add HEVC encode sample code
1. support low delay B frame
2. only support 1 frame in each reference list
3. CQP only
Signed-off-by: Tianhao Liu <tianhao.liu@intel.com>
diff --git a/encode/Makefile.am b/encode/Makefile.am
index 8298b39..ab1a86f 100644
--- a/encode/Makefile.am
+++ b/encode/Makefile.am
@@ -20,7 +20,7 @@
# TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
# SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
-bin_PROGRAMS = avcenc mpeg2vaenc h264encode jpegenc vp9enc vp8enc
+bin_PROGRAMS = avcenc mpeg2vaenc h264encode jpegenc vp9enc vp8enc hevcencode
noinst_PROGRAMS = svctenc
AM_CPPFLAGS = \
@@ -36,6 +36,14 @@
$(top_builddir)/common/libva-display.la \
-lpthread -lm
+hevcencode_SOURCES = hevcencode.c
+hevcencode_CFLAGS = -I$(top_srcdir)/common -g
+hevcencode_LDADD = \
+ $(LIBVA_LIBS) \
+ $(top_builddir)/common/libva-display.la \
+ -lpthread -lm
+
+
avcenc_SOURCES = avcenc.c
avcenc_CFLAGS = -I$(top_srcdir)/common -g
avcenc_LDADD = \
diff --git a/encode/hevcencode.c b/encode/hevcencode.c
new file mode 100644
index 0000000..681e34e
--- /dev/null
+++ b/encode/hevcencode.c
@@ -0,0 +1,3425 @@
+/*
+ * Copyright (c) 2018 Intel Corporation. All Rights Reserved.
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a
+ * copy of this software and associated documentation files (the
+ * "Software"), to deal in the Software without restriction, including
+ * without limitation the rights to use, copy, modify, merge, publish,
+ * distribute, sub license, and/or sell copies of the Software, and to
+ * permit persons to whom the Software is furnished to do so, subject to
+ * the following conditions:
+ *
+ * The above copyright notice and this permission notice (including the
+ * next paragraph) shall be included in all copies or substantial portions
+ * of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+ * OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+ * MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NON-INFRINGEMENT.
+ * IN NO EVENT SHALL PRECISION INSIGHT AND/OR ITS SUPPLIERS BE LIABLE FOR
+ * ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+ * TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+ * SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+ */
+#define LIBVA_UTILS_UPLOAD_DOWNLOAD_YUV_SURFACE 1
+
+#include <stdio.h>
+#include <string.h>
+#include <stdlib.h>
+#include <getopt.h>
+#include <unistd.h>
+#include <sys/types.h>
+#include <sys/stat.h>
+#include <sys/time.h>
+#include <sys/mman.h>
+#include <fcntl.h>
+#include <assert.h>
+#include <pthread.h>
+#include <errno.h>
+#include <math.h>
+#include <va/va.h>
+#include <va/va_enc_hevc.h>
+#include "va_display.h"
+#define ALIGN16(x) ((x+15)&~15)
+#define CHECK_VASTATUS(va_status,func) \
+ if (va_status != VA_STATUS_SUCCESS) { \
+ fprintf(stderr,"%s:%s (%d) failed,exit\n", __func__, func, __LINE__); \
+ exit(1); \
+ }
+
+#include "loadsurface.h"
+
+#define NAL_REF_IDC_NONE 0
+#define NAL_REF_IDC_LOW 1
+#define NAL_REF_IDC_MEDIUM 2
+#define NAL_REF_IDC_HIGH 3
+
+#define FRAME_I 1
+#define FRAME_P 2
+#define FRAME_B 3
+#define FRAME_IDR 7
+
+// SLICE TYPE HEVC ENUM
+enum
+{
+ SLICE_B = 0,
+ SLICE_P = 1,
+ SLICE_I = 2,
+};
+#define IS_I_SLICE(type) (SLICE_I == (type))
+#define IS_P_SLICE(type) (SLICE_P == (type))
+#define IS_B_SLICE(type) (SLICE_B == (type))
+
+
+
+#define ENTROPY_MODE_CAVLC 0
+#define ENTROPY_MODE_CABAC 1
+
+#define PROFILE_IDC_MAIN 1
+#define PROFILE_IDC_MAIN10 2
+
+#define BITSTREAM_ALLOCATE_STEPPING 4096
+#define LCU_SIZE 32
+
+#define SURFACE_NUM 16 /* 16 surfaces for source YUV */
+#define SURFACE_NUM 16 /* 16 surfaces for reference */
+enum NALUType
+{
+ NALU_TRAIL_N = 0x00, // Coded slice segment of a non-TSA, non-STSA trailing picture - slice_segment_layer_rbsp, VLC
+ NALU_TRAIL_R = 0x01, // Coded slice segment of a non-TSA, non-STSA trailing picture - slice_segment_layer_rbsp, VLC
+ NALU_TSA_N = 0x02, // Coded slice segment of a TSA picture - slice_segment_layer_rbsp, VLC
+ NALU_TSA_R = 0x03, // Coded slice segment of a TSA picture - slice_segment_layer_rbsp, VLC
+ NALU_STSA_N = 0x04, // Coded slice of an STSA picture - slice_layer_rbsp, VLC
+ NALU_STSA_R = 0x05, // Coded slice of an STSA picture - slice_layer_rbsp, VLC
+ NALU_RADL_N = 0x06, // Coded slice of an RADL picture - slice_layer_rbsp, VLC
+ NALU_RADL_R = 0x07, // Coded slice of an RADL picture - slice_layer_rbsp, VLC
+ NALU_RASL_N = 0x08, // Coded slice of an RASL picture - slice_layer_rbsp, VLC
+ NALU_RASL_R = 0x09, // Coded slice of an RASL picture - slice_layer_rbsp, VLC
+ /* 0x0a..0x0f - Reserved */
+ NALU_BLA_W_LP = 0x10, // Coded slice segment of an BLA picture - slice_segment_layer_rbsp, VLC
+ NALU_BLA_W_DLP = 0x11, // Coded slice segment of an BLA picture - slice_segment_layer_rbsp, VLC
+ NALU_BLA_N_LP = 0x12, // Coded slice segment of an BLA picture - slice_segment_layer_rbsp, VLC
+ NALU_IDR_W_DLP = 0x13, // Coded slice segment of an IDR picture - slice_segment_layer_rbsp, VLC
+ NALU_IDR_N_LP = 0x14, // Coded slice segment of an IDR picture - slice_segment_layer_rbsp, VLC
+ NALU_CRA = 0x15, // Coded slice segment of an CRA picture - slice_segment_layer_rbsp, VLC
+ /* 0x16..0x1f - Reserved */
+ NALU_VPS = 0x20, // Video parameter set - video_parameter_set_rbsp, non-VLC
+ NALU_SPS = 0x21, // Sequence parameter set - seq_parameter_set_rbsp, non-VLC
+ NALU_PPS = 0x22, // Picture parameter set - pic_parameter_set_rbsp, non-VLC
+ NALU_AUD = 0x23, // Access unit delimiter - access_unit_delimiter_rbsp, non-VLC
+ NALU_EOS = 0x24, // End of sequence - end_of_seq_rbsp, non-VLC
+ NALU_EOB = 0x25, // End of bitsteam - end_of_bitsteam_rbsp, non-VLC
+ NALU_FD = 0x26, // Filler data - filler_data_rbsp, non-VLC
+ NALU_PREFIX_SEI = 0x27, // Supplemental enhancement information (SEI) - sei_rbsp, non_VLC
+ NALU_SUFFIX_SEI = 0x28, // Supplemental enhancement information (SEI) - sei_rbsp, non_VLC
+ /* 0x29..0x2f - Reserved */
+ /* 0x30..0x3f - Unspecified */
+ //this should be the last element of this enum
+ //chagne this value if NAL unit type increased
+ MAX_HEVC_NAL_TYPE = 0x3f,
+
+};
+
+// Config const values
+#define MAX_TEMPORAL_SUBLAYERS 8
+#define MAX_LAYER_ID 64
+#define MAX_LONGTERM_REF_PIC 32
+#define NUM_OF_EXTRA_SLICEHEADER_BITS 3
+struct ProfileTierParamSet
+{
+ uint8_t general_profile_space; //u(2)
+ int general_tier_flag; //u(1)
+ uint8_t general_profile_idc; //u(5)
+ int general_profile_compatibility_flag[32]; //u(1)
+ int general_progressive_source_flag; //u(1)
+ int general_interlaced_source_flag; //u(1)
+ int general_non_packed_constraint_flag; //u(1)
+ int general_frame_only_constraint_flag; //u(1)
+ int general_reserved_zero_43bits[43]; //u(1)
+ int general_reserved_zero_bit; //u(1)
+ uint8_t general_level_idc; //u(8)
+};
+// Video parameter set structure
+struct VideoParamSet
+{
+ uint8_t vps_video_parameter_set_id; //u(4)
+ int vps_base_layer_internal_flag; //u(1)
+ int vps_base_layer_available_flag; //u(1)
+ uint8_t vps_max_layers_minus1; //u(6)
+ uint8_t vps_max_sub_layers_minus1; //u(3)
+ int vps_temporal_id_nesting_flag; //u(1)
+ uint16_t vps_reserved_0xffff_16bits; //u(16)
+
+ struct ProfileTierParamSet ptps;
+ uint8_t vps_max_nuh_reserved_zero_layer_id;
+ uint32_t vps_max_op_sets;
+ uint32_t vps_num_op_sets_minus1;
+
+ int vps_sub_layer_ordering_info_present_flag; //u(1)
+ uint32_t vps_max_dec_pic_buffering_minus1[MAX_TEMPORAL_SUBLAYERS]; //ue(v)
+ uint32_t vps_max_num_reorder_pics[MAX_TEMPORAL_SUBLAYERS]; //ue(v)
+ uint32_t vps_max_latency_increase_plus1[MAX_TEMPORAL_SUBLAYERS]; //ue(v)
+ uint8_t vps_max_layer_id; //u(6)
+ uint32_t vps_num_layer_sets_minus1; //ue(v)
+ int layer_id_included_flag[MAX_TEMPORAL_SUBLAYERS][MAX_LAYER_ID]; //u(1)
+ int vps_timing_info_present_flag; //u(1)
+ uint32_t vps_num_units_in_tick; //u(32)
+ uint32_t vps_time_scale; //u(32
+ int vps_poc_proportional_to_timing_flag; //u(1)
+ uint32_t vps_num_ticks_poc_diff_one_minus1; //ue(v)
+ uint32_t vps_num_hrd_parameters; //ue(v)
+ uint32_t hrd_layer_set_idx[MAX_TEMPORAL_SUBLAYERS]; //ue(v)
+ int cprms_present_flag[MAX_TEMPORAL_SUBLAYERS]; //u(1)
+ int vps_extension_flag; //u(1)
+ int vps_extension_data_flag; //u(1)
+};
+
+struct ShortTermRefPicParamSet
+{
+ int inter_ref_pic_set_prediction_flag; //u(1)
+ uint32_t delta_idx_minus1; //ue(v)
+ uint8_t delta_rps_sign; //u(1)
+ uint32_t abs_delta_rps_minus1; //ue(v)
+ uint8_t used_by_curr_pic_flag[32]; //u(1)
+ uint8_t use_delta_flag[32]; //u(1)
+ uint32_t num_negative_pics; //ue(v)
+ uint32_t num_positive_pics; //ue(v)
+ uint32_t delta_poc_s0_minus1[32]; //ue(v)
+ uint8_t used_by_curr_pic_s0_flag[32]; //u(1)
+ uint32_t delta_poc_s1_minus1[32]; //ue(v)
+ uint8_t used_by_curr_pic_s1_flag[32]; //u(1)
+};
+struct SeqParamSet
+{
+ uint8_t sps_video_parameter_set_id; //u(4)
+ uint8_t sps_max_sub_layers_minus1; //u(3)
+ int sps_temporal_id_nesting_flag; //u(1)
+
+ struct ProfileTierParamSet ptps;
+ uint32_t sps_seq_parameter_set_id; //ue(v)
+ uint32_t chroma_format_idc; //ue(v)
+ int separate_colour_plane_flag; //u(1)
+ uint32_t pic_width_in_luma_samples; //ue(v)
+ uint32_t pic_height_in_luma_samples; //ue(v)
+ int conformance_window_flag; //u(1)
+ uint32_t conf_win_left_offset; //ue(v)
+ uint32_t conf_win_right_offset; //ue(v)
+ uint32_t conf_win_top_offset; //ue(v)
+ uint32_t conf_win_bottom_offset; //ue(v)
+ uint32_t bit_depth_luma_minus8; //ue(v)
+ uint32_t bit_depth_chroma_minus8; //ue(v)
+ uint32_t log2_max_pic_order_cnt_lsb_minus4; //ue(v)
+ int sps_sub_layer_ordering_info_present_flag; //u(1)
+ uint32_t sps_max_dec_pic_buffering_minus1[MAX_TEMPORAL_SUBLAYERS]; //ue(v)
+ uint32_t sps_max_num_reorder_pics[MAX_TEMPORAL_SUBLAYERS]; //ue(v)
+ uint32_t sps_max_latency_increase_plus1[MAX_TEMPORAL_SUBLAYERS]; //ue(v)
+ uint32_t log2_min_luma_coding_block_size_minus3; //ue(v)
+ uint32_t log2_diff_max_min_luma_coding_block_size;
+ uint32_t log2_max_coding_block_size_minus3; //ue(v)
+ uint32_t log2_min_luma_transform_block_size_minus2; //ue(v)
+ uint32_t log2_diff_max_min_luma_transform_block_size; //ue(v)
+ uint32_t max_transform_hierarchy_depth_inter; //ue(v)
+ uint32_t max_transform_hierarchy_depth_intra; //ue(v)
+ uint8_t scaling_list_enabled_flag; //u(1)
+ uint8_t sps_scaling_list_data_present_flag; //u(1)
+ uint8_t amp_enabled_flag; //u(1)
+ uint8_t sample_adaptive_offset_enabled_flag; //u(1)
+ uint8_t pcm_enabled_flag; //u(1)
+ uint8_t pcm_sample_bit_depth_luma_minus1; //u(4)
+ uint8_t pcm_sample_bit_depth_chroma_minus1; //u(4)
+ uint32_t log2_min_pcm_luma_coding_block_size_minus3;
+ uint32_t log2_max_pcm_luma_coding_block_size_minus3; //ue(v)
+ uint32_t log2_diff_max_min_pcm_luma_coding_block_size; //ue(v)
+ uint8_t pcm_loop_filter_disabled_flag; //u(1)
+ uint32_t num_short_term_ref_pic_sets; //ue(v)
+
+ struct ShortTermRefPicParamSet strp[66];
+ uint8_t long_term_ref_pics_present_flag; //u(1)
+ uint32_t num_long_term_ref_pics_sps; //ue(v)
+ uint32_t lt_ref_pic_poc_lsb_sps[MAX_LONGTERM_REF_PIC]; //u(v)
+ uint8_t used_by_curr_pic_lt_sps_flag[MAX_LONGTERM_REF_PIC]; //u(1)
+ uint8_t sps_temporal_mvp_enabled_flag; //u(1)
+ uint8_t strong_intra_smoothing_enabled_flag; //u(1)
+ uint8_t vui_parameters_present_flag; //u(1)
+ //VuiParameters vui_parameters;
+ int sps_extension_present_flag; //u(1)
+ int sps_range_extension_flag; //u(1)
+ int sps_multilayer_extension_flag; //u(1)
+ int sps_3d_extension_flag; //u(1)
+ uint8_t sps_extension_5bits; //u(5)
+ int sps_extension_data_flag; //u(1)
+};
+struct PicParamSet
+{
+ uint32_t pps_pic_parameter_set_id; //ue(v)
+ uint32_t pps_seq_parameter_set_id; //ue(v)
+ int dependent_slice_segments_enabled_flag; //u(1)
+ int output_flag_present_flag; //u(1)
+ uint8_t num_extra_slice_header_bits; //u(3)
+ int sign_data_hiding_enabled_flag; //u(1)
+ int cabac_init_present_flag; //u(1)
+ uint32_t num_ref_idx_l0_default_active_minus1; //ue(v)
+ uint32_t num_ref_idx_l1_default_active_minus1; //ue(v)
+ int32_t init_qp_minus26; //se(v)
+ int constrained_intra_pred_flag; //u(1)
+ int transform_skip_enabled_flag; //u(1)
+ int cu_qp_delta_enabled_flag; //u(1)
+ uint32_t diff_cu_qp_delta_depth; //ue(v)
+ uint32_t pps_cb_qp_offset; //se(v)
+ uint32_t pps_cr_qp_offset; //se(v)
+ int pps_slice_chroma_qp_offsets_present_flag; //u(1)
+ int weighted_pred_flag; //u(1)
+ int weighted_bipred_flag; //u(1)
+ int transquant_bypass_enabled_flag; //u(1)
+ int tiles_enabled_flag; //u(1)
+ int entropy_coding_sync_enabled_flag; //u(1)
+ uint32_t num_tile_columns_minus1; //ue(v)
+ uint32_t num_tile_rows_minus1; //ue(v)
+ int uniform_spacing_flag; //u(1)
+ uint32_t *column_width_minus1; //ue(v)
+ uint32_t *row_height_minus1; //ue(v)
+ int loop_filter_across_tiles_enabled_flag; //u(1)
+ int pps_loop_filter_across_slices_enabled_flag; //u(1)
+ int deblocking_filter_control_present_flag; //u(1)
+ int deblocking_filter_override_enabled_flag; //u(1)
+ int pps_deblocking_filter_disabled_flag; //u(1)
+ int32_t pps_beta_offset_div2; //se(v)
+ int32_t pps_tc_offset_div2; //se(v)
+ int pps_scaling_list_data_present_flag; //u(1)
+ int lists_modification_present_flag; //u(1)
+ uint32_t log2_parallel_merge_level_minus2; //ue(v)
+ int slice_segment_header_extension_present_flag; //u(1)
+ int pps_extension_present_flag; //u(1)
+ int pps_range_extension_flag; //u(1)
+ int pps_multilayer_extension_flag; //u(1)
+ int pps_3d_extension_flag; //u(1)
+ uint8_t pps_extension_5bits; //u(5)
+ uint8_t pps_extension_data_flag; //u(1)
+ uint32_t log2_max_transform_skip_block_size_minus2; //ue(v)
+ uint8_t cross_component_prediction_enabled_flag; //ue(1)
+ uint8_t chroma_qp_offset_list_enabled_flag; //ue(1)
+ uint32_t diff_cu_chroma_qp_offset_depth; //ue(v)
+ uint32_t chroma_qp_offset_list_len_minus1; //ue(v)
+ uint32_t cb_qp_offset_list[6]; //se(v)
+ uint32_t cr_qp_offset_list[6]; //se(v)
+ uint32_t log2_sao_offset_scale_luma; //ue(v)
+ uint32_t log2_sao_offset_scale_chroma; //ue(v)
+};
+struct SliceHeader
+{
+ int first_slice_segment_in_pic_flag; //u(1)
+ int no_output_of_prior_pics_flag; //u(1)
+ uint32_t slice_pic_parameter_set_id; //ue(v)
+ int dependent_slice_segment_flag; //u(1)
+ uint32_t picture_width_in_ctus;
+ uint32_t picture_height_in_ctus;
+ uint32_t slice_segment_address; //u(v)
+ int slice_reserved_undetermined_flag[NUM_OF_EXTRA_SLICEHEADER_BITS]; //u(1)
+ uint32_t slice_type; //ue(v)
+ int pic_output_flag; //u(1)
+ uint8_t colour_plane_id; //u(2)
+ uint32_t pic_order_cnt_lsb;
+ uint32_t num_negative_pics;
+ uint32_t num_positive_pics;
+ uint32_t delta_poc_s0_minus1;
+
+ struct ShortTermRefPicParamSet strp;
+ int short_term_ref_pic_set_sps_flag; //u(1)
+ uint32_t short_term_ref_pic_set_idx; //u(v)
+ uint32_t num_long_term_sps; //ue(v)
+ uint32_t num_long_term_pics; //ue(v)
+ uint32_t *lt_idx_sps; //u(v)
+ uint32_t *poc_lsb_lt; //u(v)
+ int *used_by_curr_pic_lt_flag; //u(1)
+ int *delta_poc_msb_present_flag; //u(1)
+ uint32_t *delta_poc_msb_cycle_lt; //ue(v)
+ int slice_temporal_mvp_enabled_flag; //u(1)
+ int slice_sao_luma_flag; //u(1)
+ int slice_sao_chroma_flag; //u(1)
+ int num_ref_idx_active_override_flag; //u(1)
+ uint32_t num_ref_idx_l0_active_minus1; //ue(v)
+ uint32_t num_ref_idx_l1_active_minus1;
+ uint32_t num_poc_total_cur;
+ int ref_pic_list_modification_flag_l0;
+ int ref_pic_list_modification_flag_l1;
+ uint32_t* list_entry_l0;
+ uint32_t* list_entry_l1;
+
+ int ref_pic_list_combination_flag;
+
+ uint32_t num_ref_idx_lc_active_minus1;
+ uint32_t ref_pic_list_modification_flag_lc;
+ int pic_from_list_0_flag;
+ uint32_t ref_idx_list_curr;
+ int mvd_l1_zero_flag; //u(1)
+ int cabac_init_present_flag;
+ int pic_temporal_mvp_enable_flag;
+
+ int collocated_from_l0_flag; //u(1)
+ uint32_t collocated_ref_idx; //ue(v)
+ uint32_t five_minus_max_num_merge_cand; //ue(v)
+ int32_t delta_pic_order_cnt_bottom; //se(v)
+ int32_t slice_qp_delta; //se(v)
+ int32_t slice_qp_delta_cb; //se(v)
+ int32_t slice_qp_delta_cr; //se(v)
+ int cu_chroma_qp_offset_enabled_flag; //u(1)
+ int deblocking_filter_override_flag; //u(1)
+ int disable_deblocking_filter_flag; //u(1)
+ int32_t beta_offset_div2; //se(v)
+ int32_t tc_offset_div2; //se(v)
+ int slice_loop_filter_across_slices_enabled_flag; //u(1)
+ uint32_t num_entry_point_offsets; //ue(v)
+ uint32_t offset_len_minus1; //ue(v)
+ uint32_t *entry_point_offset; //u(v)
+ uint32_t slice_segment_header_extension_length; //ue(v)
+ uint8_t *slice_segment_header_extension_data_byte; //u(8)
+};
+
+static struct VideoParamSet vps;
+static struct SeqParamSet sps;
+static struct PicParamSet pps;
+static struct SliceHeader ssh;
+static VADisplay va_dpy;
+static VAProfile hevc_profile = ~0;
+static int real_hevc_profile = 0;
+static int p2b = 1;
+static VAConfigAttrib attrib[VAConfigAttribTypeMax];
+static VAConfigAttrib config_attrib[VAConfigAttribTypeMax];
+static int config_attrib_num = 0, enc_packed_header_idx;
+static VASurfaceID src_surface[SURFACE_NUM];
+static VABufferID coded_buf[SURFACE_NUM];
+static VASurfaceID ref_surface[SURFACE_NUM];
+static VAConfigID config_id;
+static VAContextID context_id;
+static struct ProfileTierParamSet protier_param;
+
+static VAEncSequenceParameterBufferHEVC seq_param;
+static VAEncPictureParameterBufferHEVC pic_param;
+static VAEncSliceParameterBufferHEVC slice_param;
+static VAPictureHEVC CurrentCurrPic;
+static VAPictureHEVC ReferenceFrames[16], RefPicList0_P[32], RefPicList0_B[32], RefPicList1_B[32];
+
+static unsigned int MaxPicOrderCntLsb = (2<<8);
+
+static unsigned int num_ref_frames = 2;
+static unsigned int num_active_ref_p = 1;
+static unsigned int numShortTerm = 0;
+static int constraint_set_flag = 0;
+static int hevc_packedheader = 0;
+static int hevc_maxref = 16;
+
+static char *coded_fn = NULL, *srcyuv_fn = NULL, *recyuv_fn = NULL;
+static FILE *coded_fp = NULL, *srcyuv_fp = NULL, *recyuv_fp = NULL;
+static unsigned long long srcyuv_frames = 0;
+static int srcyuv_fourcc = VA_FOURCC_NV12;
+static int calc_psnr = 0;
+
+static int frame_width = 176;
+static int frame_height = 144;
+static int frame_width_aligned;
+static int frame_height_aligned;
+static int frame_rate = 30;
+static unsigned int frame_count = 60;
+static unsigned int frame_coded = 0;
+static unsigned int frame_bitrate = 0;
+static unsigned int frame_slices = 1;
+static double frame_size = 0;
+static int initial_qp = 26;
+static int minimal_qp = 0;
+static int intra_period = 30;
+static int intra_idr_period = 60;
+static int ip_period = 1;
+static int rc_mode = -1;
+static int rc_default_modes[] = {
+ VA_RC_VBR,
+ VA_RC_CQP,
+ VA_RC_VBR_CONSTRAINED,
+ VA_RC_CBR,
+ VA_RC_VCM,
+ VA_RC_NONE,
+};
+static unsigned long long current_frame_encoding = 0;
+static unsigned long long current_frame_display = 0;
+static unsigned long long current_IDR_display = 0;
+static unsigned int current_frame_num = 0;
+static int current_frame_type;
+#define current_slot (current_frame_display % SURFACE_NUM)
+
+static int misc_priv_type = 0;
+static int misc_priv_value = 0;
+
+#define MIN(a, b) ((a)>(b)?(b):(a))
+#define MAX(a, b) ((a)>(b)?(a):(b))
+
+/* thread to save coded data/upload source YUV */
+struct storage_task_t {
+ void *next;
+ unsigned long long display_order;
+ unsigned long long encode_order;
+};
+static struct storage_task_t *storage_task_header = NULL, *storage_task_tail = NULL;
+#define SRC_SURFACE_IN_ENCODING 0
+#define SRC_SURFACE_IN_STORAGE 1
+static int srcsurface_status[SURFACE_NUM];
+static int encode_syncmode = 0;
+static pthread_mutex_t encode_mutex = PTHREAD_MUTEX_INITIALIZER;
+static pthread_cond_t encode_cond = PTHREAD_COND_INITIALIZER;
+static pthread_t encode_thread;
+
+/* for performance profiling */
+static unsigned int UploadPictureTicks=0;
+static unsigned int BeginPictureTicks=0;
+static unsigned int RenderPictureTicks=0;
+static unsigned int EndPictureTicks=0;
+static unsigned int SyncPictureTicks=0;
+static unsigned int SavePictureTicks=0;
+static unsigned int TotalTicks=0;
+
+struct __bitstream {
+ unsigned int *buffer;
+ int bit_offset;
+ int max_size_in_dword;
+};
+typedef struct __bitstream bitstream;
+
+static unsigned int
+va_swap32(unsigned int val)
+{
+ unsigned char *pval = (unsigned char *)&val;
+
+ return ((pval[0] << 24) |
+ (pval[1] << 16) |
+ (pval[2] << 8) |
+ (pval[3] << 0));
+}
+
+static void
+bitstream_start(bitstream *bs)
+{
+ bs->max_size_in_dword = BITSTREAM_ALLOCATE_STEPPING;
+ bs->buffer = calloc(bs->max_size_in_dword * sizeof(int), 1);
+ assert(bs->buffer);
+ bs->bit_offset = 0;
+}
+
+static void
+bitstream_end(bitstream *bs)
+{
+ int pos = (bs->bit_offset >> 5);
+ int bit_offset = (bs->bit_offset & 0x1f);
+ int bit_left = 32 - bit_offset;
+
+ if (bit_offset) {
+ bs->buffer[pos] = va_swap32((bs->buffer[pos] << bit_left));
+ }
+}
+
+static void
+put_ui(bitstream *bs, unsigned int val, int size_in_bits)
+{
+ int pos = (bs->bit_offset >> 5);
+ int bit_offset = (bs->bit_offset & 0x1f);
+ int bit_left = 32 - bit_offset;
+
+ if (!size_in_bits)
+ return;
+
+ bs->bit_offset += size_in_bits;
+
+ if (bit_left > size_in_bits) {
+ bs->buffer[pos] = (bs->buffer[pos] << size_in_bits | val);
+ } else {
+ size_in_bits -= bit_left;
+ bs->buffer[pos] = (bs->buffer[pos] << bit_left) | (val >> size_in_bits);
+ bs->buffer[pos] = va_swap32(bs->buffer[pos]);
+
+ if (pos + 1 == bs->max_size_in_dword) {
+ bs->max_size_in_dword += BITSTREAM_ALLOCATE_STEPPING;
+ bs->buffer = realloc(bs->buffer, bs->max_size_in_dword * sizeof(unsigned int));
+ assert(bs->buffer);
+ }
+
+ bs->buffer[pos + 1] = val;
+ }
+}
+
+static void
+put_ue(bitstream *bs, unsigned int val)
+{
+ int size_in_bits = 0;
+ int tmp_val = ++val;
+
+ while (tmp_val) {
+ tmp_val >>= 1;
+ size_in_bits++;
+ }
+
+ put_ui(bs, 0, size_in_bits - 1); // leading zero
+ put_ui(bs, val, size_in_bits);
+}
+
+static void
+put_se(bitstream *bs, int val)
+{
+ unsigned int new_val;
+
+ if (val <= 0)
+ new_val = -2 * val;
+ else
+ new_val = 2 * val - 1;
+
+ put_ue(bs, new_val);
+}
+
+static void
+byte_aligning(bitstream *bs, int bit)
+{
+ int bit_offset = (bs->bit_offset & 0x7);
+ int bit_left = 8 - bit_offset;
+ int new_val;
+
+ if (!bit_offset)
+ return;
+
+ assert(bit == 0 || bit == 1);
+
+ if (bit)
+ new_val = (1 << bit_left) - 1;
+ else
+ new_val = 0;
+
+ put_ui(bs, new_val, bit_left);
+}
+
+static void
+rbsp_trailing_bits(bitstream *bs)
+{
+ put_ui(bs, 1, 1);
+ byte_aligning(bs, 0);
+}
+
+static void nal_start_code_prefix(bitstream *bs, int nal_unit_type)
+{
+ if(nal_unit_type == NALU_VPS ||
+ nal_unit_type == NALU_SPS ||
+ nal_unit_type == NALU_PPS ||
+ nal_unit_type == NALU_AUD)
+ put_ui(bs, 0x00000001, 32);
+ else
+ put_ui(bs, 0x000001, 24);
+}
+
+static void nal_header(bitstream *bs,int nal_unit_type)
+{
+ put_ui(bs, 0, 1); /* forbidden_zero_bit: 0 */
+ put_ui(bs, nal_unit_type, 6);
+ put_ui(bs, 0, 6);
+ put_ui(bs, 1, 3);
+}
+
+static int calc_poc(int pic_order_cnt_lsb)
+{
+ static int picOrderCntMsb_ref = 0, pic_order_cnt_lsb_ref = 0;
+ int prevPicOrderCntMsb, prevPicOrderCntLsb;
+ int picOrderCntMsb, picOrderCnt;
+
+ if (current_frame_type == FRAME_IDR)
+ prevPicOrderCntMsb = prevPicOrderCntLsb = 0;
+ else {
+ prevPicOrderCntMsb = picOrderCntMsb_ref;
+ prevPicOrderCntLsb = pic_order_cnt_lsb_ref;
+ }
+
+ if ((pic_order_cnt_lsb < prevPicOrderCntLsb) &&
+ ((prevPicOrderCntLsb - pic_order_cnt_lsb) >= (int)(MaxPicOrderCntLsb / 2)))
+ picOrderCntMsb = prevPicOrderCntMsb + MaxPicOrderCntLsb;
+ else if ((pic_order_cnt_lsb > prevPicOrderCntLsb) &&
+ ((pic_order_cnt_lsb - prevPicOrderCntLsb) > (int)(MaxPicOrderCntLsb / 2)))
+ picOrderCntMsb = prevPicOrderCntMsb - MaxPicOrderCntLsb;
+ else
+ picOrderCntMsb = prevPicOrderCntMsb;
+
+ picOrderCnt = picOrderCntMsb + pic_order_cnt_lsb;
+
+ if (current_frame_type != FRAME_B) {
+ picOrderCntMsb_ref = picOrderCntMsb;
+ pic_order_cnt_lsb_ref = pic_order_cnt_lsb;
+ }
+
+ return picOrderCnt;
+}
+
+static void fill_profile_tier_level(
+ uint8_t vps_max_layers_minus1,
+ struct ProfileTierParamSet *ptps,
+ uint8_t profilePresentFlag)
+{
+ if (!profilePresentFlag)
+ return;
+
+ memset(ptps, 0, sizeof(*ptps));
+
+ ptps->general_profile_space = 0;
+ ptps->general_tier_flag = 0;
+ ptps->general_profile_idc = real_hevc_profile;
+ memset(ptps->general_profile_compatibility_flag,0,32*sizeof(int));
+ ptps->general_profile_compatibility_flag[ptps->general_profile_idc] = 1;
+ ptps->general_progressive_source_flag = 1;
+ ptps->general_interlaced_source_flag = 0;
+ ptps->general_non_packed_constraint_flag = 0;
+ ptps->general_frame_only_constraint_flag = 1;
+
+ ptps->general_level_idc = 30;
+ ptps->general_level_idc = ptps->general_level_idc * 3;
+
+}
+static void fill_vps_header(struct VideoParamSet *vps)
+{
+ int i = 0;
+ memset(vps, 0, sizeof(*vps));
+
+ vps->vps_video_parameter_set_id = 0;
+ vps->vps_base_layer_internal_flag = 1;
+ vps->vps_base_layer_available_flag = 1;
+ vps->vps_max_layers_minus1 = 0;
+ vps->vps_max_sub_layers_minus1 = 0; // max temporal layer minus 1
+ vps->vps_temporal_id_nesting_flag = 1;
+ vps->vps_reserved_0xffff_16bits = 0xFFFF;
+ // hevc::ProfileTierParamSet ptps;
+ memset(&vps->ptps, 0, sizeof(vps->ptps));
+ fill_profile_tier_level(vps->vps_max_layers_minus1, &protier_param, 1);
+ vps->vps_sub_layer_ordering_info_present_flag = 0;
+ for (i = 0; i < MAX_TEMPORAL_SUBLAYERS; i++)
+ {
+ vps->vps_max_dec_pic_buffering_minus1[i] = intra_period == 1 ? 1 : 6;
+ vps->vps_max_num_reorder_pics[i] = ip_period != 0 ? ip_period -1 : 0;
+ vps->vps_max_latency_increase_plus1[i] = 0;
+ }
+ vps->vps_max_layer_id = 0;
+ vps->vps_num_layer_sets_minus1 = 0;
+ vps->vps_sub_layer_ordering_info_present_flag = 0;
+ vps->vps_max_nuh_reserved_zero_layer_id = 0;
+ vps->vps_max_op_sets = 1;
+ vps->vps_timing_info_present_flag = 0;
+ vps->vps_extension_flag = 0;
+}
+
+static void fill_short_term_ref_pic_header(
+ struct ShortTermRefPicParamSet *strp,
+ uint8_t strp_index)
+{
+ uint32_t i = 0;
+ // inter_ref_pic_set_prediction_flag is always 0 now
+ strp->inter_ref_pic_set_prediction_flag = 0;
+ /* don't need to set below parameters since inter_ref_pic_set_prediction_flag equal to 0
+ strp->delta_idx_minus1 should be set to 0 since strp_index != num_short_term_ref_pic_sets in sps
+ strp->delta_rps_sign;
+ strp->abs_delta_rps_minus1;
+ strp->used_by_curr_pic_flag[j];
+ strp->use_delta_flag[j];
+ */
+ strp->num_negative_pics = num_active_ref_p;
+ int num_positive_pics = ip_period > 1 ? 1 : 0;
+ strp->num_positive_pics = strp_index == 0 ? 0 : num_positive_pics;
+
+ if (strp_index == 0)
+ {
+ for (i = 0; i < strp->num_negative_pics; i++)
+ {
+ strp->delta_poc_s0_minus1[i] = ip_period - 1;
+ strp->used_by_curr_pic_s0_flag[i] = 1;
+ }
+ }
+ else
+ {
+ for (i = 0; i < strp->num_negative_pics; i++)
+ {
+ strp->delta_poc_s0_minus1[i] = (i == 0) ?
+ (strp_index - 1) : (ip_period - 1);
+ strp->used_by_curr_pic_s0_flag[i] = 1;
+ }
+ for (i = 0; i < strp->num_positive_pics; i++)
+ {
+ strp->delta_poc_s1_minus1[i] = ip_period - 1 - strp_index;
+ strp->used_by_curr_pic_s1_flag[i] = 1;
+ }
+
+ }
+}
+
+void fill_sps_header(struct SeqParamSet *sps, int id)
+{
+ int i = 0;
+ memset(sps, 0, sizeof(struct SeqParamSet));
+
+ sps->sps_video_parameter_set_id = 0;
+ sps->sps_max_sub_layers_minus1 = 0;
+ sps->sps_temporal_id_nesting_flag = 1;
+ fill_profile_tier_level(sps->sps_max_sub_layers_minus1, &sps->ptps, 1);
+ sps->sps_seq_parameter_set_id = id;
+ sps->chroma_format_idc = 1;
+ if (sps->chroma_format_idc == 3)
+ {
+ sps->separate_colour_plane_flag = 0;
+ }
+ frame_width_aligned = ALIGN16(frame_width);
+ frame_height_aligned = ALIGN16(frame_height);
+ sps->pic_width_in_luma_samples = frame_width_aligned;
+ sps->pic_height_in_luma_samples = frame_height_aligned;
+ if (frame_width_aligned != frame_width ||
+ frame_height_aligned != frame_height)
+ {
+ sps->conformance_window_flag = 1;
+ sps->conf_win_left_offset = 0;
+ sps->conf_win_top_offset = 0;
+ switch (sps->chroma_format_idc)
+ {
+ case 0:
+ case 3: // 4:4:4 format
+ sps->conf_win_right_offset = (frame_width_aligned - frame_width);
+ sps->conf_win_bottom_offset = (frame_height_aligned - frame_height);
+ break;
+
+ case 2: // 4:2:2 format
+ sps->conf_win_right_offset = (frame_width_aligned - frame_width) >> 1;
+ sps->conf_win_bottom_offset = (frame_height_aligned - frame_height);
+ break;
+
+ case 1:
+ default: // 4:2:0 format
+ sps->conf_win_right_offset = (frame_width_aligned - frame_width) >> 1;
+ sps->conf_win_bottom_offset = (frame_height_aligned - frame_height) >> 1;
+ break;
+ }
+ }
+ else
+ {
+ sps->conformance_window_flag = 0;
+ }
+
+ sps->bit_depth_luma_minus8 = 0;
+ sps->bit_depth_chroma_minus8 = 0;
+ sps->log2_max_pic_order_cnt_lsb_minus4 =MAX((ceil(log(ip_period - 1 + 4)/log(2.0))+3), 4) - 4;
+ sps->sps_sub_layer_ordering_info_present_flag = 0;
+ for (i = 0; i < MAX_TEMPORAL_SUBLAYERS; i++)
+ {
+ sps->sps_max_dec_pic_buffering_minus1[i] = intra_period == 1 ? 1 : 6;
+ sps->sps_max_num_reorder_pics[i] = ip_period != 0 ? ip_period - 1 : 0;
+ sps->sps_max_latency_increase_plus1[i] = 0;
+ }
+ sps->log2_min_luma_coding_block_size_minus3 = 0;
+ int log2_max_luma_coding_block_size = log2(LCU_SIZE);
+ int log2_min_luma_coding_block_size = sps->log2_min_luma_coding_block_size_minus3 + 3;
+ sps->log2_diff_max_min_luma_coding_block_size = log2_max_luma_coding_block_size -
+ log2_min_luma_coding_block_size;
+ sps->log2_min_luma_transform_block_size_minus2 = 0;
+ sps->log2_diff_max_min_luma_transform_block_size = 3;
+ sps->max_transform_hierarchy_depth_inter = 2;
+ sps->max_transform_hierarchy_depth_intra = 2;
+ sps->scaling_list_enabled_flag = 0;
+ //sps->sps_scaling_list_data_present_flag; // ignore since scaling_list_enabled_flag equal to 0
+ sps->amp_enabled_flag = 1;
+ sps->sample_adaptive_offset_enabled_flag = 0;
+ sps->pcm_enabled_flag = 0;
+ /* ignore below parameters seting since pcm_enabled_flag equal to 0
+ pcm_sample_bit_depth_luma_minus1;
+ pcm_sample_bit_depth_chroma_minus1;
+ log2_min_pcm_luma_coding_block_size_minus3;
+ log2_diff_max_min_pcm_luma_coding_block_size;
+ pcm_loop_filter_disabled_flag;
+ */
+ sps->num_short_term_ref_pic_sets = ip_period;
+
+ memset(&sps->strp[0], 0, sizeof(sps->strp));
+ for (i = 0; i < MIN(sps->num_short_term_ref_pic_sets, 64); i++)
+ fill_short_term_ref_pic_header(&sps->strp[i], i);
+ sps->long_term_ref_pics_present_flag = 0;
+ /* ignore below parameters seting since long_term_ref_pics_present_flag equal to 0
+ num_long_term_ref_pics_sps;
+ lt_ref_pic_poc_lsb_sps[kMaxLongTermRefPic];
+ used_by_curr_pic_lt_sps_flag[kMaxLongTermRefPic];
+ */
+ sps->sps_temporal_mvp_enabled_flag = 1;
+ sps->strong_intra_smoothing_enabled_flag = 0;
+
+ sps->vui_parameters_present_flag = 0;
+ sps->sps_extension_present_flag = 0;
+ /* ignore below parameters seting since sps_extension_present_flag equal to 0
+ sps->sps_range_extension_flag
+ sps->sps_multilayer_extension_flag
+ sps->sps_3d_extension_flag
+ sps->sps_extension_5bits
+ sps->sps_extension_data_flag
+ */
+}
+
+static void fill_pps_header(
+ struct PicParamSet *pps,
+ uint32_t pps_id,
+ uint32_t sps_id)
+{
+ memset(pps, 0, sizeof(struct PicParamSet));
+
+ pps->pps_pic_parameter_set_id = pps_id;
+ pps->pps_seq_parameter_set_id = sps_id;
+ pps->dependent_slice_segments_enabled_flag = 0;
+ pps->output_flag_present_flag = 0;
+ pps->num_extra_slice_header_bits = 0;
+ pps->sign_data_hiding_enabled_flag = 0;
+ pps->cabac_init_present_flag = 1;
+
+ pps->num_ref_idx_l0_default_active_minus1 = 0;
+ pps->num_ref_idx_l1_default_active_minus1 = 0;
+
+ pps->init_qp_minus26 = initial_qp - 26;
+ pps->constrained_intra_pred_flag = 0;
+ pps->transform_skip_enabled_flag = 0;
+ pps->cu_qp_delta_enabled_flag =0;
+ if (pps->cu_qp_delta_enabled_flag)
+ pps->diff_cu_qp_delta_depth = 0;
+ pps->pps_cb_qp_offset = 0;
+ pps->pps_cr_qp_offset = 0;
+ pps->pps_slice_chroma_qp_offsets_present_flag = 0;
+ pps->weighted_pred_flag = 0;
+ pps->weighted_bipred_flag = 0;
+ pps->transquant_bypass_enabled_flag = 0;
+ pps->entropy_coding_sync_enabled_flag = 0;
+ pps->tiles_enabled_flag = 0;
+
+ pps->pps_loop_filter_across_slices_enabled_flag = 0;
+ pps->deblocking_filter_control_present_flag = 1;
+ pps->deblocking_filter_override_enabled_flag = 0,
+ pps->pps_deblocking_filter_disabled_flag = 0,
+ pps->pps_beta_offset_div2 = 2,
+ pps->pps_tc_offset_div2 = 0,
+ pps->pps_scaling_list_data_present_flag = 0;
+ pps->lists_modification_present_flag = 0;
+ pps->log2_parallel_merge_level_minus2 = 0;
+ pps->slice_segment_header_extension_present_flag = 0;
+ pps->pps_extension_present_flag = 0;
+ pps->pps_range_extension_flag = 0;
+
+}
+static void fill_slice_header(
+ uint32_t count,
+ struct PicParamSet *pps,
+ struct SliceHeader *slice)
+{
+ memset(slice, 0, sizeof(struct SliceHeader));
+ slice->pic_output_flag = 1;
+ slice->colour_plane_id = 0;
+ slice->no_output_of_prior_pics_flag = 0;
+ slice->pic_order_cnt_lsb = calc_poc((current_frame_display - current_IDR_display) % MaxPicOrderCntLsb);
+
+ //slice_segment_address (u(v))
+ slice->picture_height_in_ctus = (frame_height + LCU_SIZE -1)/LCU_SIZE;
+ slice->picture_width_in_ctus = (frame_width + LCU_SIZE -1)/LCU_SIZE;
+ slice->slice_segment_address = 0;
+ slice->first_slice_segment_in_pic_flag = ((slice->slice_segment_address == 0) ? 1 : 0);
+ slice->slice_type = current_frame_type == FRAME_P ? (p2b ? SLICE_B :SLICE_P):
+ current_frame_type == FRAME_B ? SLICE_B : SLICE_I;
+
+ slice->dependent_slice_segment_flag = 0;
+ slice->short_term_ref_pic_set_sps_flag = 1;
+ slice->num_ref_idx_active_override_flag = 0;
+ slice->short_term_ref_pic_set_idx = slice->pic_order_cnt_lsb % ip_period;
+ slice->strp.num_negative_pics = numShortTerm;
+ slice->strp.num_positive_pics = 0;
+ slice->slice_sao_luma_flag = 0;
+ slice->slice_sao_chroma_flag = 0;
+ slice->slice_temporal_mvp_enabled_flag = 1;
+
+ slice->num_ref_idx_l0_active_minus1 = pps->num_ref_idx_l0_default_active_minus1;
+ slice->num_ref_idx_l1_active_minus1 = pps->num_ref_idx_l1_default_active_minus1;
+
+ slice->num_poc_total_cur = 0;
+ // for I slice
+ if (current_frame_type == FRAME_I || current_frame_type == FRAME_IDR)
+ {
+ slice->ref_pic_list_modification_flag_l0 = 0;
+ slice->list_entry_l0 = 0;
+ slice->ref_pic_list_modification_flag_l1 = 0;
+ slice->list_entry_l1 = 0;
+ }
+ else
+ {
+ slice->ref_pic_list_modification_flag_l0 = 1;
+ slice->num_poc_total_cur = 2;
+ }
+
+ slice->ref_pic_list_combination_flag = 0;
+ slice->num_ref_idx_lc_active_minus1 = 0;
+ slice->ref_pic_list_modification_flag_lc = 0;
+ slice->pic_from_list_0_flag = 0;
+ slice->ref_idx_list_curr = 0;
+ slice->mvd_l1_zero_flag = 0;
+ slice->cabac_init_present_flag = 0;
+
+ slice->slice_qp_delta = 0;
+ slice->slice_qp_delta_cb = pps->pps_cb_qp_offset;
+ slice->slice_qp_delta_cr = pps->pps_cr_qp_offset;
+
+ slice->deblocking_filter_override_flag = 0;
+ slice->disable_deblocking_filter_flag = 0;
+ slice->tc_offset_div2 = pps->pps_tc_offset_div2;
+ slice->beta_offset_div2 = pps->pps_beta_offset_div2;
+
+ slice->collocated_from_l0_flag = 1;
+ slice->collocated_ref_idx = pps->num_ref_idx_l0_default_active_minus1;
+
+ slice->five_minus_max_num_merge_cand = 0;
+
+ slice->slice_loop_filter_across_slices_enabled_flag = 0;
+ slice->num_entry_point_offsets = 0;
+ slice->offset_len_minus1 = 0;
+}
+
+static void protier_rbsp(bitstream *bs)
+{
+ uint32_t i = 0;
+ put_ui(bs, protier_param.general_profile_space, 2);
+ put_ui(bs, protier_param.general_tier_flag, 1);
+ put_ui(bs, protier_param.general_profile_idc, 5);
+
+ for (i = 0; i < 32; i++)
+ put_ui(bs, protier_param.general_profile_compatibility_flag[i], 1);
+
+ put_ui(bs, protier_param.general_progressive_source_flag, 1);
+ put_ui(bs, protier_param.general_interlaced_source_flag, 1);
+ put_ui(bs, protier_param.general_non_packed_constraint_flag, 1);
+ put_ui(bs, protier_param.general_frame_only_constraint_flag, 1);
+ put_ui(bs, 0, 16);
+ put_ui(bs, 0, 16);
+ put_ui(bs, 0, 12);
+ put_ui(bs, protier_param.general_level_idc, 8);
+}
+void pack_short_term_ref_pic_setp(
+ bitstream *bs,
+ struct ShortTermRefPicParamSet* strp,
+ int first_strp)
+{
+ uint32_t i = 0;
+ if (!first_strp)
+ put_ui(bs, strp->inter_ref_pic_set_prediction_flag, 1);
+
+ // inter_ref_pic_set_prediction_flag is always 0 now
+ put_ue(bs, strp->num_negative_pics);
+ put_ue(bs, strp->num_positive_pics);
+
+ for (i = 0; i < strp->num_negative_pics; i++)
+ {
+ put_ue(bs, strp->delta_poc_s0_minus1[i]);
+ put_ui(bs, strp->used_by_curr_pic_s0_flag[i], 1);
+ }
+ for (i = 0; i < strp->num_positive_pics; i++)
+ {
+ put_ue(bs, strp->delta_poc_s1_minus1[i]);
+ put_ui(bs, strp->used_by_curr_pic_s1_flag[i], 1);
+ }
+}
+static void vps_rbsp(bitstream *bs)
+{
+ uint32_t i = 0;
+ put_ui(bs, vps.vps_video_parameter_set_id, 4);
+ put_ui(bs, 3, 2); //vps_reserved_three_2bits
+ put_ui(bs, 0, 6); //vps_reserved_zero_6bits
+
+ put_ui(bs, vps.vps_max_sub_layers_minus1, 3);
+ put_ui(bs, vps.vps_temporal_id_nesting_flag, 1);
+ put_ui(bs, 0xFFFF, 16); //vps_reserved_0xffff_16bits
+ protier_rbsp(bs);
+
+ put_ui(bs, vps.vps_sub_layer_ordering_info_present_flag, 1);
+
+ for (i = (vps.vps_sub_layer_ordering_info_present_flag ? 0 : vps.vps_max_sub_layers_minus1); i <= vps.vps_max_sub_layers_minus1; i++)
+ {
+ // NOTE: In teddi and mv_encoder, the setting is max_dec_pic_buffering.
+ // here just follow the spec 7.3.2.1
+ put_ue(bs, vps.vps_max_dec_pic_buffering_minus1[i]);
+ put_ue(bs, vps.vps_max_num_reorder_pics[i]);
+ put_ue(bs, vps.vps_max_latency_increase_plus1[i]);
+ }
+
+ put_ui(bs, vps.vps_max_nuh_reserved_zero_layer_id, 6);
+ put_ue(bs, vps.vps_num_op_sets_minus1);
+
+ put_ui(bs, vps.vps_timing_info_present_flag, 1);
+
+ if (vps.vps_timing_info_present_flag)
+ {
+ put_ue(bs, vps.vps_num_units_in_tick);
+ put_ue(bs, vps.vps_time_scale);
+ put_ue(bs, vps.vps_poc_proportional_to_timing_flag);
+ if (vps.vps_poc_proportional_to_timing_flag)
+ {
+ put_ue(bs, vps.vps_num_ticks_poc_diff_one_minus1);
+ }
+ put_ue(bs, vps.vps_num_hrd_parameters);
+ for (i = 0; i < vps.vps_num_hrd_parameters; i++)
+ {
+ put_ue(bs, vps.hrd_layer_set_idx[i]);
+ if (i > 0)
+ {
+ put_ui(bs, vps.cprms_present_flag[i], 1);
+ }
+ }
+ }
+
+ // no extension flag
+ put_ui(bs, 0, 1);
+}
+
+static void sps_rbsp(bitstream *bs)
+{
+ uint32_t i = 0;
+ put_ui(bs, sps.sps_video_parameter_set_id, 4);
+ put_ui(bs, sps.sps_max_sub_layers_minus1, 3);
+ put_ui(bs, sps.sps_temporal_id_nesting_flag, 1);
+
+ protier_rbsp(bs);
+
+ put_ue(bs, sps.sps_seq_parameter_set_id);
+ put_ue(bs, sps.chroma_format_idc);
+
+ if (sps.chroma_format_idc == 3)
+ {
+ put_ui(bs, sps.separate_colour_plane_flag, 1);
+
+ }
+ put_ue(bs, sps.pic_width_in_luma_samples);
+ put_ue(bs, sps.pic_height_in_luma_samples);
+
+ put_ui(bs, sps.conformance_window_flag, 1);
+
+ if (sps.conformance_window_flag)
+ {
+ put_ue(bs, sps.conf_win_left_offset);
+ put_ue(bs, sps.conf_win_right_offset);
+ put_ue(bs, sps.conf_win_top_offset);
+ put_ue(bs, sps.conf_win_bottom_offset);
+ }
+ put_ue(bs, sps.bit_depth_luma_minus8);
+ put_ue(bs, sps.bit_depth_chroma_minus8);
+ put_ue(bs, sps.log2_max_pic_order_cnt_lsb_minus4);
+ put_ui(bs, sps.sps_sub_layer_ordering_info_present_flag, 1);
+
+ for (i = (sps.sps_sub_layer_ordering_info_present_flag ? 0 : sps.sps_max_sub_layers_minus1); i <= sps.sps_max_sub_layers_minus1; i++)
+ {
+ // NOTE: In teddi and mv_encoder, the setting is max_dec_pic_buffering.
+ // here just follow the spec 7.3.2.2
+ put_ue(bs, sps.sps_max_dec_pic_buffering_minus1[i]);
+ put_ue(bs, sps.sps_max_num_reorder_pics[i]);
+ put_ue(bs, sps.sps_max_latency_increase_plus1[i]);
+ }
+
+ put_ue(bs, sps.log2_min_luma_coding_block_size_minus3);
+ put_ue(bs, sps.log2_diff_max_min_luma_coding_block_size);
+ put_ue(bs, sps.log2_min_luma_transform_block_size_minus2);
+ put_ue(bs, sps.log2_diff_max_min_luma_transform_block_size);
+ put_ue(bs, sps.max_transform_hierarchy_depth_inter);
+ put_ue(bs, sps.max_transform_hierarchy_depth_intra);
+
+ // scaling_list_enabled_flag is set as 0 in fill_sps_header() for now
+ put_ui(bs, sps.scaling_list_enabled_flag, 1);
+ if (sps.scaling_list_enabled_flag)
+ {
+ put_ui(bs, sps.sps_scaling_list_data_present_flag, 1);
+ if (sps.sps_scaling_list_data_present_flag)
+ {
+ //scaling_list_data();
+ }
+ }
+
+ put_ui(bs, sps.amp_enabled_flag, 1);
+ put_ui(bs, sps.sample_adaptive_offset_enabled_flag, 1);
+
+ // pcm_enabled_flag is set as 0 in fill_sps_header() for now
+ put_ui(bs, sps.pcm_enabled_flag, 1);
+ if (sps.pcm_enabled_flag)
+ {
+ put_ui(bs, sps.pcm_sample_bit_depth_luma_minus1, 4);
+ put_ui(bs, sps.pcm_sample_bit_depth_chroma_minus1, 4);
+ put_ue(bs, sps.log2_min_pcm_luma_coding_block_size_minus3);
+ put_ue(bs, sps.log2_diff_max_min_pcm_luma_coding_block_size);
+ put_ui(bs, sps.pcm_loop_filter_disabled_flag, 1);
+ }
+
+ put_ue(bs, sps.num_short_term_ref_pic_sets);
+ for (i = 0; i < sps.num_short_term_ref_pic_sets; i++)
+ {
+ pack_short_term_ref_pic_setp(bs, &sps.strp[i], i == 0);
+ }
+
+ // long_term_ref_pics_present_flag is set as 0 in fill_sps_header() for now
+ put_ui(bs, sps.long_term_ref_pics_present_flag, 1);
+ if (sps.long_term_ref_pics_present_flag)
+ {
+ put_ue(bs, sps.num_long_term_ref_pics_sps);
+ for (i = 0; i < sps.num_long_term_ref_pics_sps; i++)
+ {
+ put_ue(bs, sps.lt_ref_pic_poc_lsb_sps[i]);
+ put_ui(bs, sps.used_by_curr_pic_lt_sps_flag[i], 1);
+ }
+ }
+
+ put_ui(bs, sps.sps_temporal_mvp_enabled_flag, 1);
+ put_ui(bs, sps.strong_intra_smoothing_enabled_flag, 1);
+
+ // vui_parameters_present_flag is set as 0 in fill_sps_header() for now
+ put_ui(bs, sps.vui_parameters_present_flag, 1);
+
+ put_ui(bs, sps.sps_extension_present_flag, 1);
+}
+
+static void pps_rbsp(bitstream *bs)
+{
+ uint32_t i = 0;
+ put_ue(bs, pps.pps_pic_parameter_set_id);
+ put_ue(bs, pps.pps_seq_parameter_set_id);
+ put_ui(bs, pps.dependent_slice_segments_enabled_flag, 1);
+ put_ui(bs, pps.output_flag_present_flag, 1);
+ put_ui(bs, pps.num_extra_slice_header_bits, 3);
+ put_ui(bs, pps.sign_data_hiding_enabled_flag, 1);
+ put_ui(bs, pps.cabac_init_present_flag, 1);
+
+ put_ue(bs, pps.num_ref_idx_l0_default_active_minus1);
+ put_ue(bs, pps.num_ref_idx_l1_default_active_minus1);
+ put_se(bs, pps.init_qp_minus26);
+
+ put_ui(bs, pps.constrained_intra_pred_flag, 1);
+ put_ui(bs, pps.transform_skip_enabled_flag, 1);
+
+ put_ui(bs, pps.cu_qp_delta_enabled_flag, 1);
+ if (pps.cu_qp_delta_enabled_flag)
+ {
+ put_ue(bs, pps.diff_cu_qp_delta_depth);
+ }
+
+ put_se(bs, pps.pps_cb_qp_offset);
+ put_se(bs, pps.pps_cr_qp_offset);
+
+ put_ui(bs, pps.pps_slice_chroma_qp_offsets_present_flag, 1);
+ put_ui(bs, pps.weighted_pred_flag, 1);
+ put_ui(bs, pps.weighted_bipred_flag, 1);
+ put_ui(bs, pps.transquant_bypass_enabled_flag, 1);
+ put_ui(bs, pps.tiles_enabled_flag, 1);
+ put_ui(bs, pps.entropy_coding_sync_enabled_flag, 1);
+
+ if (pps.tiles_enabled_flag)
+ {
+ put_ue(bs, pps.num_tile_columns_minus1);
+ put_ue(bs, pps.num_tile_rows_minus1);
+ put_ui(bs, pps.uniform_spacing_flag, 1);
+ if (!pps.uniform_spacing_flag)
+ {
+ for (i = 0; i < pps.num_tile_columns_minus1; i++)
+ {
+ put_ue(bs, pps.column_width_minus1[i]);
+ }
+
+ for (i = 0; i < pps.num_tile_rows_minus1; i++)
+ {
+ put_ue(bs, pps.row_height_minus1[i]);
+ }
+
+ }
+ put_ui(bs, pps.loop_filter_across_tiles_enabled_flag, 1);
+ }
+
+ put_ui(bs, pps.pps_loop_filter_across_slices_enabled_flag, 1);
+ put_ui(bs, pps.deblocking_filter_control_present_flag, 1);
+ if (pps.deblocking_filter_control_present_flag)
+ {
+ put_ui(bs, pps.deblocking_filter_override_enabled_flag, 1);
+ put_ui(bs, pps.pps_deblocking_filter_disabled_flag, 1);
+ if (!pps.pps_deblocking_filter_disabled_flag)
+ {
+ put_se(bs, pps.pps_beta_offset_div2);
+ put_se(bs, pps.pps_tc_offset_div2);
+ }
+ }
+
+ // pps_scaling_list_data_present_flag is set as 0 in fill_pps_header() for now
+ put_ui(bs, pps.pps_scaling_list_data_present_flag, 1);
+ if (pps.pps_scaling_list_data_present_flag)
+ {
+ //scaling_list_data();
+ }
+
+ put_ui(bs, pps.lists_modification_present_flag, 1);
+ put_ue(bs, pps.log2_parallel_merge_level_minus2);
+ put_ui(bs, pps.slice_segment_header_extension_present_flag, 1);
+
+ put_ui(bs, pps.pps_extension_present_flag, 1);
+ if (pps.pps_extension_present_flag)
+ {
+ put_ui(bs, pps.pps_range_extension_flag, 1);
+ put_ui(bs, pps.pps_multilayer_extension_flag, 1);
+ put_ui(bs, pps.pps_3d_extension_flag, 1);
+ put_ui(bs, pps.pps_extension_5bits, 1);
+
+ }
+
+ if (pps.pps_range_extension_flag)
+ {
+ if (pps.transform_skip_enabled_flag)
+ put_ue(bs, pps.log2_max_transform_skip_block_size_minus2);
+ put_ui(bs, pps.cross_component_prediction_enabled_flag, 1);
+ put_ui(bs, pps.chroma_qp_offset_list_enabled_flag, 1);
+
+ if (pps.chroma_qp_offset_list_enabled_flag)
+ {
+ put_ue(bs, pps.diff_cu_chroma_qp_offset_depth);
+ put_ue(bs, pps.chroma_qp_offset_list_len_minus1);
+ for (i = 0; i <= pps.chroma_qp_offset_list_len_minus1; i++)
+ {
+ put_ue(bs, pps.cb_qp_offset_list[i]);
+ put_ue(bs, pps.cr_qp_offset_list[i]);
+ }
+ }
+
+ put_ue(bs, pps.log2_sao_offset_scale_luma);
+ put_ue(bs, pps.log2_sao_offset_scale_chroma);
+ }
+
+}
+static void sliceHeader_rbsp(
+ bitstream *bs,
+ struct SliceHeader *slice_header,
+ struct SeqParamSet *sps,
+ struct PicParamSet *pps,
+ int isidr)
+{
+ uint8_t nal_unit_type = NALU_TRAIL_R;
+ int gop_ref_distance = ip_period;
+ int incomplete_mini_gop = 0;
+ int p_slice_flag = 1;
+ int i = 0;
+
+ put_ui(bs, slice_header->first_slice_segment_in_pic_flag, 1);
+ if (slice_header->pic_order_cnt_lsb == 0)
+ nal_unit_type = NALU_IDR_W_DLP;
+
+ if (nal_unit_type >= 16 && nal_unit_type <= 23)
+ put_ui(bs, slice_header->no_output_of_prior_pics_flag, 1);
+
+ put_ue(bs, slice_header->slice_pic_parameter_set_id);
+
+ if (!slice_header->first_slice_segment_in_pic_flag)
+ {
+ if (slice_header->dependent_slice_segment_flag)
+ {
+ put_ui(bs, slice_header->dependent_slice_segment_flag, 1);
+ }
+
+ put_ui(bs, slice_header->slice_segment_address,
+ (uint8_t)(ceil(log(slice_header->picture_height_in_ctus * slice_header->picture_width_in_ctus) / log(2.0))));
+ }
+ if (!slice_header->dependent_slice_segment_flag)
+ {
+ for (i = 0; i < pps->num_extra_slice_header_bits; i++)
+ {
+ put_ui(bs, slice_header->slice_reserved_undetermined_flag[i], 1);
+ }
+ put_ue(bs, slice_header->slice_type);
+ if (pps->output_flag_present_flag)
+ {
+ put_ui(bs, slice_header->pic_output_flag, 1);
+ }
+ if (sps->separate_colour_plane_flag == 1)
+ {
+ put_ui(bs, slice_header->colour_plane_id, 2);
+ }
+
+ if (!(nal_unit_type == NALU_IDR_W_DLP || nal_unit_type == NALU_IDR_N_LP))
+ {
+ put_ui(bs, slice_header->pic_order_cnt_lsb, (sps->log2_max_pic_order_cnt_lsb_minus4 + 4));
+ put_ui(bs, slice_header->short_term_ref_pic_set_sps_flag, 1);
+
+ if (!slice_header->short_term_ref_pic_set_sps_flag)
+ {
+ // refer to Teddi
+ if (sps->num_short_term_ref_pic_sets > 0)
+ put_ui(bs, 0, 1); // inter_ref_pic_set_prediction_flag, always 0 for now
+
+ put_ue(bs, slice_header->strp.num_negative_pics);
+ put_ue(bs, slice_header->strp.num_positive_pics);
+
+ // below chunks of codes (majorly two big 'for' blocks) are refering both
+ // Teddi and mv_encoder, they look kind of ugly, however, keep them as these
+ // since it will be pretty easy to update if change/update in Teddi side.
+ // According to Teddi, these are CModel Implementation.
+ int prev = 0;
+ int frame_cnt_in_gop = slice_header->pic_order_cnt_lsb / 2;
+ // this is the first big 'for' block
+ for (i = 0; i < slice_header->strp.num_negative_pics; i++)
+ {
+ // Low Delay B case
+ if (1 == gop_ref_distance)
+ {
+ put_ue(bs, 0 /*delta_poc_s0_minus1*/);
+ }
+ else
+ {
+ if(incomplete_mini_gop)
+ {
+ if (frame_cnt_in_gop % gop_ref_distance > i)
+ {
+ put_ue(bs, 0 /*delta_poc_s0_minus1*/);
+ }
+ else
+ {
+ int DeltaPoc = -(int)(gop_ref_distance);
+ put_ue(bs, prev - DeltaPoc - 1 /*delta_poc_s0_minus1*/);
+ }
+ }
+ else
+ {
+ // For Non-BPyramid GOP i.e B0 type
+ if (num_active_ref_p > 1)
+ {
+ // MultiRef Case
+ if (p_slice_flag)
+ {
+ // DeltaPOC Equals NumB
+ int DeltaPoc = -(int)(gop_ref_distance);
+ put_ue(bs, prev - DeltaPoc - 1 /*delta_poc_s0_minus1*/);
+ }
+ else
+ {
+ // for normal B
+ if (frame_cnt_in_gop < gop_ref_distance)
+ {
+ if (0 == i)
+ {
+ int DeltaPoc = -(int)(frame_cnt_in_gop);
+ put_ue(bs, prev - DeltaPoc - 1 /*delta_poc_s0_minus1*/);
+ }
+ }
+ else if (frame_cnt_in_gop > gop_ref_distance)
+ {
+ if (0 == i)
+ {
+ //Need % to wraparound the delta poc, to avoid corruption caused on POC=5 with GOP (29,2) and 4 refs
+ int DeltaPoc = -(int)((frame_cnt_in_gop - gop_ref_distance) % gop_ref_distance);
+ put_ue(bs, prev - DeltaPoc - 1 /*delta_poc_s0_minus1*/);
+ }
+ else if (1 <= i)
+ {
+ int DeltaPoc = -(int)(gop_ref_distance);
+ put_ue(bs, prev - DeltaPoc - 1 /*delta_poc_s0_minus1*/);
+ }
+ }
+ }
+ }
+ else
+ {
+ // the big 'if' wraps here is -
+ // if (!slice_header->short_term_ref_pic_set_sps_flag)
+ // From the Teddi logic, the short_term_ref_pic_set_sps_flag only can be '0'
+ // either for B-Prymid or first several frames in a GOP in multi-ref cases
+ // when there are not enough backward refs.
+ // So though there are really some codes under this 'else'in Teddi, don't
+ // want to introduce them in MEA to avoid confusion, and put an assert
+ // here to guard that there is new case we need handle in the future.
+ assert(0);
+
+ }
+ }
+ }
+ put_ui(bs, 1 /*used_by_curr_pic_s0_flag*/,1);
+ }
+
+ prev = 0;
+ // this is the second big 'for' block
+ for (i = 0; i < slice_header->strp.num_positive_pics; i++)
+ {
+ // Non-BPyramid GOP
+ if (num_active_ref_p > 1)
+ {
+ // MultiRef Case
+ if (frame_cnt_in_gop < gop_ref_distance)
+ {
+ int DeltaPoc = (int)(gop_ref_distance - frame_cnt_in_gop);
+ put_ue(bs, DeltaPoc - prev - 1 /*delta_poc_s1_minus1*/);
+ }
+ else if (frame_cnt_in_gop > gop_ref_distance)
+ {
+ int DeltaPoc = (int)(gop_ref_distance * slice_header->strp.num_negative_pics - frame_cnt_in_gop);
+ put_ue(bs, DeltaPoc - prev - 1 /*delta_poc_s1_minus1*/);
+ }
+ }
+ else
+ {
+ // the big 'if' wraps here is -
+ // if (!slice_header->short_term_ref_pic_set_sps_flag)
+ // From the Teddi logic, the short_term_ref_pic_set_sps_flag only can be '0'
+ // either for B-Prymid or first several frames in a GOP in multi-ref cases
+ // when there are not enough backward refs.
+ // So though there are really some codes under this 'else'in Teddi, don't
+ // want to introduce them in MEA to avoid confusion, and put an assert
+ // here to guard that there is new case we need handle in the future.
+ assert(0);
+ }
+ put_ui(bs, 1 /*used_by_curr_pic_s1_flag*/,1);
+ }
+ }
+ else if (sps->num_short_term_ref_pic_sets > 1)
+ put_ui(bs, slice_header->short_term_ref_pic_set_idx,
+ (uint8_t)(ceil(log(sps->num_short_term_ref_pic_sets)/log(2.0))));
+
+ if (sps->long_term_ref_pics_present_flag)
+ {
+ if (sps->num_long_term_ref_pics_sps > 0)
+ put_ue(bs, slice_header->num_long_term_sps);
+
+ put_ue(bs, slice_header->num_long_term_pics);
+ }
+
+ if (slice_header->slice_temporal_mvp_enabled_flag)
+ put_ui(bs, slice_header->slice_temporal_mvp_enabled_flag, 1);
+
+ }
+
+ if (sps->sample_adaptive_offset_enabled_flag)
+ {
+ put_ui(bs, slice_header->slice_sao_luma_flag, 1);
+ put_ui(bs, slice_header->slice_sao_chroma_flag, 1);
+ }
+
+ if (slice_header->slice_type != SLICE_I)
+ {
+ put_ui(bs, slice_header->num_ref_idx_active_override_flag, 1);
+
+ if (slice_header->num_ref_idx_active_override_flag)
+ {
+ put_ue(bs, slice_header->num_ref_idx_l0_active_minus1);
+ if (slice_header->slice_type == SLICE_B)
+ put_ue(bs, slice_header->num_ref_idx_l1_active_minus1);
+ }
+
+ if (pps->lists_modification_present_flag && slice_header->num_poc_total_cur > 1)
+ {
+ /* ref_pic_list_modification */
+ put_ui(bs, slice_header->ref_pic_list_modification_flag_l0, 1);
+
+ if (slice_header->ref_pic_list_modification_flag_l0)
+ {
+ for (i = 0; i <= slice_header->num_ref_idx_l0_active_minus1; i++)
+ {
+ put_ui(bs, slice_header->list_entry_l0[i],
+ (uint8_t)(ceil(log(slice_header->num_poc_total_cur) / log(2.0))));
+ }
+ }
+
+ put_ui(bs, slice_header->ref_pic_list_modification_flag_l1, 1);
+
+ if (slice_header->ref_pic_list_modification_flag_l1)
+ {
+ for (i = 0; i <= slice_header->num_ref_idx_l1_active_minus1; i++)
+ {
+ put_ui(bs, slice_header->list_entry_l1[i],
+ (uint8_t)(ceil(log(slice_header->num_poc_total_cur) / log(2.0))));
+ }
+ }
+ }
+
+ if (slice_header->slice_type == SLICE_B)
+ {
+ put_ui(bs, slice_header->mvd_l1_zero_flag, 1);
+ }
+
+ if (pps->cabac_init_present_flag)
+ {
+ put_ui(bs, slice_header->cabac_init_present_flag, 1);
+ }
+
+ if (slice_header->slice_temporal_mvp_enabled_flag)
+ {
+ int collocated_from_l0_flag = 1;
+
+ if (slice_header->slice_type == SLICE_B)
+ {
+ collocated_from_l0_flag = slice_header->collocated_from_l0_flag;
+ put_ui(bs, slice_header->collocated_from_l0_flag, 1);
+ }
+
+ if (((collocated_from_l0_flag && (slice_header->num_ref_idx_l0_active_minus1 > 0)) ||
+ (!collocated_from_l0_flag && (slice_header->num_ref_idx_l1_active_minus1 > 0))))
+ {
+ put_ue(bs, slice_header->collocated_ref_idx);
+ }
+ }
+
+ put_ue(bs, slice_header->five_minus_max_num_merge_cand);
+ }
+
+ put_se(bs, slice_header->slice_qp_delta);
+
+ if (pps->chroma_qp_offset_list_enabled_flag)
+ {
+ put_se(bs, slice_header->slice_qp_delta_cb);
+ put_se(bs, slice_header->slice_qp_delta_cr);
+ }
+
+ if (pps->deblocking_filter_override_enabled_flag)
+ {
+ put_ui(bs, slice_header->deblocking_filter_override_flag, 1);
+ }
+ if (slice_header->deblocking_filter_override_flag)
+ {
+ put_ui(bs, slice_header->disable_deblocking_filter_flag, 1);
+
+ if (!slice_header->disable_deblocking_filter_flag)
+ {
+ put_se(bs, slice_header->beta_offset_div2);
+ put_se(bs, slice_header->tc_offset_div2);
+ }
+ }
+
+ if (pps->pps_loop_filter_across_slices_enabled_flag &&
+ (slice_header->slice_sao_luma_flag || slice_header->slice_sao_chroma_flag ||
+ !slice_header->disable_deblocking_filter_flag))
+ {
+ put_ui(bs, slice_header->slice_loop_filter_across_slices_enabled_flag, 1);
+ }
+
+ }
+
+ if ((pps->tiles_enabled_flag) || (pps->entropy_coding_sync_enabled_flag))
+ {
+ put_ue(bs, slice_header->num_entry_point_offsets);
+
+ if (slice_header->num_entry_point_offsets > 0)
+ {
+ put_ue(bs, slice_header->offset_len_minus1);
+ }
+ }
+
+ if (pps->slice_segment_header_extension_present_flag)
+ {
+ int slice_header_extension_length = 0;
+
+ put_ue(bs, slice_header_extension_length);
+
+ for (i = 0; i < slice_header_extension_length; i++)
+ {
+ int slice_header_extension_data_byte = 0;
+ put_ui(bs, slice_header_extension_data_byte, 8);
+ }
+ }
+}
+
+static int
+build_packed_pic_buffer(unsigned char **header_buffer)
+{
+ bitstream bs;
+
+ bitstream_start(&bs);
+ nal_start_code_prefix(&bs, NALU_PPS);
+ nal_header(&bs, NALU_PPS);
+ pps_rbsp(&bs);
+ rbsp_trailing_bits(&bs);
+ bitstream_end(&bs);
+
+ *header_buffer = (unsigned char *)bs.buffer;
+ return bs.bit_offset;
+}
+static int
+build_packed_video_buffer(unsigned char **header_buffer)
+{
+ bitstream bs;
+
+ bitstream_start(&bs);
+ nal_start_code_prefix(&bs, NALU_VPS);
+ nal_header(&bs, NALU_VPS);
+ vps_rbsp(&bs);
+ rbsp_trailing_bits(&bs);
+ bitstream_end(&bs);
+
+ *header_buffer = (unsigned char *)bs.buffer;
+ return bs.bit_offset;
+}
+
+static int
+build_packed_seq_buffer(unsigned char **header_buffer)
+{
+ bitstream bs;
+
+ bitstream_start(&bs);
+ nal_start_code_prefix(&bs, NALU_SPS);
+ nal_header(&bs, NALU_SPS);
+ sps_rbsp(&bs);
+ rbsp_trailing_bits(&bs);
+ bitstream_end(&bs);
+
+ *header_buffer = (unsigned char *)bs.buffer;
+ return bs.bit_offset;
+}
+
+static int build_packed_slice_buffer(unsigned char **header_buffer)
+{
+ bitstream bs;
+ int is_idr = !!pic_param.pic_fields.bits.idr_pic_flag;
+ int naluType = is_idr ? NALU_IDR_W_DLP : NALU_TRAIL_R;
+
+ bitstream_start(&bs);
+ nal_start_code_prefix(&bs, NALU_TRAIL_R);
+ nal_header(&bs, naluType);
+ sliceHeader_rbsp(&bs,&ssh, &sps, &pps, 0);
+ rbsp_trailing_bits(&bs);
+ bitstream_end(&bs);
+
+ *header_buffer = (unsigned char *)bs.buffer;
+ return bs.bit_offset;
+}
+
+
+/*
+ * Helper function for profiling purposes
+ */
+static unsigned int GetTickCount()
+{
+ struct timeval tv;
+ if (gettimeofday(&tv, NULL))
+ return 0;
+ return tv.tv_usec/1000+tv.tv_sec*1000;
+}
+
+/*
+ Assume frame sequence is: Frame#0,#1,#2,...,#M,...,#X,... (encoding order)
+ 1) period between Frame #X and Frame #N = #X - #N
+ 2) 0 means infinite for intra_period/intra_idr_period, and 0 is invalid for ip_period
+ 3) intra_idr_period % intra_period (intra_period > 0) and (intra_period -1)% ip_period must be 0
+ 4) intra_period and intra_idr_period take precedence over ip_period
+ 5) if ip_period > 1, intra_period and intra_idr_period are not the strict periods
+ of I/IDR frames, see bellow examples
+ -------------------------------------------------------------------
+ intra_period intra_idr_period ip_period frame sequence (intra_period/intra_idr_period/ip_period)
+ 0 ignored 1 IDRPPPPPPP ... (No IDR/I any more)
+ 0 ignored >=2 IDR(PBB)(PBB)... (No IDR/I any more)
+ 1 0 ignored IDRIIIIIII... (No IDR any more)
+ 1 1 ignored IDR IDR IDR IDR...
+ 1 >=2 ignored IDRII IDRII IDR... (1/3/ignore)
+ >=2 0 1 IDRPPP IPPP I... (3/0/1)
+ >=2 0 >=2 IDR(PBB)(PBB)(IBB) (7/0/3)
+ (PBB)(IBB)(PBB)(IBB)...
+ >=2 >=2 1 IDRPPPPP IPPPPP IPPPPP (7/14/1)
+ IDRPPPPP IPPPPP IPPPPP...
+ >=2 >=2 >=2 {IDR(PBB)(PBB)(IBB)(PBB)(IBB)(PBB)} (7/14/3)
+ {IDR(PBB)(PBB)(IBB)(PBB)(IBB)(PBB)}...
+ {IDR(PBB)(PBB)(IBB)(PBB)} (7/14/3)
+ {IDR(PBB)(PBB)(IBB)(PBB)}...
+ {IDR(PBB)(PBB)} (7/7/3)
+ {IDR(PBB)(PBB)}.
+*/
+
+/*
+ * Return displaying order with specified periods and encoding order
+ * displaying_order: displaying order
+ * frame_type: frame type
+ */
+void encoding2display_order(
+ unsigned long long encoding_order,int intra_period,
+ int intra_idr_period,int ip_period,
+ unsigned long long *displaying_order,
+ int *frame_type)
+{
+ int encoding_order_gop = 0;
+
+ if (intra_period == 1) { /* all are I/IDR frames */
+ *displaying_order = encoding_order;
+ if (intra_idr_period == 0)
+ *frame_type = (encoding_order == 0)?FRAME_IDR:FRAME_I;
+ else
+ *frame_type = (encoding_order % intra_idr_period == 0)?FRAME_IDR:FRAME_I;
+ return;
+ }
+
+ if (intra_period == 0)
+ intra_idr_period = 0;
+
+ /* new sequence like
+ * IDR PPPPP IPPPPP
+ * IDR (PBB)(PBB)(IBB)(PBB)
+ */
+ encoding_order_gop = (intra_idr_period == 0)? encoding_order:
+ (encoding_order % (intra_idr_period + ((ip_period == 1)?0:1)));
+
+ if (encoding_order_gop == 0) { /* the first frame */
+ *frame_type = FRAME_IDR;
+ *displaying_order = encoding_order;
+ } else if (((encoding_order_gop - 1) % ip_period) != 0) { /* B frames */
+ *frame_type = FRAME_B;
+ *displaying_order = encoding_order - 1;
+ } else if ((intra_period != 0) && /* have I frames */
+ (encoding_order_gop >= 2) &&
+ ((ip_period == 1 && encoding_order_gop % (intra_period-1) == 0) || /* for IDR PPPPP IPPPP */
+ /* for IDR (PBB)(PBB)(IBB) */
+ (ip_period >= 2 && ((encoding_order_gop - 1) / ip_period % ((intra_period-1) / ip_period)) == 0))) {
+ *frame_type = FRAME_I;
+ *displaying_order = encoding_order + ip_period - 1;
+ } else {
+ *frame_type = FRAME_P;
+ *displaying_order = encoding_order + ip_period - 1;
+ }
+
+
+}
+
+
+static char *fourcc_to_string(int fourcc)
+{
+ switch (fourcc) {
+ case VA_FOURCC_NV12:
+ return "NV12";
+ case VA_FOURCC_IYUV:
+ return "IYUV";
+ case VA_FOURCC_YV12:
+ return "YV12";
+ case VA_FOURCC_UYVY:
+ return "UYVY";
+ default:
+ return "Unknown";
+ }
+}
+
+static int string_to_fourcc(char *str)
+{
+ int fourcc;
+
+ if (!strncmp(str, "NV12", 4))
+ fourcc = VA_FOURCC_NV12;
+ else if (!strncmp(str, "IYUV", 4))
+ fourcc = VA_FOURCC_IYUV;
+ else if (!strncmp(str, "YV12", 4))
+ fourcc = VA_FOURCC_YV12;
+ else if (!strncmp(str, "UYVY", 4))
+ fourcc = VA_FOURCC_UYVY;
+ else {
+ printf("Unknow FOURCC\n");
+ fourcc = -1;
+ }
+ return fourcc;
+}
+
+
+static char *rc_to_string(int rcmode)
+{
+ switch (rc_mode) {
+ case VA_RC_NONE:
+ return "NONE";
+ case VA_RC_CBR:
+ return "CBR";
+ case VA_RC_VBR:
+ return "VBR";
+ case VA_RC_VCM:
+ return "VCM";
+ case VA_RC_CQP:
+ return "CQP";
+ case VA_RC_VBR_CONSTRAINED:
+ return "VBR_CONSTRAINED";
+ default:
+ return "Unknown";
+ }
+}
+
+static int string_to_rc(char *str)
+{
+ int rc_mode;
+
+ if (!strncmp(str, "NONE", 4))
+ rc_mode = VA_RC_NONE;
+ else if (!strncmp(str, "CBR", 3))
+ rc_mode = VA_RC_CBR;
+ else if (!strncmp(str, "VBR", 3))
+ rc_mode = VA_RC_VBR;
+ else if (!strncmp(str, "VCM", 3))
+ rc_mode = VA_RC_VCM;
+ else if (!strncmp(str, "CQP", 3))
+ rc_mode = VA_RC_CQP;
+ else if (!strncmp(str, "VBR_CONSTRAINED", 15))
+ rc_mode = VA_RC_VBR_CONSTRAINED;
+ else {
+ printf("Unknown RC mode\n");
+ rc_mode = -1;
+ }
+ return rc_mode;
+}
+
+
+static int print_help(void)
+{
+ printf("./hevcencode <options>\n");
+ printf(" -w <width> -h <height>\n");
+ printf(" -framecount <frame number>\n");
+ printf(" -n <frame number>\n");
+ printf(" if set to 0 and srcyuv is set, the frame count is from srcuv file\n");
+ printf(" -o <coded file>\n");
+ printf(" -f <frame rate>\n");
+ printf(" --intra_period <number>\n");
+ printf(" --idr_period <number>\n");
+ printf(" --ip_period <number>\n");
+ printf(" --bitrate <bitrate>\n");
+ printf(" --initialqp <number>\n");
+ printf(" --minqp <number>\n");
+ printf(" --rcmode <NONE|CBR|VBR|VCM|CQP|VBR_CONTRAINED>\n");
+ printf(" --syncmode: sequentially upload source, encoding, save result, no multi-thread\n");
+ printf(" --srcyuv <filename> load YUV from a file\n");
+ printf(" --fourcc <NV12|IYUV|YV12> source YUV fourcc\n");
+ printf(" --recyuv <filename> save reconstructed YUV into a file\n");
+ printf(" --enablePSNR calculate PSNR of recyuv vs. srcyuv\n");
+ printf(" --profile 1: main 2 : main10\n");
+ printf(" --p2b 1: enable 0 : disalbe(defalut)\n");
+ return 0;
+}
+
+static int process_cmdline(int argc, char *argv[])
+{
+ int c;
+ const struct option long_opts[] = {
+ {"help", no_argument, NULL, 0 },
+ {"bitrate", required_argument, NULL, 1 },
+ {"minqp", required_argument, NULL, 2 },
+ {"initialqp", required_argument, NULL, 3 },
+ {"intra_period", required_argument, NULL, 4 },
+ {"idr_period", required_argument, NULL, 5 },
+ {"ip_period", required_argument, NULL, 6 },
+ {"rcmode", required_argument, NULL, 7 },
+ {"srcyuv", required_argument, NULL, 9 },
+ {"recyuv", required_argument, NULL, 10 },
+ {"fourcc", required_argument, NULL, 11 },
+ {"syncmode", no_argument, NULL, 12 },
+ {"enablePSNR", no_argument, NULL, 13 },
+ {"prit", required_argument, NULL, 14 },
+ {"priv", required_argument, NULL, 15 },
+ {"framecount", required_argument, NULL, 16 },
+ {"profile", required_argument, NULL, 17 },
+ {"p2b", required_argument, NULL, 18 },
+ {NULL, no_argument, NULL, 0 }};
+ int long_index;
+
+ while ((c =getopt_long_only(argc,argv,"w:h:n:f:o:?",long_opts,&long_index)) != EOF) {
+ switch (c) {
+ case 'w':
+ frame_width = atoi(optarg);
+ break;
+ case 'h':
+ frame_height = atoi(optarg);
+ break;
+ case 'n':
+ case 16:
+ frame_count = atoi(optarg);
+ break;
+ case 'f':
+ frame_rate = atoi(optarg);
+ break;
+ case 'o':
+ coded_fn = strdup(optarg);
+ break;
+ case 0:
+ print_help();
+ exit(0);
+ case 1:
+ frame_bitrate = atoi(optarg);
+ break;
+ case 2:
+ minimal_qp = atoi(optarg);
+ break;
+ case 3:
+ initial_qp = atoi(optarg);
+ break;
+ case 4:
+ intra_period = atoi(optarg);
+ break;
+ case 5:
+ intra_idr_period = atoi(optarg);
+ break;
+ case 6:
+ ip_period = atoi(optarg);
+ break;
+ case 7:
+ rc_mode = string_to_rc(optarg);
+ if (rc_mode < 0) {
+ print_help();
+ exit(1);
+ }
+ break;
+ case 9:
+ srcyuv_fn = strdup(optarg);
+ break;
+ case 10:
+ recyuv_fn = strdup(optarg);
+ break;
+ case 11:
+ srcyuv_fourcc = string_to_fourcc(optarg);
+ if (srcyuv_fourcc <= 0) {
+ print_help();
+ exit(1);
+ }
+ break;
+ case 12:
+ encode_syncmode = 1;
+ break;
+ case 13:
+ calc_psnr = 1;
+ break;
+ case 14:
+ misc_priv_type = strtol(optarg, NULL, 0);
+ break;
+ case 15:
+ misc_priv_value = strtol(optarg, NULL, 0);
+ break;
+ case 17:
+ if (strncmp(optarg, "1", 1) == 0)
+ {
+ real_hevc_profile = 1;
+ hevc_profile = VAProfileHEVCMain;
+ }
+ else if (strncmp(optarg, "2", 1) == 0)
+ {
+ real_hevc_profile = 2;
+ hevc_profile = VAProfileHEVCMain10;
+ }
+ else
+ hevc_profile = 0;
+ break;
+ case 18:
+ p2b = atoi(optarg);
+ break;
+
+ case ':':
+ case '?':
+ print_help();
+ exit(0);
+ }
+ }
+
+ if (ip_period < 1) {
+ printf(" ip_period must be greater than 0\n");
+ exit(0);
+ }
+ if (intra_period != 1 && (intra_period - 1) % ip_period != 0) {
+ printf(" intra_period -1 must be a multiplier of ip_period\n");
+ exit(0);
+ }
+ if (intra_period != 0 && intra_idr_period % intra_period != 0) {
+ printf(" intra_idr_period must be a multiplier of intra_period\n");
+ exit(0);
+ }
+ if (ip_period > 1) {
+ frame_count -= (frame_count -1)%ip_period;
+ }
+
+ if (frame_bitrate == 0)
+ frame_bitrate = frame_width * frame_height * 12 * frame_rate / 50;
+
+ /* open source file */
+ if (srcyuv_fn) {
+ srcyuv_fp = fopen(srcyuv_fn,"r");
+
+ if (srcyuv_fp == NULL)
+ printf("Open source YUV file %s failed, use auto-generated YUV data\n", srcyuv_fn);
+ else {
+ struct stat tmp;
+
+ fstat(fileno(srcyuv_fp), &tmp);
+ srcyuv_frames = tmp.st_size / (frame_width * frame_height * 1.5);
+ printf("Source YUV file %s with %llu frames\n", srcyuv_fn, srcyuv_frames);
+
+ if (frame_count == 0)
+ frame_count = srcyuv_frames;
+ }
+ }
+
+ /* open source file */
+ if (recyuv_fn) {
+ recyuv_fp = fopen(recyuv_fn,"w+");
+
+ if (recyuv_fp == NULL)
+ printf("Open reconstructed YUV file %s failed\n", recyuv_fn);
+ }
+
+ if (coded_fn == NULL) {
+ struct stat buf;
+ if (stat("/tmp", &buf) == 0)
+ coded_fn = strdup("/tmp/test.265");
+ else if (stat("/sdcard", &buf) == 0)
+ coded_fn = strdup("/sdcard/test.265");
+ else
+ coded_fn = strdup("./test.265");
+ }
+
+ /* store coded data into a file */
+ coded_fp = fopen(coded_fn,"w+");
+ if (coded_fp == NULL) {
+ printf("Open file %s failed, exit\n", coded_fn);
+ exit(1);
+ }
+
+ frame_width_aligned = (frame_width + 63) & (~63);
+ frame_height_aligned = (frame_height + 63) & (~63);
+ if (frame_width != frame_width_aligned ||
+ frame_height != frame_height_aligned) {
+ printf("Source frame is %dx%d and will code clip to %dx%d with crop\n",
+ frame_width, frame_height,
+ frame_width_aligned, frame_height_aligned
+ );
+ }
+
+ return 0;
+}
+
+static int init_va(void)
+{
+ VAProfile profile_list[]={VAProfileHEVCMain,VAProfileHEVCMain10};
+ VAEntrypoint *entrypoints;
+ int num_entrypoints, slice_entrypoint;
+ int support_encode = 0;
+ int major_ver, minor_ver;
+ VAStatus va_status;
+ unsigned int i;
+
+ va_dpy = va_open_display();
+ va_status = vaInitialize(va_dpy, &major_ver, &minor_ver);
+ CHECK_VASTATUS(va_status, "vaInitialize");
+
+ num_entrypoints = vaMaxNumEntrypoints(va_dpy);
+ entrypoints = malloc(num_entrypoints * sizeof(*entrypoints));
+ if (!entrypoints) {
+ fprintf(stderr, "error: failed to initialize VA entrypoints array\n");
+ exit(1);
+ }
+
+ /* use the highest profile */
+ for (i = 0; i < sizeof(profile_list)/sizeof(profile_list[0]); i++) {
+ if ((hevc_profile != ~0) && hevc_profile != profile_list[i])
+ continue;
+
+ hevc_profile = profile_list[i];
+ vaQueryConfigEntrypoints(va_dpy, hevc_profile, entrypoints, &num_entrypoints);
+ for (slice_entrypoint = 0; slice_entrypoint < num_entrypoints; slice_entrypoint++) {
+ if (entrypoints[slice_entrypoint] == VAEntrypointEncSlice) {
+ support_encode = 1;
+ break;
+ }
+ }
+ if (support_encode == 1)
+ break;
+ }
+
+ if (support_encode == 0) {
+ printf("Can't find VAEntrypointEncSlice for HEVC profiles\n");
+ exit(1);
+ } else {
+ switch (hevc_profile) {
+ case VAProfileHEVCMain:
+ hevc_profile = VAProfileHEVCMain;
+ printf("Use profile VAProfileHEVCMain\n");
+ break;
+
+ case VAProfileHEVCMain10:
+ hevc_profile = VAProfileHEVCMain10;
+ printf("Use profile VAProfileHEVCMain10\n");
+ break;
+ default:
+ printf("unknow profile. Set to Main");
+ hevc_profile = VAProfileHEVCMain;
+ constraint_set_flag |= (1 << 0 | 1 << 1); /* Annex A.2.1 & A.2.2 */
+ ip_period = 1;
+ break;
+ }
+ }
+
+ /* find out the format for the render target, and rate control mode */
+ for (i = 0; i < VAConfigAttribTypeMax; i++)
+ attrib[i].type = i;
+
+ va_status = vaGetConfigAttributes(va_dpy, hevc_profile, VAEntrypointEncSlice,
+ &attrib[0], VAConfigAttribTypeMax);
+ CHECK_VASTATUS(va_status, "vaGetConfigAttributes");
+ /* check the interested configattrib */
+ if ((attrib[VAConfigAttribRTFormat].value & VA_RT_FORMAT_YUV420) == 0) {
+ printf("Not find desired YUV420 RT format\n");
+ exit(1);
+ } else {
+ config_attrib[config_attrib_num].type = VAConfigAttribRTFormat;
+ config_attrib[config_attrib_num].value = VA_RT_FORMAT_YUV420;
+ config_attrib_num++;
+ }
+
+ if (attrib[VAConfigAttribRateControl].value != VA_ATTRIB_NOT_SUPPORTED) {
+ int tmp = attrib[VAConfigAttribRateControl].value;
+
+ printf("Support rate control mode (0x%x):", tmp);
+
+ if (tmp & VA_RC_NONE)
+ printf("NONE ");
+ if (tmp & VA_RC_CBR)
+ printf("CBR ");
+ if (tmp & VA_RC_VBR)
+ printf("VBR ");
+ if (tmp & VA_RC_VCM)
+ printf("VCM ");
+ if (tmp & VA_RC_CQP)
+ printf("CQP ");
+ if (tmp & VA_RC_VBR_CONSTRAINED)
+ printf("VBR_CONSTRAINED ");
+
+ printf("\n");
+
+ if (rc_mode == -1 || !(rc_mode & tmp)) {
+ if (rc_mode != -1) {
+ printf("Warning: Don't support the specified RateControl mode: %s!!!, switch to ", rc_to_string(rc_mode));
+ }
+
+ for (i = 0; i < sizeof(rc_default_modes) / sizeof(rc_default_modes[0]); i++) {
+ if (rc_default_modes[i] & tmp) {
+ rc_mode = rc_default_modes[i];
+ break;
+ }
+ }
+
+ printf("RateControl mode: %s\n", rc_to_string(rc_mode));
+ }
+
+ config_attrib[config_attrib_num].type = VAConfigAttribRateControl;
+ config_attrib[config_attrib_num].value = rc_mode;
+ config_attrib_num++;
+ }
+
+
+ if (attrib[VAConfigAttribEncPackedHeaders].value != VA_ATTRIB_NOT_SUPPORTED) {
+ int tmp = attrib[VAConfigAttribEncPackedHeaders].value;
+
+ printf("Support VAConfigAttribEncPackedHeaders\n");
+
+ hevc_packedheader = 1;
+ config_attrib[config_attrib_num].type = VAConfigAttribEncPackedHeaders;
+ config_attrib[config_attrib_num].value = VA_ENC_PACKED_HEADER_NONE;
+
+ if (tmp & VA_ENC_PACKED_HEADER_SEQUENCE) {
+ printf("Support packed sequence headers\n");
+ config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_SEQUENCE;
+ }
+
+ if (tmp & VA_ENC_PACKED_HEADER_PICTURE) {
+ printf("Support packed picture headers\n");
+ config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_PICTURE;
+ }
+
+ if (tmp & VA_ENC_PACKED_HEADER_SLICE) {
+ printf("Support packed slice headers\n");
+ config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_SLICE;
+ }
+
+ if (tmp & VA_ENC_PACKED_HEADER_MISC) {
+ printf("Support packed misc headers\n");
+ config_attrib[config_attrib_num].value |= VA_ENC_PACKED_HEADER_MISC;
+ }
+
+ enc_packed_header_idx = config_attrib_num;
+ config_attrib_num++;
+ }
+
+ if (attrib[VAConfigAttribEncInterlaced].value != VA_ATTRIB_NOT_SUPPORTED) {
+ int tmp = attrib[VAConfigAttribEncInterlaced].value;
+
+ printf("Support VAConfigAttribEncInterlaced\n");
+
+ if (tmp & VA_ENC_INTERLACED_FRAME)
+ printf("support VA_ENC_INTERLACED_FRAME\n");
+ if (tmp & VA_ENC_INTERLACED_FIELD)
+ printf("Support VA_ENC_INTERLACED_FIELD\n");
+ if (tmp & VA_ENC_INTERLACED_MBAFF)
+ printf("Support VA_ENC_INTERLACED_MBAFF\n");
+ if (tmp & VA_ENC_INTERLACED_PAFF)
+ printf("Support VA_ENC_INTERLACED_PAFF\n");
+
+ config_attrib[config_attrib_num].type = VAConfigAttribEncInterlaced;
+ config_attrib[config_attrib_num].value = VA_ENC_PACKED_HEADER_NONE;
+ config_attrib_num++;
+ }
+
+ if (attrib[VAConfigAttribEncMaxRefFrames].value != VA_ATTRIB_NOT_SUPPORTED) {
+ hevc_maxref = attrib[VAConfigAttribEncMaxRefFrames].value;
+
+ printf("Support %d RefPicList0 and %d RefPicList1\n",
+ hevc_maxref & 0xffff, (hevc_maxref >> 16) & 0xffff );
+ }
+
+ if (attrib[VAConfigAttribEncMaxSlices].value != VA_ATTRIB_NOT_SUPPORTED)
+ printf("Support %d slices\n", attrib[VAConfigAttribEncMaxSlices].value);
+
+ if (attrib[VAConfigAttribEncSliceStructure].value != VA_ATTRIB_NOT_SUPPORTED) {
+ int tmp = attrib[VAConfigAttribEncSliceStructure].value;
+
+ printf("Support VAConfigAttribEncSliceStructure\n");
+
+ if (tmp & VA_ENC_SLICE_STRUCTURE_ARBITRARY_ROWS)
+ printf("Support VA_ENC_SLICE_STRUCTURE_ARBITRARY_ROWS\n");
+ if (tmp & VA_ENC_SLICE_STRUCTURE_POWER_OF_TWO_ROWS)
+ printf("Support VA_ENC_SLICE_STRUCTURE_POWER_OF_TWO_ROWS\n");
+ if (tmp & VA_ENC_SLICE_STRUCTURE_ARBITRARY_MACROBLOCKS)
+ printf("Support VA_ENC_SLICE_STRUCTURE_ARBITRARY_MACROBLOCKS\n");
+ }
+ if (attrib[VAConfigAttribEncMacroblockInfo].value != VA_ATTRIB_NOT_SUPPORTED) {
+ printf("Support VAConfigAttribEncMacroblockInfo\n");
+ }
+
+ free(entrypoints);
+ return 0;
+}
+
+static int setup_encode()
+{
+ VAStatus va_status;
+ VASurfaceID *tmp_surfaceid;
+ int codedbuf_size, i;
+
+ va_status = vaCreateConfig(va_dpy, hevc_profile, VAEntrypointEncSlice,
+ &config_attrib[0], config_attrib_num, &config_id);
+ CHECK_VASTATUS(va_status, "vaCreateConfig");
+
+ /* create source surfaces */
+ va_status = vaCreateSurfaces(va_dpy,
+ VA_RT_FORMAT_YUV420, frame_width_aligned, frame_height_aligned,
+ &src_surface[0], SURFACE_NUM,
+ NULL, 0);
+ CHECK_VASTATUS(va_status, "vaCreateSurfaces");
+
+ /* create reference surfaces */
+ va_status = vaCreateSurfaces(
+ va_dpy,
+ VA_RT_FORMAT_YUV420, frame_width_aligned, frame_height_aligned,
+ &ref_surface[0], SURFACE_NUM,
+ NULL, 0
+ );
+ CHECK_VASTATUS(va_status, "vaCreateSurfaces");
+
+ tmp_surfaceid = calloc(2 * SURFACE_NUM, sizeof(VASurfaceID));
+ memcpy(tmp_surfaceid, src_surface, SURFACE_NUM * sizeof(VASurfaceID));
+ memcpy(tmp_surfaceid + SURFACE_NUM, ref_surface, SURFACE_NUM * sizeof(VASurfaceID));
+
+ /* Create a context for this encode pipe */
+ va_status = vaCreateContext(va_dpy, config_id,
+ frame_width_aligned, frame_height_aligned,
+ VA_PROGRESSIVE,
+ tmp_surfaceid, 2 * SURFACE_NUM,
+ &context_id);
+ CHECK_VASTATUS(va_status, "vaCreateContext");
+ free(tmp_surfaceid);
+
+ codedbuf_size = (frame_width_aligned * frame_height_aligned * 400) / (16*16);
+
+ for (i = 0; i < SURFACE_NUM; i++) {
+ /* create coded buffer once for all
+ * other VA buffers which won't be used again after vaRenderPicture.
+ * so APP can always vaCreateBuffer for every frame
+ * but coded buffer need to be mapped and accessed after vaRenderPicture/vaEndPicture
+ * so VA won't maintain the coded buffer
+ */
+ va_status = vaCreateBuffer(va_dpy,context_id,VAEncCodedBufferType,
+ codedbuf_size, 1, NULL, &coded_buf[i]);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+ }
+
+ return 0;
+}
+
+
+
+#define partition(ref, field, key, ascending) \
+ while (i <= j) { \
+ if (ascending) { \
+ while (ref[i].field < key) \
+ i++; \
+ while (ref[j].field > key) \
+ j--; \
+ } else { \
+ while (ref[i].field > key) \
+ i++; \
+ while (ref[j].field < key) \
+ j--; \
+ } \
+ if (i <= j) { \
+ tmp = ref[i]; \
+ ref[i] = ref[j]; \
+ ref[j] = tmp; \
+ i++; \
+ j--; \
+ } \
+ } \
+
+static void sort_one(VAPictureHEVC ref[], int left, int right,
+ int ascending)
+{
+ VAPictureHEVC tmp;
+ int i = left, j = right;
+ unsigned int key = ref[(left + right) / 2].pic_order_cnt;
+ partition(ref, pic_order_cnt, (signed int)key, ascending);
+
+ /* recursion */
+ if (left < j)
+ sort_one(ref, left, j, ascending);
+
+ if (i < right)
+ sort_one(ref, i, right, ascending);
+}
+
+static void sort_two(VAPictureHEVC ref[], int left, int right, unsigned int key,
+ int partition_ascending, int list0_ascending, int list1_ascending)
+{
+ VAPictureHEVC tmp;
+ int i = left, j = right;
+
+ partition(ref, pic_order_cnt, (signed int)key, partition_ascending);
+
+ sort_one(ref, left, i-1, list0_ascending);
+ sort_one(ref, j+1, right, list1_ascending);
+}
+
+static int update_ReferenceFrames(void)
+{
+ int i;
+
+ if (current_frame_type == FRAME_B)
+ return 0;
+
+ numShortTerm++;
+ if (numShortTerm > num_ref_frames)
+ numShortTerm = num_ref_frames;
+ for (i=numShortTerm-1; i>0; i--)
+ ReferenceFrames[i] = ReferenceFrames[i-1];
+ ReferenceFrames[0] = CurrentCurrPic;
+
+ return 0;
+}
+
+static int update_RefPicList(void)
+{
+ unsigned int current_poc = CurrentCurrPic.pic_order_cnt;
+
+ if (current_frame_type == FRAME_P) {
+ memcpy(RefPicList0_P, ReferenceFrames, numShortTerm * sizeof(VAPictureHEVC));
+ sort_one(RefPicList0_P, 0, numShortTerm-1, 0);
+ }
+
+ if (current_frame_type == FRAME_B) {
+ memcpy(RefPicList0_B, ReferenceFrames, numShortTerm * sizeof(VAPictureHEVC));
+ sort_two(RefPicList0_B, 0, numShortTerm-1, current_poc, 1, 0, 1);
+
+ memcpy(RefPicList1_B, ReferenceFrames, numShortTerm * sizeof(VAPictureHEVC));
+ sort_two(RefPicList1_B, 0, numShortTerm-1, current_poc, 0, 1, 0);
+ }
+
+ return 0;
+}
+
+
+static int render_sequence(struct SeqParamSet *sps)
+{
+
+ VABufferID seq_param_buf = VA_INVALID_ID;
+ VABufferID rc_param_buf = VA_INVALID_ID;
+ VABufferID misc_param_tmpbuf= VA_INVALID_ID;
+ VABufferID render_id[2] = {VA_INVALID_ID};
+ VAStatus va_status;
+ VAEncMiscParameterBuffer *misc_param, *misc_param_tmp;
+ VAEncMiscParameterRateControl *misc_rate_ctrl;
+ seq_param.general_profile_idc = sps->ptps.general_profile_idc;
+ seq_param.general_level_idc = sps->ptps.general_level_idc;
+ seq_param.general_tier_flag = (uint8_t)(sps->ptps.general_tier_flag);
+
+ seq_param.intra_period = intra_period;
+ seq_param.intra_idr_period = intra_idr_period;
+ seq_param.ip_period = ip_period;
+
+ seq_param.bits_per_second = 400000;
+ seq_param.pic_width_in_luma_samples = sps->pic_width_in_luma_samples;
+ seq_param.pic_height_in_luma_samples = sps->pic_height_in_luma_samples;
+
+ seq_param.seq_fields.bits.chroma_format_idc = 1;
+ seq_param.seq_fields.bits.separate_colour_plane_flag = 0;
+ seq_param.seq_fields.bits.bit_depth_luma_minus8 = sps->bit_depth_luma_minus8;
+ seq_param.seq_fields.bits.bit_depth_chroma_minus8 = sps->bit_depth_chroma_minus8;
+ seq_param.seq_fields.bits.scaling_list_enabled_flag = sps->scaling_list_enabled_flag;
+ seq_param.seq_fields.bits.strong_intra_smoothing_enabled_flag = sps->strong_intra_smoothing_enabled_flag;
+ seq_param.seq_fields.bits.amp_enabled_flag = sps->amp_enabled_flag;
+ seq_param.seq_fields.bits.sample_adaptive_offset_enabled_flag = sps->sample_adaptive_offset_enabled_flag;
+ seq_param.seq_fields.bits.pcm_enabled_flag = sps->pcm_enabled_flag;
+ seq_param.seq_fields.bits.pcm_loop_filter_disabled_flag = sps->pcm_loop_filter_disabled_flag;
+ seq_param.seq_fields.bits.sps_temporal_mvp_enabled_flag = sps->sps_temporal_mvp_enabled_flag;
+
+ seq_param.log2_min_luma_coding_block_size_minus3 = sps->log2_min_luma_coding_block_size_minus3;
+ seq_param.log2_diff_max_min_luma_coding_block_size = sps->log2_diff_max_min_luma_coding_block_size;
+ seq_param.log2_min_transform_block_size_minus2 = sps->log2_min_luma_transform_block_size_minus2;
+ seq_param.log2_diff_max_min_transform_block_size = sps->log2_diff_max_min_luma_transform_block_size;
+ seq_param.max_transform_hierarchy_depth_inter = sps->max_transform_hierarchy_depth_inter;
+ seq_param.max_transform_hierarchy_depth_intra = sps->max_transform_hierarchy_depth_intra;
+
+ seq_param.vui_parameters_present_flag = sps->vui_parameters_present_flag;
+
+ va_status = vaCreateBuffer(va_dpy, context_id,
+ VAEncSequenceParameterBufferType,
+ sizeof(seq_param),1,&seq_param,&seq_param_buf);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+
+ va_status = vaCreateBuffer(va_dpy, context_id,
+ VAEncMiscParameterBufferType,
+ sizeof(VAEncMiscParameterBuffer) + sizeof(VAEncMiscParameterRateControl),
+ 1,NULL,&rc_param_buf);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+
+ vaMapBuffer(va_dpy, rc_param_buf,(void **)&misc_param);
+ misc_param->type = VAEncMiscParameterTypeRateControl;
+ misc_rate_ctrl = (VAEncMiscParameterRateControl *)misc_param->data;
+ memset(misc_rate_ctrl, 0, sizeof(*misc_rate_ctrl));
+ misc_rate_ctrl->bits_per_second = frame_bitrate;
+ misc_rate_ctrl->target_percentage = 66;
+ misc_rate_ctrl->window_size = 1000;
+ misc_rate_ctrl->initial_qp = initial_qp;
+ misc_rate_ctrl->min_qp = minimal_qp;
+ misc_rate_ctrl->basic_unit_size = 0;
+ vaUnmapBuffer(va_dpy, rc_param_buf);
+
+ render_id[0] = seq_param_buf;
+ render_id[1] = rc_param_buf;
+
+ va_status = vaRenderPicture(va_dpy,context_id, &render_id[0], 2);
+ CHECK_VASTATUS(va_status,"vaRenderPicture");
+ if (seq_param_buf != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, seq_param_buf);
+ seq_param_buf = VA_INVALID_ID;
+ }
+
+ if (rc_param_buf != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, rc_param_buf);
+ rc_param_buf = VA_INVALID_ID;
+ }
+
+
+ if (misc_priv_type != 0) {
+ va_status = vaCreateBuffer(va_dpy, context_id,
+ VAEncMiscParameterBufferType,
+ sizeof(VAEncMiscParameterBuffer),
+ 1, NULL, &misc_param_tmpbuf);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+ vaMapBuffer(va_dpy, misc_param_tmpbuf,(void **)&misc_param_tmp);
+ misc_param_tmp->type = misc_priv_type;
+ misc_param_tmp->data[0] = misc_priv_value;
+ vaUnmapBuffer(va_dpy, misc_param_tmpbuf);
+
+ va_status = vaRenderPicture(va_dpy,context_id, &misc_param_tmpbuf, 1);
+ }
+
+ return 0;
+}
+
+static int render_picture(struct PicParamSet *pps)
+{
+ VABufferID pic_param_buf = VA_INVALID_ID;
+ VAStatus va_status;
+ int i = 0;
+
+ memcpy(pic_param.reference_frames, ReferenceFrames, numShortTerm*sizeof(VAPictureHEVC));
+ for (i = numShortTerm; i < SURFACE_NUM; i++) {
+ pic_param.reference_frames[i].picture_id = VA_INVALID_SURFACE;
+ pic_param.reference_frames[i].flags = VA_PICTURE_HEVC_INVALID;
+ }
+
+ pic_param.last_picture = 0;
+ pic_param.last_picture |= ((current_frame_encoding +1) %intra_period == 0) ? HEVC_LAST_PICTURE_EOSEQ : 0;
+ pic_param.last_picture |= ((current_frame_encoding +1) == frame_count) ? HEVC_LAST_PICTURE_EOSTREAM : 0;
+ pic_param.coded_buf = coded_buf[current_slot];
+
+ pic_param.decoded_curr_pic.picture_id = ref_surface[current_slot];
+ pic_param.decoded_curr_pic.pic_order_cnt = calc_poc((current_frame_display - current_IDR_display) % MaxPicOrderCntLsb) * 2;
+ pic_param.decoded_curr_pic.flags = 0;
+ CurrentCurrPic = pic_param.decoded_curr_pic;
+
+ pic_param.collocated_ref_pic_index = pps->num_ref_idx_l0_default_active_minus1;
+ pic_param.pic_init_qp = pps->init_qp_minus26 + 26;
+ pic_param.diff_cu_qp_delta_depth = pps->diff_cu_qp_delta_depth;
+ pic_param.pps_cb_qp_offset = pps->pps_cb_qp_offset;
+ pic_param.pps_cr_qp_offset = pps->pps_cr_qp_offset;
+
+ pic_param.num_tile_columns_minus1 = pps->num_tile_columns_minus1;
+ pic_param.num_tile_rows_minus1 = pps->num_tile_rows_minus1;
+ for (i = 0; i <= (unsigned int)(pic_param.num_tile_columns_minus1); i++)
+ {
+ pic_param.column_width_minus1[i] = 0;
+ }
+ for (i = 0; i <= (unsigned int)(pic_param.num_tile_rows_minus1); i++)
+ {
+ pic_param.row_height_minus1[i] = 0;
+ }
+
+ pic_param.log2_parallel_merge_level_minus2 = pps->log2_parallel_merge_level_minus2;
+ pic_param.ctu_max_bitsize_allowed = 0;
+ pic_param.num_ref_idx_l0_default_active_minus1 = pps->num_ref_idx_l0_default_active_minus1;
+ pic_param.num_ref_idx_l1_default_active_minus1 = pps->num_ref_idx_l1_default_active_minus1;
+ pic_param.slice_pic_parameter_set_id = 0;
+ pic_param.pic_fields.bits.idr_pic_flag = (current_frame_type == FRAME_IDR);
+ pic_param.pic_fields.bits.coding_type = current_frame_type == FRAME_IDR ? FRAME_I:current_frame_type;
+ pic_param.pic_fields.bits.reference_pic_flag = current_frame_type != FRAME_B ? 1: 0;
+ pic_param.pic_fields.bits.dependent_slice_segments_enabled_flag = pps->dependent_slice_segments_enabled_flag;
+ pic_param.pic_fields.bits.sign_data_hiding_enabled_flag = pps->sign_data_hiding_enabled_flag;
+ pic_param.pic_fields.bits.constrained_intra_pred_flag = pps->constrained_intra_pred_flag;
+ pic_param.pic_fields.bits.transform_skip_enabled_flag = pps->transform_skip_enabled_flag;
+ pic_param.pic_fields.bits.cu_qp_delta_enabled_flag = pps->cu_qp_delta_enabled_flag;
+ pic_param.pic_fields.bits.weighted_pred_flag = pps->weighted_pred_flag;
+ pic_param.pic_fields.bits.weighted_bipred_flag = pps->weighted_bipred_flag;
+ pic_param.pic_fields.bits.transquant_bypass_enabled_flag = pps->transquant_bypass_enabled_flag;
+ pic_param.pic_fields.bits.tiles_enabled_flag = pps->tiles_enabled_flag;
+ pic_param.pic_fields.bits.entropy_coding_sync_enabled_flag = pps->entropy_coding_sync_enabled_flag;
+ pic_param.pic_fields.bits.loop_filter_across_tiles_enabled_flag = pps->loop_filter_across_tiles_enabled_flag;
+ pic_param.pic_fields.bits.pps_loop_filter_across_slices_enabled_flag = pps->pps_loop_filter_across_slices_enabled_flag;
+ pic_param.pic_fields.bits.scaling_list_data_present_flag = pps->pps_scaling_list_data_present_flag;
+
+ va_status = vaCreateBuffer(va_dpy, context_id,VAEncPictureParameterBufferType,
+ sizeof(pic_param),1,&pic_param, &pic_param_buf);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");;
+
+ va_status = vaRenderPicture(va_dpy,context_id, &pic_param_buf, 1);
+ CHECK_VASTATUS(va_status,"vaRenderPicture");
+
+ if(pic_param_buf != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, pic_param_buf);
+ pic_param_buf = VA_INVALID_ID;
+ }
+
+ return 0;
+}
+
+static int render_packedvideo(void)
+{
+
+ VAEncPackedHeaderParameterBuffer packedheader_param_buffer;
+ VABufferID packedvideo_para_bufid = VA_INVALID_ID;
+ VABufferID packedvideo_data_bufid = VA_INVALID_ID;
+ VABufferID render_id[2] = {VA_INVALID_ID};
+ unsigned int length_in_bits;
+ unsigned char *packedvideo_buffer = NULL;
+ VAStatus va_status;
+
+ length_in_bits = build_packed_video_buffer(&packedvideo_buffer);
+
+ packedheader_param_buffer.type = VAEncPackedHeaderSequence;
+
+ packedheader_param_buffer.bit_length = length_in_bits; /*length_in_bits*/
+ packedheader_param_buffer.has_emulation_bytes = 0;
+ va_status = vaCreateBuffer(va_dpy,
+ context_id,
+ VAEncPackedHeaderParameterBufferType,
+ sizeof(packedheader_param_buffer), 1, &packedheader_param_buffer,
+ &packedvideo_para_bufid);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+
+ va_status = vaCreateBuffer(va_dpy,
+ context_id,
+ VAEncPackedHeaderDataBufferType,
+ (length_in_bits + 7) / 8, 1, packedvideo_buffer,
+ &packedvideo_data_bufid);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+
+ render_id[0] = packedvideo_para_bufid;
+ render_id[1] = packedvideo_data_bufid;
+ va_status = vaRenderPicture(va_dpy,context_id, render_id, 2);
+ CHECK_VASTATUS(va_status,"vaRenderPicture");
+
+ free(packedvideo_buffer);
+
+ if(packedvideo_para_bufid != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, packedvideo_para_bufid);
+ packedvideo_para_bufid = VA_INVALID_ID;
+ }
+ if(packedvideo_data_bufid != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, packedvideo_data_bufid);
+ packedvideo_data_bufid = VA_INVALID_ID;
+ }
+
+ return 0;
+}
+
+static int render_packedsequence(void)
+{
+ VAEncPackedHeaderParameterBuffer packedheader_param_buffer;
+ VABufferID packedseq_para_bufid = VA_INVALID_ID;
+ VABufferID packedseq_data_bufid = VA_INVALID_ID;
+ VABufferID render_id[2] = {VA_INVALID_ID};
+ unsigned int length_in_bits;
+ unsigned char *packedseq_buffer = NULL;
+ VAStatus va_status;
+
+ length_in_bits = build_packed_seq_buffer(&packedseq_buffer);
+
+ packedheader_param_buffer.type = VAEncPackedHeaderSequence;
+
+ packedheader_param_buffer.bit_length = length_in_bits; /*length_in_bits*/
+ packedheader_param_buffer.has_emulation_bytes = 0;
+ va_status = vaCreateBuffer(va_dpy,
+ context_id,
+ VAEncPackedHeaderParameterBufferType,
+ sizeof(packedheader_param_buffer), 1, &packedheader_param_buffer,
+ &packedseq_para_bufid);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+
+ va_status = vaCreateBuffer(va_dpy,
+ context_id,
+ VAEncPackedHeaderDataBufferType,
+ (length_in_bits + 7) / 8, 1, packedseq_buffer,
+ &packedseq_data_bufid);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+
+ render_id[0] = packedseq_para_bufid;
+ render_id[1] = packedseq_data_bufid;
+ va_status = vaRenderPicture(va_dpy,context_id, render_id, 2);
+ CHECK_VASTATUS(va_status,"vaRenderPicture");
+
+ free(packedseq_buffer);
+
+ if(packedseq_para_bufid != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, packedseq_para_bufid);
+ packedseq_para_bufid = VA_INVALID_ID;
+ }
+ if(packedseq_data_bufid != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, packedseq_data_bufid);
+ packedseq_para_bufid = VA_INVALID_ID;
+ }
+
+ return 0;
+}
+
+
+static int render_packedpicture(void)
+{
+ VAEncPackedHeaderParameterBuffer packedheader_param_buffer;
+ VABufferID packedpic_para_bufid = VA_INVALID_ID;
+ VABufferID packedpic_data_bufid = VA_INVALID_ID;
+ VABufferID render_id[2] = {VA_INVALID_ID};
+ unsigned int length_in_bits;
+ unsigned char *packedpic_buffer = NULL;
+ VAStatus va_status;
+
+ length_in_bits = build_packed_pic_buffer(&packedpic_buffer);
+ packedheader_param_buffer.type = VAEncPackedHeaderPicture;
+ packedheader_param_buffer.bit_length = length_in_bits;
+ packedheader_param_buffer.has_emulation_bytes = 0;
+
+ va_status = vaCreateBuffer(va_dpy,
+ context_id,
+ VAEncPackedHeaderParameterBufferType,
+ sizeof(packedheader_param_buffer), 1, &packedheader_param_buffer,
+ &packedpic_para_bufid);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+
+ va_status = vaCreateBuffer(va_dpy,
+ context_id,
+ VAEncPackedHeaderDataBufferType,
+ (length_in_bits + 7) / 8, 1, packedpic_buffer,
+ &packedpic_data_bufid);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+
+ render_id[0] = packedpic_para_bufid;
+ render_id[1] = packedpic_data_bufid;
+ va_status = vaRenderPicture(va_dpy,context_id, render_id, 2);
+ CHECK_VASTATUS(va_status,"vaRenderPicture");
+
+ free(packedpic_buffer);
+
+ if(packedpic_para_bufid != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, packedpic_para_bufid);
+ packedpic_para_bufid = VA_INVALID_ID;
+ }
+ if(packedpic_data_bufid != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, packedpic_data_bufid);
+ packedpic_para_bufid = VA_INVALID_ID;
+ }
+
+ return 0;
+}
+
+static void render_packedslice()
+{
+ VAEncPackedHeaderParameterBuffer packedheader_param_buffer;
+ VABufferID packedslice_para_bufid = VA_INVALID_ID;
+ VABufferID packedslice_data_bufid = VA_INVALID_ID;
+ VABufferID render_id[2] = {VA_INVALID_ID};
+ unsigned int length_in_bits;
+ unsigned char *packedslice_buffer = NULL;
+ VAStatus va_status;
+
+ length_in_bits = build_packed_slice_buffer(&packedslice_buffer);
+ packedheader_param_buffer.type = VAEncPackedHeaderSlice;
+ packedheader_param_buffer.bit_length = length_in_bits;
+ packedheader_param_buffer.has_emulation_bytes = 0;
+
+ va_status = vaCreateBuffer(va_dpy,
+ context_id,
+ VAEncPackedHeaderParameterBufferType,
+ sizeof(packedheader_param_buffer), 1, &packedheader_param_buffer,
+ &packedslice_para_bufid);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+
+ va_status = vaCreateBuffer(va_dpy,
+ context_id,
+ VAEncPackedHeaderDataBufferType,
+ (length_in_bits + 7) / 8, 1, packedslice_buffer,
+ &packedslice_data_bufid);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");
+
+ render_id[0] = packedslice_para_bufid;
+ render_id[1] = packedslice_data_bufid;
+ va_status = vaRenderPicture(va_dpy,context_id, render_id, 2);
+ CHECK_VASTATUS(va_status,"vaRenderPicture");
+
+ free(packedslice_buffer);
+
+ if(packedslice_para_bufid != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, packedslice_para_bufid);
+ packedslice_para_bufid = VA_INVALID_ID;
+ }
+ if(packedslice_data_bufid != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, packedslice_data_bufid);
+ packedslice_para_bufid = VA_INVALID_ID;
+ }
+}
+
+static int render_slice(void)
+{
+ VABufferID slice_param_buf = VA_INVALID_ID;
+ VAStatus va_status;
+ memset(&slice_param, 0x00, sizeof(VAEncSliceParameterBufferHEVC));
+
+ update_RefPicList();
+
+ slice_param.slice_segment_address = 0;
+ slice_param.num_ctu_in_slice = ssh.picture_width_in_ctus *ssh.picture_height_in_ctus;
+ slice_param.slice_type = ssh.slice_type;
+ slice_param.slice_pic_parameter_set_id = ssh.slice_pic_parameter_set_id; // right???
+
+ slice_param.num_ref_idx_l0_active_minus1 = ssh.num_ref_idx_l0_active_minus1;
+ slice_param.num_ref_idx_l1_active_minus1 = ssh.num_ref_idx_l1_active_minus1;
+ memset(slice_param.ref_pic_list0, 0xff, sizeof(slice_param.ref_pic_list0));
+ memset(slice_param.ref_pic_list1, 0xff, sizeof(slice_param.ref_pic_list1));
+
+ if (current_frame_type == FRAME_P) {
+ memcpy(slice_param.ref_pic_list0, RefPicList0_P, sizeof(VAPictureHEVC));
+ if(p2b)
+ {
+ memcpy(slice_param.ref_pic_list1, RefPicList0_P, sizeof(VAPictureHEVC));
+ }
+ } else if (current_frame_type == FRAME_B) {
+ memcpy(slice_param.ref_pic_list0, RefPicList0_B, sizeof(VAPictureHEVC));
+ memcpy(slice_param.ref_pic_list1, RefPicList1_B, sizeof(VAPictureHEVC));
+ }
+
+ slice_param.luma_log2_weight_denom = 0;
+ slice_param.delta_chroma_log2_weight_denom = 0;
+
+ slice_param.max_num_merge_cand = 5 - ssh.five_minus_max_num_merge_cand;
+
+ slice_param.slice_qp_delta = ssh.slice_qp_delta;
+ slice_param.slice_cb_qp_offset = 0;
+ slice_param.slice_cr_qp_offset = 0;
+ slice_param.slice_beta_offset_div2 = ssh.beta_offset_div2;
+ slice_param.slice_tc_offset_div2 = ssh.tc_offset_div2;
+
+ slice_param.slice_fields.bits.dependent_slice_segment_flag = 0;
+ slice_param.slice_fields.bits.colour_plane_id = ssh.colour_plane_id;
+ slice_param.slice_fields.bits.slice_temporal_mvp_enabled_flag = ssh.slice_temporal_mvp_enabled_flag;
+ slice_param.slice_fields.bits.slice_sao_luma_flag = ssh.slice_sao_luma_flag;
+ slice_param.slice_fields.bits.slice_sao_chroma_flag = ssh.slice_sao_luma_flag;
+ slice_param.slice_fields.bits.num_ref_idx_active_override_flag = ssh.num_ref_idx_active_override_flag;
+ slice_param.slice_fields.bits.mvd_l1_zero_flag = 0;
+ slice_param.slice_fields.bits.cabac_init_flag = 0;
+ slice_param.slice_fields.bits.slice_deblocking_filter_disabled_flag = ssh.disable_deblocking_filter_flag;
+ slice_param.slice_fields.bits.slice_loop_filter_across_slices_enabled_flag = ssh.slice_loop_filter_across_slices_enabled_flag;
+ slice_param.slice_fields.bits.collocated_from_l0_flag = ssh.collocated_from_l0_flag;
+
+ if (hevc_packedheader &&
+ config_attrib[enc_packed_header_idx].value & VA_ENC_PACKED_HEADER_SLICE)
+ render_packedslice();
+
+ va_status = vaCreateBuffer(va_dpy,context_id,VAEncSliceParameterBufferType,
+ sizeof(slice_param),1,&slice_param,&slice_param_buf);
+ CHECK_VASTATUS(va_status,"vaCreateBuffer");;
+
+ va_status = vaRenderPicture(va_dpy,context_id, &slice_param_buf, 1);
+ CHECK_VASTATUS(va_status,"vaRenderPicture");
+
+ if (slice_param_buf != VA_INVALID_ID)
+ {
+ vaDestroyBuffer(va_dpy, slice_param_buf);
+ slice_param_buf = VA_INVALID_ID;
+ }
+
+ return 0;
+}
+
+
+static int upload_source_YUV_once_for_all()
+{
+ int box_width=8;
+ int row_shift=0;
+ int i;
+
+ for (i = 0; i < SURFACE_NUM; i++) {
+ printf("\rLoading data into surface %d.....", i);
+ upload_surface(va_dpy, src_surface[i], box_width, row_shift, 0);
+
+ row_shift++;
+ if (row_shift==(2*box_width)) row_shift= 0;
+ }
+ printf("Complete surface loading\n");
+
+ return 0;
+}
+
+static int load_surface(VASurfaceID surface_id, unsigned long long display_order)
+{
+ unsigned char *srcyuv_ptr = NULL, *src_Y = NULL, *src_U = NULL, *src_V = NULL;
+ unsigned long long frame_start, mmap_start;
+ char *mmap_ptr = NULL;
+ int frame_size, mmap_size;
+
+ if (srcyuv_fp == NULL)
+ return 0;
+
+ /* allow encoding more than srcyuv_frames */
+ display_order = display_order % srcyuv_frames;
+ frame_size = frame_width * frame_height * 3 / 2; /* for YUV420 */
+ frame_start = display_order * frame_size;
+
+ mmap_start = frame_start & (~0xfff);
+ mmap_size = (frame_size + (frame_start & 0xfff) + 0xfff) & (~0xfff);
+ mmap_ptr = mmap(0, mmap_size, PROT_READ, MAP_SHARED,
+ fileno(srcyuv_fp), mmap_start);
+ if (mmap_ptr == MAP_FAILED) {
+ printf("Failed to mmap YUV file (%s)\n", strerror(errno));
+ return 1;
+ }
+ srcyuv_ptr = (unsigned char *)mmap_ptr + (frame_start & 0xfff);
+ if (srcyuv_fourcc == VA_FOURCC_NV12) {
+ src_Y = srcyuv_ptr;
+ src_U = src_Y + frame_width * frame_height;
+ src_V = NULL;
+ } else if (srcyuv_fourcc == VA_FOURCC_IYUV ||
+ srcyuv_fourcc == VA_FOURCC_YV12) {
+ src_Y = srcyuv_ptr;
+ if (srcyuv_fourcc == VA_FOURCC_IYUV) {
+ src_U = src_Y + frame_width * frame_height;
+ src_V = src_U + (frame_width/2) * (frame_height/2);
+ } else { /* YV12 */
+ src_V = src_Y + frame_width * frame_height;
+ src_U = src_V + (frame_width/2) * (frame_height/2);
+ }
+ } else {
+ printf("Unsupported source YUV format\n");
+ exit(1);
+ }
+
+ upload_surface_yuv(va_dpy, surface_id,
+ srcyuv_fourcc, frame_width, frame_height,
+ src_Y, src_U, src_V);
+ if (mmap_ptr)
+ munmap(mmap_ptr, mmap_size);
+
+ return 0;
+}
+
+
+static int save_recyuv(VASurfaceID surface_id,
+ unsigned long long display_order,
+ unsigned long long encode_order)
+{
+ unsigned char *dst_Y = NULL, *dst_U = NULL, *dst_V = NULL;
+
+ if (recyuv_fp == NULL)
+ return 0;
+
+ if (srcyuv_fourcc == VA_FOURCC_NV12) {
+ int uv_size = 2 * (frame_width/2) * (frame_height/2);
+ dst_Y = malloc(2*uv_size);
+ if(dst_Y == NULL) {
+ printf("Failed to allocate memory for dst_Y\n");
+ exit(1);
+ }
+
+ dst_U = malloc(uv_size);
+ if(dst_U == NULL) {
+ printf("Failed to allocate memory for dst_U\n");
+ free(dst_Y);
+ exit(1);
+ }
+
+ memset(dst_Y, 0, 2*uv_size);
+ memset(dst_U, 0, uv_size);
+ } else if (srcyuv_fourcc == VA_FOURCC_IYUV ||
+ srcyuv_fourcc == VA_FOURCC_YV12) {
+ int uv_size = (frame_width/2) * (frame_height/2);
+ dst_Y = malloc(4*uv_size);
+ if(dst_Y == NULL) {
+ printf("Failed to allocate memory for dst_Y\n");
+ exit(1);
+ }
+
+ dst_U = malloc(uv_size);
+ if(dst_U == NULL) {
+ printf("Failed to allocate memory for dst_U\n");
+ free(dst_Y);
+ exit(1);
+ }
+
+ dst_V = malloc(uv_size);
+ if(dst_V == NULL) {
+ printf("Failed to allocate memory for dst_V\n");
+ free(dst_Y);
+ free(dst_U);
+ exit(1);
+ }
+
+ memset(dst_Y, 0, 4*uv_size);
+ memset(dst_U, 0, uv_size);
+ memset(dst_V, 0, uv_size);
+ } else {
+ printf("Unsupported source YUV format\n");
+ exit(1);
+ }
+
+ download_surface_yuv(va_dpy, surface_id,
+ srcyuv_fourcc, frame_width, frame_height,
+ dst_Y, dst_U, dst_V);
+ fseek(recyuv_fp, display_order * frame_width * frame_height * 1.5, SEEK_SET);
+
+ if (srcyuv_fourcc == VA_FOURCC_NV12) {
+ int uv_size = 2 * (frame_width/2) * (frame_height/2);
+ fwrite(dst_Y, uv_size * 2, 1, recyuv_fp);
+ fwrite(dst_U, uv_size, 1, recyuv_fp);
+ } else if (srcyuv_fourcc == VA_FOURCC_IYUV ||
+ srcyuv_fourcc == VA_FOURCC_YV12) {
+ int uv_size = (frame_width/2) * (frame_height/2);
+ fwrite(dst_Y, uv_size * 4, 1, recyuv_fp);
+
+ if (srcyuv_fourcc == VA_FOURCC_IYUV) {
+ fwrite(dst_U, uv_size, 1, recyuv_fp);
+ fwrite(dst_V, uv_size, 1, recyuv_fp);
+ } else {
+ fwrite(dst_V, uv_size, 1, recyuv_fp);
+ fwrite(dst_U, uv_size, 1, recyuv_fp);
+ }
+ }
+
+ if (dst_Y)
+ free(dst_Y);
+ if (dst_U)
+ free(dst_U);
+ if (dst_V)
+ free(dst_V);
+
+ fflush(recyuv_fp);
+
+ return 0;
+}
+
+
+static int save_codeddata(unsigned long long display_order, unsigned long long encode_order)
+{
+ VACodedBufferSegment *buf_list = NULL;
+ VAStatus va_status;
+ unsigned int coded_size = 0;
+
+ va_status = vaMapBuffer(va_dpy,coded_buf[display_order % SURFACE_NUM],(void **)(&buf_list));
+ CHECK_VASTATUS(va_status,"vaMapBuffer");
+ while (buf_list != NULL) {
+ coded_size += fwrite(buf_list->buf, 1, buf_list->size, coded_fp);
+ buf_list = (VACodedBufferSegment *) buf_list->next;
+
+ frame_size += coded_size;
+ }
+ vaUnmapBuffer(va_dpy,coded_buf[display_order % SURFACE_NUM]);
+
+ printf("\n "); /* return back to startpoint */
+ switch (encode_order % 4) {
+ case 0:
+ printf("|");
+ break;
+ case 1:
+ printf("/");
+ break;
+ case 2:
+ printf("-");
+ break;
+ case 3:
+ printf("\\");
+ break;
+ }
+ printf("%08lld", encode_order);
+ printf("(%06d bytes coded)\n",coded_size);
+
+ fflush(coded_fp);
+
+ return 0;
+}
+
+
+static struct storage_task_t * storage_task_dequeue(void)
+{
+ struct storage_task_t *header;
+
+ pthread_mutex_lock(&encode_mutex);
+
+ header = storage_task_header;
+ if (storage_task_header != NULL) {
+ if (storage_task_tail == storage_task_header)
+ storage_task_tail = NULL;
+ storage_task_header = header->next;
+ }
+
+ pthread_mutex_unlock(&encode_mutex);
+
+ return header;
+}
+
+static int storage_task_queue(unsigned long long display_order, unsigned long long encode_order)
+{
+ struct storage_task_t *tmp;
+
+ tmp = calloc(1, sizeof(struct storage_task_t));
+ tmp->display_order = display_order;
+ tmp->encode_order = encode_order;
+
+ pthread_mutex_lock(&encode_mutex);
+
+ if (storage_task_header == NULL) {
+ storage_task_header = tmp;
+ storage_task_tail = tmp;
+ } else {
+ storage_task_tail->next = tmp;
+ storage_task_tail = tmp;
+ }
+
+ srcsurface_status[display_order % SURFACE_NUM] = SRC_SURFACE_IN_STORAGE;
+ pthread_cond_signal(&encode_cond);
+
+ pthread_mutex_unlock(&encode_mutex);
+
+ return 0;
+}
+
+static void storage_task(unsigned long long display_order, unsigned long long encode_order)
+{
+ unsigned int tmp;
+ VAStatus va_status;
+
+ tmp = GetTickCount();
+ va_status = vaSyncSurface(va_dpy, src_surface[display_order % SURFACE_NUM]);
+ CHECK_VASTATUS(va_status,"vaSyncSurface");
+ SyncPictureTicks += GetTickCount() - tmp;
+ tmp = GetTickCount();
+ save_codeddata(display_order, encode_order);
+ SavePictureTicks += GetTickCount() - tmp;
+
+ save_recyuv(ref_surface[display_order % SURFACE_NUM], display_order, encode_order);
+
+ /* reload a new frame data */
+ tmp = GetTickCount();
+ if (srcyuv_fp != NULL)
+ load_surface(src_surface[display_order % SURFACE_NUM], display_order + SURFACE_NUM);
+ UploadPictureTicks += GetTickCount() - tmp;
+
+ pthread_mutex_lock(&encode_mutex);
+ srcsurface_status[display_order % SURFACE_NUM] = SRC_SURFACE_IN_ENCODING;
+ pthread_mutex_unlock(&encode_mutex);
+}
+
+
+static void * storage_task_thread(void *t)
+{
+ while (1) {
+ struct storage_task_t *current;
+
+ current = storage_task_dequeue();
+ if (current == NULL) {
+ pthread_mutex_lock(&encode_mutex);
+ pthread_cond_wait(&encode_cond, &encode_mutex);
+ pthread_mutex_unlock(&encode_mutex);
+ continue;
+ }
+
+ storage_task(current->display_order, current->encode_order);
+
+ free(current);
+
+ /* all frames are saved, exit the thread */
+ if (++frame_coded >= frame_count)
+ break;
+ }
+
+ return 0;
+}
+
+
+static int encode_frames(void)
+{
+ unsigned int i, tmp;
+ VAStatus va_status;
+ //VASurfaceStatus surface_status;
+
+ /* upload RAW YUV data into all surfaces */
+ tmp = GetTickCount();
+ if (srcyuv_fp != NULL) {
+ for (i = 0; i < SURFACE_NUM; i++)
+ load_surface(src_surface[i], i);
+ } else
+ upload_source_YUV_once_for_all();
+ UploadPictureTicks += GetTickCount() - tmp;
+
+ /* ready for encoding */
+ memset(srcsurface_status, SRC_SURFACE_IN_ENCODING, sizeof(srcsurface_status));
+
+ memset(&seq_param, 0, sizeof(seq_param));
+ memset(&pic_param, 0, sizeof(pic_param));
+ memset(&slice_param, 0, sizeof(slice_param));
+
+ if (encode_syncmode == 0)
+ pthread_create(&encode_thread, NULL, storage_task_thread, NULL);
+
+ for (current_frame_encoding = 0; current_frame_encoding < frame_count; current_frame_encoding++) {
+ encoding2display_order(current_frame_encoding, intra_period, intra_idr_period, ip_period,
+ ¤t_frame_display, ¤t_frame_type);
+ if (current_frame_type == FRAME_IDR) {
+ numShortTerm = 0;
+ current_frame_num = 0;
+ current_IDR_display = current_frame_display;
+ }
+ printf("%s : %lld %s : %lld type : %d\n", "encoding order", current_frame_encoding, "Display order", current_frame_display, current_frame_type);
+ /* check if the source frame is ready */
+ while (srcsurface_status[current_slot] != SRC_SURFACE_IN_ENCODING) {
+ usleep(1);
+ }
+
+ tmp = GetTickCount();
+ va_status = vaBeginPicture(va_dpy, context_id, src_surface[current_slot]);
+ CHECK_VASTATUS(va_status,"vaBeginPicture");
+ BeginPictureTicks += GetTickCount() - tmp;
+ fill_vps_header(&vps);
+ fill_sps_header(&sps, 0);
+ fill_pps_header(&pps, 0, 0);
+ tmp = GetTickCount();
+ if (current_frame_type == FRAME_IDR) {
+ render_sequence(&sps);
+ render_packedvideo();
+ render_packedsequence();
+ }
+ render_packedpicture();
+ render_picture(&pps);
+ fill_slice_header(0, &pps, &ssh);
+ render_slice();
+ RenderPictureTicks += GetTickCount() - tmp;
+
+ tmp = GetTickCount();
+ va_status = vaEndPicture(va_dpy,context_id);
+ CHECK_VASTATUS(va_status,"vaEndPicture");;
+ EndPictureTicks += GetTickCount() - tmp;
+
+ if (encode_syncmode)
+ storage_task(current_frame_display, current_frame_encoding);
+ else /* queue the storage task queue */
+ storage_task_queue(current_frame_display, current_frame_encoding);
+
+ update_ReferenceFrames();
+ }
+
+ if (encode_syncmode == 0) {
+ int ret;
+ pthread_join(encode_thread, (void **)&ret);
+ }
+
+ return 0;
+}
+
+
+static int release_encode()
+{
+ int i;
+
+ vaDestroySurfaces(va_dpy,&src_surface[0],SURFACE_NUM);
+ vaDestroySurfaces(va_dpy,&ref_surface[0],SURFACE_NUM);
+
+ for (i = 0; i < SURFACE_NUM; i++)
+ vaDestroyBuffer(va_dpy,coded_buf[i]);
+
+ vaDestroyContext(va_dpy,context_id);
+ vaDestroyConfig(va_dpy,config_id);
+
+ return 0;
+}
+
+static int deinit_va()
+{
+ vaTerminate(va_dpy);
+
+ va_close_display(va_dpy);
+
+ return 0;
+}
+
+
+static int print_input()
+{
+ printf("\n\nINPUT:Try to encode HEVC...\n");
+ if (rc_mode != -1)
+ printf("INPUT: RateControl : %s\n", rc_to_string(rc_mode));
+ printf("INPUT: Resolution : %dx%d, %d frames\n",
+ frame_width, frame_height, frame_count);
+ printf("INPUT: FrameRate : %d\n", frame_rate);
+ printf("INPUT: Bitrate : %d\n", frame_bitrate);
+ printf("INPUT: Slieces : %d\n", frame_slices);
+ printf("INPUT: IntraPeriod : %d\n", intra_period);
+ printf("INPUT: IDRPeriod : %d\n", intra_idr_period);
+ printf("INPUT: IpPeriod : %d\n", ip_period);
+ printf("INPUT: Initial QP : %d\n", initial_qp);
+ printf("INPUT: Min QP : %d\n", minimal_qp);
+ printf("INPUT: P As B : %d\n", p2b);
+ printf("INPUT: Source YUV : %s", srcyuv_fp?"FILE":"AUTO generated");
+ if (srcyuv_fp)
+ printf(":%s (fourcc %s)\n", srcyuv_fn, fourcc_to_string(srcyuv_fourcc));
+ else
+ printf("\n");
+ printf("INPUT: Coded Clip : %s\n", coded_fn);
+ if (recyuv_fp == NULL)
+ printf("INPUT: Rec Clip : %s\n", "Not save reconstructed frame");
+ else
+ printf("INPUT: Rec Clip : Save reconstructed frame into %s (fourcc %s)\n", recyuv_fn,
+ fourcc_to_string(srcyuv_fourcc));
+
+ printf("\n\n"); /* return back to startpoint */
+
+ return 0;
+}
+
+static int calc_PSNR(double *psnr)
+{
+ char *srcyuv_ptr = NULL, *recyuv_ptr = NULL, tmp;
+ unsigned long long min_size;
+ unsigned long long i, sse=0;
+ double ssemean;
+ int fourM = 0x400000; /* 4M */
+
+ min_size = MIN(srcyuv_frames, frame_count) * frame_width * frame_height * 1.5;
+ for (i=0; i<min_size; i++) {
+ unsigned long long j = i % fourM;
+
+ if ((i % fourM) == 0) {
+ if (srcyuv_ptr)
+ munmap(srcyuv_ptr, fourM);
+ if (recyuv_ptr)
+ munmap(recyuv_ptr, fourM);
+
+ srcyuv_ptr = mmap(0, fourM, PROT_READ, MAP_SHARED, fileno(srcyuv_fp), i);
+ recyuv_ptr = mmap(0, fourM, PROT_READ, MAP_SHARED, fileno(recyuv_fp), i);
+ if ((srcyuv_ptr == MAP_FAILED) || (recyuv_ptr == MAP_FAILED)) {
+ printf("Failed to mmap YUV files\n");
+ return 1;
+ }
+ }
+ tmp = srcyuv_ptr[j] - recyuv_ptr[j];
+ sse += tmp * tmp;
+ }
+ ssemean = (double)sse/(double)min_size;
+ *psnr = 20.0*log10(255) - 10.0*log10(ssemean);
+
+ if (srcyuv_ptr)
+ munmap(srcyuv_ptr, fourM);
+ if (recyuv_ptr)
+ munmap(recyuv_ptr, fourM);
+
+ return 0;
+}
+
+static int print_performance(unsigned int PictureCount)
+{
+ unsigned int psnr_ret = 1, others = 0;
+ double psnr = 0, total_size = frame_width * frame_height * 1.5 * frame_count;
+
+ if (calc_psnr && srcyuv_fp && recyuv_fp)
+ psnr_ret = calc_PSNR(&psnr);
+
+ others = TotalTicks - UploadPictureTicks - BeginPictureTicks
+ - RenderPictureTicks - EndPictureTicks - SyncPictureTicks - SavePictureTicks;
+
+ printf("\n\n");
+
+ printf("PERFORMANCE: Frame Rate : %.2f fps (%d frames, %d ms (%.2f ms per frame))\n",
+ (double) 1000*PictureCount / TotalTicks, PictureCount,
+ TotalTicks, ((double) TotalTicks) / (double) PictureCount);
+ printf("PERFORMANCE: Compression ratio : %d:1\n", (unsigned int)(total_size / frame_size));
+ if (psnr_ret == 0)
+ printf("PERFORMANCE: PSNR : %.2f (%lld frames calculated)\n",
+ psnr, MIN(frame_count, srcyuv_frames));
+
+ printf("PERFORMANCE: UploadPicture : %d ms (%.2f, %.2f%% percent)\n",
+ (int) UploadPictureTicks, ((double) UploadPictureTicks) / (double) PictureCount,
+ UploadPictureTicks/(double) TotalTicks/0.01);
+ printf("PERFORMANCE: vaBeginPicture : %d ms (%.2f, %.2f%% percent)\n",
+ (int) BeginPictureTicks, ((double) BeginPictureTicks) / (double) PictureCount,
+ BeginPictureTicks/(double) TotalTicks/0.01);
+ printf("PERFORMANCE: vaRenderHeader : %d ms (%.2f, %.2f%% percent)\n",
+ (int) RenderPictureTicks, ((double) RenderPictureTicks) / (double) PictureCount,
+ RenderPictureTicks/(double) TotalTicks/0.01);
+ printf("PERFORMANCE: vaEndPicture : %d ms (%.2f, %.2f%% percent)\n",
+ (int) EndPictureTicks, ((double) EndPictureTicks) / (double) PictureCount,
+ EndPictureTicks/(double) TotalTicks/0.01);
+ printf("PERFORMANCE: vaSyncSurface : %d ms (%.2f, %.2f%% percent)\n",
+ (int) SyncPictureTicks, ((double) SyncPictureTicks) / (double) PictureCount,
+ SyncPictureTicks/(double) TotalTicks/0.01);
+ printf("PERFORMANCE: SavePicture : %d ms (%.2f, %.2f%% percent)\n",
+ (int) SavePictureTicks, ((double) SavePictureTicks) / (double) PictureCount,
+ SavePictureTicks/(double) TotalTicks/0.01);
+ printf("PERFORMANCE: Others : %d ms (%.2f, %.2f%% percent)\n",
+ (int) others, ((double) others) / (double) PictureCount,
+ others/(double) TotalTicks/0.01);
+
+ if (encode_syncmode == 0)
+ printf("(Multithread enabled, the timing is only for reference)\n");
+
+ return 0;
+}
+
+
+int main(int argc,char **argv)
+{
+ unsigned int start;
+
+ process_cmdline(argc, argv);
+
+ print_input();
+
+ start = GetTickCount();
+
+ init_va();
+ setup_encode();
+
+ encode_frames();
+
+ release_encode();
+ deinit_va();
+
+ TotalTicks += GetTickCount() - start;
+ print_performance(frame_count);
+
+ return 0;
+}
