| /* ----------------------------------------------------------------------------- |
| Software License for The Fraunhofer FDK AAC Codec Library for Android |
| |
| © Copyright 1995 - 2018 Fraunhofer-Gesellschaft zur Förderung der angewandten |
| Forschung e.V. All rights reserved. |
| |
| 1. INTRODUCTION |
| The Fraunhofer FDK AAC Codec Library for Android ("FDK AAC Codec") is software |
| that implements the MPEG Advanced Audio Coding ("AAC") encoding and decoding |
| scheme for digital audio. This FDK AAC Codec software is intended to be used on |
| a wide variety of Android devices. |
| |
| AAC's HE-AAC and HE-AAC v2 versions are regarded as today's most efficient |
| general perceptual audio codecs. AAC-ELD is considered the best-performing |
| full-bandwidth communications codec by independent studies and is widely |
| deployed. AAC has been standardized by ISO and IEC as part of the MPEG |
| specifications. |
| |
| Patent licenses for necessary patent claims for the FDK AAC Codec (including |
| those of Fraunhofer) may be obtained through Via Licensing |
| (www.vialicensing.com) or through the respective patent owners individually for |
| the purpose of encoding or decoding bit streams in products that are compliant |
| with the ISO/IEC MPEG audio standards. Please note that most manufacturers of |
| Android devices already license these patent claims through Via Licensing or |
| directly from the patent owners, and therefore FDK AAC Codec software may |
| already be covered under those patent licenses when it is used for those |
| licensed purposes only. |
| |
| Commercially-licensed AAC software libraries, including floating-point versions |
| with enhanced sound quality, are also available from Fraunhofer. Users are |
| encouraged to check the Fraunhofer website for additional applications |
| information and documentation. |
| |
| 2. COPYRIGHT LICENSE |
| |
| Redistribution and use in source and binary forms, with or without modification, |
| are permitted without payment of copyright license fees provided that you |
| satisfy the following conditions: |
| |
| You must retain the complete text of this software license in redistributions of |
| the FDK AAC Codec or your modifications thereto in source code form. |
| |
| You must retain the complete text of this software license in the documentation |
| and/or other materials provided with redistributions of the FDK AAC Codec or |
| your modifications thereto in binary form. You must make available free of |
| charge copies of the complete source code of the FDK AAC Codec and your |
| modifications thereto to recipients of copies in binary form. |
| |
| The name of Fraunhofer may not be used to endorse or promote products derived |
| from this library without prior written permission. |
| |
| You may not charge copyright license fees for anyone to use, copy or distribute |
| the FDK AAC Codec software or your modifications thereto. |
| |
| Your modified versions of the FDK AAC Codec must carry prominent notices stating |
| that you changed the software and the date of any change. For modified versions |
| of the FDK AAC Codec, the term "Fraunhofer FDK AAC Codec Library for Android" |
| must be replaced by the term "Third-Party Modified Version of the Fraunhofer FDK |
| AAC Codec Library for Android." |
| |
| 3. NO PATENT LICENSE |
| |
| NO EXPRESS OR IMPLIED LICENSES TO ANY PATENT CLAIMS, including without |
| limitation the patents of Fraunhofer, ARE GRANTED BY THIS SOFTWARE LICENSE. |
| Fraunhofer provides no warranty of patent non-infringement with respect to this |
| software. |
| |
| You may use this FDK AAC Codec software or modifications thereto only for |
| purposes that are authorized by appropriate patent licenses. |
| |
| 4. DISCLAIMER |
| |
| This FDK AAC Codec software is provided by Fraunhofer on behalf of the copyright |
| holders and contributors "AS IS" and WITHOUT ANY EXPRESS OR IMPLIED WARRANTIES, |
| including but not limited to the implied warranties of merchantability and |
| fitness for a particular purpose. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR |
| CONTRIBUTORS BE LIABLE for any direct, indirect, incidental, special, exemplary, |
| or consequential damages, including but not limited to procurement of substitute |
| goods or services; loss of use, data, or profits, or business interruption, |
| however caused and on any theory of liability, whether in contract, strict |
| liability, or tort (including negligence), arising in any way out of the use of |
| this software, even if advised of the possibility of such damage. |
| |
| 5. CONTACT INFORMATION |
| |
| Fraunhofer Institute for Integrated Circuits IIS |
| Attention: Audio and Multimedia Departments - FDK AAC LL |
| Am Wolfsmantel 33 |
| 91058 Erlangen, Germany |
| |
| www.iis.fraunhofer.de/amm |
| amm-info@iis.fraunhofer.de |
| ----------------------------------------------------------------------------- */ |
| |
| /**************************** SBR encoder library ****************************** |
| |
| Author(s): Andreas Ehret, Tobias Chalupka |
| |
| Description: SBR encoder top level processing. |
| |
| *******************************************************************************/ |
| |
| #include "sbr_encoder.h" |
| |
| #include "sbrenc_ram.h" |
| #include "sbrenc_rom.h" |
| #include "sbrenc_freq_sca.h" |
| #include "env_bit.h" |
| #include "cmondata.h" |
| #include "sbr_misc.h" |
| #include "sbr.h" |
| #include "qmf.h" |
| |
| #include "ps_main.h" |
| |
| #define SBRENCODER_LIB_VL0 4 |
| #define SBRENCODER_LIB_VL1 0 |
| #define SBRENCODER_LIB_VL2 0 |
| |
| /***************************************************************************/ |
| /* |
| * SBR Delay balancing definitions. |
| */ |
| |
| /* |
| input buffer (1ch) |
| |
| |------------ 1537 -------------|-----|---------- 2048 -------------| |
| (core2sbr delay ) ds (read, core and ds area) |
| */ |
| |
| #define SFB(dwnsmp) \ |
| (32 << (dwnsmp - \ |
| 1)) /* SBR Frequency bands: 64 for dual-rate, 32 for single-rate */ |
| #define STS(fl) \ |
| (((fl) == 1024) ? 32 \ |
| : 30) /* SBR Time Slots: 32 for core frame length 1024, 30 \ |
| for core frame length 960 */ |
| |
| #define DELAY_QMF_ANA(dwnsmp) \ |
| ((320 << ((dwnsmp)-1)) - (32 << ((dwnsmp)-1))) /* Full bandwidth */ |
| #define DELAY_HYB_ANA (10 * 64) /* + 0.5 */ /* */ |
| #define DELAY_HYB_SYN (6 * 64 - 32) /* */ |
| #define DELAY_QMF_POSTPROC(dwnsmp) \ |
| (32 * (dwnsmp)) /* QMF postprocessing delay */ |
| #define DELAY_DEC_QMF(dwnsmp) (6 * SFB(dwnsmp)) /* Decoder QMF overlap */ |
| #define DELAY_QMF_SYN(dwnsmp) \ |
| (1 << (dwnsmp - \ |
| 1)) /* QMF_NO_POLY/2=2.5, rounded down to 2, half for single-rate */ |
| #define DELAY_QMF_DS (32) /* QMF synthesis for downsampled time signal */ |
| |
| /* Delay in QMF paths */ |
| #define DELAY_SBR(fl, dwnsmp) \ |
| (DELAY_QMF_ANA(dwnsmp) + (SFB(dwnsmp) * STS(fl) - 1) + DELAY_QMF_SYN(dwnsmp)) |
| #define DELAY_PS(fl, dwnsmp) \ |
| (DELAY_QMF_ANA(dwnsmp) + DELAY_HYB_ANA + DELAY_DEC_QMF(dwnsmp) + \ |
| (SFB(dwnsmp) * STS(fl) - 1) + DELAY_HYB_SYN + DELAY_QMF_SYN(dwnsmp)) |
| #define DELAY_ELDSBR(fl, dwnsmp) \ |
| ((((fl) / 2) * (dwnsmp)) - 1 + DELAY_QMF_POSTPROC(dwnsmp)) |
| #define DELAY_ELDv2SBR(fl, dwnsmp) \ |
| ((((fl) / 2) * (dwnsmp)) - 1 + 80 * (dwnsmp)) /* 80 is the delay caused \ |
| by the sum of the CLD \ |
| analysis and the MPSLD \ |
| synthesis filterbank */ |
| |
| /* Delay in core path (core and downsampler not taken into account) */ |
| #define DELAY_COREPATH_SBR(fl, dwnsmp) \ |
| ((DELAY_QMF_ANA(dwnsmp) + DELAY_DEC_QMF(dwnsmp) + DELAY_QMF_SYN(dwnsmp))) |
| #define DELAY_COREPATH_ELDSBR(fl, dwnsmp) ((DELAY_QMF_POSTPROC(dwnsmp))) |
| #define DELAY_COREPATH_ELDv2SBR(fl, dwnsmp) (128 * (dwnsmp)) /* 4 slots */ |
| #define DELAY_COREPATH_PS(fl, dwnsmp) \ |
| ((DELAY_QMF_ANA(dwnsmp) + DELAY_QMF_DS + \ |
| /*(DELAY_AAC(fl)*2) + */ DELAY_QMF_ANA(dwnsmp) + DELAY_DEC_QMF(dwnsmp) + \ |
| DELAY_HYB_SYN + DELAY_QMF_SYN(dwnsmp))) /* 2048 - 463*2 */ |
| |
| /* Delay differences between SBR- and downsampled path for SBR and SBR+PS */ |
| #define DELAY_AAC2SBR(fl, dwnsmp) \ |
| ((DELAY_COREPATH_SBR(fl, dwnsmp)) - DELAY_SBR((fl), (dwnsmp))) |
| #define DELAY_ELD2SBR(fl, dwnsmp) \ |
| ((DELAY_COREPATH_ELDSBR(fl, dwnsmp)) - DELAY_ELDSBR(fl, dwnsmp)) |
| #define DELAY_AAC2PS(fl, dwnsmp) \ |
| ((DELAY_COREPATH_PS(fl, dwnsmp)) - DELAY_PS(fl, dwnsmp)) /* 2048 - 463*2 */ |
| |
| /* Assumption: The sample delay resulting of of DELAY_AAC2PS is always smaller |
| * than the sample delay implied by DELAY_AAC2SBR */ |
| #define MAX_DS_FILTER_DELAY \ |
| (5) /* the additional max downsampler filter delay (source fs) */ |
| #define MAX_SAMPLE_DELAY \ |
| (DELAY_AAC2SBR(1024, 2) + MAX_DS_FILTER_DELAY) /* maximum delay: frame \ |
| length of 1024 and \ |
| dual-rate sbr */ |
| |
| /***************************************************************************/ |
| |
| /*************** Delay parameters for sbrEncoder_Init_delay() **************/ |
| typedef struct { |
| int dsDelay; /* the delay of the (time-domain) downsampler itself */ |
| int delay; /* overall delay / samples */ |
| int sbrDecDelay; /* SBR decoder's delay */ |
| int corePathOffset; /* core path offset / samples; added by |
| sbrEncoder_Init_delay() */ |
| int sbrPathOffset; /* SBR path offset / samples; added by |
| sbrEncoder_Init_delay() */ |
| int bitstrDelay; /* bitstream delay / frames; added by sbrEncoder_Init_delay() |
| */ |
| int delayInput2Core; /* delay of the input to the core / samples */ |
| } DELAY_PARAM; |
| /***************************************************************************/ |
| |
| #define INVALID_TABLE_IDX -1 |
| |
| /***************************************************************************/ |
| /*! |
| |
| \brief Selects the SBR tuning settings to use dependent on number of |
| channels, bitrate, sample rate and core coder |
| |
| \return Index to the appropriate table |
| |
| ****************************************************************************/ |
| #define DISTANCE_CEIL_VALUE 5000000 |
| static INT getSbrTuningTableIndex( |
| UINT bitrate, /*! the total bitrate in bits/sec */ |
| UINT numChannels, /*! the number of channels for the core coder */ |
| UINT sampleRate, /*! the sampling rate of the core coder */ |
| AUDIO_OBJECT_TYPE core, UINT *pBitRateClosest) { |
| int i, bitRateClosestLowerIndex = -1, bitRateClosestUpperIndex = -1, |
| found = 0; |
| UINT bitRateClosestUpper = 0, bitRateClosestLower = DISTANCE_CEIL_VALUE; |
| |
| #define isForThisCore(i) \ |
| ((sbrTuningTable[i].coreCoder == CODEC_AACLD && core == AOT_ER_AAC_ELD) || \ |
| (sbrTuningTable[i].coreCoder == CODEC_AAC && core != AOT_ER_AAC_ELD)) |
| |
| for (i = 0; i < sbrTuningTableSize; i++) { |
| if (isForThisCore(i)) /* tuning table is for this core codec */ |
| { |
| if (numChannels == sbrTuningTable[i].numChannels && |
| sampleRate == sbrTuningTable[i].sampleRate) { |
| found = 1; |
| if ((bitrate >= sbrTuningTable[i].bitrateFrom) && |
| (bitrate < sbrTuningTable[i].bitrateTo)) { |
| return i; |
| } else { |
| if (sbrTuningTable[i].bitrateFrom > bitrate) { |
| if (sbrTuningTable[i].bitrateFrom < bitRateClosestLower) { |
| bitRateClosestLower = sbrTuningTable[i].bitrateFrom; |
| bitRateClosestLowerIndex = i; |
| } |
| } |
| if (sbrTuningTable[i].bitrateTo <= bitrate) { |
| if (sbrTuningTable[i].bitrateTo > bitRateClosestUpper) { |
| bitRateClosestUpper = sbrTuningTable[i].bitrateTo - 1; |
| bitRateClosestUpperIndex = i; |
| } |
| } |
| } |
| } |
| } |
| } |
| |
| if (bitRateClosestUpperIndex >= 0) { |
| return bitRateClosestUpperIndex; |
| } |
| |
| if (pBitRateClosest != NULL) { |
| /* If there was at least one matching tuning entry pick the least distance |
| * bit rate */ |
| if (found) { |
| int distanceUpper = DISTANCE_CEIL_VALUE, |
| distanceLower = DISTANCE_CEIL_VALUE; |
| if (bitRateClosestLowerIndex >= 0) { |
| distanceLower = |
| sbrTuningTable[bitRateClosestLowerIndex].bitrateFrom - bitrate; |
| } |
| if (bitRateClosestUpperIndex >= 0) { |
| distanceUpper = |
| bitrate - sbrTuningTable[bitRateClosestUpperIndex].bitrateTo; |
| } |
| if (distanceUpper < distanceLower) { |
| *pBitRateClosest = bitRateClosestUpper; |
| } else { |
| *pBitRateClosest = bitRateClosestLower; |
| } |
| } else { |
| *pBitRateClosest = 0; |
| } |
| } |
| |
| return INVALID_TABLE_IDX; |
| } |
| |
| /***************************************************************************/ |
| /*! |
| |
| \brief Selects the PS tuning settings to use dependent on bitrate |
| and core coder |
| |
| \return Index to the appropriate table |
| |
| ****************************************************************************/ |
| static INT getPsTuningTableIndex(UINT bitrate, UINT *pBitRateClosest) { |
| INT i, paramSets = sizeof(psTuningTable) / sizeof(psTuningTable[0]); |
| int bitRateClosestLowerIndex = -1, bitRateClosestUpperIndex = -1; |
| UINT bitRateClosestUpper = 0, bitRateClosestLower = DISTANCE_CEIL_VALUE; |
| |
| for (i = 0; i < paramSets; i++) { |
| if ((bitrate >= psTuningTable[i].bitrateFrom) && |
| (bitrate < psTuningTable[i].bitrateTo)) { |
| return i; |
| } else { |
| if (psTuningTable[i].bitrateFrom > bitrate) { |
| if (psTuningTable[i].bitrateFrom < bitRateClosestLower) { |
| bitRateClosestLower = psTuningTable[i].bitrateFrom; |
| bitRateClosestLowerIndex = i; |
| } |
| } |
| if (psTuningTable[i].bitrateTo <= bitrate) { |
| if (psTuningTable[i].bitrateTo > bitRateClosestUpper) { |
| bitRateClosestUpper = psTuningTable[i].bitrateTo - 1; |
| bitRateClosestUpperIndex = i; |
| } |
| } |
| } |
| } |
| |
| if (bitRateClosestUpperIndex >= 0) { |
| return bitRateClosestUpperIndex; |
| } |
| |
| if (pBitRateClosest != NULL) { |
| int distanceUpper = DISTANCE_CEIL_VALUE, |
| distanceLower = DISTANCE_CEIL_VALUE; |
| if (bitRateClosestLowerIndex >= 0) { |
| distanceLower = |
| sbrTuningTable[bitRateClosestLowerIndex].bitrateFrom - bitrate; |
| } |
| if (bitRateClosestUpperIndex >= 0) { |
| distanceUpper = |
| bitrate - sbrTuningTable[bitRateClosestUpperIndex].bitrateTo; |
| } |
| if (distanceUpper < distanceLower) { |
| *pBitRateClosest = bitRateClosestUpper; |
| } else { |
| *pBitRateClosest = bitRateClosestLower; |
| } |
| } |
| |
| return INVALID_TABLE_IDX; |
| } |
| |
| /***************************************************************************/ |
| /*! |
| |
| \brief In case of downsampled SBR we may need to lower the stop freq |
| of a tuning setting to fit into the lower half of the |
| spectrum ( which is sampleRate/4 ) |
| |
| \return the adapted stop frequency index (-1 -> error) |
| |
| \ingroup SbrEncCfg |
| |
| ****************************************************************************/ |
| static INT FDKsbrEnc_GetDownsampledStopFreq(const INT sampleRateCore, |
| const INT startFreq, INT stopFreq, |
| const INT downSampleFactor) { |
| INT maxStopFreqRaw = sampleRateCore / 2; |
| INT startBand, stopBand; |
| HANDLE_ERROR_INFO err; |
| |
| while (stopFreq > 0 && FDKsbrEnc_getSbrStopFreqRAW(stopFreq, sampleRateCore) > |
| maxStopFreqRaw) { |
| stopFreq--; |
| } |
| |
| if (FDKsbrEnc_getSbrStopFreqRAW(stopFreq, sampleRateCore) > maxStopFreqRaw) |
| return -1; |
| |
| err = FDKsbrEnc_FindStartAndStopBand( |
| sampleRateCore << (downSampleFactor - 1), sampleRateCore, |
| 32 << (downSampleFactor - 1), startFreq, stopFreq, &startBand, &stopBand); |
| if (err) return -1; |
| |
| return stopFreq; |
| } |
| |
| /***************************************************************************/ |
| /*! |
| |
| \brief tells us, if for the given coreCoder, bitrate, number of channels |
| and input sampling rate an SBR setting is available. If yes, it |
| tells us also the core sampling rate we would need to run with |
| |
| \return a flag indicating success: yes (1) or no (0) |
| |
| ****************************************************************************/ |
| static UINT FDKsbrEnc_IsSbrSettingAvail( |
| UINT bitrate, /*! the total bitrate in bits/sec */ |
| UINT vbrMode, /*! the vbr paramter, 0 means constant bitrate */ |
| UINT numOutputChannels, /*! the number of channels for the core coder */ |
| UINT sampleRateInput, /*! the input sample rate [in Hz] */ |
| UINT sampleRateCore, /*! the core's sampling rate */ |
| AUDIO_OBJECT_TYPE core) { |
| INT idx = INVALID_TABLE_IDX; |
| |
| if (sampleRateInput < 16000) return 0; |
| |
| if (bitrate == 0) { |
| /* map vbr quality to bitrate */ |
| if (vbrMode < 30) |
| bitrate = 24000; |
| else if (vbrMode < 40) |
| bitrate = 28000; |
| else if (vbrMode < 60) |
| bitrate = 32000; |
| else if (vbrMode < 75) |
| bitrate = 40000; |
| else |
| bitrate = 48000; |
| bitrate *= numOutputChannels; |
| } |
| |
| idx = getSbrTuningTableIndex(bitrate, numOutputChannels, sampleRateCore, core, |
| NULL); |
| |
| return (idx == INVALID_TABLE_IDX ? 0 : 1); |
| } |
| |
| /***************************************************************************/ |
| /*! |
| |
| \brief Adjusts the SBR settings according to the chosen core coder |
| settings which are accessible via config->codecSettings |
| |
| \return A flag indicating success: yes (1) or no (0) |
| |
| ****************************************************************************/ |
| static UINT FDKsbrEnc_AdjustSbrSettings( |
| const sbrConfigurationPtr config, /*! output, modified */ |
| UINT bitRate, /*! the total bitrate in bits/sec */ |
| UINT numChannels, /*! the core coder number of channels */ |
| UINT sampleRateCore, /*! the core coder sampling rate in Hz */ |
| UINT sampleRateSbr, /*! the sbr coder sampling rate in Hz */ |
| UINT transFac, /*! the short block to long block ratio */ |
| UINT standardBitrate, /*! the standard bitrate per channel in bits/sec */ |
| UINT vbrMode, /*! the vbr paramter, 0 poor quality .. 100 high quality*/ |
| UINT useSpeechConfig, /*!< adapt tuning parameters for speech ? */ |
| UINT lcsMode, /*! the low complexity stereo mode */ |
| UINT bParametricStereo, /*!< use parametric stereo */ |
| AUDIO_OBJECT_TYPE core) /* Core audio codec object type */ |
| { |
| INT idx = INVALID_TABLE_IDX; |
| /* set the core codec settings */ |
| config->codecSettings.bitRate = bitRate; |
| config->codecSettings.nChannels = numChannels; |
| config->codecSettings.sampleFreq = sampleRateCore; |
| config->codecSettings.transFac = transFac; |
| config->codecSettings.standardBitrate = standardBitrate; |
| |
| if (bitRate < 28000) { |
| config->threshold_AmpRes_FF_m = (FIXP_DBL)MAXVAL_DBL; |
| config->threshold_AmpRes_FF_e = 7; |
| } else if (bitRate >= 28000 && bitRate <= 48000) { |
| /* The float threshold is 75 |
| 0.524288f is fractional part of RELAXATION, the quotaMatrix and therefore |
| tonality are scaled by this 2/3 is because the original implementation |
| divides the tonality values by 3, here it's divided by 2 128 compensates |
| the necessary shiftfactor of 7 */ |
| config->threshold_AmpRes_FF_m = |
| FL2FXCONST_DBL(75.0f * 0.524288f / (2.0f / 3.0f) / 128.0f); |
| config->threshold_AmpRes_FF_e = 7; |
| } else if (bitRate > 48000) { |
| config->threshold_AmpRes_FF_m = FL2FXCONST_DBL(0); |
| config->threshold_AmpRes_FF_e = 0; |
| } |
| |
| if (bitRate == 0) { |
| /* map vbr quality to bitrate */ |
| if (vbrMode < 30) |
| bitRate = 24000; |
| else if (vbrMode < 40) |
| bitRate = 28000; |
| else if (vbrMode < 60) |
| bitRate = 32000; |
| else if (vbrMode < 75) |
| bitRate = 40000; |
| else |
| bitRate = 48000; |
| bitRate *= numChannels; |
| /* fix to enable mono vbrMode<40 @ 44.1 of 48kHz */ |
| if (numChannels == 1) { |
| if (sampleRateSbr == 44100 || sampleRateSbr == 48000) { |
| if (vbrMode < 40) bitRate = 32000; |
| } |
| } |
| } |
| |
| idx = |
| getSbrTuningTableIndex(bitRate, numChannels, sampleRateCore, core, NULL); |
| |
| if (idx != INVALID_TABLE_IDX) { |
| config->startFreq = sbrTuningTable[idx].startFreq; |
| config->stopFreq = sbrTuningTable[idx].stopFreq; |
| if (useSpeechConfig) { |
| config->startFreq = sbrTuningTable[idx].startFreqSpeech; |
| config->stopFreq = sbrTuningTable[idx].stopFreqSpeech; |
| } |
| |
| /* Adapt stop frequency in case of downsampled SBR - only 32 bands then */ |
| if (1 == config->downSampleFactor) { |
| INT dsStopFreq = FDKsbrEnc_GetDownsampledStopFreq( |
| sampleRateCore, config->startFreq, config->stopFreq, |
| config->downSampleFactor); |
| if (dsStopFreq < 0) { |
| return 0; |
| } |
| |
| config->stopFreq = dsStopFreq; |
| } |
| |
| config->sbr_noise_bands = sbrTuningTable[idx].numNoiseBands; |
| if (core == AOT_ER_AAC_ELD) config->init_amp_res_FF = SBR_AMP_RES_1_5; |
| config->noiseFloorOffset = sbrTuningTable[idx].noiseFloorOffset; |
| |
| config->ana_max_level = sbrTuningTable[idx].noiseMaxLevel; |
| config->stereoMode = sbrTuningTable[idx].stereoMode; |
| config->freqScale = sbrTuningTable[idx].freqScale; |
| |
| if (numChannels == 1) { |
| /* stereo case */ |
| switch (core) { |
| case AOT_AAC_LC: |
| if (bitRate <= (useSpeechConfig ? 24000U : 20000U)) { |
| config->freq_res_fixfix[0] = FREQ_RES_LOW; /* set low frequency |
| resolution for |
| non-split frames */ |
| config->freq_res_fixfix[1] = FREQ_RES_LOW; /* set low frequency |
| resolution for split |
| frames */ |
| } |
| break; |
| case AOT_ER_AAC_ELD: |
| if (bitRate < 36000) |
| config->freq_res_fixfix[1] = FREQ_RES_LOW; /* set low frequency |
| resolution for split |
| frames */ |
| if (bitRate < 26000) { |
| config->freq_res_fixfix[0] = FREQ_RES_LOW; /* set low frequency |
| resolution for |
| non-split frames */ |
| config->fResTransIsLow = |
| 1; /* for transient frames, set low frequency resolution */ |
| } |
| break; |
| default: |
| break; |
| } |
| } else { |
| /* stereo case */ |
| switch (core) { |
| case AOT_AAC_LC: |
| if (bitRate <= 28000) { |
| config->freq_res_fixfix[0] = FREQ_RES_LOW; /* set low frequency |
| resolution for |
| non-split frames */ |
| config->freq_res_fixfix[1] = FREQ_RES_LOW; /* set low frequency |
| resolution for split |
| frames */ |
| } |
| break; |
| case AOT_ER_AAC_ELD: |
| if (bitRate < 72000) { |
| config->freq_res_fixfix[1] = FREQ_RES_LOW; /* set low frequency |
| resolution for split |
| frames */ |
| } |
| if (bitRate < 52000) { |
| config->freq_res_fixfix[0] = FREQ_RES_LOW; /* set low frequency |
| resolution for |
| non-split frames */ |
| config->fResTransIsLow = |
| 1; /* for transient frames, set low frequency resolution */ |
| } |
| break; |
| default: |
| break; |
| } |
| if (bitRate <= 28000) { |
| /* |
| additionally restrict frequency resolution in FIXFIX frames |
| to further reduce SBR payload size */ |
| config->freq_res_fixfix[0] = FREQ_RES_LOW; |
| config->freq_res_fixfix[1] = FREQ_RES_LOW; |
| } |
| } |
| |
| /* adjust usage of parametric coding dependent on bitrate and speech config |
| * flag */ |
| if (useSpeechConfig) config->parametricCoding = 0; |
| |
| if (core == AOT_ER_AAC_ELD) { |
| if (bitRate < 28000) config->init_amp_res_FF = SBR_AMP_RES_3_0; |
| config->SendHeaderDataTime = -1; |
| } |
| |
| if (numChannels == 1) { |
| if (bitRate < 16000) { |
| config->parametricCoding = 0; |
| } |
| } else { |
| if (bitRate < 20000) { |
| config->parametricCoding = 0; |
| } |
| } |
| |
| config->useSpeechConfig = useSpeechConfig; |
| |
| /* PS settings */ |
| config->bParametricStereo = bParametricStereo; |
| |
| return 1; |
| } else { |
| return 0; |
| } |
| } |
| |
| /***************************************************************************** |
| |
| functionname: FDKsbrEnc_InitializeSbrDefaults |
| description: initializes the SBR configuration |
| returns: error status |
| input: - core codec type, |
| - factor of SBR to core frame length, |
| - core frame length |
| output: initialized SBR configuration |
| |
| *****************************************************************************/ |
| static UINT FDKsbrEnc_InitializeSbrDefaults(sbrConfigurationPtr config, |
| INT downSampleFactor, |
| UINT codecGranuleLen, |
| const INT isLowDelay) { |
| if ((downSampleFactor < 1 || downSampleFactor > 2) || |
| (codecGranuleLen * downSampleFactor > 64 * 32)) |
| return (0); /* error */ |
| |
| config->SendHeaderDataTime = 1000; |
| config->useWaveCoding = 0; |
| config->crcSbr = 0; |
| config->dynBwSupported = 1; |
| if (isLowDelay) |
| config->tran_thr = 6000; |
| else |
| config->tran_thr = 13000; |
| |
| config->parametricCoding = 1; |
| |
| config->sbrFrameSize = codecGranuleLen * downSampleFactor; |
| config->downSampleFactor = downSampleFactor; |
| |
| /* sbr default parameters */ |
| config->sbr_data_extra = 0; |
| config->amp_res = SBR_AMP_RES_3_0; |
| config->tran_fc = 0; |
| config->tran_det_mode = 1; |
| config->spread = 1; |
| config->stat = 0; |
| config->e = 1; |
| config->deltaTAcrossFrames = 1; |
| config->dF_edge_1stEnv = FL2FXCONST_DBL(0.3f); |
| config->dF_edge_incr = FL2FXCONST_DBL(0.3f); |
| |
| config->sbr_invf_mode = INVF_SWITCHED; |
| config->sbr_xpos_mode = XPOS_LC; |
| config->sbr_xpos_ctrl = SBR_XPOS_CTRL_DEFAULT; |
| config->sbr_xpos_level = 0; |
| config->useSaPan = 0; |
| config->dynBwEnabled = 0; |
| |
| /* the following parameters are overwritten by the |
| FDKsbrEnc_AdjustSbrSettings() function since they are included in the |
| tuning table */ |
| config->stereoMode = SBR_SWITCH_LRC; |
| config->ana_max_level = 6; |
| config->noiseFloorOffset = 0; |
| config->startFreq = 5; /* 5.9 respectively 6.0 kHz at fs = 44.1/48 kHz */ |
| config->stopFreq = 9; /* 16.2 respectively 16.8 kHz at fs = 44.1/48 kHz */ |
| config->freq_res_fixfix[0] = FREQ_RES_HIGH; /* non-split case */ |
| config->freq_res_fixfix[1] = FREQ_RES_HIGH; /* split case */ |
| config->fResTransIsLow = 0; /* for transient frames, set variable frequency |
| resolution according to freqResTable */ |
| |
| /* header_extra_1 */ |
| config->freqScale = SBR_FREQ_SCALE_DEFAULT; |
| config->alterScale = SBR_ALTER_SCALE_DEFAULT; |
| config->sbr_noise_bands = SBR_NOISE_BANDS_DEFAULT; |
| |
| /* header_extra_2 */ |
| config->sbr_limiter_bands = SBR_LIMITER_BANDS_DEFAULT; |
| config->sbr_limiter_gains = SBR_LIMITER_GAINS_DEFAULT; |
| config->sbr_interpol_freq = SBR_INTERPOL_FREQ_DEFAULT; |
| config->sbr_smoothing_length = SBR_SMOOTHING_LENGTH_DEFAULT; |
| |
| return 1; |
| } |
| |
| /***************************************************************************** |
| |
| functionname: DeleteEnvChannel |
| description: frees memory of one SBR channel |
| returns: - |
| input: handle of channel |
| output: released handle |
| |
| *****************************************************************************/ |
| static void deleteEnvChannel(HANDLE_ENV_CHANNEL hEnvCut) { |
| if (hEnvCut) { |
| FDKsbrEnc_DeleteTonCorrParamExtr(&hEnvCut->TonCorr); |
| |
| FDKsbrEnc_deleteExtractSbrEnvelope(&hEnvCut->sbrExtractEnvelope); |
| } |
| } |
| |
| /***************************************************************************** |
| |
| functionname: sbrEncoder_ChannelClose |
| description: close the channel coding handle |
| returns: |
| input: phSbrChannel |
| output: |
| |
| *****************************************************************************/ |
| static void sbrEncoder_ChannelClose(HANDLE_SBR_CHANNEL hSbrChannel) { |
| if (hSbrChannel != NULL) { |
| deleteEnvChannel(&hSbrChannel->hEnvChannel); |
| } |
| } |
| |
| /***************************************************************************** |
| |
| functionname: sbrEncoder_ElementClose |
| description: close the channel coding handle |
| returns: |
| input: phSbrChannel |
| output: |
| |
| *****************************************************************************/ |
| static void sbrEncoder_ElementClose(HANDLE_SBR_ELEMENT *phSbrElement) { |
| HANDLE_SBR_ELEMENT hSbrElement = *phSbrElement; |
| |
| if (hSbrElement != NULL) { |
| if (hSbrElement->sbrConfigData.v_k_master) |
| FreeRam_Sbr_v_k_master(&hSbrElement->sbrConfigData.v_k_master); |
| if (hSbrElement->sbrConfigData.freqBandTable[LO]) |
| FreeRam_Sbr_freqBandTableLO( |
| &hSbrElement->sbrConfigData.freqBandTable[LO]); |
| if (hSbrElement->sbrConfigData.freqBandTable[HI]) |
| FreeRam_Sbr_freqBandTableHI( |
| &hSbrElement->sbrConfigData.freqBandTable[HI]); |
| |
| FreeRam_SbrElement(phSbrElement); |
| } |
| return; |
| } |
| |
| void sbrEncoder_Close(HANDLE_SBR_ENCODER *phSbrEncoder) { |
| HANDLE_SBR_ENCODER hSbrEncoder = *phSbrEncoder; |
| |
| if (hSbrEncoder != NULL) { |
| int el, ch; |
| |
| for (el = 0; el < (8); el++) { |
| if (hSbrEncoder->sbrElement[el] != NULL) { |
| sbrEncoder_ElementClose(&hSbrEncoder->sbrElement[el]); |
| } |
| } |
| |
| /* Close sbr Channels */ |
| for (ch = 0; ch < (8); ch++) { |
| if (hSbrEncoder->pSbrChannel[ch]) { |
| sbrEncoder_ChannelClose(hSbrEncoder->pSbrChannel[ch]); |
| FreeRam_SbrChannel(&hSbrEncoder->pSbrChannel[ch]); |
| } |
| |
| if (hSbrEncoder->QmfAnalysis[ch].FilterStates) |
| FreeRam_Sbr_QmfStatesAnalysis( |
| (FIXP_QAS **)&hSbrEncoder->QmfAnalysis[ch].FilterStates); |
| } |
| |
| if (hSbrEncoder->hParametricStereo) |
| PSEnc_Destroy(&hSbrEncoder->hParametricStereo); |
| if (hSbrEncoder->qmfSynthesisPS.FilterStates) |
| FreeRam_PsQmfStatesSynthesis( |
| (FIXP_DBL **)&hSbrEncoder->qmfSynthesisPS.FilterStates); |
| |
| /* Release Overlay */ |
| if (hSbrEncoder->pSBRdynamic_RAM) |
| FreeRam_SbrDynamic_RAM((FIXP_DBL **)&hSbrEncoder->pSBRdynamic_RAM); |
| |
| FreeRam_SbrEncoder(phSbrEncoder); |
| } |
| } |
| |
| /***************************************************************************** |
| |
| functionname: updateFreqBandTable |
| description: updates vk_master |
| returns: - |
| input: config handle |
| output: error info |
| |
| *****************************************************************************/ |
| static INT updateFreqBandTable(HANDLE_SBR_CONFIG_DATA sbrConfigData, |
| HANDLE_SBR_HEADER_DATA sbrHeaderData, |
| const INT downSampleFactor) { |
| INT k0, k2; |
| |
| if (FDKsbrEnc_FindStartAndStopBand( |
| sbrConfigData->sampleFreq, |
| sbrConfigData->sampleFreq >> (downSampleFactor - 1), |
| sbrConfigData->noQmfBands, sbrHeaderData->sbr_start_frequency, |
| sbrHeaderData->sbr_stop_frequency, &k0, &k2)) |
| return (1); |
| |
| if (FDKsbrEnc_UpdateFreqScale( |
| sbrConfigData->v_k_master, &sbrConfigData->num_Master, k0, k2, |
| sbrHeaderData->freqScale, sbrHeaderData->alterScale)) |
| return (1); |
| |
| sbrHeaderData->sbr_xover_band = 0; |
| |
| if (FDKsbrEnc_UpdateHiRes(sbrConfigData->freqBandTable[HI], |
| &sbrConfigData->nSfb[HI], sbrConfigData->v_k_master, |
| sbrConfigData->num_Master, |
| &sbrHeaderData->sbr_xover_band)) |
| return (1); |
| |
| FDKsbrEnc_UpdateLoRes( |
| sbrConfigData->freqBandTable[LO], &sbrConfigData->nSfb[LO], |
| sbrConfigData->freqBandTable[HI], sbrConfigData->nSfb[HI]); |
| |
| sbrConfigData->xOverFreq = |
| (sbrConfigData->freqBandTable[LOW_RES][0] * sbrConfigData->sampleFreq / |
| sbrConfigData->noQmfBands + |
| 1) >> |
| 1; |
| |
| return (0); |
| } |
| |
| /***************************************************************************** |
| |
| functionname: resetEnvChannel |
| description: resets parameters and allocates memory |
| returns: error status |
| input: |
| output: hEnv |
| |
| *****************************************************************************/ |
| static INT resetEnvChannel(HANDLE_SBR_CONFIG_DATA sbrConfigData, |
| HANDLE_SBR_HEADER_DATA sbrHeaderData, |
| HANDLE_ENV_CHANNEL hEnv) { |
| /* note !!! hEnv->encEnvData.noOfnoisebands will be updated later in function |
| * FDKsbrEnc_extractSbrEnvelope !!!*/ |
| hEnv->TonCorr.sbrNoiseFloorEstimate.noiseBands = |
| sbrHeaderData->sbr_noise_bands; |
| |
| if (FDKsbrEnc_ResetTonCorrParamExtr( |
| &hEnv->TonCorr, sbrConfigData->xposCtrlSwitch, |
| sbrConfigData->freqBandTable[HI][0], sbrConfigData->v_k_master, |
| sbrConfigData->num_Master, sbrConfigData->sampleFreq, |
| sbrConfigData->freqBandTable, sbrConfigData->nSfb, |
| sbrConfigData->noQmfBands)) |
| return (1); |
| |
| hEnv->sbrCodeNoiseFloor.nSfb[LO] = |
| hEnv->TonCorr.sbrNoiseFloorEstimate.noNoiseBands; |
| hEnv->sbrCodeNoiseFloor.nSfb[HI] = |
| hEnv->TonCorr.sbrNoiseFloorEstimate.noNoiseBands; |
| |
| hEnv->sbrCodeEnvelope.nSfb[LO] = sbrConfigData->nSfb[LO]; |
| hEnv->sbrCodeEnvelope.nSfb[HI] = sbrConfigData->nSfb[HI]; |
| |
| hEnv->encEnvData.noHarmonics = sbrConfigData->nSfb[HI]; |
| |
| hEnv->sbrCodeEnvelope.upDate = 0; |
| hEnv->sbrCodeNoiseFloor.upDate = 0; |
| |
| return (0); |
| } |
| |
| /* ****************************** FDKsbrEnc_SbrGetXOverFreq |
| * ******************************/ |
| /** |
| * @fn |
| * @brief calculates the closest possible crossover frequency |
| * @return the crossover frequency SBR accepts |
| * |
| */ |
| static INT FDKsbrEnc_SbrGetXOverFreq( |
| HANDLE_SBR_ELEMENT hEnv, /*!< handle to SBR encoder instance */ |
| INT xoverFreq) /*!< from core coder suggested crossover frequency */ |
| { |
| INT band; |
| INT lastDiff, newDiff; |
| INT cutoffSb; |
| |
| UCHAR *RESTRICT pVKMaster = hEnv->sbrConfigData.v_k_master; |
| |
| /* Check if there is a matching cutoff frequency in the master table */ |
| cutoffSb = (4 * xoverFreq * hEnv->sbrConfigData.noQmfBands / |
| hEnv->sbrConfigData.sampleFreq + |
| 1) >> |
| 1; |
| lastDiff = cutoffSb; |
| for (band = 0; band < hEnv->sbrConfigData.num_Master; band++) { |
| newDiff = fixp_abs((INT)pVKMaster[band] - cutoffSb); |
| |
| if (newDiff >= lastDiff) { |
| band--; |
| break; |
| } |
| |
| lastDiff = newDiff; |
| } |
| |
| return ((pVKMaster[band] * hEnv->sbrConfigData.sampleFreq / |
| hEnv->sbrConfigData.noQmfBands + |
| 1) >> |
| 1); |
| } |
| |
| /***************************************************************************** |
| |
| functionname: FDKsbrEnc_EnvEncodeFrame |
| description: performs the sbr envelope calculation for one element |
| returns: |
| input: |
| output: |
| |
| *****************************************************************************/ |
| INT FDKsbrEnc_EnvEncodeFrame( |
| HANDLE_SBR_ENCODER hEnvEncoder, int iElement, |
| INT_PCM *samples, /*!< time samples, always deinterleaved */ |
| UINT samplesBufSize, /*!< time buffer channel stride */ |
| UINT *sbrDataBits, /*!< Size of SBR payload */ |
| UCHAR *sbrData, /*!< SBR payload */ |
| int clearOutput /*!< Do not consider any input signal */ |
| ) { |
| HANDLE_SBR_ELEMENT hSbrElement = NULL; |
| FDK_CRCINFO crcInfo; |
| INT crcReg; |
| INT ch; |
| INT band; |
| INT cutoffSb; |
| INT newXOver; |
| |
| if (hEnvEncoder == NULL) return -1; |
| |
| hSbrElement = hEnvEncoder->sbrElement[iElement]; |
| |
| if (hSbrElement == NULL) return -1; |
| |
| /* header bitstream handling */ |
| HANDLE_SBR_BITSTREAM_DATA sbrBitstreamData = &hSbrElement->sbrBitstreamData; |
| |
| INT psHeaderActive = 0; |
| sbrBitstreamData->HeaderActive = 0; |
| |
| /* Anticipate PS header because of internal PS bitstream delay in order to be |
| * in sync with SBR header. */ |
| if (sbrBitstreamData->CountSendHeaderData == |
| (sbrBitstreamData->NrSendHeaderData - 1)) { |
| psHeaderActive = 1; |
| } |
| |
| /* Signal SBR header to be written into bitstream */ |
| if (sbrBitstreamData->CountSendHeaderData == 0) { |
| sbrBitstreamData->HeaderActive = 1; |
| } |
| |
| /* Increment header interval counter */ |
| if (sbrBitstreamData->NrSendHeaderData == 0) { |
| sbrBitstreamData->CountSendHeaderData = 1; |
| } else { |
| if (sbrBitstreamData->CountSendHeaderData >= 0) { |
| sbrBitstreamData->CountSendHeaderData++; |
| sbrBitstreamData->CountSendHeaderData %= |
| sbrBitstreamData->NrSendHeaderData; |
| } |
| } |
| |
| if (hSbrElement->CmonData.dynBwEnabled) { |
| INT i; |
| for (i = 4; i > 0; i--) |
| hSbrElement->dynXOverFreqDelay[i] = hSbrElement->dynXOverFreqDelay[i - 1]; |
| |
| hSbrElement->dynXOverFreqDelay[0] = hSbrElement->CmonData.dynXOverFreqEnc; |
| if (hSbrElement->dynXOverFreqDelay[1] > hSbrElement->dynXOverFreqDelay[2]) |
| newXOver = hSbrElement->dynXOverFreqDelay[2]; |
| else |
| newXOver = hSbrElement->dynXOverFreqDelay[1]; |
| |
| /* has the crossover frequency changed? */ |
| if (hSbrElement->sbrConfigData.dynXOverFreq != newXOver) { |
| /* get corresponding master band */ |
| cutoffSb = ((4 * newXOver * hSbrElement->sbrConfigData.noQmfBands / |
| hSbrElement->sbrConfigData.sampleFreq) + |
| 1) >> |
| 1; |
| |
| for (band = 0; band < hSbrElement->sbrConfigData.num_Master; band++) { |
| if (cutoffSb == hSbrElement->sbrConfigData.v_k_master[band]) break; |
| } |
| FDK_ASSERT(band < hSbrElement->sbrConfigData.num_Master); |
| |
| hSbrElement->sbrConfigData.dynXOverFreq = newXOver; |
| hSbrElement->sbrHeaderData.sbr_xover_band = band; |
| hSbrElement->sbrBitstreamData.HeaderActive = 1; |
| psHeaderActive = 1; /* ps header is one frame delayed */ |
| |
| /* |
| update vk_master table |
| */ |
| if (updateFreqBandTable(&hSbrElement->sbrConfigData, |
| &hSbrElement->sbrHeaderData, |
| hEnvEncoder->downSampleFactor)) |
| return (1); |
| |
| /* reset SBR channels */ |
| INT nEnvCh = hSbrElement->sbrConfigData.nChannels; |
| for (ch = 0; ch < nEnvCh; ch++) { |
| if (resetEnvChannel(&hSbrElement->sbrConfigData, |
| &hSbrElement->sbrHeaderData, |
| &hSbrElement->sbrChannel[ch]->hEnvChannel)) |
| return (1); |
| } |
| } |
| } |
| |
| /* |
| allocate space for dummy header and crc |
| */ |
| crcReg = FDKsbrEnc_InitSbrBitstream( |
| &hSbrElement->CmonData, |
| hSbrElement->payloadDelayLine[hEnvEncoder->nBitstrDelay], |
| MAX_PAYLOAD_SIZE * sizeof(UCHAR), &crcInfo, |
| hSbrElement->sbrConfigData.sbrSyntaxFlags); |
| |
| /* Temporal Envelope Data */ |
| SBR_FRAME_TEMP_DATA _fData; |
| SBR_FRAME_TEMP_DATA *fData = &_fData; |
| SBR_ENV_TEMP_DATA eData[MAX_NUM_CHANNELS]; |
| |
| /* Init Temporal Envelope Data */ |
| { |
| int i; |
| |
| FDKmemclear(&eData[0], sizeof(SBR_ENV_TEMP_DATA)); |
| FDKmemclear(&eData[1], sizeof(SBR_ENV_TEMP_DATA)); |
| FDKmemclear(fData, sizeof(SBR_FRAME_TEMP_DATA)); |
| |
| for (i = 0; i < MAX_NUM_NOISE_VALUES; i++) fData->res[i] = FREQ_RES_HIGH; |
| } |
| |
| if (!clearOutput) { |
| /* |
| * Transform audio data into QMF domain |
| */ |
| for (ch = 0; ch < hSbrElement->sbrConfigData.nChannels; ch++) { |
| HANDLE_ENV_CHANNEL h_envChan = &hSbrElement->sbrChannel[ch]->hEnvChannel; |
| HANDLE_SBR_EXTRACT_ENVELOPE sbrExtrEnv = &h_envChan->sbrExtractEnvelope; |
| |
| if (hSbrElement->elInfo.fParametricStereo == 0) { |
| QMF_SCALE_FACTOR tmpScale; |
| FIXP_DBL **pQmfReal, **pQmfImag; |
| C_AALLOC_SCRATCH_START(qmfWorkBuffer, FIXP_DBL, 64 * 2) |
| |
| /* Obtain pointers to QMF buffers. */ |
| pQmfReal = sbrExtrEnv->rBuffer; |
| pQmfImag = sbrExtrEnv->iBuffer; |
| |
| qmfAnalysisFiltering( |
| hSbrElement->hQmfAnalysis[ch], pQmfReal, pQmfImag, &tmpScale, |
| samples + hSbrElement->elInfo.ChannelIndex[ch] * samplesBufSize, 0, |
| 1, qmfWorkBuffer); |
| |
| h_envChan->qmfScale = tmpScale.lb_scale + 7; |
| |
| C_AALLOC_SCRATCH_END(qmfWorkBuffer, FIXP_DBL, 64 * 2) |
| |
| } /* fParametricStereo == 0 */ |
| |
| /* |
| Parametric Stereo processing |
| */ |
| if (hSbrElement->elInfo.fParametricStereo) { |
| INT error = noError; |
| |
| /* Limit Parametric Stereo to one instance */ |
| FDK_ASSERT(ch == 0); |
| |
| if (error == noError) { |
| /* parametric stereo processing: |
| - input: |
| o left and right time domain samples |
| - processing: |
| o stereo qmf analysis |
| o stereo hybrid analysis |
| o ps parameter extraction |
| o downmix + hybrid synthesis |
| - output: |
| o downmixed qmf data is written to sbrExtrEnv->rBuffer and |
| sbrExtrEnv->iBuffer |
| */ |
| SCHAR qmfScale; |
| INT_PCM *pSamples[2] = { |
| samples + hSbrElement->elInfo.ChannelIndex[0] * samplesBufSize, |
| samples + hSbrElement->elInfo.ChannelIndex[1] * samplesBufSize}; |
| error = FDKsbrEnc_PSEnc_ParametricStereoProcessing( |
| hEnvEncoder->hParametricStereo, pSamples, samplesBufSize, |
| hSbrElement->hQmfAnalysis, sbrExtrEnv->rBuffer, |
| sbrExtrEnv->iBuffer, |
| samples + hSbrElement->elInfo.ChannelIndex[ch] * samplesBufSize, |
| &hEnvEncoder->qmfSynthesisPS, &qmfScale, psHeaderActive); |
| h_envChan->qmfScale = (int)qmfScale; |
| } |
| |
| } /* if (hEnvEncoder->hParametricStereo) */ |
| |
| /* |
| |
| Extract Envelope relevant things from QMF data |
| |
| */ |
| FDKsbrEnc_extractSbrEnvelope1(&hSbrElement->sbrConfigData, |
| &hSbrElement->sbrHeaderData, |
| &hSbrElement->sbrBitstreamData, h_envChan, |
| &hSbrElement->CmonData, &eData[ch], fData); |
| |
| } /* hEnvEncoder->sbrConfigData.nChannels */ |
| } |
| |
| /* |
| Process Envelope relevant things and calculate envelope data and write |
| payload |
| */ |
| FDKsbrEnc_extractSbrEnvelope2( |
| &hSbrElement->sbrConfigData, &hSbrElement->sbrHeaderData, |
| (hSbrElement->elInfo.fParametricStereo) ? hEnvEncoder->hParametricStereo |
| : NULL, |
| &hSbrElement->sbrBitstreamData, &hSbrElement->sbrChannel[0]->hEnvChannel, |
| (hSbrElement->sbrConfigData.stereoMode != SBR_MONO) |
| ? &hSbrElement->sbrChannel[1]->hEnvChannel |
| : NULL, |
| &hSbrElement->CmonData, eData, fData, clearOutput); |
| |
| hSbrElement->sbrBitstreamData.rightBorderFIX = 0; |
| |
| /* |
| format payload, calculate crc |
| */ |
| FDKsbrEnc_AssembleSbrBitstream(&hSbrElement->CmonData, &crcInfo, crcReg, |
| hSbrElement->sbrConfigData.sbrSyntaxFlags); |
| |
| /* |
| save new payload, set to zero length if greater than MAX_PAYLOAD_SIZE |
| */ |
| hSbrElement->payloadDelayLineSize[hEnvEncoder->nBitstrDelay] = |
| FDKgetValidBits(&hSbrElement->CmonData.sbrBitbuf); |
| |
| if (hSbrElement->payloadDelayLineSize[hEnvEncoder->nBitstrDelay] > |
| (MAX_PAYLOAD_SIZE << 3)) |
| hSbrElement->payloadDelayLineSize[hEnvEncoder->nBitstrDelay] = 0; |
| |
| /* While filling the Delay lines, sbrData is NULL */ |
| if (sbrData) { |
| *sbrDataBits = hSbrElement->payloadDelayLineSize[0]; |
| FDKmemcpy(sbrData, hSbrElement->payloadDelayLine[0], |
| (hSbrElement->payloadDelayLineSize[0] + 7) >> 3); |
| } |
| |
| /* delay header active flag */ |
| if (hSbrElement->sbrBitstreamData.HeaderActive == 1) { |
| hSbrElement->sbrBitstreamData.HeaderActiveDelay = |
| 1 + hEnvEncoder->nBitstrDelay; |
| } else { |
| if (hSbrElement->sbrBitstreamData.HeaderActiveDelay > 0) { |
| hSbrElement->sbrBitstreamData.HeaderActiveDelay--; |
| } |
| } |
| |
| return (0); |
| } |
| |
| /***************************************************************************** |
| |
| functionname: FDKsbrEnc_Downsample |
| description: performs downsampling and delay compensation of the core path |
| returns: |
| input: |
| output: |
| |
| *****************************************************************************/ |
| INT FDKsbrEnc_Downsample( |
| HANDLE_SBR_ENCODER hSbrEncoder, |
| INT_PCM *samples, /*!< time samples, always deinterleaved */ |
| UINT samplesBufSize, /*!< time buffer size per channel */ |
| UINT numChannels, /*!< number of channels */ |
| UINT *sbrDataBits, /*!< Size of SBR payload */ |
| UCHAR *sbrData, /*!< SBR payload */ |
| int clearOutput /*!< Do not consider any input signal */ |
| ) { |
| HANDLE_SBR_ELEMENT hSbrElement = NULL; |
| INT nOutSamples; |
| int el; |
| if (hSbrEncoder->downSampleFactor > 1) { |
| /* Do downsampling */ |
| |
| /* Loop over elements (LFE is handled later) */ |
| for (el = 0; el < hSbrEncoder->noElements; el++) { |
| hSbrElement = hSbrEncoder->sbrElement[el]; |
| if (hSbrEncoder->sbrElement[el] != NULL) { |
| if (hSbrEncoder->downsamplingMethod == SBRENC_DS_TIME) { |
| int ch; |
| int nChannels = hSbrElement->sbrConfigData.nChannels; |
| |
| for (ch = 0; ch < nChannels; ch++) { |
| FDKaacEnc_Downsample( |
| &hSbrElement->sbrChannel[ch]->downSampler, |
| samples + |
| hSbrElement->elInfo.ChannelIndex[ch] * samplesBufSize + |
| hSbrEncoder->bufferOffset / numChannels, |
| hSbrElement->sbrConfigData.frameSize, |
| samples + hSbrElement->elInfo.ChannelIndex[ch] * samplesBufSize, |
| &nOutSamples); |
| } |
| } |
| } |
| } |
| |
| /* Handle LFE (if existing) */ |
| if (hSbrEncoder->lfeChIdx != -1) { /* lfe downsampler */ |
| FDKaacEnc_Downsample(&hSbrEncoder->lfeDownSampler, |
| samples + hSbrEncoder->lfeChIdx * samplesBufSize + |
| hSbrEncoder->bufferOffset / numChannels, |
| hSbrEncoder->frameSize, |
| samples + hSbrEncoder->lfeChIdx * samplesBufSize, |
| &nOutSamples); |
| } |
| } else { |
| /* No downsampling. Still, some buffer shifting for correct delay */ |
| int samples2Copy = hSbrEncoder->frameSize; |
| if (hSbrEncoder->bufferOffset / (int)numChannels < samples2Copy) { |
| for (int c = 0; c < (int)numChannels; c++) { |
| /* Do memmove while taking care of overlapping memory areas. (memcpy |
| does not necessarily take care) Distinguish between oeverlapping and |
| non overlapping version due to reasons of complexity. */ |
| FDKmemmove(samples + c * samplesBufSize, |
| samples + c * samplesBufSize + |
| hSbrEncoder->bufferOffset / numChannels, |
| samples2Copy * sizeof(INT_PCM)); |
| } |
| } else { |
| for (int c = 0; c < (int)numChannels; c++) { |
| /* Simple memcpy since the memory areas are not overlapping */ |
| FDKmemcpy(samples + c * samplesBufSize, |
| samples + c * samplesBufSize + |
| hSbrEncoder->bufferOffset / numChannels, |
| samples2Copy * sizeof(INT_PCM)); |
| } |
| } |
| } |
| |
| return 0; |
| } |
| |
| /***************************************************************************** |
| |
| functionname: createEnvChannel |
| description: initializes parameters and allocates memory |
| returns: error status |
| input: |
| output: hEnv |
| |
| *****************************************************************************/ |
| |
| static INT createEnvChannel(HANDLE_ENV_CHANNEL hEnv, INT channel, |
| UCHAR *dynamic_RAM) { |
| FDKmemclear(hEnv, sizeof(struct ENV_CHANNEL)); |
| |
| if (FDKsbrEnc_CreateTonCorrParamExtr(&hEnv->TonCorr, channel)) { |
| return (1); |
| } |
| |
| if (FDKsbrEnc_CreateExtractSbrEnvelope(&hEnv->sbrExtractEnvelope, channel, |
| /*chan*/ 0, dynamic_RAM)) { |
| return (1); |
| } |
| |
| return 0; |
| } |
| |
| /***************************************************************************** |
| |
| functionname: initEnvChannel |
| description: initializes parameters |
| returns: error status |
| input: |
| output: |
| |
| *****************************************************************************/ |
| static INT initEnvChannel(HANDLE_SBR_CONFIG_DATA sbrConfigData, |
| HANDLE_SBR_HEADER_DATA sbrHeaderData, |
| HANDLE_ENV_CHANNEL hEnv, sbrConfigurationPtr params, |
| ULONG statesInitFlag, INT chanInEl, |
| UCHAR *dynamic_RAM) { |
| int frameShift, tran_off = 0; |
| INT e; |
| INT tran_fc; |
| INT timeSlots, timeStep, startIndex; |
| INT noiseBands[2] = {3, 3}; |
| |
| e = 1 << params->e; |
| |
| FDK_ASSERT(params->e >= 0); |
| |
| hEnv->encEnvData.freq_res_fixfix[0] = params->freq_res_fixfix[0]; |
| hEnv->encEnvData.freq_res_fixfix[1] = params->freq_res_fixfix[1]; |
| hEnv->encEnvData.fResTransIsLow = params->fResTransIsLow; |
| |
| hEnv->fLevelProtect = 0; |
| |
| hEnv->encEnvData.ldGrid = |
| (sbrConfigData->sbrSyntaxFlags & SBR_SYNTAX_LOW_DELAY) ? 1 : 0; |
| |
| hEnv->encEnvData.sbr_xpos_mode = (XPOS_MODE)params->sbr_xpos_mode; |
| |
| if (hEnv->encEnvData.sbr_xpos_mode == XPOS_SWITCHED) { |
| /* |
| no other type than XPOS_MDCT or XPOS_SPEECH allowed, |
| but enable switching |
| */ |
| sbrConfigData->switchTransposers = TRUE; |
| hEnv->encEnvData.sbr_xpos_mode = XPOS_MDCT; |
| } else { |
| sbrConfigData->switchTransposers = FALSE; |
| } |
| |
| hEnv->encEnvData.sbr_xpos_ctrl = params->sbr_xpos_ctrl; |
| |
| /* extended data */ |
| if (params->parametricCoding) { |
| hEnv->encEnvData.extended_data = 1; |
| } else { |
| hEnv->encEnvData.extended_data = 0; |
| } |
| |
| hEnv->encEnvData.extension_size = 0; |
| |
| startIndex = QMF_FILTER_PROTOTYPE_SIZE - sbrConfigData->noQmfBands; |
| |
| switch (params->sbrFrameSize) { |
| case 2304: |
| timeSlots = 18; |
| break; |
| case 2048: |
| case 1024: |
| case 512: |
| timeSlots = 16; |
| break; |
| case 1920: |
| case 960: |
| case 480: |
| timeSlots = 15; |
| break; |
| case 1152: |
| timeSlots = 9; |
| break; |
| default: |
| return (1); /* Illegal frame size */ |
| } |
| |
| timeStep = sbrConfigData->noQmfSlots / timeSlots; |
| |
| if (FDKsbrEnc_InitTonCorrParamExtr( |
| params->sbrFrameSize, &hEnv->TonCorr, sbrConfigData, timeSlots, |
| params->sbr_xpos_ctrl, params->ana_max_level, |
| sbrHeaderData->sbr_noise_bands, params->noiseFloorOffset, |
| params->useSpeechConfig)) |
| return (1); |
| |
| hEnv->encEnvData.noOfnoisebands = |
| hEnv->TonCorr.sbrNoiseFloorEstimate.noNoiseBands; |
| |
| noiseBands[0] = hEnv->encEnvData.noOfnoisebands; |
| noiseBands[1] = hEnv->encEnvData.noOfnoisebands; |
| |
| hEnv->encEnvData.sbr_invf_mode = (INVF_MODE)params->sbr_invf_mode; |
| |
| if (hEnv->encEnvData.sbr_invf_mode == INVF_SWITCHED) { |
| hEnv->encEnvData.sbr_invf_mode = INVF_MID_LEVEL; |
| hEnv->TonCorr.switchInverseFilt = TRUE; |
| } else { |
| hEnv->TonCorr.switchInverseFilt = FALSE; |
| } |
| |
| tran_fc = params->tran_fc; |
| |
| if (tran_fc == 0) { |
| tran_fc = fixMin( |
| 5000, FDKsbrEnc_getSbrStartFreqRAW(sbrHeaderData->sbr_start_frequency, |
| params->codecSettings.sampleFreq)); |
| } |
| |
| tran_fc = |
| (tran_fc * 4 * sbrConfigData->noQmfBands / sbrConfigData->sampleFreq + |
| 1) >> |
| 1; |
| |
| if (sbrConfigData->sbrSyntaxFlags & SBR_SYNTAX_LOW_DELAY) { |
| frameShift = LD_PRETRAN_OFF; |
| tran_off = LD_PRETRAN_OFF + FRAME_MIDDLE_SLOT_512LD * timeStep; |
| } else { |
| frameShift = 0; |
| switch (timeSlots) { |
| /* The factor of 2 is by definition. */ |
| case NUMBER_TIME_SLOTS_2048: |
| tran_off = 8 + FRAME_MIDDLE_SLOT_2048 * timeStep; |
| break; |
| case NUMBER_TIME_SLOTS_1920: |
| tran_off = 7 + FRAME_MIDDLE_SLOT_1920 * timeStep; |
| break; |
| default: |
| return 1; |
| } |
| } |
| if (FDKsbrEnc_InitExtractSbrEnvelope( |
| &hEnv->sbrExtractEnvelope, sbrConfigData->noQmfSlots, |
| sbrConfigData->noQmfBands, startIndex, timeSlots, timeStep, tran_off, |
| statesInitFlag, chanInEl, dynamic_RAM, sbrConfigData->sbrSyntaxFlags)) |
| return (1); |
| |
| if (FDKsbrEnc_InitSbrCodeEnvelope(&hEnv->sbrCodeEnvelope, sbrConfigData->nSfb, |
| params->deltaTAcrossFrames, |
| params->dF_edge_1stEnv, |
| params->dF_edge_incr)) |
| return (1); |
| |
| if (FDKsbrEnc_InitSbrCodeEnvelope(&hEnv->sbrCodeNoiseFloor, noiseBands, |
| params->deltaTAcrossFrames, 0, 0)) |
| return (1); |
| |
| sbrConfigData->initAmpResFF = params->init_amp_res_FF; |
| |
| if (FDKsbrEnc_InitSbrHuffmanTables(&hEnv->encEnvData, &hEnv->sbrCodeEnvelope, |
| &hEnv->sbrCodeNoiseFloor, |
| sbrHeaderData->sbr_amp_res)) |
| return (1); |
| |
| FDKsbrEnc_initFrameInfoGenerator( |
| &hEnv->SbrEnvFrame, params->spread, e, params->stat, timeSlots, |
| hEnv->encEnvData.freq_res_fixfix, hEnv->encEnvData.fResTransIsLow, |
| hEnv->encEnvData.ldGrid); |
| |
| if (sbrConfigData->sbrSyntaxFlags & SBR_SYNTAX_LOW_DELAY) |
| |
| { |
| INT bandwidth_qmf_slot = |
| (sbrConfigData->sampleFreq >> 1) / (sbrConfigData->noQmfBands); |
| if (FDKsbrEnc_InitSbrFastTransientDetector( |
| &hEnv->sbrFastTransientDetector, sbrConfigData->noQmfSlots, |
| bandwidth_qmf_slot, sbrConfigData->noQmfBands, |
| sbrConfigData->freqBandTable[0][0])) |
| return (1); |
| } |
| |
| /* The transient detector has to be initialized also if the fast transient |
| detector was active, because the values from the transient detector |
| structure are used. */ |
| if (FDKsbrEnc_InitSbrTransientDetector( |
| &hEnv->sbrTransientDetector, sbrConfigData->sbrSyntaxFlags, |
| sbrConfigData->frameSize, sbrConfigData->sampleFreq, params, tran_fc, |
| sbrConfigData->noQmfSlots, sbrConfigData->noQmfBands, |
| hEnv->sbrExtractEnvelope.YBufferWriteOffset, |
| hEnv->sbrExtractEnvelope.YBufferSzShift, frameShift, tran_off)) |
| return (1); |
| |
| sbrConfigData->xposCtrlSwitch = params->sbr_xpos_ctrl; |
| |
| hEnv->encEnvData.noHarmonics = sbrConfigData->nSfb[HI]; |
| hEnv->encEnvData.addHarmonicFlag = 0; |
| |
| return (0); |
| } |
| |
| INT sbrEncoder_Open(HANDLE_SBR_ENCODER *phSbrEncoder, INT nElements, |
| INT nChannels, INT supportPS) { |
| INT i; |
| INT errorStatus = 1; |
| HANDLE_SBR_ENCODER hSbrEncoder = NULL; |
| |
| if (phSbrEncoder == NULL) { |
| goto bail; |
| } |
| |
| hSbrEncoder = GetRam_SbrEncoder(); |
| if (hSbrEncoder == NULL) { |
| goto bail; |
| } |
| FDKmemclear(hSbrEncoder, sizeof(SBR_ENCODER)); |
| |
| if (NULL == |
| (hSbrEncoder->pSBRdynamic_RAM = (UCHAR *)GetRam_SbrDynamic_RAM())) { |
| goto bail; |
| } |
| hSbrEncoder->dynamicRam = hSbrEncoder->pSBRdynamic_RAM; |
| |
| /* Create SBR elements */ |
| for (i = 0; i < nElements; i++) { |
| hSbrEncoder->sbrElement[i] = GetRam_SbrElement(i); |
| if (hSbrEncoder->sbrElement[i] == NULL) { |
| goto bail; |
| } |
| FDKmemclear(hSbrEncoder->sbrElement[i], sizeof(SBR_ELEMENT)); |
| hSbrEncoder->sbrElement[i]->sbrConfigData.freqBandTable[LO] = |
| GetRam_Sbr_freqBandTableLO(i); |
| hSbrEncoder->sbrElement[i]->sbrConfigData.freqBandTable[HI] = |
| GetRam_Sbr_freqBandTableHI(i); |
| hSbrEncoder->sbrElement[i]->sbrConfigData.v_k_master = |
| GetRam_Sbr_v_k_master(i); |
| if ((hSbrEncoder->sbrElement[i]->sbrConfigData.freqBandTable[LO] == NULL) || |
| (hSbrEncoder->sbrElement[i]->sbrConfigData.freqBandTable[HI] == NULL) || |
| (hSbrEncoder->sbrElement[i]->sbrConfigData.v_k_master == NULL)) { |
| goto bail; |
| } |
| } |
| |
| /* Create SBR channels */ |
| for (i = 0; i < nChannels; i++) { |
| hSbrEncoder->pSbrChannel[i] = GetRam_SbrChannel(i); |
| if (hSbrEncoder->pSbrChannel[i] == NULL) { |
| goto bail; |
| } |
| |
| if (createEnvChannel(&hSbrEncoder->pSbrChannel[i]->hEnvChannel, i, |
| hSbrEncoder->dynamicRam)) { |
| goto bail; |
| } |
| } |
| |
| /* Create QMF States */ |
| for (i = 0; i < fixMax(nChannels, (supportPS) ? 2 : 0); i++) { |
| hSbrEncoder->QmfAnalysis[i].FilterStates = GetRam_Sbr_QmfStatesAnalysis(i); |
| if (hSbrEncoder->QmfAnalysis[i].FilterStates == NULL) { |
| goto bail; |
| } |
| } |
| |
| /* Create Parametric Stereo handle */ |
| if (supportPS) { |
| if (PSEnc_Create(&hSbrEncoder->hParametricStereo)) { |
| goto bail; |
| } |
| |
| hSbrEncoder->qmfSynthesisPS.FilterStates = GetRam_PsQmfStatesSynthesis(); |
| if (hSbrEncoder->qmfSynthesisPS.FilterStates == NULL) { |
| goto bail; |
| } |
| } /* supportPS */ |
| |
| *phSbrEncoder = hSbrEncoder; |
| |
| errorStatus = 0; |
| return errorStatus; |
| |
| bail: |
| /* Close SBR encoder instance */ |
| sbrEncoder_Close(&hSbrEncoder); |
| return errorStatus; |
| } |
| |
| static INT FDKsbrEnc_Reallocate(HANDLE_SBR_ENCODER hSbrEncoder, |
| SBR_ELEMENT_INFO elInfo[(8)], |
| const INT noElements) { |
| INT totalCh = 0; |
| INT totalQmf = 0; |
| INT coreEl; |
| INT el = -1; |
| |
| hSbrEncoder->lfeChIdx = -1; /* default value, until lfe found */ |
| |
| for (coreEl = 0; coreEl < noElements; coreEl++) { |
| /* SBR only handles SCE and CPE's */ |
| if (elInfo[coreEl].elType == ID_SCE || elInfo[coreEl].elType == ID_CPE) { |
| el++; |
| } else { |
| if (elInfo[coreEl].elType == ID_LFE) { |
| hSbrEncoder->lfeChIdx = elInfo[coreEl].ChannelIndex[0]; |
| } |
| continue; |
| } |
| |
| SBR_ELEMENT_INFO *pelInfo = &elInfo[coreEl]; |
| HANDLE_SBR_ELEMENT hSbrElement = hSbrEncoder->sbrElement[el]; |
| |
| int ch; |
| for (ch = 0; ch < pelInfo->nChannelsInEl; ch++) { |
| hSbrElement->sbrChannel[ch] = hSbrEncoder->pSbrChannel[totalCh]; |
| totalCh++; |
| } |
| /* analysis QMF */ |
| for (ch = 0; |
| ch < ((pelInfo->fParametricStereo) ? 2 : pelInfo->nChannelsInEl); |
| ch++) { |
| hSbrElement->elInfo.ChannelIndex[ch] = pelInfo->ChannelIndex[ch]; |
| hSbrElement->hQmfAnalysis[ch] = &hSbrEncoder->QmfAnalysis[totalQmf++]; |
| } |
| |
| /* Copy Element info */ |
| hSbrElement->elInfo.elType = pelInfo->elType; |
| hSbrElement->elInfo.instanceTag = pelInfo->instanceTag; |
| hSbrElement->elInfo.nChannelsInEl = pelInfo->nChannelsInEl; |
| hSbrElement->elInfo.fParametricStereo = pelInfo->fParametricStereo; |
| hSbrElement->elInfo.fDualMono = pelInfo->fDualMono; |
| } /* coreEl */ |
| |
| return 0; |
| } |
| |
| /***************************************************************************** |
| |
| functionname: FDKsbrEnc_bsBufInit |
| description: initializes bitstream buffer |
| returns: initialized bitstream buffer in env encoder |
| input: |
| output: hEnv |
| |
| *****************************************************************************/ |
| static INT FDKsbrEnc_bsBufInit(HANDLE_SBR_ELEMENT hSbrElement, |
| int nBitstrDelay) { |
| UCHAR *bitstreamBuffer; |
| |
| /* initialize the bitstream buffer */ |
| bitstreamBuffer = hSbrElement->payloadDelayLine[nBitstrDelay]; |
| FDKinitBitStream(&hSbrElement->CmonData.sbrBitbuf, bitstreamBuffer, |
| MAX_PAYLOAD_SIZE * sizeof(UCHAR), 0, BS_WRITER); |
| |
| return (0); |
| } |
| |
| /***************************************************************************** |
| |
| functionname: FDKsbrEnc_EnvInit |
| description: initializes parameters |
| returns: error status |
| input: |
| output: hEnv |
| |
| *****************************************************************************/ |
| static INT FDKsbrEnc_EnvInit(HANDLE_SBR_ELEMENT hSbrElement, |
| sbrConfigurationPtr params, INT *coreBandWith, |
| AUDIO_OBJECT_TYPE aot, int nElement, |
| const int headerPeriod, ULONG statesInitFlag, |
| const SBRENC_DS_TYPE downsamplingMethod, |
| UCHAR *dynamic_RAM) { |
| int ch, i; |
| |
| if ((params->codecSettings.nChannels < 1) || |
| (params->codecSettings.nChannels > MAX_NUM_CHANNELS)) { |
| return (1); |
| } |
| |
| /* init and set syntax flags */ |
| hSbrElement->sbrConfigData.sbrSyntaxFlags = 0; |
| |
| switch (aot) { |
| case AOT_ER_AAC_ELD: |
| hSbrElement->sbrConfigData.sbrSyntaxFlags |= SBR_SYNTAX_LOW_DELAY; |
| break; |
| default: |
| break; |
| } |
| if (params->crcSbr) { |
| hSbrElement->sbrConfigData.sbrSyntaxFlags |= SBR_SYNTAX_CRC; |
| } |
| |
| hSbrElement->sbrConfigData.noQmfBands = 64 >> (2 - params->downSampleFactor); |
| switch (hSbrElement->sbrConfigData.noQmfBands) { |
| case 64: |
| hSbrElement->sbrConfigData.noQmfSlots = params->sbrFrameSize >> 6; |
| break; |
| case 32: |
| hSbrElement->sbrConfigData.noQmfSlots = params->sbrFrameSize >> 5; |
| break; |
| default: |
| hSbrElement->sbrConfigData.noQmfSlots = params->sbrFrameSize >> 6; |
| return (2); |
| } |
| |
| /* |
| now initialize sbrConfigData, sbrHeaderData and sbrBitstreamData, |
| */ |
| hSbrElement->sbrConfigData.nChannels = params->codecSettings.nChannels; |
| |
| if (params->codecSettings.nChannels == 2) { |
| if ((hSbrElement->elInfo.elType == ID_CPE) && |
| ((hSbrElement->elInfo.fDualMono == 1))) { |
| hSbrElement->sbrConfigData.stereoMode = SBR_LEFT_RIGHT; |
| } else { |
| hSbrElement->sbrConfigData.stereoMode = params->stereoMode; |
| } |
| } else { |
| hSbrElement->sbrConfigData.stereoMode = SBR_MONO; |
| } |
| |
| hSbrElement->sbrConfigData.frameSize = params->sbrFrameSize; |
| |
| hSbrElement->sbrConfigData.sampleFreq = |
| params->downSampleFactor * params->codecSettings.sampleFreq; |
| |
| hSbrElement->sbrBitstreamData.CountSendHeaderData = 0; |
| if (params->SendHeaderDataTime > 0) { |
| if (headerPeriod == -1) { |
| hSbrElement->sbrBitstreamData.NrSendHeaderData = (INT)( |
| params->SendHeaderDataTime * hSbrElement->sbrConfigData.sampleFreq / |
| (1000 * hSbrElement->sbrConfigData.frameSize)); |
| hSbrElement->sbrBitstreamData.NrSendHeaderData = |
| fixMax(hSbrElement->sbrBitstreamData.NrSendHeaderData, 1); |
| } else { |
| /* assure header period at least once per second */ |
| hSbrElement->sbrBitstreamData.NrSendHeaderData = fixMin( |
| fixMax(headerPeriod, 1), (hSbrElement->sbrConfigData.sampleFreq / |
| hSbrElement->sbrConfigData.frameSize)); |
| } |
| } else { |
| hSbrElement->sbrBitstreamData.NrSendHeaderData = 0; |
| } |
| |
| hSbrElement->sbrHeaderData.sbr_data_extra = params->sbr_data_extra; |
| hSbrElement->sbrBitstreamData.HeaderActive = 0; |
| hSbrElement->sbrBitstreamData.rightBorderFIX = 0; |
| hSbrElement->sbrHeaderData.sbr_start_frequency = params->startFreq; |
| hSbrElement->sbrHeaderData.sbr_stop_frequency = params->stopFreq; |
| hSbrElement->sbrHeaderData.sbr_xover_band = 0; |
| hSbrElement->sbrHeaderData.sbr_lc_stereo_mode = 0; |
| |
| /* data_extra */ |
| if (params->sbr_xpos_ctrl != SBR_XPOS_CTRL_DEFAULT) |
| hSbrElement->sbrHeaderData.sbr_data_extra = 1; |
| |
| hSbrElement->sbrHeaderData.sbr_amp_res = (AMP_RES)params->amp_res; |
| |
| /* header_extra_1 */ |
| hSbrElement->sbrHeaderData.freqScale = params->freqScale; |
| hSbrElement->sbrHeaderData.alterScale = params->alterScale; |
| hSbrElement->sbrHeaderData.sbr_noise_bands = params->sbr_noise_bands; |
| hSbrElement->sbrHeaderData.header_extra_1 = 0; |
| |
| if ((params->freqScale != SBR_FREQ_SCALE_DEFAULT) || |
| (params->alterScale != SBR_ALTER_SCALE_DEFAULT) || |
| (params->sbr_noise_bands != SBR_NOISE_BANDS_DEFAULT)) { |
| hSbrElement->sbrHeaderData.header_extra_1 = 1; |
| } |
| |
| /* header_extra_2 */ |
| hSbrElement->sbrHeaderData.sbr_limiter_bands = params->sbr_limiter_bands; |
| hSbrElement->sbrHeaderData.sbr_limiter_gains = params->sbr_limiter_gains; |
| |
| if ((hSbrElement->sbrConfigData.sampleFreq > 48000) && |
| (hSbrElement->sbrHeaderData.sbr_start_frequency >= 9)) { |
| hSbrElement->sbrHeaderData.sbr_limiter_gains = SBR_LIMITER_GAINS_INFINITE; |
| } |
| |
| hSbrElement->sbrHeaderData.sbr_interpol_freq = params->sbr_interpol_freq; |
| hSbrElement->sbrHeaderData.sbr_smoothing_length = |
| params->sbr_smoothing_length; |
| hSbrElement->sbrHeaderData.header_extra_2 = 0; |
| |
| if ((params->sbr_limiter_bands != SBR_LIMITER_BANDS_DEFAULT) || |
| (params->sbr_limiter_gains != SBR_LIMITER_GAINS_DEFAULT) || |
| (params->sbr_interpol_freq != SBR_INTERPOL_FREQ_DEFAULT) || |
| (params->sbr_smoothing_length != SBR_SMOOTHING_LENGTH_DEFAULT)) { |
| hSbrElement->sbrHeaderData.header_extra_2 = 1; |
| } |
| |
| /* other switches */ |
| hSbrElement->sbrConfigData.useWaveCoding = params->useWaveCoding; |
| hSbrElement->sbrConfigData.useParametricCoding = params->parametricCoding; |
| hSbrElement->sbrConfigData.thresholdAmpResFF_m = |
| params->threshold_AmpRes_FF_m; |
| hSbrElement->sbrConfigData.thresholdAmpResFF_e = |
| params->threshold_AmpRes_FF_e; |
| |
| /* init freq band table */ |
| if (updateFreqBandTable(&hSbrElement->sbrConfigData, |
| &hSbrElement->sbrHeaderData, |
| params->downSampleFactor)) { |
| return (1); |
| } |
| |
| /* now create envelope ext and QMF for each available channel */ |
| for (ch = 0; ch < hSbrElement->sbrConfigData.nChannels; ch++) { |
| if (initEnvChannel(&hSbrElement->sbrConfigData, &hSbrElement->sbrHeaderData, |
| &hSbrElement->sbrChannel[ch]->hEnvChannel, params, |
| statesInitFlag, ch, dynamic_RAM)) { |
| return (1); |
| } |
| |
| } /* nChannels */ |
| |
| /* reset and intialize analysis qmf */ |
| for (ch = 0; ch < ((hSbrElement->elInfo.fParametricStereo) |
| ? 2 |
| : hSbrElement->sbrConfigData.nChannels); |
| ch++) { |
| int err; |
| UINT qmfFlags = |
| (hSbrElement->sbrConfigData.sbrSyntaxFlags & SBR_SYNTAX_LOW_DELAY) |
| ? QMF_FLAG_CLDFB |
| : 0; |
| if (statesInitFlag) |
| qmfFlags &= ~QMF_FLAG_KEEP_STATES; |
| else |
| qmfFlags |= QMF_FLAG_KEEP_STATES; |
| |
| err = qmfInitAnalysisFilterBank( |
| hSbrElement->hQmfAnalysis[ch], |
| (FIXP_QAS *)hSbrElement->hQmfAnalysis[ch]->FilterStates, |
| hSbrElement->sbrConfigData.noQmfSlots, |
| hSbrElement->sbrConfigData.noQmfBands, |
| hSbrElement->sbrConfigData.noQmfBands, |
| hSbrElement->sbrConfigData.noQmfBands, qmfFlags); |
| if (0 != err) { |
| return err; |
| } |
| } |
| |
| /* */ |
| hSbrElement->CmonData.xOverFreq = hSbrElement->sbrConfigData.xOverFreq; |
| hSbrElement->CmonData.dynBwEnabled = |
| (params->dynBwSupported && params->dynBwEnabled); |
| hSbrElement->CmonData.dynXOverFreqEnc = |
| FDKsbrEnc_SbrGetXOverFreq(hSbrElement, hSbrElement->CmonData.xOverFreq); |
| for (i = 0; i < 5; i++) |
| hSbrElement->dynXOverFreqDelay[i] = hSbrElement->CmonData.dynXOverFreqEnc; |
| hSbrElement->CmonData.sbrNumChannels = hSbrElement->sbrConfigData.nChannels; |
| hSbrElement->sbrConfigData.dynXOverFreq = hSbrElement->CmonData.xOverFreq; |
| |
| /* Update Bandwith to be passed to the core encoder */ |
| *coreBandWith = hSbrElement->CmonData.xOverFreq; |
| |
| return (0); |
| } |
| |
| INT sbrEncoder_GetInBufferSize(int noChannels) { |
| INT temp; |
| |
| temp = (2048); |
| temp += 1024 + MAX_SAMPLE_DELAY; |
| temp *= noChannels; |
| temp *= sizeof(INT_PCM); |
| return temp; |
| } |
| |
| /* |
| * Encode Dummy SBR payload frames to fill the delay lines. |
| */ |
| static INT FDKsbrEnc_DelayCompensation(HANDLE_SBR_ENCODER hEnvEnc, |
| INT_PCM *timeBuffer, |
| UINT timeBufferBufSize) { |
| int n, el; |
| |
| for (n = hEnvEnc->nBitstrDelay; n > 0; n--) { |
| for (el = 0; el < hEnvEnc->noElements; el++) { |
| if (FDKsbrEnc_EnvEncodeFrame( |
| hEnvEnc, el, |
| timeBuffer + hEnvEnc->downsampledOffset / hEnvEnc->nChannels, |
| timeBufferBufSize, NULL, NULL, 1)) |
| return -1; |
| } |
| sbrEncoder_UpdateBuffers(hEnvEnc, timeBuffer, timeBufferBufSize); |
| } |
| return 0; |
| } |
| |
| UINT sbrEncoder_LimitBitRate(UINT bitRate, UINT numChannels, |
| UINT coreSampleRate, AUDIO_OBJECT_TYPE aot) { |
| UINT newBitRate = bitRate; |
| INT index; |
| |
| FDK_ASSERT(numChannels > 0 && numChannels <= 2); |
| if (aot == AOT_PS) { |
| if (numChannels == 1) { |
| index = getPsTuningTableIndex(bitRate, &newBitRate); |
| if (index == INVALID_TABLE_IDX) { |
| bitRate = newBitRate; |
| } |
| } else { |
| return 0; |
| } |
| } |
| index = getSbrTuningTableIndex(bitRate, numChannels, coreSampleRate, aot, |
| &newBitRate); |
| if (index != INVALID_TABLE_IDX) { |
| newBitRate = bitRate; |
| } |
| |
| return newBitRate; |
| } |
| |
| UINT sbrEncoder_IsSingleRatePossible(AUDIO_OBJECT_TYPE aot) { |
| UINT isPossible = (AOT_PS == aot) ? 0 : 1; |
| return isPossible; |
| } |
| |
| /*****************************************************************************/ |
| /* */ |
| /*functionname: sbrEncoder_Init_delay */ |
| /*description: Determine Delay balancing and new encoder delay */ |
| /* */ |
| /*returns: - error status */ |
| /*input: - frame length of the core (i.e. e.g. AAC) */ |
| /* - number of channels */ |
| /* - downsample factor (1 for downsampled, 2 for dual-rate SBR) */ |
| /* - low delay presence */ |
| /* - ps presence */ |
| /* - downsampling method: QMF-, time domain or no downsampling */ |
| /* - various delay values (see DELAY_PARAM struct description) */ |
| /* */ |
| /*Example: Delay balancing for a HE-AACv1 encoder (time-domain downsampling) */ |
| /*========================================================================== */ |
| /* */ |
| /* +--------+ +--------+ +--------+ +--------+ +--------+ */ |
| /* |core | |ds 2:1 | |AAC | |QMF | |QMF | */ |
| /* +-+path +------------+ +-+core +-+analysis+-+overlap +-+ */ |
| /* | |offset | | | | | |32 bands| | | | */ |
| /* | +--------+ +--------+ +--------+ +--------+ +--------+ | */ |
| /* | core path +-------++ */ |
| /* | |QMF | */ |
| /*->+ +synth. +-> */ |
| /* | |64 bands| */ |
| /* | +-------++ */ |
| /* | +--------+ +--------+ +--------+ +--------+ | */ |
| /* | |SBR path| |QMF | |subband | |bs delay| | */ |
| /* +-+offset +-+analysis+-+sample +-+(full +-----------------------+ */ |
| /* | | |64 bands| |buffer | | frames)| */ |
| /* +--------+ +--------+ +--------+ +--------+ */ |
| /* SBR path */ |
| /* */ |
| /*****************************************************************************/ |
| static INT sbrEncoder_Init_delay( |
| const int coreFrameLength, /* input */ |
| const int numChannels, /* input */ |
| const int downSampleFactor, /* input */ |
| const int lowDelay, /* input */ |
| const int usePs, /* input */ |
| const int is212, /* input */ |
| const SBRENC_DS_TYPE downsamplingMethod, /* input */ |
| DELAY_PARAM *hDelayParam /* input/output */ |
| ) { |
| int delayCorePath = 0; /* delay in core path */ |
| int delaySbrPath = 0; /* delay difference in QMF aka SBR path */ |
| int delayInput2Core = 0; /* delay from the input to the core */ |
| int delaySbrDec = 0; /* delay of the decoder's SBR module */ |
| |
| int delayCore = hDelayParam->delay; /* delay of the core */ |
| |
| /* Added delay by the SBR delay initialization */ |
| int corePathOffset = 0; /* core path */ |
| int sbrPathOffset = 0; /* sbr path */ |
| int bitstreamDelay = 0; /* sbr path, framewise */ |
| |
| int flCore = coreFrameLength; /* core frame length */ |
| |
| int returnValue = 0; /* return value - 0 means: no error */ |
| |
| /* 1) Calculate actual delay for core and SBR path */ |
| if (is212) { |
| delayCorePath = DELAY_COREPATH_ELDv2SBR(flCore, downSampleFactor); |
| delaySbrPath = DELAY_ELDv2SBR(flCore, downSampleFactor); |
| delaySbrDec = ((flCore) / 2) * (downSampleFactor); |
| } else if (lowDelay) { |
| delayCorePath = DELAY_COREPATH_ELDSBR(flCore, downSampleFactor); |
| delaySbrPath = DELAY_ELDSBR(flCore, downSampleFactor); |
| delaySbrDec = DELAY_QMF_POSTPROC(downSampleFactor); |
| } else if (usePs) { |
| delayCorePath = DELAY_COREPATH_PS(flCore, downSampleFactor); |
| delaySbrPath = DELAY_PS(flCore, downSampleFactor); |
| delaySbrDec = DELAY_COREPATH_SBR(flCore, downSampleFactor); |
| } else { |
| delayCorePath = DELAY_COREPATH_SBR(flCore, downSampleFactor); |
| delaySbrPath = DELAY_SBR(flCore, downSampleFactor); |
| delaySbrDec = DELAY_COREPATH_SBR(flCore, downSampleFactor); |
| } |
| delayCorePath += delayCore * downSampleFactor; |
| delayCorePath += |
| (downsamplingMethod == SBRENC_DS_TIME) ? hDelayParam->dsDelay : 0; |
| |
| /* 2) Manage coupling of paths */ |
| if (downsamplingMethod == SBRENC_DS_QMF && delayCorePath > delaySbrPath) { |
| /* In case of QMF downsampling, both paths are coupled, i.e. the SBR path |
| offset would be added to both the SBR path and to the core path |
| as well, thus making it impossible to achieve delay balancing. |
| To overcome that problem, a framewise delay is added to the SBR path |
| first, until the overall delay of the core path is shorter than |
| the delay of the SBR path. When this is achieved, the missing delay |
| difference can be added as downsampled offset to the core path. |
| */ |
| while (delayCorePath > delaySbrPath) { |
| /* Add one frame delay to SBR path */ |
| delaySbrPath += flCore * downSampleFactor; |
| bitstreamDelay += 1; |
| } |
| } |
| |
| /* 3) Calculate necessary additional delay to balance the paths */ |
| if (delayCorePath > delaySbrPath) { |
| /* Delay QMF input */ |
| while (delayCorePath > delaySbrPath + (int)flCore * (int)downSampleFactor) { |
| /* Do bitstream frame-wise delay balancing if there are |
| more than SBR framelength samples delay difference */ |
| delaySbrPath += flCore * downSampleFactor; |
| bitstreamDelay += 1; |
| } |
| /* Multiply input offset by input channels */ |
| corePathOffset = 0; |
| sbrPathOffset = (delayCorePath - delaySbrPath) * numChannels; |
| } else { |
| /* Delay AAC data */ |
| /* Multiply downsampled offset by AAC core channels. Divide by 2 because of |
| half samplerate of downsampled data. */ |
| corePathOffset = ((delaySbrPath - delayCorePath) * numChannels) >> |
| (downSampleFactor - 1); |
| sbrPathOffset = 0; |
| } |
| |
| /* 4) Calculate delay from input to core */ |
| if (usePs) { |
| delayInput2Core = |
| (DELAY_QMF_ANA(downSampleFactor) + DELAY_QMF_DS + DELAY_HYB_SYN) + |
| (downSampleFactor * corePathOffset) + 1; |
| } else if (downsamplingMethod == SBRENC_DS_TIME) { |
| delayInput2Core = corePathOffset + hDelayParam->dsDelay; |
| } else { |
| delayInput2Core = corePathOffset; |
| } |
| |
| /* 6) Set output parameters */ |
| hDelayParam->delay = FDKmax(delayCorePath, delaySbrPath); /* overall delay */ |
| hDelayParam->sbrDecDelay = delaySbrDec; /* SBR decoder delay */ |
| hDelayParam->delayInput2Core = delayInput2Core; /* delay input - core */ |
| hDelayParam->bitstrDelay = bitstreamDelay; /* bitstream delay, in frames */ |
| hDelayParam->corePathOffset = corePathOffset; /* offset added to core path */ |
| hDelayParam->sbrPathOffset = sbrPathOffset; /* offset added to SBR path */ |
| |
| return returnValue; |
| } |
| |
| /***************************************************************************** |
| |
| functionname: sbrEncoder_Init |
| description: initializes the SBR encoder |
| returns: error status |
| |
| *****************************************************************************/ |
| INT sbrEncoder_Init(HANDLE_SBR_ENCODER hSbrEncoder, |
| SBR_ELEMENT_INFO elInfo[(8)], int noElements, |
| INT_PCM *inputBuffer, UINT inputBufferBufSize, |
| INT *coreBandwidth, INT *inputBufferOffset, |
| INT *numChannels, const UINT syntaxFlags, |
| INT *coreSampleRate, UINT *downSampleFactor, |
| INT *frameLength, AUDIO_OBJECT_TYPE aot, int *delay, |
| int transformFactor, const int headerPeriod, |
| ULONG statesInitFlag) { |
| HANDLE_ERROR_INFO errorInfo = noError; |
| sbrConfiguration sbrConfig[(8)]; |
| INT error = 0; |
| INT lowestBandwidth; |
| /* Save input parameters */ |
| INT inputSampleRate = *coreSampleRate; |
| int coreFrameLength = *frameLength; |
| int inputBandWidth = *coreBandwidth; |
| int inputChannels = *numChannels; |
| |
| SBRENC_DS_TYPE downsamplingMethod = SBRENC_DS_NONE; |
| int highestSbrStartFreq, highestSbrStopFreq; |
| int lowDelay = 0; |
| int usePs = 0; |
| int is212 = 0; |
| |
| DELAY_PARAM delayParam; |
| |
| /* check whether SBR setting is available for the current encoder |
| * configuration (bitrate, samplerate) */ |
| if (!sbrEncoder_IsSingleRatePossible(aot)) { |
| *downSampleFactor = 2; |
| } |
| |
| if (aot == AOT_PS) { |
| usePs = 1; |
| } |
| if (aot == AOT_ER_AAC_ELD) { |
| lowDelay = 1; |
| } else if (aot == AOT_ER_AAC_LD) { |
| error = 1; |
| goto bail; |
| } |
| |
| /* Parametric Stereo */ |
| if (usePs) { |
| if (*numChannels == 2 && noElements == 1) { |
| /* Override Element type in case of Parametric stereo */ |
| elInfo[0].elType = ID_SCE; |
| elInfo[0].fParametricStereo = 1; |
| elInfo[0].nChannelsInEl = 1; |
| /* core encoder gets downmixed mono signal */ |
| *numChannels = 1; |
| } else { |
| error = 1; |
| goto bail; |
| } |
| } /* usePs */ |
| |
| /* set the core's sample rate */ |
| switch (*downSampleFactor) { |
| case 1: |
| *coreSampleRate = inputSampleRate; |
| downsamplingMethod = SBRENC_DS_NONE; |
| break; |
| case 2: |
| *coreSampleRate = inputSampleRate >> 1; |
| downsamplingMethod = usePs ? SBRENC_DS_QMF : SBRENC_DS_TIME; |
| break; |
| default: |
| *coreSampleRate = inputSampleRate >> 1; |
| return 0; /* return error */ |
| } |
| |
| /* check whether SBR setting is available for the current encoder |
| * configuration (bitrate, coreSampleRate) */ |
| { |
| int el, coreEl; |
| |
| /* Check if every element config is feasible */ |
| for (coreEl = 0; coreEl < noElements; coreEl++) { |
| /* SBR only handles SCE and CPE's */ |
| if (elInfo[coreEl].elType != ID_SCE && elInfo[coreEl].elType != ID_CPE) { |
| continue; |
| } |
| /* check if desired configuration is available */ |
| if (!FDKsbrEnc_IsSbrSettingAvail(elInfo[coreEl].bitRate, 0, |
| elInfo[coreEl].nChannelsInEl, |
| inputSampleRate, *coreSampleRate, aot)) { |
| error = 1; |
| goto bail; |
| } |
| } |
| |
| hSbrEncoder->nChannels = *numChannels; |
| hSbrEncoder->frameSize = coreFrameLength * *downSampleFactor; |
| hSbrEncoder->downsamplingMethod = downsamplingMethod; |
| hSbrEncoder->downSampleFactor = *downSampleFactor; |
| hSbrEncoder->estimateBitrate = 0; |
| hSbrEncoder->inputDataDelay = 0; |
| is212 = ((aot == AOT_ER_AAC_ELD) && (syntaxFlags & AC_LD_MPS)) ? 1 : 0; |
| |
| /* Open SBR elements */ |
| el = -1; |
| highestSbrStartFreq = highestSbrStopFreq = 0; |
| lowestBandwidth = 99999; |
| |
| /* Loop through each core encoder element and get a matching SBR element |
| * config */ |
| for (coreEl = 0; coreEl < noElements; coreEl++) { |
| /* SBR only handles SCE and CPE's */ |
| if (elInfo[coreEl].elType == ID_SCE || elInfo[coreEl].elType == ID_CPE) { |
| el++; |
| } else { |
| continue; |
| } |
| |
| /* Set parametric Stereo Flag. */ |
| if (usePs) { |
| elInfo[coreEl].fParametricStereo = 1; |
| } else { |
| elInfo[coreEl].fParametricStereo = 0; |
| } |
| |
| /* |
| * Init sbrConfig structure |
| */ |
| if (!FDKsbrEnc_InitializeSbrDefaults(&sbrConfig[el], *downSampleFactor, |
| coreFrameLength, IS_LOWDELAY(aot))) { |
| error = 1; |
| goto bail; |
| } |
| |
| /* |
| * Modify sbrConfig structure according to Element parameters |
| */ |
| if (!FDKsbrEnc_AdjustSbrSettings( |
| &sbrConfig[el], elInfo[coreEl].bitRate, |
| elInfo[coreEl].nChannelsInEl, *coreSampleRate, inputSampleRate, |
| transformFactor, 24000, 0, 0, /* useSpeechConfig */ |
| 0, /* lcsMode */ |
| usePs, /* bParametricStereo */ |
| aot)) { |
| error = 1; |
| goto bail; |
| } |
| |
| /* Find common frequency border for all SBR elements */ |
| highestSbrStartFreq = |
| fixMax(highestSbrStartFreq, sbrConfig[el].startFreq); |
| highestSbrStopFreq = fixMax(highestSbrStopFreq, sbrConfig[el].stopFreq); |
| |
| } /* first element loop */ |
| |
| /* Set element count (can be less than core encoder element count) */ |
| hSbrEncoder->noElements = el + 1; |
| |
| FDKsbrEnc_Reallocate(hSbrEncoder, elInfo, noElements); |
| |
| for (el = 0; el < hSbrEncoder->noElements; el++) { |
| int bandwidth = *coreBandwidth; |
| |
| /* Use lowest common bandwidth */ |
| sbrConfig[el].startFreq = highestSbrStartFreq; |
| sbrConfig[el].stopFreq = highestSbrStopFreq; |
| |
| /* initialize SBR element, and get core bandwidth */ |
| error = FDKsbrEnc_EnvInit(hSbrEncoder->sbrElement[el], &sbrConfig[el], |
| &bandwidth, aot, el, headerPeriod, |
| statesInitFlag, hSbrEncoder->downsamplingMethod, |
| hSbrEncoder->dynamicRam); |
| |
| if (error != 0) { |
| error = 2; |
| goto bail; |
| } |
| |
| /* Get lowest core encoder bandwidth to be returned later. */ |
| lowestBandwidth = fixMin(lowestBandwidth, bandwidth); |
| |
| } /* second element loop */ |
| |
| /* Initialize a downsampler for each channel in each SBR element */ |
| if (hSbrEncoder->downsamplingMethod == SBRENC_DS_TIME) { |
| for (el = 0; el < hSbrEncoder->noElements; el++) { |
| HANDLE_SBR_ELEMENT hSbrEl = hSbrEncoder->sbrElement[el]; |
| INT Wc, ch; |
| |
| Wc = 500; /* Cutoff frequency with full bandwidth */ |
| |
| for (ch = 0; ch < hSbrEl->elInfo.nChannelsInEl; ch++) { |
| FDKaacEnc_InitDownsampler(&hSbrEl->sbrChannel[ch]->downSampler, Wc, |
| *downSampleFactor); |
| FDK_ASSERT(hSbrEl->sbrChannel[ch]->downSampler.delay <= |
| MAX_DS_FILTER_DELAY); |
| } |
| } /* third element loop */ |
| |
| /* lfe */ |
| FDKaacEnc_InitDownsampler(&hSbrEncoder->lfeDownSampler, 0, |
| *downSampleFactor); |
| } |
| |
| /* Get delay information */ |
| delayParam.dsDelay = |
| hSbrEncoder->sbrElement[0]->sbrChannel[0]->downSampler.delay; |
| delayParam.delay = *delay; |
| |
| error = sbrEncoder_Init_delay(coreFrameLength, *numChannels, |
| *downSampleFactor, lowDelay, usePs, is212, |
| downsamplingMethod, &delayParam); |
| |
| if (error != 0) { |
| error = 3; |
| goto bail; |
| } |
| |
| hSbrEncoder->nBitstrDelay = delayParam.bitstrDelay; |
| hSbrEncoder->sbrDecDelay = delayParam.sbrDecDelay; |
| hSbrEncoder->inputDataDelay = delayParam.delayInput2Core; |
| |
| /* Assign core encoder Bandwidth */ |
| *coreBandwidth = lowestBandwidth; |
| |
| /* Estimate sbr bitrate, 2.5 kBit/s per sbr channel */ |
| hSbrEncoder->estimateBitrate += 2500 * (*numChannels); |
| |
| /* Initialize bitstream buffer for each element */ |
| for (el = 0; el < hSbrEncoder->noElements; el++) { |
| FDKsbrEnc_bsBufInit(hSbrEncoder->sbrElement[el], delayParam.bitstrDelay); |
| } |
| |
| /* initialize parametric stereo */ |
| if (usePs) { |
| PSENC_CONFIG psEncConfig; |
| FDK_ASSERT(hSbrEncoder->noElements == 1); |
| INT psTuningTableIdx = getPsTuningTableIndex(elInfo[0].bitRate, NULL); |
| |
| psEncConfig.frameSize = coreFrameLength; // sbrConfig.sbrFrameSize; |
| psEncConfig.qmfFilterMode = 0; |
| psEncConfig.sbrPsDelay = 0; |
| |
| /* tuning parameters */ |
| if (psTuningTableIdx != INVALID_TABLE_IDX) { |
| psEncConfig.nStereoBands = psTuningTable[psTuningTableIdx].nStereoBands; |
| psEncConfig.maxEnvelopes = psTuningTable[psTuningTableIdx].nEnvelopes; |
| psEncConfig.iidQuantErrorThreshold = |
| (FIXP_DBL)psTuningTable[psTuningTableIdx].iidQuantErrorThreshold; |
| |
| /* calculation is not quite linear, increased number of envelopes causes |
| * more bits */ |
| /* assume avg. 50 bits per frame for 10 stereo bands / 1 envelope |
| * configuration */ |
| hSbrEncoder->estimateBitrate += |
| ((((*coreSampleRate) * 5 * psEncConfig.nStereoBands * |
| psEncConfig.maxEnvelopes) / |
| hSbrEncoder->frameSize)); |
| |
| } else { |
| error = ERROR(CDI, "Invalid ps tuning table index."); |
| goto bail; |
| } |
| |
| qmfInitSynthesisFilterBank( |
| &hSbrEncoder->qmfSynthesisPS, |
| (FIXP_DBL *)hSbrEncoder->qmfSynthesisPS.FilterStates, |
| hSbrEncoder->sbrElement[0]->sbrConfigData.noQmfSlots, |
| hSbrEncoder->sbrElement[0]->sbrConfigData.noQmfBands >> 1, |
| hSbrEncoder->sbrElement[0]->sbrConfigData.noQmfBands >> 1, |
| hSbrEncoder->sbrElement[0]->sbrConfigData.noQmfBands >> 1, |
| (statesInitFlag) ? 0 : QMF_FLAG_KEEP_STATES); |
| |
| if (errorInfo == noError) { |
| /* update delay */ |
| psEncConfig.sbrPsDelay = |
| FDKsbrEnc_GetEnvEstDelay(&hSbrEncoder->sbrElement[0] |
| ->sbrChannel[0] |
| ->hEnvChannel.sbrExtractEnvelope); |
| |
| errorInfo = |
| PSEnc_Init(hSbrEncoder->hParametricStereo, &psEncConfig, |
| hSbrEncoder->sbrElement[0]->sbrConfigData.noQmfSlots, |
| hSbrEncoder->sbrElement[0]->sbrConfigData.noQmfBands, |
| hSbrEncoder->dynamicRam); |
| } |
| } |
| |
| hSbrEncoder->downsampledOffset = delayParam.corePathOffset; |
| hSbrEncoder->bufferOffset = delayParam.sbrPathOffset; |
| *delay = delayParam.delay; |
| |
| { hSbrEncoder->downmixSize = coreFrameLength * (*numChannels); } |
| |
| /* Delay Compensation: fill bitstream delay buffer with zero input signal */ |
| if (hSbrEncoder->nBitstrDelay > 0) { |
| error = FDKsbrEnc_DelayCompensation(hSbrEncoder, inputBuffer, |
| inputBufferBufSize); |
| if (error != 0) goto bail; |
| } |
| |
| /* Set Output frame length */ |
| *frameLength = coreFrameLength * *downSampleFactor; |
| /* Input buffer offset */ |
| *inputBufferOffset = |
| fixMax(delayParam.sbrPathOffset, delayParam.corePathOffset); |
| } |
| |
| return error; |
| |
| bail: |
| /* Restore input settings */ |
| *coreSampleRate = inputSampleRate; |
| *frameLength = coreFrameLength; |
| *numChannels = inputChannels; |
| *coreBandwidth = inputBandWidth; |
| |
| return error; |
| } |
| |
| INT sbrEncoder_EncodeFrame(HANDLE_SBR_ENCODER hSbrEncoder, INT_PCM *samples, |
| UINT samplesBufSize, UINT sbrDataBits[(8)], |
| UCHAR sbrData[(8)][MAX_PAYLOAD_SIZE]) { |
| INT error; |
| int el; |
| |
| for (el = 0; el < hSbrEncoder->noElements; el++) { |
| if (hSbrEncoder->sbrElement[el] != NULL) { |
| error = FDKsbrEnc_EnvEncodeFrame( |
| hSbrEncoder, el, |
| samples + hSbrEncoder->downsampledOffset / hSbrEncoder->nChannels, |
| samplesBufSize, &sbrDataBits[el], sbrData[el], 0); |
| if (error) return error; |
| } |
| } |
| |
| error = FDKsbrEnc_Downsample( |
| hSbrEncoder, |
| samples + hSbrEncoder->downsampledOffset / hSbrEncoder->nChannels, |
| samplesBufSize, hSbrEncoder->nChannels, &sbrDataBits[el], sbrData[el], 0); |
| if (error) return error; |
| |
| return 0; |
| } |
| |
| INT sbrEncoder_UpdateBuffers(HANDLE_SBR_ENCODER hSbrEncoder, |
| INT_PCM *timeBuffer, UINT timeBufferBufSize) { |
| if (hSbrEncoder->downsampledOffset > 0) { |
| int c; |
| int nd = hSbrEncoder->downmixSize / hSbrEncoder->nChannels; |
| |
| for (c = 0; c < hSbrEncoder->nChannels; c++) { |
| /* Move delayed downsampled data */ |
| FDKmemcpy(timeBuffer + timeBufferBufSize * c, |
| timeBuffer + timeBufferBufSize * c + nd, |
| sizeof(INT_PCM) * |
| (hSbrEncoder->downsampledOffset / hSbrEncoder->nChannels)); |
| } |
| } else { |
| int c; |
| |
| for (c = 0; c < hSbrEncoder->nChannels; c++) { |
| /* Move delayed input data */ |
| FDKmemcpy( |
| timeBuffer + timeBufferBufSize * c, |
| timeBuffer + timeBufferBufSize * c + hSbrEncoder->frameSize, |
| sizeof(INT_PCM) * hSbrEncoder->bufferOffset / hSbrEncoder->nChannels); |
| } |
| } |
| if (hSbrEncoder->nBitstrDelay > 0) { |
| int el; |
| |
| for (el = 0; el < hSbrEncoder->noElements; el++) { |
| FDKmemmove( |
| hSbrEncoder->sbrElement[el]->payloadDelayLine[0], |
| hSbrEncoder->sbrElement[el]->payloadDelayLine[1], |
| sizeof(UCHAR) * (hSbrEncoder->nBitstrDelay * MAX_PAYLOAD_SIZE)); |
| |
| FDKmemmove(&hSbrEncoder->sbrElement[el]->payloadDelayLineSize[0], |
| &hSbrEncoder->sbrElement[el]->payloadDelayLineSize[1], |
| sizeof(UINT) * (hSbrEncoder->nBitstrDelay)); |
| } |
| } |
| return 0; |
| } |
| |
| INT sbrEncoder_SendHeader(HANDLE_SBR_ENCODER hSbrEncoder) { |
| INT error = -1; |
| if (hSbrEncoder) { |
| int el; |
| for (el = 0; el < hSbrEncoder->noElements; el++) { |
| if ((hSbrEncoder->noElements == 1) && |
| (hSbrEncoder->sbrElement[0]->elInfo.fParametricStereo == 1)) { |
| hSbrEncoder->sbrElement[el]->sbrBitstreamData.CountSendHeaderData = |
| hSbrEncoder->sbrElement[el]->sbrBitstreamData.NrSendHeaderData - 1; |
| } else { |
| hSbrEncoder->sbrElement[el]->sbrBitstreamData.CountSendHeaderData = 0; |
| } |
| } |
| error = 0; |
| } |
| return error; |
| } |
| |
| INT sbrEncoder_ContainsHeader(HANDLE_SBR_ENCODER hSbrEncoder) { |
| INT sbrHeader = 1; |
| if (hSbrEncoder) { |
| int el; |
| for (el = 0; el < hSbrEncoder->noElements; el++) { |
| sbrHeader &= |
| (hSbrEncoder->sbrElement[el]->sbrBitstreamData.HeaderActiveDelay == 1) |
| ? 1 |
| : 0; |
| } |
| } |
| return sbrHeader; |
| } |
| |
| INT sbrEncoder_GetHeaderDelay(HANDLE_SBR_ENCODER hSbrEncoder) { |
| INT delay = -1; |
| |
| if (hSbrEncoder) { |
| if ((hSbrEncoder->noElements == 1) && |
| (hSbrEncoder->sbrElement[0]->elInfo.fParametricStereo == 1)) { |
| delay = hSbrEncoder->nBitstrDelay + 1; |
| } else { |
| delay = hSbrEncoder->nBitstrDelay; |
| } |
| } |
| return delay; |
| } |
| INT sbrEncoder_GetBsDelay(HANDLE_SBR_ENCODER hSbrEncoder) { |
| INT delay = -1; |
| |
| if (hSbrEncoder) { |
| delay = hSbrEncoder->nBitstrDelay; |
| } |
| return delay; |
| } |
| |
| INT sbrEncoder_SAPPrepare(HANDLE_SBR_ENCODER hSbrEncoder) { |
| INT error = -1; |
| if (hSbrEncoder) { |
| int el; |
| for (el = 0; el < hSbrEncoder->noElements; el++) { |
| hSbrEncoder->sbrElement[el]->sbrBitstreamData.rightBorderFIX = 1; |
| } |
| error = 0; |
| } |
| return error; |
| } |
| |
| INT sbrEncoder_GetEstimateBitrate(HANDLE_SBR_ENCODER hSbrEncoder) { |
| INT estimateBitrate = 0; |
| |
| if (hSbrEncoder) { |
| estimateBitrate += hSbrEncoder->estimateBitrate; |
| } |
| |
| return estimateBitrate; |
| } |
| |
| INT sbrEncoder_GetInputDataDelay(HANDLE_SBR_ENCODER hSbrEncoder) { |
| INT delay = -1; |
| |
| if (hSbrEncoder) { |
| delay = hSbrEncoder->inputDataDelay; |
| } |
| return delay; |
| } |
| |
| INT sbrEncoder_GetSbrDecDelay(HANDLE_SBR_ENCODER hSbrEncoder) { |
| INT delay = -1; |
| |
| if (hSbrEncoder) { |
| delay = hSbrEncoder->sbrDecDelay; |
| } |
| return delay; |
| } |
| |
| INT sbrEncoder_GetLibInfo(LIB_INFO *info) { |
| int i; |
| |
| if (info == NULL) { |
| return -1; |
| } |
| /* search for next free tab */ |
| for (i = 0; i < FDK_MODULE_LAST; i++) { |
| if (info[i].module_id == FDK_NONE) break; |
| } |
| if (i == FDK_MODULE_LAST) { |
| return -1; |
| } |
| info += i; |
| |
| info->module_id = FDK_SBRENC; |
| info->version = |
| LIB_VERSION(SBRENCODER_LIB_VL0, SBRENCODER_LIB_VL1, SBRENCODER_LIB_VL2); |
| LIB_VERSION_STRING(info); |
| #ifdef SUPPRESS_BUILD_DATE_INFO |
| info->build_date = ""; |
| info->build_time = ""; |
| #else |
| info->build_date = __DATE__; |
| info->build_time = __TIME__; |
| #endif |
| info->title = "SBR Encoder"; |
| |
| /* Set flags */ |
| info->flags = 0 | CAPF_SBR_HQ | CAPF_SBR_PS_MPEG; |
| /* End of flags */ |
| |
| return 0; |
| } |