, 1); |
| } |
| |
| if (pps->cabac_init_present_flag) { |
| put_ui(bs, slice_header->cabac_init_present_flag, 1); |
| } |
| |
| if (slice_header->slice_temporal_mvp_enabled_flag) { |
| int collocated_from_l0_flag = 1; |
| |
| if (slice_header->slice_type == SLICE_B) { |
| collocated_from_l0_flag = slice_header->collocated_from_l0_flag; |
| put_ui(bs, slice_header->collocated_from_l0_flag, 1); |
| } |
| |
| if (((collocated_from_l0_flag && (slice_header->num_ref_idx_l0_active_minus1 > 0)) || |
| (!collocated_from_l0_flag && (slice_header->num_ref_idx_l1_active_minus1 > 0)))) { |
| put_ue(bs, slice_header->collocated_ref_idx); |
| } |
| } |
| |
| put_ue(bs, slice_header->five_minus_max_num_merge_cand); |
| } |
| |
| put_se(bs, slice_header->slice_qp_delta); |
| |
| if (pps->chroma_qp_offset_list_enabled_flag) { |
| put_se(bs, slice_header->slice_qp_delta_cb); |
| put_se(bs, slice_header->slice_qp_delta_cr); |
| } |
| |
| if (pps->deblocking_filter_override_enabled_flag) { |
| put_ui(bs, slice_header->deblocking_filter_override_flag, 1); |
| } |
| if (slice_header->deblocking_filter_override_flag) { |
| put_ui(bs, slice_header->disable_deblocking_filter_flag, 1); |
| |
| if (!slice_header->disable_deblocking_filter_flag) { |
| put_se(bs, slice_header->beta_offset_div2); |
| put_se(bs, slice_header->tc_offset_div2); |
| } |
| } |
| |
| if (pps->pps_loop_filter_across_slices_enabled_flag && |
| (slice_header->slice_sao_luma_flag || slice_header->slice_sao_chroma_flag || |
| !slice_header->disable_deblocking_filter_flag)) { |
| put_ui(bs, slice_header->slice_loop_filter_across_slices_enabled_flag, 1); |
| } |
| |
| } |
| |
| if ((pps->tiles_enabled_flag) || (pps->entropy_coding_sync_enabled_flag)) { |
| put_ue(bs, slice_header->num_entry_point_offsets); |
| |
| if (slice_header->num_entry_point_offsets > 0) { |
| put_ue(bs, slice_header->offset_len_minus1); |
| } |
| } |
| |
| if (pps->slice_segment_header_extension_present_flag) { |
| int slice_header_extension_length = 0; |
| |
| put_ue(bs, slice_header_extension_length); |
| |
| for (i = 0; i < slice_header_extension_length; i++) { |
| int slice_header_extension_data_byte = 0; |
| put_ui(bs, slice_header_extension_data_byte, 8); |
| } |
| } |
| } |
| |
| static int |
| build_packed_pic_buffer(unsigned char **header_buffer) |
| { |
| bitstream bs; |
| |
| bitstream_start(&bs); |
| nal_start_code_prefix(&bs, NALU_PPS); |
| nal_header(&bs, NALU_PPS); |
| pps_rbsp(&bs); |
| rbsp_trailing_bits(&bs); |
| bitstream_end(&bs); |
| |
| *header_buffer = (unsigned char *)bs.buffer; |
| return bs.bit_offset; |
| } |
| static int |
| build_packed_video_buffer(unsigned char **header_buffer) |
| { |
| bitstream bs; |
| |
| bitstream_start(&bs); |
| nal_start_code_prefix(&bs, NALU_VPS); |
| nal_header(&bs, NALU_VPS); |
| vps_rbsp(&bs); |
| rbsp_trailing_bits(&bs); |
| bitstream_end(&bs); |
| |
| *header_buffer = (unsigned char *)bs.buffer; |
| return bs.bit_offset; |
| } |
| |
| static int |
| build_packed_seq_buffer(unsigned char **header_buffer) |
| { |
| bitstream bs; |
| |
| bitstream_start(&bs); |
| nal_start_code_prefix(&bs, NALU_SPS); |
| nal_header(&bs, NALU_SPS); |
| sps_rbsp(&bs); |
| rbsp_trailing_bits(&bs); |
| bitstream_end(&bs); |
| |
| *header_buffer = (unsigned char *)bs.buffer; |
| return bs.bit_offset; |
| } |
| |
| static int build_packed_slice_buffer(unsigned char **header_buffer) |
| { |
| bitstream bs; |
| int is_idr = !!pic_param.pic_fields.bits.idr_pic_flag; |
| int naluType = is_idr ? NALU_IDR_W_DLP : NALU_TRAIL_R; |
| |
| bitstream_start(&bs); |
| nal_start_code_prefix(&bs, NALU_TRAIL_R); |
| nal_header(&bs, naluType); |
| sliceHeader_rbsp(&bs, &ssh, &sps, &pps, 0); |
| rbsp_trailing_bits(&bs); |
| bitstream_end(&bs); |
| |
| *header_buffer = (unsigned char *)bs.buffer; |
| return bs.bit_offset; |
| } |
| |
| |
| /* |
| * Helper function for profiling purposes |
| */ |
| static unsigned int GetTickCount() |
| { |
| struct timeval tv; |
| if (gettimeofday(&tv, NULL)) |
| return 0; |
| return tv.tv_usec / 1000 + tv.tv_sec * 1000; |
| } |
| |
| /* |
| Assume frame sequence is: Frame#0,#1,#2,...,#M,...,#X,... (encoding order) |
| 1) period between Frame #X and Frame #N = #X - #N |
| 2) 0 means infinite for intra_period/intra_idr_period, and 0 is invalid for ip_period |
| 3) intra_idr_period % intra_period (intra_period > 0) and (intra_period -1)% ip_period must be 0 |
| 4) intra_period and intra_idr_period take precedence over ip_period |
| 5) if ip_period > 1, intra_period and intra_idr_period are not the strict periods |
| of I/IDR frames, see bellow examples |
| ------------------------------------------------------------------- |
| intra_period intra_idr_period ip_period frame sequence (intra_period/intra_idr_period/ip_period) |
| 0 ignored 1 IDRPPPPPPP ... (No IDR/I any more) |
| 0 ignored >=2 IDR(PBB)(PBB)... (No IDR/I any more) |
| 1 0 ignored IDRIIIIIII... (No IDR any more) |
| 1 1 ignored IDR IDR IDR IDR... |
| 1 >=2 ignored IDRII IDRII IDR... (1/3/ignore) |
| >=2 0 1 IDRPPP IPPP I... (3/0/1) |
| >=2 0 >=2 IDR(PBB)(PBB)(IBB) (7/0/3) |
| (PBB)(IBB)(PBB)(IBB)... |
| >=2 >=2 1 IDRPPPPP IPPPPP IPPPPP (7/14/1) |
| IDRPPPPP IPPPPP IPPPPP... |
| >=2 >=2 >=2 {IDR(PBB)(PBB)(IBB)(PBB)(IBB)(PBB)} (7/14/3) |
| {IDR(PBB)(PBB)(IBB)(PBB)(IBB)(PBB)}... |
| {IDR(PBB)(PBB)(IBB)(PBB)} (7/14/3) |
| {IDR(PBB)(PBB)(IBB)(PBB)}... |
| {IDR(PBB)(PBB)} (7/7/3) |
| {IDR(PBB)(PBB)}. |
| */ |
| |
| /* |
| * Return displaying order with specified periods and encoding order |
| * displaying_order: displaying order |
| * frame_type: frame type |
| */ |
| void encoding2display_order( |
| unsigned long long encoding_order, int intra_period, |
| int intra_idr_period, int ip_period, |
| unsigned long long *displaying_order, |
| int *frame_type) |
| { |
| int encoding_order_gop = 0; |
| |
| if (intra_period == 1) { /* all are I/IDR frames */ |
| *displaying_order = encoding_order; |
| if (intra_idr_period == 0) |
| *frame_type = (encoding_order == 0) ? FRAME_IDR : FRAME_I; |
| else |
| *frame_type = (encoding_order % intra_idr_period == 0) ? FRAME_IDR : FRAME_I; |
| return; |
| } |
| |
| if (intra_period == 0) |
| intra_idr_period = 0; |
| |
| /* new sequence like |
| * IDR PPPPP IPPPPP |
| * IDR (PBB)(PBB)(IBB)(PBB) |
| */ |
| encoding_order_gop = (intra_idr_period == 0) ? encoding_order : |
| (encoding_order % (intra_idr_period + ((ip_period == 1) ? 0 : 1))); |
| |
| if (encoding_order_gop == 0) { /* the first frame */ |
| *frame_type = FRAME_IDR; |
| *displaying_order = encoding_order; |
| } else if (((encoding_order_gop - 1) % ip_period) != 0) { /* B frames */ |
| *frame_type = FRAME_B; |
| *displaying_order = encoding_order - 1; |
| } else if ((intra_period != 0) && /* have I frames */ |
| (encoding_order_gop >= 2) && |
| ((ip_period == 1 && encoding_order_gop % (intra_period - 1) == 0) || /* for IDR PPPPP IPPPP */ |
| /* for IDR (PBB)(PBB)(IBB) */ |
| (ip_period >= 2 && ((encoding_order_gop - 1) / ip_period % ((intra_period - 1) / ip_period)) == 0))) { |
| *frame_type = FRAME_I; |
| *displaying_order = encoding_order + ip_period - 1; |
| } else { |
| *frame_type = FRAME_P; |
| *displaying_order = encoding_order + ip_period - 1; |
| } |
| |
| |
| } |
| |
| |
| static char *fourcc_to_string(int fourcc) |
| { |
| switch (fourcc) { |
| case VA_FOURCC_NV12: |
| return "NV12"; |
| case VA_FOURCC_IYUV: |
| return "IYUV"; |
| case VA_FOURCC_YV12: |
| return "YV12"; |
| case VA_FOURCC_UYVY: |
| return "UYVY"; |
| default: |
| return "Unknown"; |
| } |
| } |
| |
| static int string_to_fourcc(char *str) |
| { |
| int fourcc; |
| |
| if (!strncmp(str, "NV12", 4)) |
| fourcc = VA_FOURCC_NV12; |
| else if (!strncmp(str, "IYUV", 4)) |
| fourcc = VA_FOURCC_IYUV; |
| else if (!strncmp(str, "YV12", 4)) |
| fourcc = VA_FOURCC_YV12; |
| else if (!strncmp(str, "UYVY", 4)) |
| fourcc = VA_FOURCC_UYVY; |
| else { |
| printf("Unknow FOURCC\n"); |
| fourcc = -1; |
| } |
| return fourcc; |
| } |
| |
| |
| static char *rc_to_string(int rcmode) |
| { |
| switch (rc_mode) { |
| case VA_RC_NONE: |
| return "NONE"; |
| case VA_RC_CBR: |
| return "CBR"; |
| case VA_RC_VBR: |
| return "VBR"; |
| case VA_RC_VCM: |
| return "VCM"; |
| case VA_RC_CQP: |
| return "CQP"; |
| case VA_RC_VBR_CONSTRAINED: |
| return "VBR_CONSTRAINED"; |
| default: |
| return "Unknown"; |
| } |
| } |
| |
| static int string_to_rc(char *str) |
| { |
| int rc_mode; |
| |
| if (!strncmp(str, "NONE", 4)) |
| rc_mode = VA_RC_NONE; |
| else if (!strncmp(str, "CBR", 3)) |
| rc_mode = VA_RC_CBR; |
| else if (!strncmp(str, "VBR", 3)) |
| rc_mode = VA_RC_VBR; |
| else if (!strncmp(str, "VCM", 3)) |
| rc_mode = VA_RC_VCM; |
| else if (!strncmp(str, "CQP", 3)) |
| rc_mode = VA_RC_CQP; |
| else if (!strncmp(str, "VBR_CONSTRAINED", 15)) |
| rc_mode = VA_RC_VBR_CONSTRAINED; |
| else { |
| printf("Unknown RC mode\n"); |
| rc_mode = -1; |
| } |
| return rc_mode; |
| } |
| |
| |
| static int print_help(void) |
| { |
| printf("./hevcencode <options>\n"); |
| printf(" -w <width> -h <height>\n"); |
| printf(" -framecount <frame number>\n"); |
| printf(" -n <frame number>\n"); |
| printf(" if set to 0 and srcyuv is set, the frame count is from srcuv file\n"); |
| printf(" -o <coded file>\n"); |
| printf(" -f <frame rate>\n"); |
| printf(" --intra_period <number>\n"); |
| printf(" --idr_period <number>\n"); |
| printf(" --ip_period <number>\n"); |
| printf(" --bitrate <bitrate>\n"); |
| printf(" --initialqp <number>\n"); |
| printf(" --minqp <number>\n"); |
| printf(" --rcmode <NONE|CBR|VBR|VCM|CQP|VBR_CONTRAINED>\n"); |
| printf(" --syncmode: sequentially upload source, encoding, save result, no multi-thread\n"); |
| printf(" --srcyuv <filename> load YUV from a file\n"); |
| printf(" --fourcc <NV12|IYUV|YV12> source YUV fourcc\n"); |
| printf(" --recyuv <filename> save reconstructed YUV into a file\n"); |
| printf(" --enablePSNR calculate PSNR of recyuv vs. srcyuv\n"); |
| printf(" --profile 1: main 2 : main10\n"); |
| printf(" --p2b 1: enable 0 : disalbe(defalut)\n"); |
| return 0; |
| } |
| |
| static int process_cmdline(int argc, char *argv[]) |
| { |
| int c; |
| const struct option long_opts[] = { |
| {"help", no_argument, NULL, 0 }, |
| {"bitrate", required_argument, NULL, 1 }, |
| {"minqp", required_argument, NULL, 2 }, |
| {"initialqp", required_argument, NULL, 3 }, |
| {"intra_period", required_argument, NULL, 4 }, |
| {"idr_period", required_argument, NULL, 5 }, |
| {"ip_period", required_argument, NULL, 6 }, |
| {"rcmode", required_argument, NULL, 7 }, |
| {"srcyuv", required_argument, NULL, 9 }, |
| {"recyuv", required_argument, NULL, 10 }, |
| {"fourcc", required_argument, NULL, 11 }, |
| {"syncmode", no_argument, NULL, 12 }, |
| {"enablePSNR", no_argument, NULL, 13 }, |
| {"prit", required_argument, NULL, 14 }, |
| {"priv", required_argument, NULL, 15 }, |
| {"framecount", required_argument, NULL, 16 }, |
| {"profile", required_argument, NULL, 17 }, |
| {"p2b", required_argument, NULL, 18 }, |
| {NULL, no_argument, NULL, 0 } |
| }; |
| int long_index; |
| |
| while ((c = getopt_long_only(argc, argv, "w:h:n:f:o:?", long_opts, &long_index)) != EOF) { |
| switch (c) { |
| case 'w': |
| frame_width = atoi(optarg); |
| break; |
| case 'h': |
| frame_height = atoi(optarg); |
| break; |
| case 'n': |
| case 16: |
| frame_count = atoi(optarg); |
| break; |
| case 'f': |
| frame_rate = atoi(optarg); |
| break; |
| case 'o': |
| coded_fn = strdup(optarg); |
| break; |
| case 0: |
| print_help(); |
| exit(0); |
| case 1: |
| frame_bitrate = atoi(optarg); |
| break; |
| case 2: |
| minimal_qp = atoi(optarg); |
| break; |
| case 3: |
| initial_qp = atoi(optarg); |
| break; |
| case 4: |
| intra_period = atoi(optarg); |
| break; |
| case 5: |
| intra_idr_period = atoi(optarg); |
| break; |
| case 6: |
| ip_period = atoi(optarg); |
| break; |
| case 7: |
| rc_mode = string_to_rc(optarg); |
| if (rc_mode < 0) { |
| print_help(); |
| exit(1); |
| } |
| break; |
| case 9: |
| srcyuv_fn = strdup(optarg); |
| break; |
| case 10: |
| recyuv_fn = strdup(optarg); |
| break; |
| case 11: |
| srcyuv_fourcc = string_to_fourcc(optarg); |
| if (srcyuv_fourcc <= 0) { |
| print_help(); |
| exit(1); |
| } |
| break; |
| case 12: |
| encode_syncmode = 1; |
| break; |
| case 13: |
| calc_psnr = 1; |
| break; |
| case 14: |
| misc_priv_type = strtol(optarg, NULL, 0); |
| break; |
| case 15: |
| misc_priv_value = strtol(optarg, NULL, 0); |
| break; |
| case 17: |
| if (strncmp(optarg, "1", 1) == 0) { |
| real_hevc_profile = 1; |
| hevc_profile = VAProfileHEVCMain; |
| } else if (strncmp(optarg, "2", 1) == 0) { |
| real_hevc_profile = 2; |
| hevc_profile = VAProfileHEVCMain10; |
| } else |
| hevc_profile = 0; |
| break; |
| case 18: |
| p2b = atoi(optarg); |
| break; |
| |
| case ':': |
| case '?': |
| print_help(); |
| exit(0); |
| } |
| } |
| |
| if (ip_period < 1) { |
| printf(" ip_period must be greater than 0\n"); |
| exit(0); |
| } |
| if (intra_period != 1 && (intra_period - 1) % ip_period != 0) { |
| printf(" intra_period -1 must be a multiplier of ip_period\n"); |
| exit(0); |
| } |
| if (intra_period != 0 && intra_idr_period % intra_period != 0) { |
| printf(" intra_idr_period must be a multiplier of intra_period\n"); |
| exit(0); |
| } |
| if (ip_period > 1) { |
| frame_count -= (frame_count - 1) % ip_period; |
| } |
| |
| if (frame_bitrate == 0) |
| frame_bitrate = (long long int) frame_width * frame_height * 12 * frame_rate / 50; |
| |
| /* open source file */ |
| if (srcyuv_fn) { |
| srcyuv_fp = fopen(srcyuv_fn, "r"); |
| |
| if (srcyuv_fp == NULL) |
| printf("Open source YUV file %s failed, use auto-generated YUV data\n", srcyuv_fn); |
| else { |
| struct stat tmp; |
| |
| fstat(fileno(srcyuv_fp), &tmp); |
| srcyuv_frames = tmp.st_size / (frame_width * frame_height * 1.5); |
| printf("Source YUV file %s with %llu frames\n", srcyuv_fn, srcyuv_frames); |
| |
| if (frame_count == 0) |
| frame_count = srcyuv_frames; |
| } |
| } |
| |
| /* open source file */ |
| if (recyuv_fn) { |
| recyuv_fp = fopen(recyuv_fn, "w+"); |
| |
| if (recyuv_fp == NULL) |
| printf("Open reconstructed YUV file %s failed\n", recyuv_fn); |
| } |
| |
| if (coded_fn == NULL) { |
| struct stat buf; |
| if (stat("/tmp", &buf) == 0) |
| coded_fn = strdup("/tmp/test.265"); |
| else if (stat("/sdcard", &buf) == 0) |
| coded_fn = strdup("/sdcard/test.265"); |
| else |
| coded_fn = strdup("./test.265"); |
| } |
| |
| /* store coded data into a file */ |
| if (coded_fn) { |
| coded_fp = fopen(coded_fn, "w+"); |
| } else { |
| printf("Copy file string failed"); |
| exit(1); |
| } |
| if (coded_fp == NULL) { |
| printf("Open file %s failed, exit\n", coded_fn); |
| exit(1); |
| } |
| |
| frame_width_aligned = (frame_width + 63) & (~63); |
| frame_height_aligned = (frame_height + 63) & (~63); |
| if (frame_width != frame_width_aligned || |
| frame_height != frame_height_aligned) { |
| printf("Source frame is %dx%d and will code clip to %dx%d with crop\n", |
| frame_width, frame_height, |
| frame_width_aligned, frame_height_aligned |
| ); |
| } |
| |
| return 0; |
| } |
| |
| static int init_va(void) |
| { |
| VAProfile profile_list[] = {VAProfileHEVCMain, VAProfileHEVCMain10}; |
| VAEntrypoint *entrypoints; |
| int num_entrypoints, slice_entrypoint; |
| int support_encode = 0; |
| int major_ver, minor_ver; |
| VAStatus va_status; |
| unsigned int i; |
| |
| va_dpy = va_open_display(); |
| va_status = vaInitialize(va_dpy, &major_ver, &minor_ver); |
| CHECK_VASTATUS(va_status, "vaInitialize"); |
| |
| num_entrypoints = vaMaxNumEntrypoints(va_dpy); |
| entrypoints = malloc(num_entrypoints * sizeof(*entrypoints)); |
| if (!entrypoints) { |
| fprintf(stderr, "error: failed to initialize VA entrypoints array\n"); |
| exit(1); |
| } |
| |
| /* use the highest profile */ |
| for (i = 0; i < sizeof(profile_list) / sizeof(profile_list[0]); i++) { |
| if ((hevc_profile != ~0) && hevc_profile != profile_list[i]) |
| continue; |
| |
| hevc_profile = profile_list[i]; |
| vaQueryConfigEntrypoints(va_dpy, hevc_profile, entrypoints, &num_entrypoints); |
| for (slice_entrypoint = 0; slice_entrypoint < num_entrypoints; slice_entrypoint++) { |
| if (entrypoints[slice_entrypoint] == VAEntrypointEncSlice) { |
| support_encode = 1; |
| break; |
| } |
| } |
| if (support_encode == 1) |
| break; |
| } |
| |
| if (support_encode == 0) { |
| printf("Can't find VAEntrypointEncSlice for HEVC profiles\n"); |
| exit(1); |
| } else { |
| switch (hevc_profile) { |
| case VAProfileHEVCMain: |
| hevc_profile = VAProfileHEVCMain; |
| printf("Use profile VAProfileHEVCMain\n"); |
| break; |
| |
| case VAProfileHEVCMain10: |
| hevc_profile = VAProfileHEVCMain10; |
| printf("Use profile VAProfileHEVCMain10\n"); |
| break; |
| default: |
| printf("unknow profile. Set to Main"); |
| hevc_profile = VAProfileHEVCMain; |
| constraint_set_flag |= (1 << 0 | 1 << 1); /* Annex A.2.1 & A.2.2 */ |
| ip_period = 1; |
| break; |
| } |
| } |
| |
| /* find out the format for the render target, and rate control mode */ |
| for (i = 0; i < VAConfigAttribTypeMax; i++) |
| attrib[i].type = i; |
| |
| va_status = vaGetConfigAttributes(va_dpy, hevc_profile, VAEntrypointEncSlice, |
| &attrib[0], VAConfigAttribTypeMax); |
| CHECK_VASTATUS(va_status, "vaGetConfigAttributes"); |
| /* check the interested configattrib */ |
| if ((attrib[VAConfigAttribRTFormat].value & VA_RT_FORMAT_YUV420) == 0) { |
| printf("Not find desired YUV420 RT format\n"); |
| exit(1); |
| } else { |
| config_attrib[config_attrib_num].type = VAConfigAttribRTFormat; |
| config_attrib[config_attrib_num].value = VA_RT_FORMAT_YUV420; |
| config_attrib_num++; |
| } |
| |
| if (attrib[VAConfigAttribRateControl].value != VA_ATTRIB_NOT_SUPPORTED) { |
| int tmp = attrib[VAConfigAttribRateControl].value; |
| |
| printf("Support rate control mode (0x%x):", tmp); |
| |
| if (tmp & VA_RC_NONE) |
| printf("NONE "); |
| if (tmp & VA_RC_CBR) |
| printf("CBR "); |
| if (tmp & VA_RC_VBR) |
| printf("VBR "); |
| if (tmp & VA_RC_VCM) |
| printf("VCM "); |
| if (tmp & VA_RC_CQP) |
| printf("CQP "); |
| if (tmp & VA_RC_VBR_CONSTRAINED) |
| printf("VBR_CONSTRAINED "); |
| |
| printf("\n"); |
| |
| if (rc_mode == -1 || !(rc_mode & tmp)) { |
| if (rc_mode != -1) { |
| printf("Warning: Don't support the specified RateControl mode: %s!!!, switch to ", rc_to_string(rc_mode)); |
| } |
| |
| for (i = 0; i < sizeof(rc_default_modes) / sizeof(rc_default_modes[0]); i++) { |
| if (rc_default_modes[i] & tmp) { |
| rc_mode = rc_default_modes[i]; |
| break; |
| } |
| } |
| |
| printf("RateControl mode: %s\n", rc_to_string(rc_mode)); |
| } |
| |
| config_attrib[config_attrib_num].type = VAConfigAttribRateControl; |
| config_attrib[config_attrib_num].value = rc_mode; |
| config_attrib_num++; |
| } |
| |
| |
| if (attrib[VAConfigAttribEncPackedHeaders].value != VA_ATTRIB_NOT_SUPPORTED) { |
| int tmp = attrib[VAConfigAttribEncPackedHeaders].value; |
| |
| printf("Support VAConfigAttribEncPackedHeaders\n"); |
| |
| hevc_packedheader = 1; |
| config_attrib[config_attrib_num].type = VAConfigAttribEncPackedHeaders; |
| config_attrib[config_attrib_num].value = VA_ENC_PACKED_HEADER_NONE; |
| |
| if (tmp & VA_ENC_PACKED_HEADER_SEQUENCE) { |
| printf("Support packed sequence headers\n"); |
| config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_SEQUENCE; |
| } |
| |
| if (tmp & VA_ENC_PACKED_HEADER_PICTURE) { |
| printf("Support packed picture headers\n"); |
| config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_PICTURE; |
| } |
| |
| if (tmp & VA_ENC_PACKED_HEADER_SLICE) { |
| printf("Support packed slice headers\n"); |
| config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_SLICE; |
| } |
| |
| if (tmp & VA_ENC_PACKED_HEADER_MISC) { |
| printf("Support packed misc headers\n"); |
| config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_MISC; |
| } |
| |
| enc_packed_header_idx = config_attrib_num; |
| config_attrib_num++; |
| } |
| |
| if (attrib[VAConfigAttribEncInterlaced].value != VA_ATTRIB_NOT_SUPPORTED) { |
| int tmp = attrib[VAConfigAttribEncInterlaced].value; |
| |
| printf("Support VAConfigAttribEncInterlaced\n"); |
| |
| if (tmp & VA_ENC_INTERLACED_FRAME) |
| printf("support VA_ENC_INTERLACED_FRAME\n"); |
| if (tmp & VA_ENC_INTERLACED_FIELD) |
| printf("Support VA_ENC_INTERLACED_FIELD\n"); |
| if (tmp & VA_ENC_INTERLACED_MBAFF) |
| printf("Support VA_ENC_INTERLACED_MBAFF\n"); |
| if (tmp & VA_ENC_INTERLACED_PAFF) |
| printf("Support VA_ENC_INTERLACED_PAFF\n"); |
| |
| config_attrib[config_attrib_num].type = VAConfigAttribEncInterlaced; |
| config_attrib[config_attrib_num].value = VA_ENC_PACKED_HEADER_NONE; |
| config_attrib_num++; |
| } |
| |
| if (attrib[VAConfigAttribEncMaxRefFrames].value != VA_ATTRIB_NOT_SUPPORTED) { |
| hevc_maxref = attrib[VAConfigAttribEncMaxRefFrames].value; |
| |
| printf("Support %d RefPicList0 and %d RefPicList1\n", |
| hevc_maxref & 0xffff, (hevc_maxref >> 16) & 0xffff); |
| } |
| |
| if (attrib[VAConfigAttribEncMaxSlices].value != VA_ATTRIB_NOT_SUPPORTED) |
| printf("Support %d slices\n", attrib[VAConfigAttribEncMaxSlices].value); |
| |
| if (attrib[VAConfigAttribEncSliceStructure].value != VA_ATTRIB_NOT_SUPPORTED) { |
| int tmp = attrib[VAConfigAttribEncSliceStructure].value; |
| |
| printf("Support VAConfigAttribEncSliceStructure\n"); |
| |
| if (tmp & VA_ENC_SLICE_STRUCTURE_ARBITRARY_ROWS) |
| printf("Support VA_ENC_SLICE_STRUCTURE_ARBITRARY_ROWS\n"); |
| if (tmp & VA_ENC_SLICE_STRUCTURE_POWER_OF_TWO_ROWS) |
| printf("Support VA_ENC_SLICE_STRUCTURE_POWER_OF_TWO_ROWS\n"); |
| if (tmp & VA_ENC_SLICE_STRUCTURE_ARBITRARY_MACROBLOCKS) |
| printf("Support VA_ENC_SLICE_STRUCTURE_ARBITRARY_MACROBLOCKS\n"); |
| } |
| if (attrib[VAConfigAttribEncMacroblockInfo].value != VA_ATTRIB_NOT_SUPPORTED) { |
| printf("Support VAConfigAttribEncMacroblockInfo\n"); |
| } |
| |
| free(entrypoints); |
| return 0; |
| } |
| |
| static int setup_encode() |
| { |
| VAStatus va_status; |
| VASurfaceID *tmp_surfaceid; |
| int codedbuf_size, i; |
| |
| va_status = vaCreateConfig(va_dpy, hevc_profile, VAEntrypointEncSlice, |
| &config_attrib[0], config_attrib_num, &config_id); |
| CHECK_VASTATUS(va_status, "vaCreateConfig"); |
| |
| /* create source surfaces */ |
| va_status = vaCreateSurfaces(va_dpy, |
| VA_RT_FORMAT_YUV420, frame_width_aligned, frame_height_aligned, |
| &src_surface[0], SURFACE_NUM, |
| NULL, 0); |
| CHECK_VASTATUS(va_status, "vaCreateSurfaces"); |
| |
| /* create reference surfaces */ |
| va_status = vaCreateSurfaces( |
| va_dpy, |
| VA_RT_FORMAT_YUV420, frame_width_aligned, frame_height_aligned, |
| &ref_surface[0], SURFACE_NUM, |
| NULL, 0 |
| ); |
| CHECK_VASTATUS(va_status, "vaCreateSurfaces"); |
| |
| tmp_surfaceid = calloc(2 * SURFACE_NUM, sizeof(VASurfaceID)); |
| if (tmp_surfaceid) { |
| memcpy(tmp_surfaceid, src_surface, SURFACE_NUM * sizeof(VASurfaceID)); |
| memcpy(tmp_surfaceid + SURFACE_NUM, ref_surface, SURFACE_NUM * sizeof(VASurfaceID)); |
| } |
| |
| /* Create a context for this encode pipe */ |
| va_status = vaCreateContext(va_dpy, config_id, |
| frame_width_aligned, frame_height_aligned, |
| VA_PROGRESSIVE, |
| tmp_surfaceid, 2 * SURFACE_NUM, |
| &context_id); |
| CHECK_VASTATUS(va_status, "vaCreateContext"); |
| free(tmp_surfaceid); |
| |
| codedbuf_size = ((long long int) frame_width_aligned * frame_height_aligned * 400) / (16 * 16); |
| |
| for (i = 0; i < SURFACE_NUM; i++) { |
| /* create coded buffer once for all |
| * other VA buffers which won't be used again after vaRenderPicture. |
| * so APP can always vaCreateBuffer for every frame |
| * but coded buffer need to be mapped and accessed after vaRenderPicture/vaEndPicture |
| * so VA won't maintain the coded buffer |
| */ |
| va_status = vaCreateBuffer(va_dpy, context_id, VAEncCodedBufferType, |
| codedbuf_size, 1, NULL, &coded_buf[i]); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| } |
| |
| return 0; |
| } |
| |
| |
| |
| #define partition(ref, field, key, ascending) \ |
| while (i <= j) { \ |
| if (ascending) { \ |
| while (ref[i].field < key) \ |
| i++; \ |
| while (ref[j].field > key) \ |
| j--; \ |
| } else { \ |
| while (ref[i].field > key) \ |
| i++; \ |
| while (ref[j].field < key) \ |
| j--; \ |
| } \ |
| if (i <= j) { \ |
| tmp = ref[i]; \ |
| ref[i] = ref[j]; \ |
| ref[j] = tmp; \ |
| i++; \ |
| j--; \ |
| } \ |
| } \ |
| |
| static void sort_one(VAPictureHEVC ref[], int left, int right, |
| int ascending) |
| { |
| VAPictureHEVC tmp; |
| int i = left, j = right; |
| unsigned int key = ref[(left + right) / 2].pic_order_cnt; |
| partition(ref, pic_order_cnt, (signed int)key, ascending); |
| |
| /* recursion */ |
| if (left < j) |
| sort_one(ref, left, j, ascending); |
| |
| if (i < right) |
| sort_one(ref, i, right, ascending); |
| } |
| |
| static void sort_two(VAPictureHEVC ref[], int left, int right, unsigned int key, |
| int partition_ascending, int list0_ascending, int list1_ascending) |
| { |
| VAPictureHEVC tmp; |
| int i = left, j = right; |
| |
| partition(ref, pic_order_cnt, (signed int)key, partition_ascending); |
| |
| sort_one(ref, left, i - 1, list0_ascending); |
| sort_one(ref, j + 1, right, list1_ascending); |
| } |
| |
| static int update_ReferenceFrames(void) |
| { |
| int i; |
| |
| if (current_frame_type == FRAME_B) |
| return 0; |
| |
| numShortTerm++; |
| if (numShortTerm > num_ref_frames) |
| numShortTerm = num_ref_frames; |
| for (i = numShortTerm - 1; i > 0; i--) |
| ReferenceFrames[i] = ReferenceFrames[i - 1]; |
| ReferenceFrames[0] = CurrentCurrPic; |
| |
| return 0; |
| } |
| |
| static int update_RefPicList(void) |
| { |
| unsigned int current_poc = CurrentCurrPic.pic_order_cnt; |
| |
| if (current_frame_type == FRAME_P) { |
| memcpy(RefPicList0_P, ReferenceFrames, numShortTerm * sizeof(VAPictureHEVC)); |
| sort_one(RefPicList0_P, 0, numShortTerm - 1, 0); |
| } |
| |
| if (current_frame_type == FRAME_B) { |
| memcpy(RefPicList0_B, ReferenceFrames, numShortTerm * sizeof(VAPictureHEVC)); |
| sort_two(RefPicList0_B, 0, numShortTerm - 1, current_poc, 1, 0, 1); |
| |
| memcpy(RefPicList1_B, ReferenceFrames, numShortTerm * sizeof(VAPictureHEVC)); |
| sort_two(RefPicList1_B, 0, numShortTerm - 1, current_poc, 0, 1, 0); |
| } |
| |
| return 0; |
| } |
| |
| |
| static int render_sequence(struct SeqParamSet *sps) |
| { |
| |
| VABufferID seq_param_buf = VA_INVALID_ID; |
| VABufferID rc_param_buf = VA_INVALID_ID; |
| VABufferID misc_param_tmpbuf = VA_INVALID_ID; |
| VABufferID render_id[2] = {VA_INVALID_ID}; |
| VAStatus va_status; |
| VAEncMiscParameterBuffer *misc_param, *misc_param_tmp; |
| VAEncMiscParameterRateControl *misc_rate_ctrl; |
| seq_param.general_profile_idc = sps->ptps.general_profile_idc; |
| seq_param.general_level_idc = sps->ptps.general_level_idc; |
| seq_param.general_tier_flag = (uint8_t)(sps->ptps.general_tier_flag); |
| |
| seq_param.intra_period = intra_period; |
| seq_param.intra_idr_period = intra_idr_period; |
| seq_param.ip_period = ip_period; |
| |
| seq_param.bits_per_second = 400000; |
| seq_param.pic_width_in_luma_samples = sps->pic_width_in_luma_samples; |
| seq_param.pic_height_in_luma_samples = sps->pic_height_in_luma_samples; |
| |
| seq_param.seq_fields.bits.chroma_format_idc = 1; |
| seq_param.seq_fields.bits.separate_colour_plane_flag = 0; |
| seq_param.seq_fields.bits.bit_depth_luma_minus8 = sps->bit_depth_luma_minus8; |
| seq_param.seq_fields.bits.bit_depth_chroma_minus8 = sps->bit_depth_chroma_minus8; |
| seq_param.seq_fields.bits.scaling_list_enabled_flag = sps->scaling_list_enabled_flag; |
| seq_param.seq_fields.bits.strong_intra_smoothing_enabled_flag = sps->strong_intra_smoothing_enabled_flag; |
| seq_param.seq_fields.bits.amp_enabled_flag = sps->amp_enabled_flag; |
| seq_param.seq_fields.bits.sample_adaptive_offset_enabled_flag = sps->sample_adaptive_offset_enabled_flag; |
| seq_param.seq_fields.bits.pcm_enabled_flag = sps->pcm_enabled_flag; |
| seq_param.seq_fields.bits.pcm_loop_filter_disabled_flag = sps->pcm_loop_filter_disabled_flag; |
| seq_param.seq_fields.bits.sps_temporal_mvp_enabled_flag = sps->sps_temporal_mvp_enabled_flag; |
| |
| seq_param.log2_min_luma_coding_block_size_minus3 = sps->log2_min_luma_coding_block_size_minus3; |
| seq_param.log2_diff_max_min_luma_coding_block_size = sps->log2_diff_max_min_luma_coding_block_size; |
| seq_param.log2_min_transform_block_size_minus2 = sps->log2_min_luma_transform_block_size_minus2; |
| seq_param.log2_diff_max_min_transform_block_size = sps->log2_diff_max_min_luma_transform_block_size; |
| seq_param.max_transform_hierarchy_depth_inter = sps->max_transform_hierarchy_depth_inter; |
| seq_param.max_transform_hierarchy_depth_intra = sps->max_transform_hierarchy_depth_intra; |
| |
| seq_param.vui_parameters_present_flag = sps->vui_parameters_present_flag; |
| |
| va_status = vaCreateBuffer(va_dpy, context_id, |
| VAEncSequenceParameterBufferType, |
| sizeof(seq_param), 1, &seq_param, &seq_param_buf); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| |
| va_status = vaCreateBuffer(va_dpy, context_id, |
| VAEncMiscParameterBufferType, |
| sizeof(VAEncMiscParameterBuffer) + sizeof(VAEncMiscParameterRateControl), |
| 1, NULL, &rc_param_buf); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| |
| vaMapBuffer(va_dpy, rc_param_buf, (void **)&misc_param); |
| misc_param->type = VAEncMiscParameterTypeRateControl; |
| misc_rate_ctrl = (VAEncMiscParameterRateControl *)misc_param->data; |
| memset(misc_rate_ctrl, 0, sizeof(*misc_rate_ctrl)); |
| misc_rate_ctrl->bits_per_second = frame_bitrate; |
| misc_rate_ctrl->target_percentage = 66; |
| misc_rate_ctrl->window_size = 1000; |
| misc_rate_ctrl->initial_qp = initial_qp; |
| misc_rate_ctrl->min_qp = minimal_qp; |
| misc_rate_ctrl->basic_unit_size = 0; |
| vaUnmapBuffer(va_dpy, rc_param_buf); |
| |
| render_id[0] = seq_param_buf; |
| render_id[1] = rc_param_buf; |
| |
| va_status = vaRenderPicture(va_dpy, context_id, &render_id[0], 2); |
| CHECK_VASTATUS(va_status, "vaRenderPicture"); |
| if (seq_param_buf != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, seq_param_buf); |
| seq_param_buf = VA_INVALID_ID; |
| } |
| |
| if (rc_param_buf != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, rc_param_buf); |
| rc_param_buf = VA_INVALID_ID; |
| } |
| |
| |
| if (misc_priv_type != 0) { |
| va_status = vaCreateBuffer(va_dpy, context_id, |
| VAEncMiscParameterBufferType, |
| sizeof(VAEncMiscParameterBuffer), |
| 1, NULL, &misc_param_tmpbuf); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| vaMapBuffer(va_dpy, misc_param_tmpbuf, (void **)&misc_param_tmp); |
| misc_param_tmp->type = misc_priv_type; |
| misc_param_tmp->data[0] = misc_priv_value; |
| vaUnmapBuffer(va_dpy, misc_param_tmpbuf); |
| |
| va_status = vaRenderPicture(va_dpy, context_id, &misc_param_tmpbuf, 1); |
| } |
| |
| return 0; |
| } |
| |
| static int render_picture(struct PicParamSet *pps) |
| { |
| VABufferID pic_param_buf = VA_INVALID_ID; |
| VAStatus va_status; |
| int i = 0; |
| |
| memcpy(pic_param.reference_frames, ReferenceFrames, numShortTerm * sizeof(VAPictureHEVC)); |
| for (i = numShortTerm; i < SURFACE_NUM; i++) { |
| pic_param.reference_frames[i].picture_id = VA_INVALID_SURFACE; |
| pic_param.reference_frames[i].flags = VA_PICTURE_HEVC_INVALID; |
| } |
| |
| pic_param.last_picture = 0; |
| pic_param.last_picture |= ((current_frame_encoding + 1) % intra_period == 0) ? HEVC_LAST_PICTURE_EOSEQ : 0; |
| pic_param.last_picture |= ((current_frame_encoding + 1) == frame_count) ? HEVC_LAST_PICTURE_EOSTREAM : 0; |
| pic_param.coded_buf = coded_buf[current_slot]; |
| |
| pic_param.decoded_curr_pic.picture_id = ref_surface[current_slot]; |
| pic_param.decoded_curr_pic.pic_order_cnt = calc_poc((current_frame_display - current_IDR_display) % MaxPicOrderCntLsb) * 2; |
| pic_param.decoded_curr_pic.flags = 0; |
| CurrentCurrPic = pic_param.decoded_curr_pic; |
| |
| pic_param.collocated_ref_pic_index = pps->num_ref_idx_l0_default_active_minus1; |
| pic_param.pic_init_qp = pps->init_qp_minus26 + 26; |
| pic_param.diff_cu_qp_delta_depth = pps->diff_cu_qp_delta_depth; |
| pic_param.pps_cb_qp_offset = pps->pps_cb_qp_offset; |
| pic_param.pps_cr_qp_offset = pps->pps_cr_qp_offset; |
| |
| pic_param.num_tile_columns_minus1 = pps->num_tile_columns_minus1; |
| pic_param.num_tile_rows_minus1 = pps->num_tile_rows_minus1; |
| for (i = 0; i <= (unsigned int)(pic_param.num_tile_columns_minus1); i++) { |
| pic_param.column_width_minus1[i] = 0; |
| } |
| for (i = 0; i <= (unsigned int)(pic_param.num_tile_rows_minus1); i++) { |
| pic_param.row_height_minus1[i] = 0; |
| } |
| |
| pic_param.log2_parallel_merge_level_minus2 = pps->log2_parallel_merge_level_minus2; |
| pic_param.ctu_max_bitsize_allowed = 0; |
| pic_param.num_ref_idx_l0_default_active_minus1 = pps->num_ref_idx_l0_default_active_minus1; |
| pic_param.num_ref_idx_l1_default_active_minus1 = pps->num_ref_idx_l1_default_active_minus1; |
| pic_param.slice_pic_parameter_set_id = 0; |
| pic_param.pic_fields.bits.idr_pic_flag = (current_frame_type == FRAME_IDR); |
| pic_param.pic_fields.bits.coding_type = current_frame_type == FRAME_IDR ? FRAME_I : current_frame_type; |
| pic_param.pic_fields.bits.reference_pic_flag = current_frame_type != FRAME_B ? 1 : 0; |
| pic_param.pic_fields.bits.dependent_slice_segments_enabled_flag = pps->dependent_slice_segments_enabled_flag; |
| pic_param.pic_fields.bits.sign_data_hiding_enabled_flag = pps->sign_data_hiding_enabled_flag; |
| pic_param.pic_fields.bits.constrained_intra_pred_flag = pps->constrained_intra_pred_flag; |
| pic_param.pic_fields.bits.transform_skip_enabled_flag = pps->transform_skip_enabled_flag; |
| pic_param.pic_fields.bits.cu_qp_delta_enabled_flag = pps->cu_qp_delta_enabled_flag; |
| pic_param.pic_fields.bits.weighted_pred_flag = pps->weighted_pred_flag; |
| pic_param.pic_fields.bits.weighted_bipred_flag = pps->weighted_bipred_flag; |
| pic_param.pic_fields.bits.transquant_bypass_enabled_flag = pps->transquant_bypass_enabled_flag; |
| pic_param.pic_fields.bits.tiles_enabled_flag = pps->tiles_enabled_flag; |
| pic_param.pic_fields.bits.entropy_coding_sync_enabled_flag = pps->entropy_coding_sync_enabled_flag; |
| pic_param.pic_fields.bits.loop_filter_across_tiles_enabled_flag = pps->loop_filter_across_tiles_enabled_flag; |
| pic_param.pic_fields.bits.pps_loop_filter_across_slices_enabled_flag = pps->pps_loop_filter_across_slices_enabled_flag; |
| pic_param.pic_fields.bits.scaling_list_data_present_flag = pps->pps_scaling_list_data_present_flag; |
| |
| va_status = vaCreateBuffer(va_dpy, context_id, VAEncPictureParameterBufferType, |
| sizeof(pic_param), 1, &pic_param, &pic_param_buf); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer");; |
| |
| va_status = vaRenderPicture(va_dpy, context_id, &pic_param_buf, 1); |
| CHECK_VASTATUS(va_status, "vaRenderPicture"); |
| |
| if (pic_param_buf != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, pic_param_buf); |
| pic_param_buf = VA_INVALID_ID; |
| } |
| |
| return 0; |
| } |
| |
| static int render_packedvideo(void) |
| { |
| |
| VAEncPackedHeaderParameterBuffer packedheader_param_buffer; |
| VABufferID packedvideo_para_bufid = VA_INVALID_ID; |
| VABufferID packedvideo_data_bufid = VA_INVALID_ID; |
| VABufferID render_id[2] = {VA_INVALID_ID}; |
| unsigned int length_in_bits; |
| unsigned char *packedvideo_buffer = NULL; |
| VAStatus va_status; |
| |
| length_in_bits = build_packed_video_buffer(&packedvideo_buffer); |
| |
| packedheader_param_buffer.type = VAEncPackedHeaderSequence; |
| |
| packedheader_param_buffer.bit_length = length_in_bits; /*length_in_bits*/ |
| packedheader_param_buffer.has_emulation_bytes = 0; |
| va_status = vaCreateBuffer(va_dpy, |
| context_id, |
| VAEncPackedHeaderParameterBufferType, |
| sizeof(packedheader_param_buffer), 1, &packedheader_param_buffer, |
| &packedvideo_para_bufid); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| |
| va_status = vaCreateBuffer(va_dpy, |
| context_id, |
| VAEncPackedHeaderDataBufferType, |
| (length_in_bits + 7) / 8, 1, packedvideo_buffer, |
| &packedvideo_data_bufid); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| |
| render_id[0] = packedvideo_para_bufid; |
| render_id[1] = packedvideo_data_bufid; |
| va_status = vaRenderPicture(va_dpy, context_id, render_id, 2); |
| CHECK_VASTATUS(va_status, "vaRenderPicture"); |
| |
| free(packedvideo_buffer); |
| |
| if (packedvideo_para_bufid != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, packedvideo_para_bufid); |
| packedvideo_para_bufid = VA_INVALID_ID; |
| } |
| if (packedvideo_data_bufid != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, packedvideo_data_bufid); |
| packedvideo_data_bufid = VA_INVALID_ID; |
| } |
| |
| return 0; |
| } |
| |
| static int render_packedsequence(void) |
| { |
| VAEncPackedHeaderParameterBuffer packedheader_param_buffer; |
| VABufferID packedseq_para_bufid = VA_INVALID_ID; |
| VABufferID packedseq_data_bufid = VA_INVALID_ID; |
| VABufferID render_id[2] = {VA_INVALID_ID}; |
| unsigned int length_in_bits; |
| unsigned char *packedseq_buffer = NULL; |
| VAStatus va_status; |
| |
| length_in_bits = build_packed_seq_buffer(&packedseq_buffer); |
| |
| packedheader_param_buffer.type = VAEncPackedHeaderSequence; |
| |
| packedheader_param_buffer.bit_length = length_in_bits; /*length_in_bits*/ |
| packedheader_param_buffer.has_emulation_bytes = 0; |
| va_status = vaCreateBuffer(va_dpy, |
| context_id, |
| VAEncPackedHeaderParameterBufferType, |
| sizeof(packedheader_param_buffer), 1, &packedheader_param_buffer, |
| &packedseq_para_bufid); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| |
| va_status = vaCreateBuffer(va_dpy, |
| context_id, |
| VAEncPackedHeaderDataBufferType, |
| (length_in_bits + 7) / 8, 1, packedseq_buffer, |
| &packedseq_data_bufid); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| |
| render_id[0] = packedseq_para_bufid; |
| render_id[1] = packedseq_data_bufid; |
| va_status = vaRenderPicture(va_dpy, context_id, render_id, 2); |
| CHECK_VASTATUS(va_status, "vaRenderPicture"); |
| |
| free(packedseq_buffer); |
| |
| if (packedseq_para_bufid != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, packedseq_para_bufid); |
| packedseq_para_bufid = VA_INVALID_ID; |
| } |
| if (packedseq_data_bufid != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, packedseq_data_bufid); |
| packedseq_para_bufid = VA_INVALID_ID; |
| } |
| |
| return 0; |
| } |
| |
| |
| static int render_packedpicture(void) |
| { |
| VAEncPackedHeaderParameterBuffer packedheader_param_buffer; |
| VABufferID packedpic_para_bufid = VA_INVALID_ID; |
| VABufferID packedpic_data_bufid = VA_INVALID_ID; |
| VABufferID render_id[2] = {VA_INVALID_ID}; |
| unsigned int length_in_bits; |
| unsigned char *packedpic_buffer = NULL; |
| VAStatus va_status; |
| |
| length_in_bits = build_packed_pic_buffer(&packedpic_buffer); |
| packedheader_param_buffer.type = VAEncPackedHeaderPicture; |
| packedheader_param_buffer.bit_length = length_in_bits; |
| packedheader_param_buffer.has_emulation_bytes = 0; |
| |
| va_status = vaCreateBuffer(va_dpy, |
| context_id, |
| VAEncPackedHeaderParameterBufferType, |
| sizeof(packedheader_param_buffer), 1, &packedheader_param_buffer, |
| &packedpic_para_bufid); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| |
| va_status = vaCreateBuffer(va_dpy, |
| context_id, |
| VAEncPackedHeaderDataBufferType, |
| (length_in_bits + 7) / 8, 1, packedpic_buffer, |
| &packedpic_data_bufid); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| |
| render_id[0] = packedpic_para_bufid; |
| render_id[1] = packedpic_data_bufid; |
| va_status = vaRenderPicture(va_dpy, context_id, render_id, 2); |
| CHECK_VASTATUS(va_status, "vaRenderPicture"); |
| |
| free(packedpic_buffer); |
| |
| if (packedpic_para_bufid != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, packedpic_para_bufid); |
| packedpic_para_bufid = VA_INVALID_ID; |
| } |
| if (packedpic_data_bufid != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, packedpic_data_bufid); |
| packedpic_para_bufid = VA_INVALID_ID; |
| } |
| |
| return 0; |
| } |
| |
| static void render_packedslice() |
| { |
| VAEncPackedHeaderParameterBuffer packedheader_param_buffer; |
| VABufferID packedslice_para_bufid = VA_INVALID_ID; |
| VABufferID packedslice_data_bufid = VA_INVALID_ID; |
| VABufferID render_id[2] = {VA_INVALID_ID}; |
| unsigned int length_in_bits; |
| unsigned char *packedslice_buffer = NULL; |
| VAStatus va_status; |
| |
| length_in_bits = build_packed_slice_buffer(&packedslice_buffer); |
| packedheader_param_buffer.type = VAEncPackedHeaderSlice; |
| packedheader_param_buffer.bit_length = length_in_bits; |
| packedheader_param_buffer.has_emulation_bytes = 0; |
| |
| va_status = vaCreateBuffer(va_dpy, |
| context_id, |
| VAEncPackedHeaderParameterBufferType, |
| sizeof(packedheader_param_buffer), 1, &packedheader_param_buffer, |
| &packedslice_para_bufid); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| |
| va_status = vaCreateBuffer(va_dpy, |
| context_id, |
| VAEncPackedHeaderDataBufferType, |
| (length_in_bits + 7) / 8, 1, packedslice_buffer, |
| &packedslice_data_bufid); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer"); |
| |
| render_id[0] = packedslice_para_bufid; |
| render_id[1] = packedslice_data_bufid; |
| va_status = vaRenderPicture(va_dpy, context_id, render_id, 2); |
| CHECK_VASTATUS(va_status, "vaRenderPicture"); |
| |
| free(packedslice_buffer); |
| |
| if (packedslice_para_bufid != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, packedslice_para_bufid); |
| packedslice_para_bufid = VA_INVALID_ID; |
| } |
| if (packedslice_data_bufid != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, packedslice_data_bufid); |
| packedslice_para_bufid = VA_INVALID_ID; |
| } |
| } |
| |
| static int render_slice(void) |
| { |
| VABufferID slice_param_buf = VA_INVALID_ID; |
| VAStatus va_status; |
| memset(&slice_param, 0x00, sizeof(VAEncSliceParameterBufferHEVC)); |
| |
| update_RefPicList(); |
| |
| slice_param.slice_segment_address = 0; |
| slice_param.num_ctu_in_slice = ssh.picture_width_in_ctus * ssh.picture_height_in_ctus; |
| slice_param.slice_type = ssh.slice_type; |
| slice_param.slice_pic_parameter_set_id = ssh.slice_pic_parameter_set_id; // right??? |
| |
| slice_param.num_ref_idx_l0_active_minus1 = ssh.num_ref_idx_l0_active_minus1; |
| slice_param.num_ref_idx_l1_active_minus1 = ssh.num_ref_idx_l1_active_minus1; |
| memset(slice_param.ref_pic_list0, 0xff, sizeof(slice_param.ref_pic_list0)); |
| memset(slice_param.ref_pic_list1, 0xff, sizeof(slice_param.ref_pic_list1)); |
| |
| if (current_frame_type == FRAME_P) { |
| memcpy(slice_param.ref_pic_list0, RefPicList0_P, sizeof(VAPictureHEVC)); |
| if (p2b) { |
| memcpy(slice_param.ref_pic_list1, RefPicList0_P, sizeof(VAPictureHEVC)); |
| } |
| } else if (current_frame_type == FRAME_B) { |
| memcpy(slice_param.ref_pic_list0, RefPicList0_B, sizeof(VAPictureHEVC)); |
| memcpy(slice_param.ref_pic_list1, RefPicList1_B, sizeof(VAPictureHEVC)); |
| } |
| |
| slice_param.luma_log2_weight_denom = 0; |
| slice_param.delta_chroma_log2_weight_denom = 0; |
| |
| slice_param.max_num_merge_cand = 5 - ssh.five_minus_max_num_merge_cand; |
| |
| slice_param.slice_qp_delta = ssh.slice_qp_delta; |
| slice_param.slice_cb_qp_offset = 0; |
| slice_param.slice_cr_qp_offset = 0; |
| slice_param.slice_beta_offset_div2 = ssh.beta_offset_div2; |
| slice_param.slice_tc_offset_div2 = ssh.tc_offset_div2; |
| |
| slice_param.slice_fields.bits.dependent_slice_segment_flag = 0; |
| slice_param.slice_fields.bits.colour_plane_id = ssh.colour_plane_id; |
| slice_param.slice_fields.bits.slice_temporal_mvp_enabled_flag = ssh.slice_temporal_mvp_enabled_flag; |
| slice_param.slice_fields.bits.slice_sao_luma_flag = ssh.slice_sao_luma_flag; |
| slice_param.slice_fields.bits.slice_sao_chroma_flag = ssh.slice_sao_luma_flag; |
| slice_param.slice_fields.bits.num_ref_idx_active_override_flag = ssh.num_ref_idx_active_override_flag; |
| slice_param.slice_fields.bits.mvd_l1_zero_flag = 0; |
| slice_param.slice_fields.bits.cabac_init_flag = 0; |
| slice_param.slice_fields.bits.slice_deblocking_filter_disabled_flag = ssh.disable_deblocking_filter_flag; |
| slice_param.slice_fields.bits.slice_loop_filter_across_slices_enabled_flag = ssh.slice_loop_filter_across_slices_enabled_flag; |
| slice_param.slice_fields.bits.collocated_from_l0_flag = ssh.collocated_from_l0_flag; |
| |
| if (hevc_packedheader && |
| config_attrib[enc_packed_header_idx].value & VA_ENC_PACKED_HEADER_SLICE) |
| render_packedslice(); |
| |
| va_status = vaCreateBuffer(va_dpy, context_id, VAEncSliceParameterBufferType, |
| sizeof(slice_param), 1, &slice_param, &slice_param_buf); |
| CHECK_VASTATUS(va_status, "vaCreateBuffer");; |
| |
| va_status = vaRenderPicture(va_dpy, context_id, &slice_param_buf, 1); |
| CHECK_VASTATUS(va_status, "vaRenderPicture"); |
| |
| if (slice_param_buf != VA_INVALID_ID) { |
| vaDestroyBuffer(va_dpy, slice_param_buf); |
| slice_param_buf = VA_INVALID_ID; |
| } |
| |
| return 0; |
| } |
| |
| |
| static int upload_source_YUV_once_for_all() |
| { |
| int box_width = 8; |
| int row_shift = 0; |
| int i; |
| |
| for (i = 0; i < SURFACE_NUM; i++) { |
| printf("\rLoading data into surface %d.....", i); |
| upload_surface(va_dpy, src_surface[i], box_width, row_shift, 0); |
| |
| row_shift++; |
| if (row_shift == (2 * box_width)) row_shift = 0; |
| } |
| printf("Complete surface loading\n"); |
| |
| return 0; |
| } |
| |
| static int load_surface(VASurfaceID surface_id, unsigned long long display_order) |
| { |
| unsigned char *srcyuv_ptr = NULL, *src_Y = NULL, *src_U = NULL, *src_V = NULL; |
| unsigned long long frame_start, mmap_start; |
| char *mmap_ptr = NULL; |
| int frame_size, mmap_size; |
| |
| if (srcyuv_fp == NULL) |
| return 0; |
| |
| /* allow encoding more than srcyuv_frames */ |
| display_order = display_order % srcyuv_frames; |
| frame_size = frame_width * frame_height * 3 / 2; /* for YUV420 */ |
| frame_start = display_order * frame_size; |
| |
| mmap_start = frame_start & (~0xfff); |
| mmap_size = (frame_size + (frame_start & 0xfff) + 0xfff) & (~0xfff); |
| mmap_ptr = mmap(0, mmap_size, PROT_READ, MAP_SHARED, |
| fileno(srcyuv_fp), mmap_start); |
| if (mmap_ptr == MAP_FAILED) { |
| printf("Failed to mmap YUV file (%s)\n", strerror(errno)); |
| return 1; |
| } |
| srcyuv_ptr = (unsigned char *)mmap_ptr + (frame_start & 0xfff); |
| if (srcyuv_fourcc == VA_FOURCC_NV12) { |
| src_Y = srcyuv_ptr; |
| src_U = src_Y + frame_width * frame_height; |
| src_V = NULL; |
| } else if (srcyuv_fourcc == VA_FOURCC_IYUV || |
| srcyuv_fourcc == VA_FOURCC_YV12) { |
| src_Y = srcyuv_ptr; |
| if (srcyuv_fourcc == VA_FOURCC_IYUV) { |
| src_U = src_Y + frame_width * frame_height; |
| src_V = src_U + (frame_width / 2) * (frame_height / 2); |
| } else { /* YV12 */ |
| src_V = src_Y + frame_width * frame_height; |
| src_U = src_V + (frame_width / 2) * (frame_height / 2); |
| } |
| } else { |
| printf("Unsupported source YUV format\n"); |
| exit(1); |
| } |
| |
| upload_surface_yuv(va_dpy, surface_id, |
| srcyuv_fourcc, frame_width, frame_height, |
| src_Y, src_U, src_V); |
| if (mmap_ptr) |
| munmap(mmap_ptr, mmap_size); |
| |
| return 0; |
| } |
| |
| |
| static int save_recyuv(VASurfaceID surface_id, |
| unsigned long long display_order, |
| unsigned long long encode_order) |
| { |
| unsigned char *dst_Y = NULL, *dst_U = NULL, *dst_V = NULL; |
| |
| if (recyuv_fp == NULL) |
| return 0; |
| |
| if (srcyuv_fourcc == VA_FOURCC_NV12) { |
| int uv_size = 2 * (frame_width / 2) * (frame_height / 2); |
| dst_Y = malloc(2 * uv_size); |
| if (dst_Y == NULL) { |
| printf("Failed to allocate memory for dst_Y\n"); |
| exit(1); |
| } |
| |
| dst_U = malloc(uv_size); |
| if (dst_U == NULL) { |
| printf("Failed to allocate memory for dst_U\n"); |
| free(dst_Y); |
| exit(1); |
| } |
| |
| memset(dst_Y, 0, 2 * uv_size); |
| memset(dst_U, 0, uv_size); |
| } else if (srcyuv_fourcc == VA_FOURCC_IYUV || |
| srcyuv_fourcc == VA_FOURCC_YV12) { |
| int uv_size = (frame_width / 2) * (frame_height / 2); |
| dst_Y = malloc(4 * uv_size); |
| if (dst_Y == NULL) { |
| printf("Failed to allocate memory for dst_Y\n"); |
| exit(1); |
| } |
| |
| dst_U = malloc(uv_size); |
| if (dst_U == NULL) { |
| printf("Failed to allocate memory for dst_U\n"); |
| free(dst_Y); |
| exit(1); |
| } |
| |
| dst_V = malloc(uv_size); |
| if (dst_V == NULL) { |
| printf("Failed to allocate memory for dst_V\n"); |
| free(dst_Y); |
| free(dst_U); |
| exit(1); |
| } |
| |
| memset(dst_Y, 0, 4 * uv_size); |
| memset(dst_U, 0, uv_size); |
| memset(dst_V, 0, uv_size); |
| } else { |
| printf("Unsupported source YUV format\n"); |
| exit(1); |
| } |
| |
| download_surface_yuv(va_dpy, surface_id, |
| srcyuv_fourcc, frame_width, frame_height, |
| dst_Y, dst_U, dst_V); |
| fseek(recyuv_fp, display_order * frame_width * frame_height * 1.5, SEEK_SET); |
| |
| if (srcyuv_fourcc == VA_FOURCC_NV12) { |
| int uv_size = 2 * (frame_width / 2) * (frame_height / 2); |
| fwrite(dst_Y, uv_size * 2, 1, recyuv_fp); |
| fwrite(dst_U, uv_size, 1, recyuv_fp); |
| } else if (srcyuv_fourcc == VA_FOURCC_IYUV || |
| srcyuv_fourcc == VA_FOURCC_YV12) { |
| int uv_size = (frame_width / 2) * (frame_height / 2); |
| fwrite(dst_Y, uv_size * 4, 1, recyuv_fp); |
| |
| if (srcyuv_fourcc == VA_FOURCC_IYUV) { |
| fwrite(dst_U, uv_size, 1, recyuv_fp); |
| fwrite(dst_V, uv_size, 1, recyuv_fp); |
| } else { |
| fwrite(dst_V, uv_size, 1, recyuv_fp); |
| fwrite(dst_U, uv_size, 1, recyuv_fp); |
| } |
| } |
| |
| if (dst_Y) |
| free(dst_Y); |
| if (dst_U) |
| free(dst_U); |
| if (dst_V) |
| free(dst_V); |
| |
| fflush(recyuv_fp); |
| |
| return 0; |
| } |
| |
| |
| static int save_codeddata(unsigned long long display_order, unsigned long long encode_order) |
| { |
| VACodedBufferSegment *buf_list = NULL; |
| VAStatus va_status; |
| unsigned int coded_size = 0; |
| |
| va_status = vaMapBuffer(va_dpy, coded_buf[display_order % SURFACE_NUM], (void **)(&buf_list)); |
| CHECK_VASTATUS(va_status, "vaMapBuffer"); |
| while (buf_list != NULL) { |
| coded_size += fwrite(buf_list->buf, 1, buf_list->size, coded_fp); |
| buf_list = (VACodedBufferSegment *) buf_list->next; |
| |
| frame_size += coded_size; |
| } |
| vaUnmapBuffer(va_dpy, coded_buf[display_order % SURFACE_NUM]); |
| |
| printf("\n "); /* return back to startpoint */ |
| switch (encode_order % 4) { |
| case 0: |
| printf("|"); |
| break; |
| case 1: |
| printf("/"); |
| break; |
| case 2: |
| printf("-"); |
| break; |
| case 3: |
| printf("\\"); |
| break; |
| } |
| printf("%08lld", encode_order); |
| printf("(%06d bytes coded)\n", coded_size); |
| |
| fflush(coded_fp); |
| |
| return 0; |
| } |
| |
| |
| static struct storage_task_t * storage_task_dequeue(void) |
| { |
| struct storage_task_t *header; |
| |
| pthread_mutex_lock(&encode_mutex); |
| |
| header = storage_task_header; |
| if (storage_task_header != NULL) { |
| if (storage_task_tail == storage_task_header) |
| storage_task_tail = NULL; |
| storage_task_header = header->next; |
| } |
| |
| pthread_mutex_unlock(&encode_mutex); |
| |
| return header; |
| } |
| |
| static int storage_task_queue(unsigned long long display_order, unsigned long long encode_order) |
| { |
| struct storage_task_t *tmp; |
| |
| tmp = calloc(1, sizeof(struct storage_task_t)); |
| if (tmp) { |
| tmp->display_order = display_order; |
| tmp->encode_order = encode_order; |
| } |
| |
| pthread_mutex_lock(&encode_mutex); |
| |
| if (storage_task_header == NULL) { |
| storage_task_header = tmp; |
| storage_task_tail = tmp; |
| } else { |
| storage_task_tail->next = tmp; |
| storage_task_tail = tmp; |
| } |
| |
| srcsurface_status[display_order % SURFACE_NUM] = SRC_SURFACE_IN_STORAGE; |
| pthread_cond_signal(&encode_cond); |
| |
| pthread_mutex_unlock(&encode_mutex); |
| |
| return 0; |
| } |
| |
| static void storage_task(unsigned long long display_order, unsigned long long encode_order) |
| { |
| unsigned int tmp; |
| VAStatus va_status; |
| |
| tmp = GetTickCount(); |
| va_status = vaSyncSurface(va_dpy, src_surface[display_order % SURFACE_NUM]); |
| CHECK_VASTATUS(va_status, "vaSyncSurface"); |
| SyncPictureTicks += GetTickCount() - tmp; |
| tmp = GetTickCount(); |
| save_codeddata(display_order, encode_order); |
| SavePictureTicks += GetTickCount() - tmp; |
| |
| save_recyuv(ref_surface[display_order % SURFACE_NUM], display_order, encode_order); |
| |
| /* reload a new frame data */ |
| tmp = GetTickCount(); |
| if (srcyuv_fp != NULL) |
| load_surface(src_surface[display_order % SURFACE_NUM], display_order + SURFACE_NUM); |
| UploadPictureTicks += GetTickCount() - tmp; |
| |
| pthread_mutex_lock(&encode_mutex); |
| srcsurface_status[display_order % SURFACE_NUM] = SRC_SURFACE_IN_ENCODING; |
| pthread_mutex_unlock(&encode_mutex); |
| } |
| |
| |
| static void * storage_task_thread(void *t) |
| { |
| while (1) { |
| struct storage_task_t *current; |
| |
| current = storage_task_dequeue(); |
| if (current == NULL) { |
| pthread_mutex_lock(&encode_mutex); |
| pthread_cond_wait(&encode_cond, &encode_mutex); |
| pthread_mutex_unlock(&encode_mutex); |
| continue; |
| } |
| |
| storage_task(current->display_order, current->encode_order); |
| |
| free(current); |
| |
| /* all frames are saved, exit the thread */ |
| if (++frame_coded >= frame_count) |
| break; |
| } |
| |
| return 0; |
| } |
| |
| |
| static int encode_frames(void) |
| { |
| unsigned int i, tmp; |
| VAStatus va_status; |
| //VASurfaceStatus surface_status; |
| |
| /* upload RAW YUV data into all surfaces */ |
| tmp = GetTickCount(); |
| if (srcyuv_fp != NULL) { |
| for (i = 0; i < SURFACE_NUM; i++) |
| load_surface(src_surface[i], i); |
| } else |
| upload_source_YUV_once_for_all(); |
| UploadPictureTicks += GetTickCount() - tmp; |
| |
| /* ready for encoding */ |
| memset(srcsurface_status, SRC_SURFACE_IN_ENCODING, sizeof(srcsurface_status)); |
| |
| memset(&seq_param, 0, sizeof(seq_param)); |
| memset(&pic_param, 0, sizeof(pic_param)); |
| memset(&slice_param, 0, sizeof(slice_param)); |
| |
| if (encode_syncmode == 0) |
| pthread_create(&encode_thread, NULL, storage_task_thread, NULL); |
| |
| for (current_frame_encoding = 0; current_frame_encoding < frame_count; current_frame_encoding++) { |
| encoding2display_order(current_frame_encoding, intra_period, intra_idr_period, ip_period, |
| ¤t_frame_display, ¤t_frame_type); |
| if (current_frame_type == FRAME_IDR) { |
| numShortTerm = 0; |
| current_frame_num = 0; |
| current_IDR_display = current_frame_display; |
| } |
| printf("%s : %lld %s : %lld type : %d\n", "encoding order", current_frame_encoding, "Display order", current_frame_display, current_frame_type); |
| /* check if the source frame is ready */ |
| while (srcsurface_status[current_slot] != SRC_SURFACE_IN_ENCODING) { |
| usleep(1); |
| } |
| |
| tmp = GetTickCount(); |
| va_status = vaBeginPicture(va_dpy, context_id, src_surface[current_slot]); |
| CHECK_VASTATUS(va_status, "vaBeginPicture"); |
| BeginPictureTicks += GetTickCount() - tmp; |
| fill_vps_header(&vps); |
| fill_sps_header(&sps, 0); |
| fill_pps_header(&pps, 0, 0); |
| tmp = GetTickCount(); |
| if (current_frame_type == FRAME_IDR) { |
| render_sequence(&sps); |
| render_packedvideo(); |
| render_packedsequence(); |
| } |
| render_packedpicture(); |
| render_picture(&pps); |
| fill_slice_header(0, &pps, &ssh); |
| render_slice(); |
| RenderPictureTicks += GetTickCount() - tmp; |
| |
| tmp = GetTickCount(); |
| va_status = vaEndPicture(va_dpy, context_id); |
| CHECK_VASTATUS(va_status, "vaEndPicture");; |
| EndPictureTicks += GetTickCount() - tmp; |
| |
| if (encode_syncmode) |
| storage_task(current_frame_display, current_frame_encoding); |
| else /* queue the storage task queue */ |
| storage_task_queue(current_frame_display, current_frame_encoding); |
| |
| update_ReferenceFrames(); |
| } |
| |
| if (encode_syncmode == 0) { |
| int ret; |
| pthread_join(encode_thread, (void **)&ret); |
| } |
| |
| return 0; |
| } |
| |
| |
| static int release_encode() |
| { |
| int i; |
| |
| vaDestroySurfaces(va_dpy, &src_surface[0], SURFACE_NUM); |
| vaDestroySurfaces(va_dpy, &ref_surface[0], SURFACE_NUM); |
| |
| for (i = 0; i < SURFACE_NUM; i++) |
| vaDestroyBuffer(va_dpy, coded_buf[i]); |
| |
| vaDestroyContext(va_dpy, context_id); |
| vaDestroyConfig(va_dpy, config_id); |
| |
| return 0; |
| } |
| |
| static int deinit_va() |
| { |
| vaTerminate(va_dpy); |
| |
| va_close_display(va_dpy); |
| |
| return 0; |
| } |
| |
| |
| static int print_input() |
| { |
| printf("\n\nINPUT:Try to encode HEVC...\n"); |
| if (rc_mode != -1) |
| printf("INPUT: RateControl : %s\n", rc_to_string(rc_mode)); |
| printf("INPUT: Resolution : %dx%d, %d frames\n", |
| frame_width, frame_height, frame_count); |
| printf("INPUT: FrameRate : %d\n", frame_rate); |
| printf("INPUT: Bitrate : %d\n", frame_bitrate); |
| printf("INPUT: Slieces : %d\n", frame_slices); |
| printf("INPUT: IntraPeriod : %d\n", intra_period); |
| printf("INPUT: IDRPeriod : %d\n", intra_idr_period); |
| printf("INPUT: IpPeriod : %d\n", ip_period); |
| printf("INPUT: Initial QP : %d\n", initial_qp); |
| printf("INPUT: Min QP : %d\n", minimal_qp); |
| printf("INPUT: P As B : %d\n", p2b); |
| printf("INPUT: Source YUV : %s", srcyuv_fp ? "FILE" : "AUTO generated"); |
| if (srcyuv_fp) |
| printf(":%s (fourcc %s)\n", srcyuv_fn, fourcc_to_string(srcyuv_fourcc)); |
| else |
| printf("\n"); |
| printf("INPUT: Coded Clip : %s\n", coded_fn); |
| if (recyuv_fp == NULL) |
| printf("INPUT: Rec Clip : %s\n", "Not save reconstructed frame"); |
| else |
| printf("INPUT: Rec Clip : Save reconstructed frame into %s (fourcc %s)\n", recyuv_fn, |
| fourcc_to_string(srcyuv_fourcc)); |
| |
| printf("\n\n"); /* return back to startpoint */ |
| |
| return 0; |
| } |
| |
| static int calc_PSNR(double *psnr) |
| { |
| char *srcyuv_ptr = NULL, *recyuv_ptr = NULL, tmp; |
| unsigned long long min_size; |
| unsigned long long i, sse = 0; |
| double ssemean; |
| int fourM = 0x400000; /* 4M */ |
| |
| min_size = MIN(srcyuv_frames, frame_count) * frame_width * frame_height * 1.5; |
| for (i = 0; i < min_size; i++) { |
| unsigned long long j = i % fourM; |
| |
| if ((i % fourM) == 0) { |
| if (srcyuv_ptr) |
| munmap(srcyuv_ptr, fourM); |
| if (recyuv_ptr) |
| munmap(recyuv_ptr, fourM); |
| |
| srcyuv_ptr = mmap(0, fourM, PROT_READ, MAP_SHARED, fileno(srcyuv_fp), i); |
| recyuv_ptr = mmap(0, fourM, PROT_READ, MAP_SHARED, fileno(recyuv_fp), i); |
| if ((srcyuv_ptr == MAP_FAILED) || (recyuv_ptr == MAP_FAILED)) { |
| printf("Failed to mmap YUV files\n"); |
| return 1; |
| } |
| } |
| tmp = srcyuv_ptr[j] - recyuv_ptr[j]; |
| sse += tmp * tmp; |
| } |
| ssemean = (double)sse / (double)min_size; |
| *psnr = 20.0 * log10(255) - 10.0 * log10(ssemean); |
| |
| if (srcyuv_ptr) |
| munmap(srcyuv_ptr, fourM); |
| if (recyuv_ptr) |
| munmap(recyuv_ptr, fourM); |
| |
| return 0; |
| } |
| |
| static int print_performance(unsigned int PictureCount) |
| { |
| unsigned int psnr_ret = 1, others = 0; |
| double psnr = 0, total_size = frame_width * frame_height * 1.5 * frame_count; |
| |
| if (calc_psnr && srcyuv_fp && recyuv_fp) |
| psnr_ret = calc_PSNR(&psnr); |
| |
| others = TotalTicks - UploadPictureTicks - BeginPictureTicks |
| - RenderPictureTicks - EndPictureTicks - SyncPictureTicks - SavePictureTicks; |
| |
| printf("\n\n"); |
| |
| printf("PERFORMANCE: Frame Rate : %.2f fps (%d frames, %d ms (%.2f ms per frame))\n", |
| (double) 1000 * PictureCount / TotalTicks, PictureCount, |
| TotalTicks, ((double) TotalTicks) / (double) PictureCount); |
| printf("PERFORMANCE: Compression ratio : %d:1\n", (unsigned int)(total_size / frame_size)); |
| if (psnr_ret == 0) |
| printf("PERFORMANCE: PSNR : %.2f (%lld frames calculated)\n", |
| psnr, MIN(frame_count, srcyuv_frames)); |
| |
| printf("PERFORMANCE: UploadPicture : %d ms (%.2f, %.2f%% percent)\n", |
| (int) UploadPictureTicks, ((double) UploadPictureTicks) / (double) PictureCount, |
| UploadPictureTicks / (double) TotalTicks / 0.01); |
| printf("PERFORMANCE: vaBeginPicture : %d ms (%.2f, %.2f%% percent)\n", |
| (int) BeginPictureTicks, ((double) BeginPictureTicks) / (double) PictureCount, |
| BeginPictureTicks / (double) TotalTicks / 0.01); |
| printf("PERFORMANCE: vaRenderHeader : %d ms (%.2f, %.2f%% percent)\n", |
| (int) RenderPictureTicks, ((double) RenderPictureTicks) / (double) PictureCount, |
| RenderPictureTicks / (double) TotalTicks / 0.01); |
| printf("PERFORMANCE: vaEndPicture : %d ms (%.2f, %.2f%% percent)\n", |
| (int) EndPictureTicks, ((double) EndPictureTicks) / (double) PictureCount, |
| EndPictureTicks / (double) TotalTicks / 0.01); |
| printf("PERFORMANCE: vaSyncSurface : %d ms (%.2f, %.2f%% percent)\n", |
| (int) SyncPictureTicks, ((double) SyncPictureTicks) / (double) PictureCount, |
| SyncPictureTicks / (double) TotalTicks / 0.01); |
| printf("PERFORMANCE: SavePicture : %d ms (%.2f, %.2f%% percent)\n", |
| (int) SavePictureTicks, ((double) SavePictureTicks) / (double) PictureCount, |
| SavePictureTicks / (double) TotalTicks / 0.01); |
| printf("PERFORMANCE: Others : %d ms (%.2f, %.2f%% percent)\n", |
| (int) others, ((double) others) / (double) PictureCount, |
| others / (double) TotalTicks / 0.01); |
| |
| if (encode_syncmode == 0) |
| printf("(Multithread enabled, the timing is only for reference)\n"); |
| |
| return 0; |
| } |
| |
| |
| int main(int argc, char **argv) |
| { |
| unsigned int start; |
| |
| process_cmdline(argc, argv); |
| |
| print_input(); |
| |
| start = GetTickCount(); |
| |
| init_va(); |
| setup_encode(); |
| |
| encode_frames(); |
| |
| release_encode(); |
| deinit_va(); |
| |
| TotalTicks += GetTickCount() - start; |
| print_performance(frame_count); |
| |
| return 0; |
| } |